api, login, auth

306 files changed, 44255 insertions, 0 deletions

diff --git a/node_modules/webpack/lib/APIPlugin.js b/node_modules/webpack/lib/APIPlugin.js
new file mode 100644
index 0000000..bc084f0
--- /dev/null
+++ b/node_modules/webpack/lib/APIPlugin.js
@@ -0,0 +1,84 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ConstDependency = require("./dependencies/ConstDependency");
+const ParserHelpers = require("./ParserHelpers");
+
+const NullFactory = require("./NullFactory");
+
+/* eslint-disable camelcase */
+const REPLACEMENTS = {
+	__webpack_require__: "__webpack_require__",
+	__webpack_public_path__: "__webpack_require__.p",
+	__webpack_modules__: "__webpack_require__.m",
+	__webpack_chunk_load__: "__webpack_require__.e",
+	__non_webpack_require__: "require",
+	__webpack_nonce__: "__webpack_require__.nc",
+	"require.onError": "__webpack_require__.oe"
+};
+const NO_WEBPACK_REQUIRE = {
+	__non_webpack_require__: true
+};
+const REPLACEMENT_TYPES = {
+	__webpack_public_path__: "string",
+	__webpack_require__: "function",
+	__webpack_modules__: "object",
+	__webpack_chunk_load__: "function",
+	__webpack_nonce__: "string"
+};
+/* eslint-enable camelcase */
+
+class APIPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"APIPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+
+				const handler = parser => {
+					Object.keys(REPLACEMENTS).forEach(key => {
+						parser.hooks.expression
+							.for(key)
+							.tap(
+								"APIPlugin",
+								NO_WEBPACK_REQUIRE[key]
+									? ParserHelpers.toConstantDependency(
+											parser,
+											REPLACEMENTS[key]
+									  )
+									: ParserHelpers.toConstantDependencyWithWebpackRequire(
+											parser,
+											REPLACEMENTS[key]
+									  )
+							);
+						const type = REPLACEMENT_TYPES[key];
+						if (type) {
+							parser.hooks.evaluateTypeof
+								.for(key)
+								.tap("APIPlugin", ParserHelpers.evaluateToString(type));
+						}
+					});
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("APIPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("APIPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/esm")
+					.tap("APIPlugin", handler);
+			}
+		);
+	}
+}
+
+module.exports = APIPlugin;
diff --git a/node_modules/webpack/lib/AbstractMethodError.js b/node_modules/webpack/lib/AbstractMethodError.js
new file mode 100644
index 0000000..c9eb9cf
--- /dev/null
+++ b/node_modules/webpack/lib/AbstractMethodError.js
@@ -0,0 +1,43 @@
+"use strict";
+
+const WebpackError = require("./WebpackError");
+const CURRENT_METHOD_REGEXP = /at ([a-zA-Z0-9_.]*)/;
+
+/**
+ * @param {string=} method method name
+ * @returns {string} message
+ */
+function createMessage(method) {
+	return `Abstract method${method ? " " + method : ""}. Must be overridden.`;
+}
+
+/**
+ * @constructor
+ */
+function Message() {
+	this.stack = undefined;
+	Error.captureStackTrace(this);
+	/** @type {RegExpMatchArray} */
+	const match = this.stack.split("\n")[3].match(CURRENT_METHOD_REGEXP);
+
+	this.message = match && match[1] ? createMessage(match[1]) : createMessage();
+}
+
+/**
+ * Error for abstract method
+ * @example
+ * class FooClass {
+ *     abstractMethod() {
+ *         throw new AbstractMethodError(); // error message: Abstract method FooClass.abstractMethod. Must be overriden.
+ *     }
+ * }
+ *
+ */
+class AbstractMethodError extends WebpackError {
+	constructor() {
+		super(new Message().message);
+		this.name = "AbstractMethodError";
+	}
+}
+
+module.exports = AbstractMethodError;
diff --git a/node_modules/webpack/lib/AmdMainTemplatePlugin.js b/node_modules/webpack/lib/AmdMainTemplatePlugin.js
new file mode 100644
index 0000000..705f88d
--- /dev/null
+++ b/node_modules/webpack/lib/AmdMainTemplatePlugin.js
@@ -0,0 +1,106 @@
+/*
+ MIT License http://www.opensource.org/licenses/mit-license.php
+ Author Tobias Koppers @sokra
+ */
+
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+const Template = require("./Template");
+
+/** @typedef {import("./Compilation")} Compilation */
+
+/**
+ * @typedef {Object} AmdMainTemplatePluginOptions
+ * @param {string=} name the library name
+ * @property {boolean=} requireAsWrapper
+ */
+
+class AmdMainTemplatePlugin {
+	/**
+	 * @param {AmdMainTemplatePluginOptions} options the plugin options
+	 */
+	constructor(options) {
+		if (!options || typeof options === "string") {
+			this.name = options;
+			this.requireAsWrapper = false;
+		} else {
+			this.name = options.name;
+			this.requireAsWrapper = options.requireAsWrapper;
+		}
+	}
+
+	/**
+	 * @param {Compilation} compilation the compilation instance
+	 * @returns {void}
+	 */
+	apply(compilation) {
+		const { mainTemplate, chunkTemplate } = compilation;
+
+		const onRenderWithEntry = (source, chunk, hash) => {
+			const externals = chunk.getModules().filter(m => m.external);
+			const externalsDepsArray = JSON.stringify(
+				externals.map(m =>
+					typeof m.request === "object" ? m.request.amd : m.request
+				)
+			);
+			const externalsArguments = externals
+				.map(
+					m => `__WEBPACK_EXTERNAL_MODULE_${Template.toIdentifier(`${m.id}`)}__`
+				)
+				.join(", ");
+
+			if (this.requireAsWrapper) {
+				return new ConcatSource(
+					`require(${externalsDepsArray}, function(${externalsArguments}) { return `,
+					source,
+					"});"
+				);
+			} else if (this.name) {
+				const name = mainTemplate.getAssetPath(this.name, {
+					hash,
+					chunk
+				});
+
+				return new ConcatSource(
+					`define(${JSON.stringify(
+						name
+					)}, ${externalsDepsArray}, function(${externalsArguments}) { return `,
+					source,
+					"});"
+				);
+			} else if (externalsArguments) {
+				return new ConcatSource(
+					`define(${externalsDepsArray}, function(${externalsArguments}) { return `,
+					source,
+					"});"
+				);
+			} else {
+				return new ConcatSource("define(function() { return ", source, "});");
+			}
+		};
+
+		for (const template of [mainTemplate, chunkTemplate]) {
+			template.hooks.renderWithEntry.tap(
+				"AmdMainTemplatePlugin",
+				onRenderWithEntry
+			);
+		}
+
+		mainTemplate.hooks.globalHashPaths.tap("AmdMainTemplatePlugin", paths => {
+			if (this.name) {
+				paths.push(this.name);
+			}
+			return paths;
+		});
+
+		mainTemplate.hooks.hash.tap("AmdMainTemplatePlugin", hash => {
+			hash.update("exports amd");
+			if (this.name) {
+				hash.update(this.name);
+			}
+		});
+	}
+}
+
+module.exports = AmdMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/AsyncDependenciesBlock.js b/node_modules/webpack/lib/AsyncDependenciesBlock.js
new file mode 100644
index 0000000..a7e0291
--- /dev/null
+++ b/node_modules/webpack/lib/AsyncDependenciesBlock.js
@@ -0,0 +1,110 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DependenciesBlock = require("./DependenciesBlock");
+
+/** @typedef {import("./ChunkGroup")} ChunkGroup */
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./Dependency").DependencyLocation} DependencyLocation */
+/** @typedef {import("./util/createHash").Hash} Hash */
+/** @typedef {TODO} GroupOptions */
+
+module.exports = class AsyncDependenciesBlock extends DependenciesBlock {
+	/**
+	 * @param {GroupOptions} groupOptions options for the group
+	 * @param {Module} module the Module object
+	 * @param {DependencyLocation=} loc the line of code
+	 * @param {TODO=} request the request
+	 */
+	constructor(groupOptions, module, loc, request) {
+		super();
+		if (typeof groupOptions === "string") {
+			groupOptions = { name: groupOptions };
+		} else if (!groupOptions) {
+			groupOptions = { name: undefined };
+		}
+		this.groupOptions = groupOptions;
+		/** @type {ChunkGroup=} */
+		this.chunkGroup = undefined;
+		this.module = module;
+		this.loc = loc;
+		this.request = request;
+		/** @type {DependenciesBlock} */
+		this.parent = undefined;
+	}
+
+	/**
+	 * @returns {string} The name of the chunk
+	 */
+	get chunkName() {
+		return this.groupOptions.name;
+	}
+
+	/**
+	 * @param {string} value The new chunk name
+	 * @returns {void}
+	 */
+	set chunkName(value) {
+		this.groupOptions.name = value;
+	}
+
+	/**
+	 * @returns {never} this throws and should never be called
+	 */
+	get chunks() {
+		throw new Error("Moved to AsyncDependenciesBlock.chunkGroup");
+	}
+
+	/**
+	 * @param {never} value setter value
+	 * @returns {never} this is going to throw therefore we should throw type
+	 * assertions by returning never
+	 */
+	set chunks(value) {
+		throw new Error("Moved to AsyncDependenciesBlock.chunkGroup");
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track block changes, from "crypto" module
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update(JSON.stringify(this.groupOptions));
+		hash.update(
+			(this.chunkGroup &&
+				this.chunkGroup.chunks
+					.map(chunk => {
+						return chunk.id !== null ? chunk.id : "";
+					})
+					.join(",")) ||
+				""
+		);
+		super.updateHash(hash);
+	}
+
+	/**
+	 * @returns {void}
+	 */
+	disconnect() {
+		this.chunkGroup = undefined;
+		super.disconnect();
+	}
+
+	/**
+	 * @returns {void}
+	 */
+	unseal() {
+		this.chunkGroup = undefined;
+		super.unseal();
+	}
+
+	/**
+	 * @returns {void}
+	 */
+	sortItems() {
+		super.sortItems();
+	}
+};
diff --git a/node_modules/webpack/lib/AsyncDependencyToInitialChunkError.js b/node_modules/webpack/lib/AsyncDependencyToInitialChunkError.js
new file mode 100644
index 0000000..a0631aa
--- /dev/null
+++ b/node_modules/webpack/lib/AsyncDependencyToInitialChunkError.js
@@ -0,0 +1,31 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Sean Larkin @thelarkinn
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+/** @typedef {import("./Module")} Module */
+
+class AsyncDependencyToInitialChunkError extends WebpackError {
+	/**
+	 * Creates an instance of AsyncDependencyToInitialChunkError.
+	 * @param {string} chunkName Name of Chunk
+	 * @param {Module} module module tied to dependency
+	 * @param {TODO} loc location of dependency
+	 */
+	constructor(chunkName, module, loc) {
+		super(
+			`It's not allowed to load an initial chunk on demand. The chunk name "${chunkName}" is already used by an entrypoint.`
+		);
+
+		this.name = "AsyncDependencyToInitialChunkError";
+		this.module = module;
+		this.loc = loc;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = AsyncDependencyToInitialChunkError;
diff --git a/node_modules/webpack/lib/AutomaticPrefetchPlugin.js b/node_modules/webpack/lib/AutomaticPrefetchPlugin.js
new file mode 100644
index 0000000..2d0db16
--- /dev/null
+++ b/node_modules/webpack/lib/AutomaticPrefetchPlugin.js
@@ -0,0 +1,57 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const asyncLib = require("neo-async");
+const PrefetchDependency = require("./dependencies/PrefetchDependency");
+const NormalModule = require("./NormalModule");
+
+/** @typedef {import("./Compiler")} Compiler */
+
+class AutomaticPrefetchPlugin {
+	/**
+	 * Apply the plugin
+	 * @param {Compiler} compiler Webpack Compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"AutomaticPrefetchPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					PrefetchDependency,
+					normalModuleFactory
+				);
+			}
+		);
+		let lastModules = null;
+		compiler.hooks.afterCompile.tap("AutomaticPrefetchPlugin", compilation => {
+			lastModules = compilation.modules
+				.filter(m => m instanceof NormalModule)
+				.map((/** @type {NormalModule} */ m) => ({
+					context: m.context,
+					request: m.request
+				}));
+		});
+		compiler.hooks.make.tapAsync(
+			"AutomaticPrefetchPlugin",
+			(compilation, callback) => {
+				if (!lastModules) return callback();
+				asyncLib.forEach(
+					lastModules,
+					(m, callback) => {
+						compilation.prefetch(
+							m.context || compiler.context,
+							new PrefetchDependency(m.request),
+							callback
+						);
+					},
+					callback
+				);
+			}
+		);
+	}
+}
+module.exports = AutomaticPrefetchPlugin;
diff --git a/node_modules/webpack/lib/BannerPlugin.js b/node_modules/webpack/lib/BannerPlugin.js
new file mode 100644
index 0000000..322d854
--- /dev/null
+++ b/node_modules/webpack/lib/BannerPlugin.js
@@ -0,0 +1,122 @@
+/*
+ MIT License http://www.opensource.org/licenses/mit-license.php
+ Author Tobias Koppers @sokra
+ */
+
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+const ModuleFilenameHelpers = require("./ModuleFilenameHelpers");
+const Template = require("./Template");
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/BannerPlugin.json");
+
+/** @typedef {import("../declarations/plugins/BannerPlugin").BannerPluginArgument} BannerPluginArgument */
+/** @typedef {import("../declarations/plugins/BannerPlugin").BannerPluginOptions} BannerPluginOptions */
+
+const wrapComment = str => {
+	if (!str.includes("\n")) {
+		return Template.toComment(str);
+	}
+	return `/*!\n * ${str
+		.replace(/\*\//g, "* /")
+		.split("\n")
+		.join("\n * ")}\n */`;
+};
+
+class BannerPlugin {
+	/**
+	 * @param {BannerPluginArgument} options options object
+	 */
+	constructor(options) {
+		if (arguments.length > 1) {
+			throw new Error(
+				"BannerPlugin only takes one argument (pass an options object)"
+			);
+		}
+
+		validateOptions(schema, options, "Banner Plugin");
+
+		if (typeof options === "string" || typeof options === "function") {
+			options = {
+				banner: options
+			};
+		}
+
+		/** @type {BannerPluginOptions} */
+		this.options = options;
+
+		const bannerOption = options.banner;
+		if (typeof bannerOption === "function") {
+			const getBanner = bannerOption;
+			this.banner = this.options.raw
+				? getBanner
+				: data => wrapComment(getBanner(data));
+		} else {
+			const banner = this.options.raw
+				? bannerOption
+				: wrapComment(bannerOption);
+			this.banner = () => banner;
+		}
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		const banner = this.banner;
+		const matchObject = ModuleFilenameHelpers.matchObject.bind(
+			undefined,
+			options
+		);
+
+		compiler.hooks.compilation.tap("BannerPlugin", compilation => {
+			compilation.hooks.optimizeChunkAssets.tap("BannerPlugin", chunks => {
+				for (const chunk of chunks) {
+					if (options.entryOnly && !chunk.canBeInitial()) {
+						continue;
+					}
+
+					for (const file of chunk.files) {
+						if (!matchObject(file)) {
+							continue;
+						}
+
+						let query = "";
+						let filename = file;
+						const hash = compilation.hash;
+						const querySplit = filename.indexOf("?");
+
+						if (querySplit >= 0) {
+							query = filename.substr(querySplit);
+							filename = filename.substr(0, querySplit);
+						}
+
+						const lastSlashIndex = filename.lastIndexOf("/");
+
+						const basename =
+							lastSlashIndex === -1
+								? filename
+								: filename.substr(lastSlashIndex + 1);
+
+						const data = {
+							hash,
+							chunk,
+							filename,
+							basename,
+							query
+						};
+
+						const comment = compilation.getPath(banner(data), data);
+
+						compilation.updateAsset(
+							file,
+							old => new ConcatSource(comment, "\n", old)
+						);
+					}
+				}
+			});
+		});
+	}
+}
+
+module.exports = BannerPlugin;
diff --git a/node_modules/webpack/lib/BasicEvaluatedExpression.js b/node_modules/webpack/lib/BasicEvaluatedExpression.js
new file mode 100644
index 0000000..a0f7bd4
--- /dev/null
+++ b/node_modules/webpack/lib/BasicEvaluatedExpression.js
@@ -0,0 +1,248 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const TypeUnknown = 0;
+const TypeNull = 1;
+const TypeString = 2;
+const TypeNumber = 3;
+const TypeBoolean = 4;
+const TypeRegExp = 5;
+const TypeConditional = 6;
+const TypeArray = 7;
+const TypeConstArray = 8;
+const TypeIdentifier = 9;
+const TypeWrapped = 10;
+const TypeTemplateString = 11;
+
+class BasicEvaluatedExpression {
+	constructor() {
+		this.type = TypeUnknown;
+		this.range = null;
+		this.falsy = false;
+		this.truthy = false;
+		this.bool = null;
+		this.number = null;
+		this.regExp = null;
+		this.string = null;
+		this.quasis = null;
+		this.parts = null;
+		this.array = null;
+		this.items = null;
+		this.options = null;
+		this.prefix = null;
+		this.postfix = null;
+		this.wrappedInnerExpressions = null;
+		this.expression = null;
+	}
+
+	isNull() {
+		return this.type === TypeNull;
+	}
+
+	isString() {
+		return this.type === TypeString;
+	}
+
+	isNumber() {
+		return this.type === TypeNumber;
+	}
+
+	isBoolean() {
+		return this.type === TypeBoolean;
+	}
+
+	isRegExp() {
+		return this.type === TypeRegExp;
+	}
+
+	isConditional() {
+		return this.type === TypeConditional;
+	}
+
+	isArray() {
+		return this.type === TypeArray;
+	}
+
+	isConstArray() {
+		return this.type === TypeConstArray;
+	}
+
+	isIdentifier() {
+		return this.type === TypeIdentifier;
+	}
+
+	isWrapped() {
+		return this.type === TypeWrapped;
+	}
+
+	isTemplateString() {
+		return this.type === TypeTemplateString;
+	}
+
+	isTruthy() {
+		return this.truthy;
+	}
+
+	isFalsy() {
+		return this.falsy;
+	}
+
+	asBool() {
+		if (this.truthy) return true;
+		if (this.falsy) return false;
+		if (this.isBoolean()) return this.bool;
+		if (this.isNull()) return false;
+		if (this.isString()) return this.string !== "";
+		if (this.isNumber()) return this.number !== 0;
+		if (this.isRegExp()) return true;
+		if (this.isArray()) return true;
+		if (this.isConstArray()) return true;
+		if (this.isWrapped()) {
+			return (this.prefix && this.prefix.asBool()) ||
+				(this.postfix && this.postfix.asBool())
+				? true
+				: undefined;
+		}
+		if (this.isTemplateString()) {
+			const str = this.asString();
+			if (typeof str === "string") return str !== "";
+		}
+		return undefined;
+	}
+
+	asString() {
+		if (this.isBoolean()) return `${this.bool}`;
+		if (this.isNull()) return "null";
+		if (this.isString()) return this.string;
+		if (this.isNumber()) return `${this.number}`;
+		if (this.isRegExp()) return `${this.regExp}`;
+		if (this.isArray()) {
+			let array = [];
+			for (const item of this.items) {
+				const itemStr = item.asString();
+				if (itemStr === undefined) return undefined;
+				array.push(itemStr);
+			}
+			return `${array}`;
+		}
+		if (this.isConstArray()) return `${this.array}`;
+		if (this.isTemplateString()) {
+			let str = "";
+			for (const part of this.parts) {
+				const partStr = part.asString();
+				if (partStr === undefined) return undefined;
+				str += partStr;
+			}
+			return str;
+		}
+		return undefined;
+	}
+
+	setString(string) {
+		this.type = TypeString;
+		this.string = string;
+		return this;
+	}
+
+	setNull() {
+		this.type = TypeNull;
+		return this;
+	}
+
+	setNumber(number) {
+		this.type = TypeNumber;
+		this.number = number;
+		return this;
+	}
+
+	setBoolean(bool) {
+		this.type = TypeBoolean;
+		this.bool = bool;
+		return this;
+	}
+
+	setRegExp(regExp) {
+		this.type = TypeRegExp;
+		this.regExp = regExp;
+		return this;
+	}
+
+	setIdentifier(identifier) {
+		this.type = TypeIdentifier;
+		this.identifier = identifier;
+		return this;
+	}
+
+	setWrapped(prefix, postfix, innerExpressions) {
+		this.type = TypeWrapped;
+		this.prefix = prefix;
+		this.postfix = postfix;
+		this.wrappedInnerExpressions = innerExpressions;
+		return this;
+	}
+
+	setOptions(options) {
+		this.type = TypeConditional;
+		this.options = options;
+		return this;
+	}
+
+	addOptions(options) {
+		if (!this.options) {
+			this.type = TypeConditional;
+			this.options = [];
+		}
+		for (const item of options) {
+			this.options.push(item);
+		}
+		return this;
+	}
+
+	setItems(items) {
+		this.type = TypeArray;
+		this.items = items;
+		return this;
+	}
+
+	setArray(array) {
+		this.type = TypeConstArray;
+		this.array = array;
+		return this;
+	}
+
+	setTemplateString(quasis, parts, kind) {
+		this.type = TypeTemplateString;
+		this.quasis = quasis;
+		this.parts = parts;
+		this.templateStringKind = kind;
+		return this;
+	}
+
+	setTruthy() {
+		this.falsy = false;
+		this.truthy = true;
+		return this;
+	}
+
+	setFalsy() {
+		this.falsy = true;
+		this.truthy = false;
+		return this;
+	}
+
+	setRange(range) {
+		this.range = range;
+		return this;
+	}
+
+	setExpression(expression) {
+		this.expression = expression;
+		return this;
+	}
+}
+
+module.exports = BasicEvaluatedExpression;
diff --git a/node_modules/webpack/lib/CachePlugin.js b/node_modules/webpack/lib/CachePlugin.js
new file mode 100644
index 0000000..68da003
--- /dev/null
+++ b/node_modules/webpack/lib/CachePlugin.js
@@ -0,0 +1,100 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const asyncLib = require("neo-async");
+
+class CachePlugin {
+	constructor(cache) {
+		this.cache = cache || {};
+		this.FS_ACCURACY = 2000;
+	}
+
+	apply(compiler) {
+		if (Array.isArray(compiler.compilers)) {
+			compiler.compilers.forEach((c, idx) => {
+				new CachePlugin((this.cache[idx] = this.cache[idx] || {})).apply(c);
+			});
+		} else {
+			const registerCacheToCompiler = (compiler, cache) => {
+				compiler.hooks.thisCompilation.tap("CachePlugin", compilation => {
+					compilation.cache = cache;
+					compilation.hooks.childCompiler.tap(
+						"CachePlugin",
+						(childCompiler, compilerName, compilerIndex) => {
+							let childCache;
+							if (!cache.children) {
+								cache.children = {};
+							}
+							if (!cache.children[compilerName]) {
+								cache.children[compilerName] = [];
+							}
+							if (cache.children[compilerName][compilerIndex]) {
+								childCache = cache.children[compilerName][compilerIndex];
+							} else {
+								cache.children[compilerName].push((childCache = {}));
+							}
+							registerCacheToCompiler(childCompiler, childCache);
+						}
+					);
+				});
+			};
+			registerCacheToCompiler(compiler, this.cache);
+			compiler.hooks.watchRun.tap("CachePlugin", () => {
+				this.watching = true;
+			});
+			compiler.hooks.run.tapAsync("CachePlugin", (compiler, callback) => {
+				if (!compiler._lastCompilationFileDependencies) {
+					return callback();
+				}
+				const fs = compiler.inputFileSystem;
+				const fileTs = (compiler.fileTimestamps = new Map());
+				asyncLib.forEach(
+					compiler._lastCompilationFileDependencies,
+					(file, callback) => {
+						fs.stat(file, (err, stat) => {
+							if (err) {
+								if (err.code === "ENOENT") return callback();
+								return callback(err);
+							}
+
+							if (stat.mtime) this.applyMtime(+stat.mtime);
+
+							fileTs.set(file, +stat.mtime || Infinity);
+
+							callback();
+						});
+					},
+					err => {
+						if (err) return callback(err);
+
+						for (const [file, ts] of fileTs) {
+							fileTs.set(file, ts + this.FS_ACCURACY);
+						}
+
+						callback();
+					}
+				);
+			});
+			compiler.hooks.afterCompile.tap("CachePlugin", compilation => {
+				compilation.compiler._lastCompilationFileDependencies =
+					compilation.fileDependencies;
+				compilation.compiler._lastCompilationContextDependencies =
+					compilation.contextDependencies;
+			});
+		}
+	}
+
+	/* istanbul ignore next */
+	applyMtime(mtime) {
+		if (this.FS_ACCURACY > 1 && mtime % 2 !== 0) this.FS_ACCURACY = 1;
+		else if (this.FS_ACCURACY > 10 && mtime % 20 !== 0) this.FS_ACCURACY = 10;
+		else if (this.FS_ACCURACY > 100 && mtime % 200 !== 0)
+			this.FS_ACCURACY = 100;
+		else if (this.FS_ACCURACY > 1000 && mtime % 2000 !== 0)
+			this.FS_ACCURACY = 1000;
+	}
+}
+module.exports = CachePlugin;
diff --git a/node_modules/webpack/lib/CaseSensitiveModulesWarning.js b/node_modules/webpack/lib/CaseSensitiveModulesWarning.js
new file mode 100644
index 0000000..6bfeeca
--- /dev/null
+++ b/node_modules/webpack/lib/CaseSensitiveModulesWarning.js
@@ -0,0 +1,67 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+/** @typedef {import("./Module")} Module */
+
+/**
+ * @param {Module[]} modules the modules to be sorted
+ * @returns {Module[]} sorted version of original modules
+ */
+const sortModules = modules => {
+	return modules.slice().sort((a, b) => {
+		const aIdent = a.identifier();
+		const bIdent = b.identifier();
+		/* istanbul ignore next */
+		if (aIdent < bIdent) return -1;
+		/* istanbul ignore next */
+		if (aIdent > bIdent) return 1;
+		/* istanbul ignore next */
+		return 0;
+	});
+};
+
+/**
+ * @param {Module[]} modules each module from throw
+ * @returns {string} each message from provided moduels
+ */
+const createModulesListMessage = modules => {
+	return modules
+		.map(m => {
+			let message = `* ${m.identifier()}`;
+			const validReasons = m.reasons.filter(reason => reason.module);
+
+			if (validReasons.length > 0) {
+				message += `\n    Used by ${validReasons.length} module(s), i. e.`;
+				message += `\n    ${validReasons[0].module.identifier()}`;
+			}
+			return message;
+		})
+		.join("\n");
+};
+
+class CaseSensitiveModulesWarning extends WebpackError {
+	/**
+	 * Creates an instance of CaseSensitiveModulesWarning.
+	 * @param {Module[]} modules modules that were detected
+	 */
+	constructor(modules) {
+		const sortedModules = sortModules(modules);
+		const modulesList = createModulesListMessage(sortedModules);
+		super(`There are multiple modules with names that only differ in casing.
+This can lead to unexpected behavior when compiling on a filesystem with other case-semantic.
+Use equal casing. Compare these module identifiers:
+${modulesList}`);
+
+		this.name = "CaseSensitiveModulesWarning";
+		this.origin = this.module = sortedModules[0];
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = CaseSensitiveModulesWarning;
diff --git a/node_modules/webpack/lib/Chunk.js b/node_modules/webpack/lib/Chunk.js
new file mode 100644
index 0000000..db644ee
--- /dev/null
+++ b/node_modules/webpack/lib/Chunk.js
@@ -0,0 +1,875 @@
+/*
+MIT License http://www.opensource.org/licenses/mit-license.php
+Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const util = require("util");
+const SortableSet = require("./util/SortableSet");
+const intersect = require("./util/SetHelpers").intersect;
+const GraphHelpers = require("./GraphHelpers");
+const Entrypoint = require("./Entrypoint");
+let debugId = 1000;
+const ERR_CHUNK_ENTRY = "Chunk.entry was removed. Use hasRuntime()";
+const ERR_CHUNK_INITIAL =
+	"Chunk.initial was removed. Use canBeInitial/isOnlyInitial()";
+
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./ChunkGroup")} ChunkGroup */
+/** @typedef {import("./ModuleReason")} ModuleReason */
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+/**
+ *  @typedef {Object} WithId an object who has an id property *
+ *  @property {string | number} id the id of the object
+ */
+
+/**
+ * Compare two Modules based on their ids for sorting
+ * @param {Module} a module
+ * @param {Module} b module
+ * @returns {-1|0|1} sort value
+ */
+
+// TODO use @callback
+/** @typedef {(a: Module, b: Module) => -1|0|1} ModuleSortPredicate */
+/** @typedef {(m: Module) => boolean} ModuleFilterPredicate */
+/** @typedef {(c: Chunk) => boolean} ChunkFilterPredicate */
+
+const sortModuleById = (a, b) => {
+	if (a.id < b.id) return -1;
+	if (b.id < a.id) return 1;
+	return 0;
+};
+
+/**
+ * Compare two ChunkGroups based on their ids for sorting
+ * @param {ChunkGroup} a chunk group
+ * @param {ChunkGroup} b chunk group
+ * @returns {-1|0|1} sort value
+ */
+const sortChunkGroupById = (a, b) => {
+	if (a.id < b.id) return -1;
+	if (b.id < a.id) return 1;
+	return 0;
+};
+
+/**
+ * Compare two Identifiables , based on their ids for sorting
+ * @param {Module} a first object with ident fn
+ * @param {Module} b second object with ident fn
+ * @returns {-1|0|1} The order number of the sort
+ */
+const sortByIdentifier = (a, b) => {
+	if (a.identifier() > b.identifier()) return 1;
+	if (a.identifier() < b.identifier()) return -1;
+	return 0;
+};
+
+/**
+ * @returns {string} a concatenation of module identifiers sorted
+ * @param {SortableSet} set to pull module identifiers from
+ */
+const getModulesIdent = set => {
+	set.sort();
+	let str = "";
+	for (const m of set) {
+		str += m.identifier() + "#";
+	}
+	return str;
+};
+
+/**
+ * @template T
+ * @param {SortableSet<T>} set the sortable set to convert to array
+ * @returns {Array<T>} the array returned from Array.from(set)
+ */
+const getArray = set => Array.from(set);
+
+/**
+ * @param {SortableSet<Module>} set the sortable Set to get the count/size of
+ * @returns {number} the size of the modules
+ */
+const getModulesSize = set => {
+	let size = 0;
+	for (const module of set) {
+		size += module.size();
+	}
+	return size;
+};
+
+/**
+ * A Chunk is a unit of encapsulation for Modules.
+ * Chunks are "rendered" into bundles that get emitted when the build completes.
+ */
+class Chunk {
+	/**
+	 * @param {string=} name of chunk being created, is optional (for subclasses)
+	 */
+	constructor(name) {
+		/** @type {number | null} */
+		this.id = null;
+		/** @type {number[] | null} */
+		this.ids = null;
+		/** @type {number} */
+		this.debugId = debugId++;
+		/** @type {string} */
+		this.name = name;
+		/** @type {boolean} */
+		this.preventIntegration = false;
+		/** @type {Module=} */
+		this.entryModule = undefined;
+		/** @private @type {SortableSet<Module>} */
+		this._modules = new SortableSet(undefined, sortByIdentifier);
+		/** @type {string?} */
+		this.filenameTemplate = undefined;
+		/** @private @type {SortableSet<ChunkGroup>} */
+		this._groups = new SortableSet(undefined, sortChunkGroupById);
+		/** @type {string[]} */
+		this.files = [];
+		/** @type {boolean} */
+		this.rendered = false;
+		/** @type {string=} */
+		this.hash = undefined;
+		/** @type {Object} */
+		this.contentHash = Object.create(null);
+		/** @type {string=} */
+		this.renderedHash = undefined;
+		/** @type {string=} */
+		this.chunkReason = undefined;
+		/** @type {boolean} */
+		this.extraAsync = false;
+		this.removedModules = undefined;
+	}
+
+	/**
+	 * @deprecated Chunk.entry has been deprecated. Please use .hasRuntime() instead
+	 * @returns {never} Throws an error trying to access this property
+	 */
+	get entry() {
+		throw new Error(ERR_CHUNK_ENTRY);
+	}
+
+	/**
+	 * @deprecated .entry has been deprecated. Please use .hasRuntime() instead
+	 * @param {never} data The data that was attempting to be set
+	 * @returns {never} Throws an error trying to access this property
+	 */
+	set entry(data) {
+		throw new Error(ERR_CHUNK_ENTRY);
+	}
+
+	/**
+	 * @deprecated Chunk.initial was removed. Use canBeInitial/isOnlyInitial()
+	 * @returns {never} Throws an error trying to access this property
+	 */
+	get initial() {
+		throw new Error(ERR_CHUNK_INITIAL);
+	}
+
+	/**
+	 * @deprecated Chunk.initial was removed. Use canBeInitial/isOnlyInitial()
+	 * @param {never} data The data attempting to be set
+	 * @returns {never} Throws an error trying to access this property
+	 */
+	set initial(data) {
+		throw new Error(ERR_CHUNK_INITIAL);
+	}
+
+	/**
+	 * @returns {boolean} whether or not the Chunk will have a runtime
+	 */
+	hasRuntime() {
+		for (const chunkGroup of this._groups) {
+			if (
+				chunkGroup.isInitial() &&
+				chunkGroup instanceof Entrypoint &&
+				chunkGroup.getRuntimeChunk() === this
+			) {
+				return true;
+			}
+		}
+		return false;
+	}
+
+	/**
+	 * @returns {boolean} whether or not this chunk can be an initial chunk
+	 */
+	canBeInitial() {
+		for (const chunkGroup of this._groups) {
+			if (chunkGroup.isInitial()) return true;
+		}
+		return false;
+	}
+
+	/**
+	 * @returns {boolean} whether this chunk can only be an initial chunk
+	 */
+	isOnlyInitial() {
+		if (this._groups.size <= 0) return false;
+		for (const chunkGroup of this._groups) {
+			if (!chunkGroup.isInitial()) return false;
+		}
+		return true;
+	}
+
+	/**
+	 * @returns {boolean} if this chunk contains the entry module
+	 */
+	hasEntryModule() {
+		return !!this.entryModule;
+	}
+
+	/**
+	 * @param {Module} module the module that will be added to this chunk.
+	 * @returns {boolean} returns true if the chunk doesn't have the module and it was added
+	 */
+	addModule(module) {
+		if (!this._modules.has(module)) {
+			this._modules.add(module);
+			return true;
+		}
+		return false;
+	}
+
+	/**
+	 * @param {Module} module the module that will be removed from this chunk
+	 * @returns {boolean} returns true if chunk exists and is successfully deleted
+	 */
+	removeModule(module) {
+		if (this._modules.delete(module)) {
+			module.removeChunk(this);
+			return true;
+		}
+		return false;
+	}
+
+	/**
+	 * @param {Module[]} modules the new modules to be set
+	 * @returns {void} set new modules to this chunk and return nothing
+	 */
+	setModules(modules) {
+		this._modules = new SortableSet(modules, sortByIdentifier);
+	}
+
+	/**
+	 * @returns {number} the amount of modules in chunk
+	 */
+	getNumberOfModules() {
+		return this._modules.size;
+	}
+
+	/**
+	 * @returns {SortableSet} return the modules SortableSet for this chunk
+	 */
+	get modulesIterable() {
+		return this._modules;
+	}
+
+	/**
+	 * @param {ChunkGroup} chunkGroup the chunkGroup the chunk is being added
+	 * @returns {boolean} returns true if chunk is not apart of chunkGroup and is added successfully
+	 */
+	addGroup(chunkGroup) {
+		if (this._groups.has(chunkGroup)) return false;
+		this._groups.add(chunkGroup);
+		return true;
+	}
+
+	/**
+	 * @param {ChunkGroup} chunkGroup the chunkGroup the chunk is being removed from
+	 * @returns {boolean} returns true if chunk does exist in chunkGroup and is removed
+	 */
+	removeGroup(chunkGroup) {
+		if (!this._groups.has(chunkGroup)) return false;
+		this._groups.delete(chunkGroup);
+		return true;
+	}
+
+	/**
+	 * @param {ChunkGroup} chunkGroup the chunkGroup to check
+	 * @returns {boolean} returns true if chunk has chunkGroup reference and exists in chunkGroup
+	 */
+	isInGroup(chunkGroup) {
+		return this._groups.has(chunkGroup);
+	}
+
+	/**
+	 * @returns {number} the amount of groups said chunk is in
+	 */
+	getNumberOfGroups() {
+		return this._groups.size;
+	}
+
+	/**
+	 * @returns {SortableSet<ChunkGroup>} the chunkGroups that said chunk is referenced in
+	 */
+	get groupsIterable() {
+		return this._groups;
+	}
+
+	/**
+	 * @param {Chunk} otherChunk the chunk to compare itself with
+	 * @returns {-1|0|1} this is a comparitor function like sort and returns -1, 0, or 1 based on sort order
+	 */
+	compareTo(otherChunk) {
+		if (this.name && !otherChunk.name) return -1;
+		if (!this.name && otherChunk.name) return 1;
+		if (this.name < otherChunk.name) return -1;
+		if (this.name > otherChunk.name) return 1;
+		if (this._modules.size > otherChunk._modules.size) return -1;
+		if (this._modules.size < otherChunk._modules.size) return 1;
+		this._modules.sort();
+		otherChunk._modules.sort();
+		const a = this._modules[Symbol.iterator]();
+		const b = otherChunk._modules[Symbol.iterator]();
+		// eslint-disable-next-line no-constant-condition
+		while (true) {
+			const aItem = a.next();
+			if (aItem.done) return 0;
+			const bItem = b.next();
+			const aModuleIdentifier = aItem.value.identifier();
+			const bModuleIdentifier = bItem.value.identifier();
+			if (aModuleIdentifier < bModuleIdentifier) return -1;
+			if (aModuleIdentifier > bModuleIdentifier) return 1;
+		}
+	}
+
+	/**
+	 * @param {Module} module Module to check
+	 * @returns {boolean} returns true if module does exist in this chunk
+	 */
+	containsModule(module) {
+		return this._modules.has(module);
+	}
+
+	/**
+	 * @returns {Module[]} an array of modules (do not modify)
+	 */
+	getModules() {
+		return this._modules.getFromCache(getArray);
+	}
+
+	getModulesIdent() {
+		return this._modules.getFromUnorderedCache(getModulesIdent);
+	}
+
+	/**
+	 * @param {string=} reason reason why chunk is removed
+	 * @returns {void}
+	 */
+	remove(reason) {
+		// cleanup modules
+		// Array.from is used here to create a clone, because removeChunk modifies this._modules
+		for (const module of Array.from(this._modules)) {
+			module.removeChunk(this);
+		}
+		for (const chunkGroup of this._groups) {
+			chunkGroup.removeChunk(this);
+		}
+	}
+
+	/**
+	 *
+	 * @param {Module} module module to move
+	 * @param {Chunk} otherChunk other chunk to move it to
+	 * @returns {void}
+	 */
+	moveModule(module, otherChunk) {
+		GraphHelpers.disconnectChunkAndModule(this, module);
+		GraphHelpers.connectChunkAndModule(otherChunk, module);
+		module.rewriteChunkInReasons(this, [otherChunk]);
+	}
+
+	/**
+	 *
+	 * @param {Chunk} otherChunk the chunk to integrate with
+	 * @param {string} reason reason why the module is being integrated
+	 * @returns {boolean} returns true or false if integration succeeds or fails
+	 */
+	integrate(otherChunk, reason) {
+		if (!this.canBeIntegrated(otherChunk)) {
+			return false;
+		}
+
+		// Pick a new name for the integrated chunk
+		if (this.name && otherChunk.name) {
+			if (this.hasEntryModule() === otherChunk.hasEntryModule()) {
+				// When both chunks have entry modules or none have one, use
+				// shortest name
+				if (this.name.length !== otherChunk.name.length) {
+					this.name =
+						this.name.length < otherChunk.name.length
+							? this.name
+							: otherChunk.name;
+				} else {
+					this.name = this.name < otherChunk.name ? this.name : otherChunk.name;
+				}
+			} else if (otherChunk.hasEntryModule()) {
+				// Pick the name of the chunk with the entry module
+				this.name = otherChunk.name;
+			}
+		} else if (otherChunk.name) {
+			this.name = otherChunk.name;
+		}
+
+		// Array.from is used here to create a clone, because moveModule modifies otherChunk._modules
+		for (const module of Array.from(otherChunk._modules)) {
+			otherChunk.moveModule(module, this);
+		}
+		otherChunk._modules.clear();
+
+		if (otherChunk.entryModule) {
+			this.entryModule = otherChunk.entryModule;
+		}
+
+		for (const chunkGroup of otherChunk._groups) {
+			chunkGroup.replaceChunk(otherChunk, this);
+			this.addGroup(chunkGroup);
+		}
+		otherChunk._groups.clear();
+
+		return true;
+	}
+
+	/**
+	 * @param {Chunk} newChunk the new chunk that will be split out of the current chunk
+	 * @returns {void}
+	 */
+	split(newChunk) {
+		for (const chunkGroup of this._groups) {
+			chunkGroup.insertChunk(newChunk, this);
+			newChunk.addGroup(chunkGroup);
+		}
+	}
+
+	isEmpty() {
+		return this._modules.size === 0;
+	}
+
+	updateHash(hash) {
+		hash.update(`${this.id} `);
+		hash.update(this.ids ? this.ids.join(",") : "");
+		hash.update(`${this.name || ""} `);
+		for (const m of this._modules) {
+			hash.update(m.hash);
+		}
+	}
+
+	canBeIntegrated(otherChunk) {
+		if (this.preventIntegration || otherChunk.preventIntegration) {
+			return false;
+		}
+
+		/**
+		 * @param {Chunk} a chunk
+		 * @param {Chunk} b chunk
+		 * @returns {boolean} true, if a is always available when b is reached
+		 */
+		const isAvailable = (a, b) => {
+			const queue = new Set(b.groupsIterable);
+			for (const chunkGroup of queue) {
+				if (a.isInGroup(chunkGroup)) continue;
+				if (chunkGroup.isInitial()) return false;
+				for (const parent of chunkGroup.parentsIterable) {
+					queue.add(parent);
+				}
+			}
+			return true;
+		};
+
+		const selfHasRuntime = this.hasRuntime();
+		const otherChunkHasRuntime = otherChunk.hasRuntime();
+
+		if (selfHasRuntime !== otherChunkHasRuntime) {
+			if (selfHasRuntime) {
+				return isAvailable(this, otherChunk);
+			} else if (otherChunkHasRuntime) {
+				return isAvailable(otherChunk, this);
+			} else {
+				return false;
+			}
+		}
+
+		if (this.hasEntryModule() || otherChunk.hasEntryModule()) {
+			return false;
+		}
+
+		return true;
+	}
+
+	/**
+	 *
+	 * @param {number} size the size
+	 * @param {Object} options the options passed in
+	 * @returns {number} the multiplier returned
+	 */
+	addMultiplierAndOverhead(size, options) {
+		const overhead =
+			typeof options.chunkOverhead === "number" ? options.chunkOverhead : 10000;
+		const multiplicator = this.canBeInitial()
+			? options.entryChunkMultiplicator || 10
+			: 1;
+
+		return size * multiplicator + overhead;
+	}
+
+	/**
+	 * @returns {number} the size of all modules
+	 */
+	modulesSize() {
+		return this._modules.getFromUnorderedCache(getModulesSize);
+	}
+
+	/**
+	 * @param {Object} options the size display options
+	 * @returns {number} the chunk size
+	 */
+	size(options = {}) {
+		return this.addMultiplierAndOverhead(this.modulesSize(), options);
+	}
+
+	/**
+	 * @param {Chunk} otherChunk the other chunk
+	 * @param {TODO} options the options for this function
+	 * @returns {number | false} the size, or false if it can't be integrated
+	 */
+	integratedSize(otherChunk, options) {
+		// Chunk if it's possible to integrate this chunk
+		if (!this.canBeIntegrated(otherChunk)) {
+			return false;
+		}
+
+		let integratedModulesSize = this.modulesSize();
+		// only count modules that do not exist in this chunk!
+		for (const otherModule of otherChunk._modules) {
+			if (!this._modules.has(otherModule)) {
+				integratedModulesSize += otherModule.size();
+			}
+		}
+
+		return this.addMultiplierAndOverhead(integratedModulesSize, options);
+	}
+
+	/**
+	 * @param {function(Module, Module): -1|0|1=} sortByFn a predicate function used to sort modules
+	 * @returns {void}
+	 */
+	sortModules(sortByFn) {
+		this._modules.sortWith(sortByFn || sortModuleById);
+	}
+
+	sortItems() {
+		this.sortModules();
+	}
+
+	/**
+	 * @returns {Set<Chunk>} a set of all the async chunks
+	 */
+	getAllAsyncChunks() {
+		const queue = new Set();
+		const chunks = new Set();
+
+		const initialChunks = intersect(
+			Array.from(this.groupsIterable, g => new Set(g.chunks))
+		);
+
+		for (const chunkGroup of this.groupsIterable) {
+			for (const child of chunkGroup.childrenIterable) {
+				queue.add(child);
+			}
+		}
+
+		for (const chunkGroup of queue) {
+			for (const chunk of chunkGroup.chunks) {
+				if (!initialChunks.has(chunk)) {
+					chunks.add(chunk);
+				}
+			}
+			for (const child of chunkGroup.childrenIterable) {
+				queue.add(child);
+			}
+		}
+
+		return chunks;
+	}
+
+	/**
+	 * @typedef {Object} ChunkMaps
+	 * @property {Record<string|number, string>} hash
+	 * @property {Record<string|number, Record<string, string>>} contentHash
+	 * @property {Record<string|number, string>} name
+	 */
+
+	/**
+	 * @param {boolean} realHash should the full hash or the rendered hash be used
+	 * @returns {ChunkMaps} the chunk map information
+	 */
+	getChunkMaps(realHash) {
+		/** @type {Record<string|number, string>} */
+		const chunkHashMap = Object.create(null);
+		/** @type {Record<string|number, Record<string, string>>} */
+		const chunkContentHashMap = Object.create(null);
+		/** @type {Record<string|number, string>} */
+		const chunkNameMap = Object.create(null);
+
+		for (const chunk of this.getAllAsyncChunks()) {
+			chunkHashMap[chunk.id] = realHash ? chunk.hash : chunk.renderedHash;
+			for (const key of Object.keys(chunk.contentHash)) {
+				if (!chunkContentHashMap[key]) {
+					chunkContentHashMap[key] = Object.create(null);
+				}
+				chunkContentHashMap[key][chunk.id] = chunk.contentHash[key];
+			}
+			if (chunk.name) {
+				chunkNameMap[chunk.id] = chunk.name;
+			}
+		}
+
+		return {
+			hash: chunkHashMap,
+			contentHash: chunkContentHashMap,
+			name: chunkNameMap
+		};
+	}
+
+	/**
+	 * @returns {Record<string, Set<TODO>[]>} a record object of names to lists of child ids(?)
+	 */
+	getChildIdsByOrders() {
+		const lists = new Map();
+		for (const group of this.groupsIterable) {
+			if (group.chunks[group.chunks.length - 1] === this) {
+				for (const childGroup of group.childrenIterable) {
+					// TODO webpack 5 remove this check for options
+					if (typeof childGroup.options === "object") {
+						for (const key of Object.keys(childGroup.options)) {
+							if (key.endsWith("Order")) {
+								const name = key.substr(0, key.length - "Order".length);
+								let list = lists.get(name);
+								if (list === undefined) lists.set(name, (list = []));
+								list.push({
+									order: childGroup.options[key],
+									group: childGroup
+								});
+							}
+						}
+					}
+				}
+			}
+		}
+		const result = Object.create(null);
+		for (const [name, list] of lists) {
+			list.sort((a, b) => {
+				const cmp = b.order - a.order;
+				if (cmp !== 0) return cmp;
+				// TODO webpack 5 remove this check of compareTo
+				if (a.group.compareTo) {
+					return a.group.compareTo(b.group);
+				}
+				return 0;
+			});
+			result[name] = Array.from(
+				list.reduce((set, item) => {
+					for (const chunk of item.group.chunks) {
+						set.add(chunk.id);
+					}
+					return set;
+				}, new Set())
+			);
+		}
+		return result;
+	}
+
+	getChildIdsByOrdersMap(includeDirectChildren) {
+		const chunkMaps = Object.create(null);
+
+		const addChildIdsByOrdersToMap = chunk => {
+			const data = chunk.getChildIdsByOrders();
+			for (const key of Object.keys(data)) {
+				let chunkMap = chunkMaps[key];
+				if (chunkMap === undefined) {
+					chunkMaps[key] = chunkMap = Object.create(null);
+				}
+				chunkMap[chunk.id] = data[key];
+			}
+		};
+
+		if (includeDirectChildren) {
+			const chunks = new Set();
+			for (const chunkGroup of this.groupsIterable) {
+				for (const chunk of chunkGroup.chunks) {
+					chunks.add(chunk);
+				}
+			}
+			for (const chunk of chunks) {
+				addChildIdsByOrdersToMap(chunk);
+			}
+		}
+
+		for (const chunk of this.getAllAsyncChunks()) {
+			addChildIdsByOrdersToMap(chunk);
+		}
+
+		return chunkMaps;
+	}
+
+	/**
+	 * @typedef {Object} ChunkModuleMaps
+	 * @property {Record<string|number, (string|number)[]>} id
+	 * @property {Record<string|number, string>} hash
+	 */
+
+	/**
+	 * @param {ModuleFilterPredicate} filterFn function used to filter modules
+	 * @returns {ChunkModuleMaps} module map information
+	 */
+	getChunkModuleMaps(filterFn) {
+		/** @type {Record<string|number, (string|number)[]>} */
+		const chunkModuleIdMap = Object.create(null);
+		/** @type {Record<string|number, string>} */
+		const chunkModuleHashMap = Object.create(null);
+
+		for (const chunk of this.getAllAsyncChunks()) {
+			/** @type {(string|number)[]} */
+			let array;
+			for (const module of chunk.modulesIterable) {
+				if (filterFn(module)) {
+					if (array === undefined) {
+						array = [];
+						chunkModuleIdMap[chunk.id] = array;
+					}
+					array.push(module.id);
+					chunkModuleHashMap[module.id] = module.renderedHash;
+				}
+			}
+			if (array !== undefined) {
+				array.sort();
+			}
+		}
+
+		return {
+			id: chunkModuleIdMap,
+			hash: chunkModuleHashMap
+		};
+	}
+
+	/**
+	 *
+	 * @param {function(Module): boolean} filterFn predicate function used to filter modules
+	 * @param {function(Chunk): boolean} filterChunkFn predicate function used to filter chunks
+	 * @returns {boolean} return true if module exists in graph
+	 */
+	hasModuleInGraph(filterFn, filterChunkFn) {
+		const queue = new Set(this.groupsIterable);
+		const chunksProcessed = new Set();
+
+		for (const chunkGroup of queue) {
+			for (const chunk of chunkGroup.chunks) {
+				if (!chunksProcessed.has(chunk)) {
+					chunksProcessed.add(chunk);
+					if (!filterChunkFn || filterChunkFn(chunk)) {
+						for (const module of chunk.modulesIterable) {
+							if (filterFn(module)) {
+								return true;
+							}
+						}
+					}
+				}
+			}
+			for (const child of chunkGroup.childrenIterable) {
+				queue.add(child);
+			}
+		}
+		return false;
+	}
+
+	toString() {
+		return `Chunk[${Array.from(this._modules).join()}]`;
+	}
+}
+
+// TODO remove in webpack 5
+Object.defineProperty(Chunk.prototype, "forEachModule", {
+	configurable: false,
+	value: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {Chunk}
+		 * @typedef {function(any, any, Set<any>): void} ForEachModuleCallback
+		 * @param {ForEachModuleCallback} fn Callback function
+		 * @returns {void}
+		 */
+		function(fn) {
+			this._modules.forEach(fn);
+		},
+		"Chunk.forEachModule: Use for(const module of chunk.modulesIterable) instead"
+	)
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(Chunk.prototype, "mapModules", {
+	configurable: false,
+	value: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {Chunk}
+		 * @typedef {function(any, number): any} MapModulesCallback
+		 * @param {MapModulesCallback} fn Callback function
+		 * @returns {TODO[]} result of mapped modules
+		 */
+		function(fn) {
+			return Array.from(this._modules, fn);
+		},
+		"Chunk.mapModules: Use Array.from(chunk.modulesIterable, fn) instead"
+	)
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(Chunk.prototype, "chunks", {
+	configurable: false,
+	get() {
+		throw new Error("Chunk.chunks: Use ChunkGroup.getChildren() instead");
+	},
+	set() {
+		throw new Error("Chunk.chunks: Use ChunkGroup.add/removeChild() instead");
+	}
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(Chunk.prototype, "parents", {
+	configurable: false,
+	get() {
+		throw new Error("Chunk.parents: Use ChunkGroup.getParents() instead");
+	},
+	set() {
+		throw new Error("Chunk.parents: Use ChunkGroup.add/removeParent() instead");
+	}
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(Chunk.prototype, "blocks", {
+	configurable: false,
+	get() {
+		throw new Error("Chunk.blocks: Use ChunkGroup.getBlocks() instead");
+	},
+	set() {
+		throw new Error("Chunk.blocks: Use ChunkGroup.add/removeBlock() instead");
+	}
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(Chunk.prototype, "entrypoints", {
+	configurable: false,
+	get() {
+		throw new Error(
+			"Chunk.entrypoints: Use Chunks.groupsIterable and filter by instanceof Entrypoint instead"
+		);
+	},
+	set() {
+		throw new Error("Chunk.entrypoints: Use Chunks.addGroup instead");
+	}
+});
+
+module.exports = Chunk;
diff --git a/node_modules/webpack/lib/ChunkGroup.js b/node_modules/webpack/lib/ChunkGroup.js
new file mode 100644
index 0000000..6f0ad97
--- /dev/null
+++ b/node_modules/webpack/lib/ChunkGroup.js
@@ -0,0 +1,513 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const SortableSet = require("./util/SortableSet");
+const compareLocations = require("./compareLocations");
+
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./ModuleReason")} ModuleReason */
+
+/** @typedef {{module: Module, loc: TODO, request: string}} OriginRecord */
+/** @typedef {string|{name: string}} ChunkGroupOptions */
+
+let debugId = 5000;
+
+/**
+ * @template T
+ * @param {SortableSet<T>} set set to convert to array.
+ * @returns {T[]} the array format of existing set
+ */
+const getArray = set => Array.from(set);
+
+/**
+ * A convenience method used to sort chunks based on their id's
+ * @param {ChunkGroup} a first sorting comparator
+ * @param {ChunkGroup} b second sorting comparator
+ * @returns {1|0|-1} a sorting index to determine order
+ */
+const sortById = (a, b) => {
+	if (a.id < b.id) return -1;
+	if (b.id < a.id) return 1;
+	return 0;
+};
+
+/**
+ * @param {OriginRecord} a the first comparator in sort
+ * @param {OriginRecord} b the second comparator in sort
+ * @returns {1|-1|0} returns sorting order as index
+ */
+const sortOrigin = (a, b) => {
+	const aIdent = a.module ? a.module.identifier() : "";
+	const bIdent = b.module ? b.module.identifier() : "";
+	if (aIdent < bIdent) return -1;
+	if (aIdent > bIdent) return 1;
+	return compareLocations(a.loc, b.loc);
+};
+
+class ChunkGroup {
+	/**
+	 * Creates an instance of ChunkGroup.
+	 * @param {ChunkGroupOptions=} options chunk group options passed to chunkGroup
+	 */
+	constructor(options) {
+		if (typeof options === "string") {
+			options = { name: options };
+		} else if (!options) {
+			options = { name: undefined };
+		}
+		/** @type {number} */
+		this.groupDebugId = debugId++;
+		this.options = options;
+		/** @type {SortableSet<ChunkGroup>} */
+		this._children = new SortableSet(undefined, sortById);
+		this._parents = new SortableSet(undefined, sortById);
+		this._blocks = new SortableSet();
+		/** @type {Chunk[]} */
+		this.chunks = [];
+		/** @type {OriginRecord[]} */
+		this.origins = [];
+		/** Indices in top-down order */
+		/** @private @type {Map<Module, number>} */
+		this._moduleIndices = new Map();
+		/** Indices in bottom-up order */
+		/** @private @type {Map<Module, number>} */
+		this._moduleIndices2 = new Map();
+	}
+
+	/**
+	 * when a new chunk is added to a chunkGroup, addingOptions will occur.
+	 * @param {ChunkGroupOptions} options the chunkGroup options passed to addOptions
+	 * @returns {void}
+	 */
+	addOptions(options) {
+		for (const key of Object.keys(options)) {
+			if (this.options[key] === undefined) {
+				this.options[key] = options[key];
+			} else if (this.options[key] !== options[key]) {
+				if (key.endsWith("Order")) {
+					this.options[key] = Math.max(this.options[key], options[key]);
+				} else {
+					throw new Error(
+						`ChunkGroup.addOptions: No option merge strategy for ${key}`
+					);
+				}
+			}
+		}
+	}
+
+	/**
+	 * returns the name of current ChunkGroup
+	 * @returns {string|undefined} returns the ChunkGroup name
+	 */
+	get name() {
+		return this.options.name;
+	}
+
+	/**
+	 * sets a new name for current ChunkGroup
+	 * @param {string} value the new name for ChunkGroup
+	 * @returns {void}
+	 */
+	set name(value) {
+		this.options.name = value;
+	}
+
+	/**
+	 * get a uniqueId for ChunkGroup, made up of its member Chunk debugId's
+	 * @returns {string} a unique concatenation of chunk debugId's
+	 */
+	get debugId() {
+		return Array.from(this.chunks, x => x.debugId).join("+");
+	}
+
+	/**
+	 * get a unique id for ChunkGroup, made up of its member Chunk id's
+	 * @returns {string} a unique concatenation of chunk ids
+	 */
+	get id() {
+		return Array.from(this.chunks, x => x.id).join("+");
+	}
+
+	/**
+	 * Performs an unshift of a specific chunk
+	 * @param {Chunk} chunk chunk being unshifted
+	 * @returns {boolean} returns true if attempted chunk shift is accepted
+	 */
+	unshiftChunk(chunk) {
+		const oldIdx = this.chunks.indexOf(chunk);
+		if (oldIdx > 0) {
+			this.chunks.splice(oldIdx, 1);
+			this.chunks.unshift(chunk);
+		} else if (oldIdx < 0) {
+			this.chunks.unshift(chunk);
+			return true;
+		}
+		return false;
+	}
+
+	/**
+	 * inserts a chunk before another existing chunk in group
+	 * @param {Chunk} chunk Chunk being inserted
+	 * @param {Chunk} before Placeholder/target chunk marking new chunk insertion point
+	 * @returns {boolean} return true if insertion was successful
+	 */
+	insertChunk(chunk, before) {
+		const oldIdx = this.chunks.indexOf(chunk);
+		const idx = this.chunks.indexOf(before);
+		if (idx < 0) {
+			throw new Error("before chunk not found");
+		}
+		if (oldIdx >= 0 && oldIdx > idx) {
+			this.chunks.splice(oldIdx, 1);
+			this.chunks.splice(idx, 0, chunk);
+		} else if (oldIdx < 0) {
+			this.chunks.splice(idx, 0, chunk);
+			return true;
+		}
+		return false;
+	}
+
+	/**
+	 * add a chunk into ChunkGroup. Is pushed on or prepended
+	 * @param {Chunk} chunk chunk being pushed into ChunkGroupS
+	 * @returns {boolean} returns true if chunk addition was successful.
+	 */
+	pushChunk(chunk) {
+		const oldIdx = this.chunks.indexOf(chunk);
+		if (oldIdx >= 0) {
+			return false;
+		}
+		this.chunks.push(chunk);
+		return true;
+	}
+
+	/**
+	 * @param {Chunk} oldChunk chunk to be replaced
+	 * @param {Chunk} newChunk New chunk that will be replaced with
+	 * @returns {boolean} returns true if the replacement was successful
+	 */
+	replaceChunk(oldChunk, newChunk) {
+		const oldIdx = this.chunks.indexOf(oldChunk);
+		if (oldIdx < 0) return false;
+		const newIdx = this.chunks.indexOf(newChunk);
+		if (newIdx < 0) {
+			this.chunks[oldIdx] = newChunk;
+			return true;
+		}
+		if (newIdx < oldIdx) {
+			this.chunks.splice(oldIdx, 1);
+			return true;
+		} else if (newIdx !== oldIdx) {
+			this.chunks[oldIdx] = newChunk;
+			this.chunks.splice(newIdx, 1);
+			return true;
+		}
+	}
+
+	removeChunk(chunk) {
+		const idx = this.chunks.indexOf(chunk);
+		if (idx >= 0) {
+			this.chunks.splice(idx, 1);
+			return true;
+		}
+		return false;
+	}
+
+	isInitial() {
+		return false;
+	}
+
+	addChild(chunk) {
+		if (this._children.has(chunk)) {
+			return false;
+		}
+		this._children.add(chunk);
+		return true;
+	}
+
+	getChildren() {
+		return this._children.getFromCache(getArray);
+	}
+
+	getNumberOfChildren() {
+		return this._children.size;
+	}
+
+	get childrenIterable() {
+		return this._children;
+	}
+
+	removeChild(chunk) {
+		if (!this._children.has(chunk)) {
+			return false;
+		}
+
+		this._children.delete(chunk);
+		chunk.removeParent(this);
+		return true;
+	}
+
+	addParent(parentChunk) {
+		if (!this._parents.has(parentChunk)) {
+			this._parents.add(parentChunk);
+			return true;
+		}
+		return false;
+	}
+
+	getParents() {
+		return this._parents.getFromCache(getArray);
+	}
+
+	setParents(newParents) {
+		this._parents.clear();
+		for (const p of newParents) {
+			this._parents.add(p);
+		}
+	}
+
+	getNumberOfParents() {
+		return this._parents.size;
+	}
+
+	hasParent(parent) {
+		return this._parents.has(parent);
+	}
+
+	get parentsIterable() {
+		return this._parents;
+	}
+
+	removeParent(chunk) {
+		if (this._parents.delete(chunk)) {
+			chunk.removeChunk(this);
+			return true;
+		}
+		return false;
+	}
+
+	/**
+	 * @returns {Array} - an array containing the blocks
+	 */
+	getBlocks() {
+		return this._blocks.getFromCache(getArray);
+	}
+
+	getNumberOfBlocks() {
+		return this._blocks.size;
+	}
+
+	hasBlock(block) {
+		return this._blocks.has(block);
+	}
+
+	get blocksIterable() {
+		return this._blocks;
+	}
+
+	addBlock(block) {
+		if (!this._blocks.has(block)) {
+			this._blocks.add(block);
+			return true;
+		}
+		return false;
+	}
+
+	addOrigin(module, loc, request) {
+		this.origins.push({
+			module,
+			loc,
+			request
+		});
+	}
+
+	containsModule(module) {
+		for (const chunk of this.chunks) {
+			if (chunk.containsModule(module)) return true;
+		}
+		return false;
+	}
+
+	getFiles() {
+		const files = new Set();
+
+		for (const chunk of this.chunks) {
+			for (const file of chunk.files) {
+				files.add(file);
+			}
+		}
+
+		return Array.from(files);
+	}
+
+	/**
+	 * @param {string=} reason reason for removing ChunkGroup
+	 * @returns {void}
+	 */
+	remove(reason) {
+		// cleanup parents
+		for (const parentChunkGroup of this._parents) {
+			// remove this chunk from its parents
+			parentChunkGroup._children.delete(this);
+
+			// cleanup "sub chunks"
+			for (const chunkGroup of this._children) {
+				/**
+				 * remove this chunk as "intermediary" and connect
+				 * it "sub chunks" and parents directly
+				 */
+				// add parent to each "sub chunk"
+				chunkGroup.addParent(parentChunkGroup);
+				// add "sub chunk" to parent
+				parentChunkGroup.addChild(chunkGroup);
+			}
+		}
+
+		/**
+		 * we need to iterate again over the children
+		 * to remove this from the child's parents.
+		 * This can not be done in the above loop
+		 * as it is not guaranteed that `this._parents` contains anything.
+		 */
+		for (const chunkGroup of this._children) {
+			// remove this as parent of every "sub chunk"
+			chunkGroup._parents.delete(this);
+		}
+
+		// cleanup blocks
+		for (const block of this._blocks) {
+			block.chunkGroup = null;
+		}
+
+		// remove chunks
+		for (const chunk of this.chunks) {
+			chunk.removeGroup(this);
+		}
+	}
+
+	sortItems() {
+		this.origins.sort(sortOrigin);
+		this._parents.sort();
+		this._children.sort();
+	}
+
+	/**
+	 * Sorting predicate which allows current ChunkGroup to be compared against another.
+	 * Sorting values are based off of number of chunks in ChunkGroup.
+	 *
+	 * @param {ChunkGroup} otherGroup the chunkGroup to compare this against
+	 * @returns {-1|0|1} sort position for comparison
+	 */
+	compareTo(otherGroup) {
+		if (this.chunks.length > otherGroup.chunks.length) return -1;
+		if (this.chunks.length < otherGroup.chunks.length) return 1;
+		const a = this.chunks[Symbol.iterator]();
+		const b = otherGroup.chunks[Symbol.iterator]();
+		// eslint-disable-next-line no-constant-condition
+		while (true) {
+			const aItem = a.next();
+			const bItem = b.next();
+			if (aItem.done) return 0;
+			const cmp = aItem.value.compareTo(bItem.value);
+			if (cmp !== 0) return cmp;
+		}
+	}
+
+	getChildrenByOrders() {
+		const lists = new Map();
+		for (const childGroup of this._children) {
+			// TODO webpack 5 remove this check for options
+			if (typeof childGroup.options === "object") {
+				for (const key of Object.keys(childGroup.options)) {
+					if (key.endsWith("Order")) {
+						const name = key.substr(0, key.length - "Order".length);
+						let list = lists.get(name);
+						if (list === undefined) {
+							lists.set(name, (list = []));
+						}
+						list.push({
+							order: childGroup.options[key],
+							group: childGroup
+						});
+					}
+				}
+			}
+		}
+		const result = Object.create(null);
+		for (const [name, list] of lists) {
+			list.sort((a, b) => {
+				const cmp = b.order - a.order;
+				if (cmp !== 0) return cmp;
+				// TODO webpack 5 remove this check of compareTo
+				if (a.group.compareTo) {
+					return a.group.compareTo(b.group);
+				}
+				return 0;
+			});
+			result[name] = list.map(i => i.group);
+		}
+		return result;
+	}
+
+	/**
+	 * Sets the top-down index of a module in this ChunkGroup
+	 * @param {Module} module module for which the index should be set
+	 * @param {number} index the index of the module
+	 * @returns {void}
+	 */
+	setModuleIndex(module, index) {
+		this._moduleIndices.set(module, index);
+	}
+
+	/**
+	 * Gets the top-down index of a module in this ChunkGroup
+	 * @param {Module} module the module
+	 * @returns {number} index
+	 */
+	getModuleIndex(module) {
+		return this._moduleIndices.get(module);
+	}
+
+	/**
+	 * Sets the bottom-up index of a module in this ChunkGroup
+	 * @param {Module} module module for which the index should be set
+	 * @param {number} index the index of the module
+	 * @returns {void}
+	 */
+	setModuleIndex2(module, index) {
+		this._moduleIndices2.set(module, index);
+	}
+
+	/**
+	 * Gets the bottom-up index of a module in this ChunkGroup
+	 * @param {Module} module the module
+	 * @returns {number} index
+	 */
+	getModuleIndex2(module) {
+		return this._moduleIndices2.get(module);
+	}
+
+	checkConstraints() {
+		const chunk = this;
+		for (const child of chunk._children) {
+			if (!child._parents.has(chunk)) {
+				throw new Error(
+					`checkConstraints: child missing parent ${chunk.debugId} -> ${child.debugId}`
+				);
+			}
+		}
+		for (const parentChunk of chunk._parents) {
+			if (!parentChunk._children.has(chunk)) {
+				throw new Error(
+					`checkConstraints: parent missing child ${parentChunk.debugId} <- ${chunk.debugId}`
+				);
+			}
+		}
+	}
+}
+
+module.exports = ChunkGroup;
diff --git a/node_modules/webpack/lib/ChunkRenderError.js b/node_modules/webpack/lib/ChunkRenderError.js
new file mode 100644
index 0000000..0d0eb2c
--- /dev/null
+++ b/node_modules/webpack/lib/ChunkRenderError.js
@@ -0,0 +1,32 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+/** @typedef {import("./Chunk")} Chunk */
+
+class ChunkRenderError extends WebpackError {
+	/**
+	 * Create a new ChunkRenderError
+	 * @param {Chunk} chunk A chunk
+	 * @param {string} file Related file
+	 * @param {Error} error Original error
+	 */
+	constructor(chunk, file, error) {
+		super();
+
+		this.name = "ChunkRenderError";
+		this.error = error;
+		this.message = error.message;
+		this.details = error.stack;
+		this.file = file;
+		this.chunk = chunk;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = ChunkRenderError;
diff --git a/node_modules/webpack/lib/ChunkTemplate.js b/node_modules/webpack/lib/ChunkTemplate.js
new file mode 100644
index 0000000..65861af
--- /dev/null
+++ b/node_modules/webpack/lib/ChunkTemplate.js
@@ -0,0 +1,87 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { Tapable, SyncWaterfallHook, SyncHook } = require("tapable");
+
+/** @typedef {import("./ModuleTemplate")} ModuleTemplate */
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("./Module")} Module} */
+/** @typedef {import("./Dependency").DependencyTemplate} DependencyTemplate} */
+/** @typedef {import("./util/createHash").Hash} Hash} */
+
+/**
+ * @typedef {Object} RenderManifestOptions
+ * @property {Chunk} chunk the chunk used to render
+ * @property {string} hash
+ * @property {string} fullHash
+ * @property {TODO} outputOptions
+ * @property {{javascript: ModuleTemplate, webassembly: ModuleTemplate}} moduleTemplates
+ * @property {Map<TODO, TODO>} dependencyTemplates
+ */
+
+module.exports = class ChunkTemplate extends Tapable {
+	constructor(outputOptions) {
+		super();
+		this.outputOptions = outputOptions || {};
+		this.hooks = {
+			/** @type {SyncWaterfallHook<TODO[], RenderManifestOptions>} */
+			renderManifest: new SyncWaterfallHook(["result", "options"]),
+			modules: new SyncWaterfallHook([
+				"source",
+				"chunk",
+				"moduleTemplate",
+				"dependencyTemplates"
+			]),
+			render: new SyncWaterfallHook([
+				"source",
+				"chunk",
+				"moduleTemplate",
+				"dependencyTemplates"
+			]),
+			renderWithEntry: new SyncWaterfallHook(["source", "chunk"]),
+			hash: new SyncHook(["hash"]),
+			hashForChunk: new SyncHook(["hash", "chunk"])
+		};
+	}
+
+	/**
+	 *
+	 * @param {RenderManifestOptions} options render manifest options
+	 * @returns {TODO[]} returns render manifest
+	 */
+	getRenderManifest(options) {
+		const result = [];
+
+		this.hooks.renderManifest.call(result, options);
+
+		return result;
+	}
+
+	/**
+	 * Updates hash with information from this template
+	 * @param {Hash} hash the hash to update
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update("ChunkTemplate");
+		hash.update("2");
+		this.hooks.hash.call(hash);
+	}
+
+	/**
+	 * TODO webpack 5: remove moduleTemplate and dependencyTemplates
+	 * Updates hash with chunk-specific information from this template
+	 * @param {Hash} hash the hash to update
+	 * @param {Chunk} chunk the chunk
+	 * @param {ModuleTemplate} moduleTemplate ModuleTemplate instance for render
+	 * @param {Map<Function, DependencyTemplate>} dependencyTemplates dependency templates
+	 * @returns {void}
+	 */
+	updateHashForChunk(hash, chunk, moduleTemplate, dependencyTemplates) {
+		this.updateHash(hash);
+		this.hooks.hashForChunk.call(hash, chunk);
+	}
+};
diff --git a/node_modules/webpack/lib/CommentCompilationWarning.js b/node_modules/webpack/lib/CommentCompilationWarning.js
new file mode 100644
index 0000000..79f0a2a
--- /dev/null
+++ b/node_modules/webpack/lib/CommentCompilationWarning.js
@@ -0,0 +1,32 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+/** @typedef {import("./Module")} Module */
+
+/** @typedef {import("./Dependency").DependencyLocation} DependencyLocation */
+
+class CommentCompilationWarning extends WebpackError {
+	/**
+	 *
+	 * @param {string} message warning message
+	 * @param {Module} module affected module
+	 * @param {DependencyLocation} loc affected lines of code
+	 */
+	constructor(message, module, loc) {
+		super(message);
+
+		this.name = "CommentCompilationWarning";
+
+		this.module = module;
+		this.loc = loc;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = CommentCompilationWarning;
diff --git a/node_modules/webpack/lib/CommonJsStuffPlugin.js b/node_modules/webpack/lib/CommonJsStuffPlugin.js
new file mode 100644
index 0000000..80fee87
--- /dev/null
+++ b/node_modules/webpack/lib/CommonJsStuffPlugin.js
@@ -0,0 +1,116 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+const ParserHelpers = require("./ParserHelpers");
+
+class CommonJsStuffPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"CommonJsStuffPlugin",
+			(compilation, { normalModuleFactory }) => {
+				const handler = (parser, parserOptions) => {
+					parser.hooks.expression
+						.for("require.main.require")
+						.tap(
+							"CommonJsStuffPlugin",
+							ParserHelpers.expressionIsUnsupported(
+								parser,
+								"require.main.require is not supported by webpack."
+							)
+						);
+					parser.hooks.expression
+						.for("module.parent.require")
+						.tap(
+							"CommonJsStuffPlugin",
+							ParserHelpers.expressionIsUnsupported(
+								parser,
+								"module.parent.require is not supported by webpack."
+							)
+						);
+					parser.hooks.expression
+						.for("require.main")
+						.tap(
+							"CommonJsStuffPlugin",
+							ParserHelpers.toConstantDependencyWithWebpackRequire(
+								parser,
+								"__webpack_require__.c[__webpack_require__.s]"
+							)
+						);
+					parser.hooks.expression
+						.for("module.loaded")
+						.tap("CommonJsStuffPlugin", expr => {
+							parser.state.module.buildMeta.moduleConcatenationBailout =
+								"module.loaded";
+							return ParserHelpers.toConstantDependency(
+								parser,
+								"module.l"
+							)(expr);
+						});
+					parser.hooks.expression
+						.for("module.id")
+						.tap("CommonJsStuffPlugin", expr => {
+							parser.state.module.buildMeta.moduleConcatenationBailout =
+								"module.id";
+							return ParserHelpers.toConstantDependency(
+								parser,
+								"module.i"
+							)(expr);
+						});
+					parser.hooks.expression
+						.for("module.exports")
+						.tap("CommonJsStuffPlugin", () => {
+							const module = parser.state.module;
+							const isHarmony =
+								module.buildMeta && module.buildMeta.exportsType;
+							if (!isHarmony) return true;
+						});
+					parser.hooks.evaluateIdentifier
+						.for("module.hot")
+						.tap(
+							"CommonJsStuffPlugin",
+							ParserHelpers.evaluateToIdentifier("module.hot", false)
+						);
+					parser.hooks.expression
+						.for("module")
+						.tap("CommonJsStuffPlugin", () => {
+							const module = parser.state.module;
+							const isHarmony =
+								module.buildMeta && module.buildMeta.exportsType;
+							let moduleJsPath = path.join(
+								__dirname,
+								"..",
+								"buildin",
+								isHarmony ? "harmony-module.js" : "module.js"
+							);
+							if (module.context) {
+								moduleJsPath = path.relative(
+									parser.state.module.context,
+									moduleJsPath
+								);
+								if (!/^[A-Z]:/i.test(moduleJsPath)) {
+									moduleJsPath = `./${moduleJsPath.replace(/\\/g, "/")}`;
+								}
+							}
+							return ParserHelpers.addParsedVariableToModule(
+								parser,
+								"module",
+								`require(${JSON.stringify(moduleJsPath)})(module)`
+							);
+						});
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("CommonJsStuffPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("CommonJsStuffPlugin", handler);
+			}
+		);
+	}
+}
+module.exports = CommonJsStuffPlugin;
diff --git a/node_modules/webpack/lib/CompatibilityPlugin.js b/node_modules/webpack/lib/CompatibilityPlugin.js
new file mode 100644
index 0000000..1544d6c
--- /dev/null
+++ b/node_modules/webpack/lib/CompatibilityPlugin.js
@@ -0,0 +1,70 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ConstDependency = require("./dependencies/ConstDependency");
+
+const NullFactory = require("./NullFactory");
+
+/** @typedef {import("./Compiler")} Compiler */
+
+class CompatibilityPlugin {
+	/**
+	 * Apply the plugin
+	 * @param {Compiler} compiler Webpack Compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"CompatibilityPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("CompatibilityPlugin", (parser, parserOptions) => {
+						if (
+							parserOptions.browserify !== undefined &&
+							!parserOptions.browserify
+						)
+							return;
+
+						parser.hooks.call
+							.for("require")
+							.tap("CompatibilityPlugin", expr => {
+								// support for browserify style require delegator: "require(o, !0)"
+								if (expr.arguments.length !== 2) return;
+								const second = parser.evaluateExpression(expr.arguments[1]);
+								if (!second.isBoolean()) return;
+								if (second.asBool() !== true) return;
+								const dep = new ConstDependency("require", expr.callee.range);
+								dep.loc = expr.loc;
+								if (parser.state.current.dependencies.length > 1) {
+									const last =
+										parser.state.current.dependencies[
+											parser.state.current.dependencies.length - 1
+										];
+									if (
+										last.critical &&
+										last.options &&
+										last.options.request === "." &&
+										last.userRequest === "." &&
+										last.options.recursive
+									)
+										parser.state.current.dependencies.pop();
+								}
+								parser.state.current.addDependency(dep);
+								return true;
+							});
+					});
+			}
+		);
+	}
+}
+module.exports = CompatibilityPlugin;
diff --git a/node_modules/webpack/lib/Compilation.js b/node_modules/webpack/lib/Compilation.js
new file mode 100644
index 0000000..6329174
--- /dev/null
+++ b/node_modules/webpack/lib/Compilation.js
@@ -0,0 +1,2327 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+	*/
+"use strict";
+
+const asyncLib = require("neo-async");
+const util = require("util");
+const { CachedSource } = require("webpack-sources");
+const {
+	Tapable,
+	SyncHook,
+	SyncBailHook,
+	SyncWaterfallHook,
+	AsyncSeriesHook
+} = require("tapable");
+const EntryModuleNotFoundError = require("./EntryModuleNotFoundError");
+const ModuleNotFoundError = require("./ModuleNotFoundError");
+const ModuleDependencyWarning = require("./ModuleDependencyWarning");
+const ModuleDependencyError = require("./ModuleDependencyError");
+const ChunkGroup = require("./ChunkGroup");
+const Chunk = require("./Chunk");
+const Entrypoint = require("./Entrypoint");
+const MainTemplate = require("./MainTemplate");
+const ChunkTemplate = require("./ChunkTemplate");
+const HotUpdateChunkTemplate = require("./HotUpdateChunkTemplate");
+const ModuleTemplate = require("./ModuleTemplate");
+const RuntimeTemplate = require("./RuntimeTemplate");
+const ChunkRenderError = require("./ChunkRenderError");
+const Stats = require("./Stats");
+const Semaphore = require("./util/Semaphore");
+const createHash = require("./util/createHash");
+const SortableSet = require("./util/SortableSet");
+const GraphHelpers = require("./GraphHelpers");
+const ModuleDependency = require("./dependencies/ModuleDependency");
+const compareLocations = require("./compareLocations");
+const { Logger, LogType } = require("./logging/Logger");
+const ErrorHelpers = require("./ErrorHelpers");
+const buildChunkGraph = require("./buildChunkGraph");
+const WebpackError = require("./WebpackError");
+
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./Compiler")} Compiler */
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("./DependenciesBlockVariable")} DependenciesBlockVariable */
+/** @typedef {import("./dependencies/SingleEntryDependency")} SingleEntryDependency */
+/** @typedef {import("./dependencies/MultiEntryDependency")} MultiEntryDependency */
+/** @typedef {import("./dependencies/DllEntryDependency")} DllEntryDependency */
+/** @typedef {import("./dependencies/DependencyReference")} DependencyReference */
+/** @typedef {import("./DependenciesBlock")} DependenciesBlock */
+/** @typedef {import("./AsyncDependenciesBlock")} AsyncDependenciesBlock */
+/** @typedef {import("./Dependency")} Dependency */
+/** @typedef {import("./Dependency").DependencyLocation} DependencyLocation */
+/** @typedef {import("./Dependency").DependencyTemplate} DependencyTemplate */
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+// TODO use @callback
+/** @typedef {{[assetName: string]: Source}} CompilationAssets */
+/** @typedef {(err: Error|null, result?: Module) => void } ModuleCallback */
+/** @typedef {(err?: Error|null, result?: Module) => void } ModuleChainCallback */
+/** @typedef {(module: Module) => void} OnModuleCallback */
+/** @typedef {(err?: Error|null) => void} Callback */
+/** @typedef {(d: Dependency) => any} DepBlockVarDependenciesCallback */
+/** @typedef {new (...args: any[]) => Dependency} DepConstructor */
+/** @typedef {{apply: () => void}} Plugin */
+
+/**
+ * @typedef {Object} ModuleFactoryCreateDataContextInfo
+ * @property {string} issuer
+ * @property {string} compiler
+ */
+
+/**
+ * @typedef {Object} ModuleFactoryCreateData
+ * @property {ModuleFactoryCreateDataContextInfo} contextInfo
+ * @property {any=} resolveOptions
+ * @property {string} context
+ * @property {Dependency[]} dependencies
+ */
+
+/**
+ * @typedef {Object} ModuleFactory
+ * @property {(data: ModuleFactoryCreateData, callback: ModuleCallback) => any} create
+ */
+
+/**
+ * @typedef {Object} SortedDependency
+ * @property {ModuleFactory} factory
+ * @property {Dependency[]} dependencies
+ */
+
+/**
+ * @typedef {Object} DependenciesBlockLike
+ * @property {Dependency[]} dependencies
+ * @property {AsyncDependenciesBlock[]} blocks
+ * @property {DependenciesBlockVariable[]} variables
+ */
+
+/**
+ * @typedef {Object} LogEntry
+ * @property {string} type
+ * @property {any[]} args
+ * @property {number} time
+ * @property {string[]=} trace
+ */
+
+/**
+ * @typedef {Object} AssetInfo
+ * @property {boolean=} immutable true, if the asset can be long term cached forever (contains a hash)
+ * @property {number=} size size in bytes, only set after asset has been emitted
+ * @property {boolean=} development true, when asset is only used for development and doesn't count towards user-facing assets
+ * @property {boolean=} hotModuleReplacement true, when asset ships data for updating an existing application (HMR)
+ */
+
+/**
+ * @typedef {Object} Asset
+ * @property {string} name the filename of the asset
+ * @property {Source} source source of the asset
+ * @property {AssetInfo} info info about the asset
+ */
+
+/**
+ * @param {Chunk} a first chunk to sort by id
+ * @param {Chunk} b second chunk to sort by id
+ * @returns {-1|0|1} sort value
+ */
+const byId = (a, b) => {
+	if (typeof a.id !== typeof b.id) {
+		return typeof a.id < typeof b.id ? -1 : 1;
+	}
+	if (a.id < b.id) return -1;
+	if (a.id > b.id) return 1;
+	return 0;
+};
+
+/**
+ * @param {Module} a first module to sort by
+ * @param {Module} b second module to sort by
+ * @returns {-1|0|1} sort value
+ */
+const byIdOrIdentifier = (a, b) => {
+	if (typeof a.id !== typeof b.id) {
+		return typeof a.id < typeof b.id ? -1 : 1;
+	}
+	if (a.id < b.id) return -1;
+	if (a.id > b.id) return 1;
+	const identA = a.identifier();
+	const identB = b.identifier();
+	if (identA < identB) return -1;
+	if (identA > identB) return 1;
+	return 0;
+};
+
+/**
+ * @param {Module} a first module to sort by
+ * @param {Module} b second module to sort by
+ * @returns {-1|0|1} sort value
+ */
+const byIndexOrIdentifier = (a, b) => {
+	if (a.index < b.index) return -1;
+	if (a.index > b.index) return 1;
+	const identA = a.identifier();
+	const identB = b.identifier();
+	if (identA < identB) return -1;
+	if (identA > identB) return 1;
+	return 0;
+};
+
+/**
+ * @param {Compilation} a first compilation to sort by
+ * @param {Compilation} b second compilation to sort by
+ * @returns {-1|0|1} sort value
+ */
+const byNameOrHash = (a, b) => {
+	if (a.name < b.name) return -1;
+	if (a.name > b.name) return 1;
+	if (a.fullHash < b.fullHash) return -1;
+	if (a.fullHash > b.fullHash) return 1;
+	return 0;
+};
+
+/**
+ * @param {DependenciesBlockVariable[]} variables DepBlock Variables to iterate over
+ * @param {DepBlockVarDependenciesCallback} fn callback to apply on iterated elements
+ * @returns {void}
+ */
+const iterationBlockVariable = (variables, fn) => {
+	for (
+		let indexVariable = 0;
+		indexVariable < variables.length;
+		indexVariable++
+	) {
+		const varDep = variables[indexVariable].dependencies;
+		for (let indexVDep = 0; indexVDep < varDep.length; indexVDep++) {
+			fn(varDep[indexVDep]);
+		}
+	}
+};
+
+/**
+ * @template T
+ * @param {T[]} arr array of elements to iterate over
+ * @param {function(T): void} fn callback applied to each element
+ * @returns {void}
+ */
+const iterationOfArrayCallback = (arr, fn) => {
+	for (let index = 0; index < arr.length; index++) {
+		fn(arr[index]);
+	}
+};
+
+/**
+ * @template T
+ * @param {Set<T>} set set to add items to
+ * @param {Set<T>} otherSet set to add items from
+ * @returns {void}
+ */
+const addAllToSet = (set, otherSet) => {
+	for (const item of otherSet) {
+		set.add(item);
+	}
+};
+
+/**
+ * @param {Source} a a source
+ * @param {Source} b another source
+ * @returns {boolean} true, when both sources are equal
+ */
+const isSourceEqual = (a, b) => {
+	if (a === b) return true;
+	// TODO webpack 5: check .buffer() instead, it's called anyway during emit
+	/** @type {Buffer|string} */
+	let aSource = a.source();
+	/** @type {Buffer|string} */
+	let bSource = b.source();
+	if (aSource === bSource) return true;
+	if (typeof aSource === "string" && typeof bSource === "string") return false;
+	if (!Buffer.isBuffer(aSource)) aSource = Buffer.from(aSource, "utf-8");
+	if (!Buffer.isBuffer(bSource)) bSource = Buffer.from(bSource, "utf-8");
+	return aSource.equals(bSource);
+};
+
+class Compilation extends Tapable {
+	/**
+	 * Creates an instance of Compilation.
+	 * @param {Compiler} compiler the compiler which created the compilation
+	 */
+	constructor(compiler) {
+		super();
+		this.hooks = {
+			/** @type {SyncHook<Module>} */
+			buildModule: new SyncHook(["module"]),
+			/** @type {SyncHook<Module>} */
+			rebuildModule: new SyncHook(["module"]),
+			/** @type {SyncHook<Module, Error>} */
+			failedModule: new SyncHook(["module", "error"]),
+			/** @type {SyncHook<Module>} */
+			succeedModule: new SyncHook(["module"]),
+
+			/** @type {SyncHook<Dependency, string>} */
+			addEntry: new SyncHook(["entry", "name"]),
+			/** @type {SyncHook<Dependency, string, Error>} */
+			failedEntry: new SyncHook(["entry", "name", "error"]),
+			/** @type {SyncHook<Dependency, string, Module>} */
+			succeedEntry: new SyncHook(["entry", "name", "module"]),
+
+			/** @type {SyncWaterfallHook<DependencyReference, Dependency, Module>} */
+			dependencyReference: new SyncWaterfallHook([
+				"dependencyReference",
+				"dependency",
+				"module"
+			]),
+
+			/** @type {AsyncSeriesHook<Module[]>} */
+			finishModules: new AsyncSeriesHook(["modules"]),
+			/** @type {SyncHook<Module>} */
+			finishRebuildingModule: new SyncHook(["module"]),
+			/** @type {SyncHook} */
+			unseal: new SyncHook([]),
+			/** @type {SyncHook} */
+			seal: new SyncHook([]),
+
+			/** @type {SyncHook} */
+			beforeChunks: new SyncHook([]),
+			/** @type {SyncHook<Chunk[]>} */
+			afterChunks: new SyncHook(["chunks"]),
+
+			/** @type {SyncBailHook<Module[]>} */
+			optimizeDependenciesBasic: new SyncBailHook(["modules"]),
+			/** @type {SyncBailHook<Module[]>} */
+			optimizeDependencies: new SyncBailHook(["modules"]),
+			/** @type {SyncBailHook<Module[]>} */
+			optimizeDependenciesAdvanced: new SyncBailHook(["modules"]),
+			/** @type {SyncBailHook<Module[]>} */
+			afterOptimizeDependencies: new SyncHook(["modules"]),
+
+			/** @type {SyncHook} */
+			optimize: new SyncHook([]),
+			/** @type {SyncBailHook<Module[]>} */
+			optimizeModulesBasic: new SyncBailHook(["modules"]),
+			/** @type {SyncBailHook<Module[]>} */
+			optimizeModules: new SyncBailHook(["modules"]),
+			/** @type {SyncBailHook<Module[]>} */
+			optimizeModulesAdvanced: new SyncBailHook(["modules"]),
+			/** @type {SyncHook<Module[]>} */
+			afterOptimizeModules: new SyncHook(["modules"]),
+
+			/** @type {SyncBailHook<Chunk[], ChunkGroup[]>} */
+			optimizeChunksBasic: new SyncBailHook(["chunks", "chunkGroups"]),
+			/** @type {SyncBailHook<Chunk[], ChunkGroup[]>} */
+			optimizeChunks: new SyncBailHook(["chunks", "chunkGroups"]),
+			/** @type {SyncBailHook<Chunk[], ChunkGroup[]>} */
+			optimizeChunksAdvanced: new SyncBailHook(["chunks", "chunkGroups"]),
+			/** @type {SyncHook<Chunk[], ChunkGroup[]>} */
+			afterOptimizeChunks: new SyncHook(["chunks", "chunkGroups"]),
+
+			/** @type {AsyncSeriesHook<Chunk[], Module[]>} */
+			optimizeTree: new AsyncSeriesHook(["chunks", "modules"]),
+			/** @type {SyncHook<Chunk[], Module[]>} */
+			afterOptimizeTree: new SyncHook(["chunks", "modules"]),
+
+			/** @type {SyncBailHook<Chunk[], Module[]>} */
+			optimizeChunkModulesBasic: new SyncBailHook(["chunks", "modules"]),
+			/** @type {SyncBailHook<Chunk[], Module[]>} */
+			optimizeChunkModules: new SyncBailHook(["chunks", "modules"]),
+			/** @type {SyncBailHook<Chunk[], Module[]>} */
+			optimizeChunkModulesAdvanced: new SyncBailHook(["chunks", "modules"]),
+			/** @type {SyncHook<Chunk[], Module[]>} */
+			afterOptimizeChunkModules: new SyncHook(["chunks", "modules"]),
+			/** @type {SyncBailHook} */
+			shouldRecord: new SyncBailHook([]),
+
+			/** @type {SyncHook<Module[], any>} */
+			reviveModules: new SyncHook(["modules", "records"]),
+			/** @type {SyncHook<Module[]>} */
+			optimizeModuleOrder: new SyncHook(["modules"]),
+			/** @type {SyncHook<Module[]>} */
+			advancedOptimizeModuleOrder: new SyncHook(["modules"]),
+			/** @type {SyncHook<Module[]>} */
+			beforeModuleIds: new SyncHook(["modules"]),
+			/** @type {SyncHook<Module[]>} */
+			moduleIds: new SyncHook(["modules"]),
+			/** @type {SyncHook<Module[]>} */
+			optimizeModuleIds: new SyncHook(["modules"]),
+			/** @type {SyncHook<Module[]>} */
+			afterOptimizeModuleIds: new SyncHook(["modules"]),
+
+			/** @type {SyncHook<Chunk[], any>} */
+			reviveChunks: new SyncHook(["chunks", "records"]),
+			/** @type {SyncHook<Chunk[]>} */
+			optimizeChunkOrder: new SyncHook(["chunks"]),
+			/** @type {SyncHook<Chunk[]>} */
+			beforeChunkIds: new SyncHook(["chunks"]),
+			/** @type {SyncHook<Chunk[]>} */
+			optimizeChunkIds: new SyncHook(["chunks"]),
+			/** @type {SyncHook<Chunk[]>} */
+			afterOptimizeChunkIds: new SyncHook(["chunks"]),
+
+			/** @type {SyncHook<Module[], any>} */
+			recordModules: new SyncHook(["modules", "records"]),
+			/** @type {SyncHook<Chunk[], any>} */
+			recordChunks: new SyncHook(["chunks", "records"]),
+
+			/** @type {SyncHook} */
+			beforeHash: new SyncHook([]),
+			/** @type {SyncHook<Chunk>} */
+			contentHash: new SyncHook(["chunk"]),
+			/** @type {SyncHook} */
+			afterHash: new SyncHook([]),
+			/** @type {SyncHook<any>} */
+			recordHash: new SyncHook(["records"]),
+			/** @type {SyncHook<Compilation, any>} */
+			record: new SyncHook(["compilation", "records"]),
+
+			/** @type {SyncHook} */
+			beforeModuleAssets: new SyncHook([]),
+			/** @type {SyncBailHook} */
+			shouldGenerateChunkAssets: new SyncBailHook([]),
+			/** @type {SyncHook} */
+			beforeChunkAssets: new SyncHook([]),
+			/** @type {SyncHook<Chunk[]>} */
+			additionalChunkAssets: new SyncHook(["chunks"]),
+
+			/** @type {AsyncSeriesHook} */
+			additionalAssets: new AsyncSeriesHook([]),
+			/** @type {AsyncSeriesHook<Chunk[]>} */
+			optimizeChunkAssets: new AsyncSeriesHook(["chunks"]),
+			/** @type {SyncHook<Chunk[]>} */
+			afterOptimizeChunkAssets: new SyncHook(["chunks"]),
+			/** @type {AsyncSeriesHook<CompilationAssets>} */
+			optimizeAssets: new AsyncSeriesHook(["assets"]),
+			/** @type {SyncHook<CompilationAssets>} */
+			afterOptimizeAssets: new SyncHook(["assets"]),
+
+			/** @type {SyncBailHook} */
+			needAdditionalSeal: new SyncBailHook([]),
+			/** @type {AsyncSeriesHook} */
+			afterSeal: new AsyncSeriesHook([]),
+
+			/** @type {SyncHook<Chunk, Hash>} */
+			chunkHash: new SyncHook(["chunk", "chunkHash"]),
+			/** @type {SyncHook<Module, string>} */
+			moduleAsset: new SyncHook(["module", "filename"]),
+			/** @type {SyncHook<Chunk, string>} */
+			chunkAsset: new SyncHook(["chunk", "filename"]),
+
+			/** @type {SyncWaterfallHook<string, TODO>} */
+			assetPath: new SyncWaterfallHook(["filename", "data"]), // TODO MainTemplate
+
+			/** @type {SyncBailHook} */
+			needAdditionalPass: new SyncBailHook([]),
+
+			/** @type {SyncHook<Compiler, string, number>} */
+			childCompiler: new SyncHook([
+				"childCompiler",
+				"compilerName",
+				"compilerIndex"
+			]),
+
+			/** @type {SyncBailHook<string, LogEntry>} */
+			log: new SyncBailHook(["origin", "logEntry"]),
+
+			// TODO the following hooks are weirdly located here
+			// TODO move them for webpack 5
+			/** @type {SyncHook<object, Module>} */
+			normalModuleLoader: new SyncHook(["loaderContext", "module"]),
+
+			/** @type {SyncBailHook<Chunk[]>} */
+			optimizeExtractedChunksBasic: new SyncBailHook(["chunks"]),
+			/** @type {SyncBailHook<Chunk[]>} */
+			optimizeExtractedChunks: new SyncBailHook(["chunks"]),
+			/** @type {SyncBailHook<Chunk[]>} */
+			optimizeExtractedChunksAdvanced: new SyncBailHook(["chunks"]),
+			/** @type {SyncHook<Chunk[]>} */
+			afterOptimizeExtractedChunks: new SyncHook(["chunks"])
+		};
+		this._pluginCompat.tap("Compilation", options => {
+			switch (options.name) {
+				case "optimize-tree":
+				case "additional-assets":
+				case "optimize-chunk-assets":
+				case "optimize-assets":
+				case "after-seal":
+					options.async = true;
+					break;
+			}
+		});
+		/** @type {string=} */
+		this.name = undefined;
+		/** @type {Compiler} */
+		this.compiler = compiler;
+		this.resolverFactory = compiler.resolverFactory;
+		this.inputFileSystem = compiler.inputFileSystem;
+		this.requestShortener = compiler.requestShortener;
+
+		const options = compiler.options;
+		this.options = options;
+		this.outputOptions = options && options.output;
+		/** @type {boolean=} */
+		this.bail = options && options.bail;
+		this.profile = options && options.profile;
+		this.performance = options && options.performance;
+
+		this.mainTemplate = new MainTemplate(this.outputOptions);
+		this.chunkTemplate = new ChunkTemplate(this.outputOptions);
+		this.hotUpdateChunkTemplate = new HotUpdateChunkTemplate(
+			this.outputOptions
+		);
+		this.runtimeTemplate = new RuntimeTemplate(
+			this.outputOptions,
+			this.requestShortener
+		);
+		this.moduleTemplates = {
+			javascript: new ModuleTemplate(this.runtimeTemplate, "javascript"),
+			webassembly: new ModuleTemplate(this.runtimeTemplate, "webassembly")
+		};
+
+		this.semaphore = new Semaphore(options.parallelism || 100);
+
+		this.entries = [];
+		/** @private @type {{name: string, request: string, module: Module}[]} */
+		this._preparedEntrypoints = [];
+		/** @type {Map<string, Entrypoint>} */
+		this.entrypoints = new Map();
+		/** @type {Chunk[]} */
+		this.chunks = [];
+		/** @type {ChunkGroup[]} */
+		this.chunkGroups = [];
+		/** @type {Map<string, ChunkGroup>} */
+		this.namedChunkGroups = new Map();
+		/** @type {Map<string, Chunk>} */
+		this.namedChunks = new Map();
+		/** @type {Module[]} */
+		this.modules = [];
+		/** @private @type {Map<string, Module>} */
+		this._modules = new Map();
+		this.cache = null;
+		this.records = null;
+		/** @type {string[]} */
+		this.additionalChunkAssets = [];
+		/** @type {CompilationAssets} */
+		this.assets = {};
+		/** @type {Map<string, AssetInfo>} */
+		this.assetsInfo = new Map();
+		/** @type {WebpackError[]} */
+		this.errors = [];
+		/** @type {WebpackError[]} */
+		this.warnings = [];
+		/** @type {Compilation[]} */
+		this.children = [];
+		/** @type {Map<string, LogEntry[]>} */
+		this.logging = new Map();
+		/** @type {Map<DepConstructor, ModuleFactory>} */
+		this.dependencyFactories = new Map();
+		/** @type {Map<DepConstructor, DependencyTemplate>} */
+		this.dependencyTemplates = new Map();
+		// TODO refactor this in webpack 5 to a custom DependencyTemplates class with a hash property
+		// @ts-ignore
+		this.dependencyTemplates.set("hash", "");
+		this.childrenCounters = {};
+		/** @type {Set<number|string>} */
+		this.usedChunkIds = null;
+		/** @type {Set<number>} */
+		this.usedModuleIds = null;
+		/** @type {Map<string, number>=} */
+		this.fileTimestamps = undefined;
+		/** @type {Map<string, number>=} */
+		this.contextTimestamps = undefined;
+		/** @type {Set<string>=} */
+		this.compilationDependencies = undefined;
+		/** @private @type {Map<Module, Callback[]>} */
+		this._buildingModules = new Map();
+		/** @private @type {Map<Module, Callback[]>} */
+		this._rebuildingModules = new Map();
+		/** @type {Set<string>} */
+		this.emittedAssets = new Set();
+	}
+
+	getStats() {
+		return new Stats(this);
+	}
+
+	/**
+	 * @param {string | (function(): string)} name name of the logger, or function called once to get the logger name
+	 * @returns {Logger} a logger with that name
+	 */
+	getLogger(name) {
+		if (!name) {
+			throw new TypeError("Compilation.getLogger(name) called without a name");
+		}
+		/** @type {LogEntry[] | undefined} */
+		let logEntries;
+		return new Logger((type, args) => {
+			if (typeof name === "function") {
+				name = name();
+				if (!name) {
+					throw new TypeError(
+						"Compilation.getLogger(name) called with a function not returning a name"
+					);
+				}
+			}
+			let trace;
+			switch (type) {
+				case LogType.warn:
+				case LogType.error:
+				case LogType.trace:
+					trace = ErrorHelpers.cutOffLoaderExecution(new Error("Trace").stack)
+						.split("\n")
+						.slice(3);
+					break;
+			}
+			/** @type {LogEntry} */
+			const logEntry = {
+				time: Date.now(),
+				type,
+				args,
+				trace
+			};
+			if (this.hooks.log.call(name, logEntry) === undefined) {
+				if (logEntry.type === LogType.profileEnd) {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					if (typeof console.profileEnd === "function") {
+						// eslint-disable-next-line node/no-unsupported-features/node-builtins
+						console.profileEnd(`[${name}] ${logEntry.args[0]}`);
+					}
+				}
+				if (logEntries === undefined) {
+					logEntries = this.logging.get(name);
+					if (logEntries === undefined) {
+						logEntries = [];
+						this.logging.set(name, logEntries);
+					}
+				}
+				logEntries.push(logEntry);
+				if (logEntry.type === LogType.profile) {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					if (typeof console.profile === "function") {
+						// eslint-disable-next-line node/no-unsupported-features/node-builtins
+						console.profile(`[${name}] ${logEntry.args[0]}`);
+					}
+				}
+			}
+		});
+	}
+
+	/**
+	 * @typedef {Object} AddModuleResult
+	 * @property {Module} module the added or existing module
+	 * @property {boolean} issuer was this the first request for this module
+	 * @property {boolean} build should the module be build
+	 * @property {boolean} dependencies should dependencies be walked
+	 */
+
+	/**
+	 * @param {Module} module module to be added that was created
+	 * @param {any=} cacheGroup cacheGroup it is apart of
+	 * @returns {AddModuleResult} returns meta about whether or not the module had built
+	 * had an issuer, or any dependnecies
+	 */
+	addModule(module, cacheGroup) {
+		const identifier = module.identifier();
+		const alreadyAddedModule = this._modules.get(identifier);
+		if (alreadyAddedModule) {
+			return {
+				module: alreadyAddedModule,
+				issuer: false,
+				build: false,
+				dependencies: false
+			};
+		}
+		const cacheName = (cacheGroup || "m") + identifier;
+		if (this.cache && this.cache[cacheName]) {
+			const cacheModule = this.cache[cacheName];
+
+			if (typeof cacheModule.updateCacheModule === "function") {
+				cacheModule.updateCacheModule(module);
+			}
+
+			let rebuild = true;
+			if (this.fileTimestamps && this.contextTimestamps) {
+				rebuild = cacheModule.needRebuild(
+					this.fileTimestamps,
+					this.contextTimestamps
+				);
+			}
+
+			if (!rebuild) {
+				cacheModule.disconnect();
+				this._modules.set(identifier, cacheModule);
+				this.modules.push(cacheModule);
+				for (const err of cacheModule.errors) {
+					this.errors.push(err);
+				}
+				for (const err of cacheModule.warnings) {
+					this.warnings.push(err);
+				}
+				return {
+					module: cacheModule,
+					issuer: true,
+					build: false,
+					dependencies: true
+				};
+			}
+			cacheModule.unbuild();
+			module = cacheModule;
+		}
+		this._modules.set(identifier, module);
+		if (this.cache) {
+			this.cache[cacheName] = module;
+		}
+		this.modules.push(module);
+		return {
+			module: module,
+			issuer: true,
+			build: true,
+			dependencies: true
+		};
+	}
+
+	/**
+	 * Fetches a module from a compilation by its identifier
+	 * @param {Module} module the module provided
+	 * @returns {Module} the module requested
+	 */
+	getModule(module) {
+		const identifier = module.identifier();
+		return this._modules.get(identifier);
+	}
+
+	/**
+	 * Attempts to search for a module by its identifier
+	 * @param {string} identifier identifier (usually path) for module
+	 * @returns {Module|undefined} attempt to search for module and return it, else undefined
+	 */
+	findModule(identifier) {
+		return this._modules.get(identifier);
+	}
+
+	/**
+	 * @param {Module} module module with its callback list
+	 * @param {Callback} callback the callback function
+	 * @returns {void}
+	 */
+	waitForBuildingFinished(module, callback) {
+		let callbackList = this._buildingModules.get(module);
+		if (callbackList) {
+			callbackList.push(() => callback());
+		} else {
+			process.nextTick(callback);
+		}
+	}
+
+	/**
+	 * Builds the module object
+	 *
+	 * @param {Module} module module to be built
+	 * @param {boolean} optional optional flag
+	 * @param {Module=} origin origin module this module build was requested from
+	 * @param {Dependency[]=} dependencies optional dependencies from the module to be built
+	 * @param {TODO} thisCallback the callback
+	 * @returns {TODO} returns the callback function with results
+	 */
+	buildModule(module, optional, origin, dependencies, thisCallback) {
+		let callbackList = this._buildingModules.get(module);
+		if (callbackList) {
+			callbackList.push(thisCallback);
+			return;
+		}
+		this._buildingModules.set(module, (callbackList = [thisCallback]));
+
+		const callback = err => {
+			this._buildingModules.delete(module);
+			for (const cb of callbackList) {
+				cb(err);
+			}
+		};
+
+		this.hooks.buildModule.call(module);
+		module.build(
+			this.options,
+			this,
+			this.resolverFactory.get("normal", module.resolveOptions),
+			this.inputFileSystem,
+			error => {
+				const errors = module.errors;
+				for (let indexError = 0; indexError < errors.length; indexError++) {
+					const err = errors[indexError];
+					err.origin = origin;
+					err.dependencies = dependencies;
+					if (optional) {
+						this.warnings.push(err);
+					} else {
+						this.errors.push(err);
+					}
+				}
+
+				const warnings = module.warnings;
+				for (
+					let indexWarning = 0;
+					indexWarning < warnings.length;
+					indexWarning++
+				) {
+					const war = warnings[indexWarning];
+					war.origin = origin;
+					war.dependencies = dependencies;
+					this.warnings.push(war);
+				}
+				const originalMap = module.dependencies.reduce((map, v, i) => {
+					map.set(v, i);
+					return map;
+				}, new Map());
+				module.dependencies.sort((a, b) => {
+					const cmp = compareLocations(a.loc, b.loc);
+					if (cmp) return cmp;
+					return originalMap.get(a) - originalMap.get(b);
+				});
+				if (error) {
+					this.hooks.failedModule.call(module, error);
+					return callback(error);
+				}
+				this.hooks.succeedModule.call(module);
+				return callback();
+			}
+		);
+	}
+
+	/**
+	 * @param {Module} module to be processed for deps
+	 * @param {ModuleCallback} callback callback to be triggered
+	 * @returns {void}
+	 */
+	processModuleDependencies(module, callback) {
+		const dependencies = new Map();
+
+		const addDependency = dep => {
+			const resourceIdent = dep.getResourceIdentifier();
+			if (resourceIdent) {
+				const factory = this.dependencyFactories.get(dep.constructor);
+				if (factory === undefined) {
+					throw new Error(
+						`No module factory available for dependency type: ${dep.constructor.name}`
+					);
+				}
+				let innerMap = dependencies.get(factory);
+				if (innerMap === undefined) {
+					dependencies.set(factory, (innerMap = new Map()));
+				}
+				let list = innerMap.get(resourceIdent);
+				if (list === undefined) innerMap.set(resourceIdent, (list = []));
+				list.push(dep);
+			}
+		};
+
+		const addDependenciesBlock = block => {
+			if (block.dependencies) {
+				iterationOfArrayCallback(block.dependencies, addDependency);
+			}
+			if (block.blocks) {
+				iterationOfArrayCallback(block.blocks, addDependenciesBlock);
+			}
+			if (block.variables) {
+				iterationBlockVariable(block.variables, addDependency);
+			}
+		};
+
+		try {
+			addDependenciesBlock(module);
+		} catch (e) {
+			callback(e);
+		}
+
+		const sortedDependencies = [];
+
+		for (const pair1 of dependencies) {
+			for (const pair2 of pair1[1]) {
+				sortedDependencies.push({
+					factory: pair1[0],
+					dependencies: pair2[1]
+				});
+			}
+		}
+
+		this.addModuleDependencies(
+			module,
+			sortedDependencies,
+			this.bail,
+			null,
+			true,
+			callback
+		);
+	}
+
+	/**
+	 * @param {Module} module module to add deps to
+	 * @param {SortedDependency[]} dependencies set of sorted dependencies to iterate through
+	 * @param {(boolean|null)=} bail whether to bail or not
+	 * @param {TODO} cacheGroup optional cacheGroup
+	 * @param {boolean} recursive whether it is recursive traversal
+	 * @param {function} callback callback for when dependencies are finished being added
+	 * @returns {void}
+	 */
+	addModuleDependencies(
+		module,
+		dependencies,
+		bail,
+		cacheGroup,
+		recursive,
+		callback
+	) {
+		const start = this.profile && Date.now();
+		const currentProfile = this.profile && {};
+
+		asyncLib.forEach(
+			dependencies,
+			(item, callback) => {
+				const dependencies = item.dependencies;
+
+				const errorAndCallback = err => {
+					err.origin = module;
+					err.dependencies = dependencies;
+					this.errors.push(err);
+					if (bail) {
+						callback(err);
+					} else {
+						callback();
+					}
+				};
+				const warningAndCallback = err => {
+					err.origin = module;
+					this.warnings.push(err);
+					callback();
+				};
+
+				const semaphore = this.semaphore;
+				semaphore.acquire(() => {
+					const factory = item.factory;
+					factory.create(
+						{
+							contextInfo: {
+								issuer: module.nameForCondition && module.nameForCondition(),
+								compiler: this.compiler.name
+							},
+							resolveOptions: module.resolveOptions,
+							context: module.context,
+							dependencies: dependencies
+						},
+						(err, dependentModule) => {
+							let afterFactory;
+
+							const isOptional = () => {
+								return dependencies.every(d => d.optional);
+							};
+
+							const errorOrWarningAndCallback = err => {
+								if (isOptional()) {
+									return warningAndCallback(err);
+								} else {
+									return errorAndCallback(err);
+								}
+							};
+
+							if (err) {
+								semaphore.release();
+								return errorOrWarningAndCallback(
+									new ModuleNotFoundError(module, err)
+								);
+							}
+							if (!dependentModule) {
+								semaphore.release();
+								return process.nextTick(callback);
+							}
+							if (currentProfile) {
+								afterFactory = Date.now();
+								currentProfile.factory = afterFactory - start;
+							}
+
+							const iterationDependencies = depend => {
+								for (let index = 0; index < depend.length; index++) {
+									const dep = depend[index];
+									dep.module = dependentModule;
+									dependentModule.addReason(module, dep);
+								}
+							};
+
+							const addModuleResult = this.addModule(
+								dependentModule,
+								cacheGroup
+							);
+							dependentModule = addModuleResult.module;
+							iterationDependencies(dependencies);
+
+							const afterBuild = () => {
+								if (recursive && addModuleResult.dependencies) {
+									this.processModuleDependencies(dependentModule, callback);
+								} else {
+									return callback();
+								}
+							};
+
+							if (addModuleResult.issuer) {
+								if (currentProfile) {
+									dependentModule.profile = currentProfile;
+								}
+
+								dependentModule.issuer = module;
+							} else {
+								if (this.profile) {
+									if (module.profile) {
+										const time = Date.now() - start;
+										if (
+											!module.profile.dependencies ||
+											time > module.profile.dependencies
+										) {
+											module.profile.dependencies = time;
+										}
+									}
+								}
+							}
+
+							if (addModuleResult.build) {
+								this.buildModule(
+									dependentModule,
+									isOptional(),
+									module,
+									dependencies,
+									err => {
+										if (err) {
+											semaphore.release();
+											return errorOrWarningAndCallback(err);
+										}
+
+										if (currentProfile) {
+											const afterBuilding = Date.now();
+											currentProfile.building = afterBuilding - afterFactory;
+										}
+
+										semaphore.release();
+										afterBuild();
+									}
+								);
+							} else {
+								semaphore.release();
+								this.waitForBuildingFinished(dependentModule, afterBuild);
+							}
+						}
+					);
+				});
+			},
+			err => {
+				// In V8, the Error objects keep a reference to the functions on the stack. These warnings &
+				// errors are created inside closures that keep a reference to the Compilation, so errors are
+				// leaking the Compilation object.
+
+				if (err) {
+					// eslint-disable-next-line no-self-assign
+					err.stack = err.stack;
+					return callback(err);
+				}
+
+				return process.nextTick(callback);
+			}
+		);
+	}
+
+	/**
+	 *
+	 * @param {string} context context string path
+	 * @param {Dependency} dependency dependency used to create Module chain
+	 * @param {OnModuleCallback} onModule function invoked on modules creation
+	 * @param {ModuleChainCallback} callback callback for when module chain is complete
+	 * @returns {void} will throw if dependency instance is not a valid Dependency
+	 */
+	_addModuleChain(context, dependency, onModule, callback) {
+		const start = this.profile && Date.now();
+		const currentProfile = this.profile && {};
+
+		const errorAndCallback = this.bail
+			? err => {
+					callback(err);
+			  }
+			: err => {
+					err.dependencies = [dependency];
+					this.errors.push(err);
+					callback();
+			  };
+
+		if (
+			typeof dependency !== "object" ||
+			dependency === null ||
+			!dependency.constructor
+		) {
+			throw new Error("Parameter 'dependency' must be a Dependency");
+		}
+		const Dep = /** @type {DepConstructor} */ (dependency.constructor);
+		const moduleFactory = this.dependencyFactories.get(Dep);
+		if (!moduleFactory) {
+			throw new Error(
+				`No dependency factory available for this dependency type: ${dependency.constructor.name}`
+			);
+		}
+
+		this.semaphore.acquire(() => {
+			moduleFactory.create(
+				{
+					contextInfo: {
+						issuer: "",
+						compiler: this.compiler.name
+					},
+					context: context,
+					dependencies: [dependency]
+				},
+				(err, module) => {
+					if (err) {
+						this.semaphore.release();
+						return errorAndCallback(new EntryModuleNotFoundError(err));
+					}
+
+					let afterFactory;
+
+					if (currentProfile) {
+						afterFactory = Date.now();
+						currentProfile.factory = afterFactory - start;
+					}
+
+					const addModuleResult = this.addModule(module);
+					module = addModuleResult.module;
+
+					onModule(module);
+
+					dependency.module = module;
+					module.addReason(null, dependency);
+
+					const afterBuild = () => {
+						if (addModuleResult.dependencies) {
+							this.processModuleDependencies(module, err => {
+								if (err) return callback(err);
+								callback(null, module);
+							});
+						} else {
+							return callback(null, module);
+						}
+					};
+
+					if (addModuleResult.issuer) {
+						if (currentProfile) {
+							module.profile = currentProfile;
+						}
+					}
+
+					if (addModuleResult.build) {
+						this.buildModule(module, false, null, null, err => {
+							if (err) {
+								this.semaphore.release();
+								return errorAndCallback(err);
+							}
+
+							if (currentProfile) {
+								const afterBuilding = Date.now();
+								currentProfile.building = afterBuilding - afterFactory;
+							}
+
+							this.semaphore.release();
+							afterBuild();
+						});
+					} else {
+						this.semaphore.release();
+						this.waitForBuildingFinished(module, afterBuild);
+					}
+				}
+			);
+		});
+	}
+
+	/**
+	 *
+	 * @param {string} context context path for entry
+	 * @param {Dependency} entry entry dependency being created
+	 * @param {string} name name of entry
+	 * @param {ModuleCallback} callback callback function
+	 * @returns {void} returns
+	 */
+	addEntry(context, entry, name, callback) {
+		this.hooks.addEntry.call(entry, name);
+
+		const slot = {
+			name: name,
+			// TODO webpack 5 remove `request`
+			request: null,
+			module: null
+		};
+
+		if (entry instanceof ModuleDependency) {
+			slot.request = entry.request;
+		}
+
+		// TODO webpack 5: merge modules instead when multiple entry modules are supported
+		const idx = this._preparedEntrypoints.findIndex(slot => slot.name === name);
+		if (idx >= 0) {
+			// Overwrite existing entrypoint
+			this._preparedEntrypoints[idx] = slot;
+		} else {
+			this._preparedEntrypoints.push(slot);
+		}
+		this._addModuleChain(
+			context,
+			entry,
+			module => {
+				this.entries.push(module);
+			},
+			(err, module) => {
+				if (err) {
+					this.hooks.failedEntry.call(entry, name, err);
+					return callback(err);
+				}
+
+				if (module) {
+					slot.module = module;
+				} else {
+					const idx = this._preparedEntrypoints.indexOf(slot);
+					if (idx >= 0) {
+						this._preparedEntrypoints.splice(idx, 1);
+					}
+				}
+				this.hooks.succeedEntry.call(entry, name, module);
+				return callback(null, module);
+			}
+		);
+	}
+
+	/**
+	 * @param {string} context context path string
+	 * @param {Dependency} dependency dep used to create module
+	 * @param {ModuleCallback} callback module callback sending module up a level
+	 * @returns {void}
+	 */
+	prefetch(context, dependency, callback) {
+		this._addModuleChain(
+			context,
+			dependency,
+			module => {
+				module.prefetched = true;
+			},
+			callback
+		);
+	}
+
+	/**
+	 * @param {Module} module module to be rebuilt
+	 * @param {Callback} thisCallback callback when module finishes rebuilding
+	 * @returns {void}
+	 */
+	rebuildModule(module, thisCallback) {
+		let callbackList = this._rebuildingModules.get(module);
+		if (callbackList) {
+			callbackList.push(thisCallback);
+			return;
+		}
+		this._rebuildingModules.set(module, (callbackList = [thisCallback]));
+
+		const callback = err => {
+			this._rebuildingModules.delete(module);
+			for (const cb of callbackList) {
+				cb(err);
+			}
+		};
+
+		this.hooks.rebuildModule.call(module);
+		const oldDependencies = module.dependencies.slice();
+		const oldVariables = module.variables.slice();
+		const oldBlocks = module.blocks.slice();
+		module.unbuild();
+		this.buildModule(module, false, module, null, err => {
+			if (err) {
+				this.hooks.finishRebuildingModule.call(module);
+				return callback(err);
+			}
+
+			this.processModuleDependencies(module, err => {
+				if (err) return callback(err);
+				this.removeReasonsOfDependencyBlock(module, {
+					dependencies: oldDependencies,
+					variables: oldVariables,
+					blocks: oldBlocks
+				});
+				this.hooks.finishRebuildingModule.call(module);
+				callback();
+			});
+		});
+	}
+
+	finish(callback) {
+		const modules = this.modules;
+		this.hooks.finishModules.callAsync(modules, err => {
+			if (err) return callback(err);
+
+			for (let index = 0; index < modules.length; index++) {
+				const module = modules[index];
+				this.reportDependencyErrorsAndWarnings(module, [module]);
+			}
+
+			callback();
+		});
+	}
+
+	unseal() {
+		this.hooks.unseal.call();
+		this.chunks.length = 0;
+		this.chunkGroups.length = 0;
+		this.namedChunks.clear();
+		this.namedChunkGroups.clear();
+		this.additionalChunkAssets.length = 0;
+		this.assets = {};
+		this.assetsInfo.clear();
+		for (const module of this.modules) {
+			module.unseal();
+		}
+	}
+
+	/**
+	 * @param {Callback} callback signals when the seal method is finishes
+	 * @returns {void}
+	 */
+	seal(callback) {
+		this.hooks.seal.call();
+
+		while (
+			this.hooks.optimizeDependenciesBasic.call(this.modules) ||
+			this.hooks.optimizeDependencies.call(this.modules) ||
+			this.hooks.optimizeDependenciesAdvanced.call(this.modules)
+		) {
+			/* empty */
+		}
+		this.hooks.afterOptimizeDependencies.call(this.modules);
+
+		this.hooks.beforeChunks.call();
+		for (const preparedEntrypoint of this._preparedEntrypoints) {
+			const module = preparedEntrypoint.module;
+			const name = preparedEntrypoint.name;
+			const chunk = this.addChunk(name);
+			const entrypoint = new Entrypoint(name);
+			entrypoint.setRuntimeChunk(chunk);
+			entrypoint.addOrigin(null, name, preparedEntrypoint.request);
+			this.namedChunkGroups.set(name, entrypoint);
+			this.entrypoints.set(name, entrypoint);
+			this.chunkGroups.push(entrypoint);
+
+			GraphHelpers.connectChunkGroupAndChunk(entrypoint, chunk);
+			GraphHelpers.connectChunkAndModule(chunk, module);
+
+			chunk.entryModule = module;
+			chunk.name = name;
+
+			this.assignDepth(module);
+		}
+		buildChunkGraph(
+			this,
+			/** @type {Entrypoint[]} */ (this.chunkGroups.slice())
+		);
+		this.sortModules(this.modules);
+		this.hooks.afterChunks.call(this.chunks);
+
+		this.hooks.optimize.call();
+
+		while (
+			this.hooks.optimizeModulesBasic.call(this.modules) ||
+			this.hooks.optimizeModules.call(this.modules) ||
+			this.hooks.optimizeModulesAdvanced.call(this.modules)
+		) {
+			/* empty */
+		}
+		this.hooks.afterOptimizeModules.call(this.modules);
+
+		while (
+			this.hooks.optimizeChunksBasic.call(this.chunks, this.chunkGroups) ||
+			this.hooks.optimizeChunks.call(this.chunks, this.chunkGroups) ||
+			this.hooks.optimizeChunksAdvanced.call(this.chunks, this.chunkGroups)
+		) {
+			/* empty */
+		}
+		this.hooks.afterOptimizeChunks.call(this.chunks, this.chunkGroups);
+
+		this.hooks.optimizeTree.callAsync(this.chunks, this.modules, err => {
+			if (err) {
+				return callback(err);
+			}
+
+			this.hooks.afterOptimizeTree.call(this.chunks, this.modules);
+
+			while (
+				this.hooks.optimizeChunkModulesBasic.call(this.chunks, this.modules) ||
+				this.hooks.optimizeChunkModules.call(this.chunks, this.modules) ||
+				this.hooks.optimizeChunkModulesAdvanced.call(this.chunks, this.modules)
+			) {
+				/* empty */
+			}
+			this.hooks.afterOptimizeChunkModules.call(this.chunks, this.modules);
+
+			const shouldRecord = this.hooks.shouldRecord.call() !== false;
+
+			this.hooks.reviveModules.call(this.modules, this.records);
+			this.hooks.optimizeModuleOrder.call(this.modules);
+			this.hooks.advancedOptimizeModuleOrder.call(this.modules);
+			this.hooks.beforeModuleIds.call(this.modules);
+			this.hooks.moduleIds.call(this.modules);
+			this.applyModuleIds();
+			this.hooks.optimizeModuleIds.call(this.modules);
+			this.hooks.afterOptimizeModuleIds.call(this.modules);
+
+			this.sortItemsWithModuleIds();
+
+			this.hooks.reviveChunks.call(this.chunks, this.records);
+			this.hooks.optimizeChunkOrder.call(this.chunks);
+			this.hooks.beforeChunkIds.call(this.chunks);
+			this.applyChunkIds();
+			this.hooks.optimizeChunkIds.call(this.chunks);
+			this.hooks.afterOptimizeChunkIds.call(this.chunks);
+
+			this.sortItemsWithChunkIds();
+
+			if (shouldRecord) {
+				this.hooks.recordModules.call(this.modules, this.records);
+				this.hooks.recordChunks.call(this.chunks, this.records);
+			}
+
+			this.hooks.beforeHash.call();
+			this.createHash();
+			this.hooks.afterHash.call();
+
+			if (shouldRecord) {
+				this.hooks.recordHash.call(this.records);
+			}
+
+			this.hooks.beforeModuleAssets.call();
+			this.createModuleAssets();
+			if (this.hooks.shouldGenerateChunkAssets.call() !== false) {
+				this.hooks.beforeChunkAssets.call();
+				this.createChunkAssets();
+			}
+			this.hooks.additionalChunkAssets.call(this.chunks);
+			this.summarizeDependencies();
+			if (shouldRecord) {
+				this.hooks.record.call(this, this.records);
+			}
+
+			this.hooks.additionalAssets.callAsync(err => {
+				if (err) {
+					return callback(err);
+				}
+				this.hooks.optimizeChunkAssets.callAsync(this.chunks, err => {
+					if (err) {
+						return callback(err);
+					}
+					this.hooks.afterOptimizeChunkAssets.call(this.chunks);
+					this.hooks.optimizeAssets.callAsync(this.assets, err => {
+						if (err) {
+							return callback(err);
+						}
+						this.hooks.afterOptimizeAssets.call(this.assets);
+						if (this.hooks.needAdditionalSeal.call()) {
+							this.unseal();
+							return this.seal(callback);
+						}
+						return this.hooks.afterSeal.callAsync(callback);
+					});
+				});
+			});
+		});
+	}
+
+	/**
+	 * @param {Module[]} modules the modules array on compilation to perform the sort for
+	 * @returns {void}
+	 */
+	sortModules(modules) {
+		// TODO webpack 5: this should only be enabled when `moduleIds: "natural"`
+		// TODO move it into a plugin (NaturalModuleIdsPlugin) and use this in WebpackOptionsApply
+		// TODO remove this method
+		modules.sort(byIndexOrIdentifier);
+	}
+
+	/**
+	 * @param {Module} module moulde to report from
+	 * @param {DependenciesBlock[]} blocks blocks to report from
+	 * @returns {void}
+	 */
+	reportDependencyErrorsAndWarnings(module, blocks) {
+		for (let indexBlock = 0; indexBlock < blocks.length; indexBlock++) {
+			const block = blocks[indexBlock];
+			const dependencies = block.dependencies;
+
+			for (let indexDep = 0; indexDep < dependencies.length; indexDep++) {
+				const d = dependencies[indexDep];
+
+				const warnings = d.getWarnings();
+				if (warnings) {
+					for (let indexWar = 0; indexWar < warnings.length; indexWar++) {
+						const w = warnings[indexWar];
+
+						const warning = new ModuleDependencyWarning(module, w, d.loc);
+						this.warnings.push(warning);
+					}
+				}
+				const errors = d.getErrors();
+				if (errors) {
+					for (let indexErr = 0; indexErr < errors.length; indexErr++) {
+						const e = errors[indexErr];
+
+						const error = new ModuleDependencyError(module, e, d.loc);
+						this.errors.push(error);
+					}
+				}
+			}
+
+			this.reportDependencyErrorsAndWarnings(module, block.blocks);
+		}
+	}
+
+	/**
+	 * @param {TODO} groupOptions options for the chunk group
+	 * @param {Module} module the module the references the chunk group
+	 * @param {DependencyLocation} loc the location from with the chunk group is referenced (inside of module)
+	 * @param {string} request the request from which the the chunk group is referenced
+	 * @returns {ChunkGroup} the new or existing chunk group
+	 */
+	addChunkInGroup(groupOptions, module, loc, request) {
+		if (typeof groupOptions === "string") {
+			groupOptions = { name: groupOptions };
+		}
+		const name = groupOptions.name;
+		if (name) {
+			const chunkGroup = this.namedChunkGroups.get(name);
+			if (chunkGroup !== undefined) {
+				chunkGroup.addOptions(groupOptions);
+				if (module) {
+					chunkGroup.addOrigin(module, loc, request);
+				}
+				return chunkGroup;
+			}
+		}
+		const chunkGroup = new ChunkGroup(groupOptions);
+		if (module) chunkGroup.addOrigin(module, loc, request);
+		const chunk = this.addChunk(name);
+
+		GraphHelpers.connectChunkGroupAndChunk(chunkGroup, chunk);
+
+		this.chunkGroups.push(chunkGroup);
+		if (name) {
+			this.namedChunkGroups.set(name, chunkGroup);
+		}
+		return chunkGroup;
+	}
+
+	/**
+	 * This method first looks to see if a name is provided for a new chunk,
+	 * and first looks to see if any named chunks already exist and reuse that chunk instead.
+	 *
+	 * @param {string=} name optional chunk name to be provided
+	 * @returns {Chunk} create a chunk (invoked during seal event)
+	 */
+	addChunk(name) {
+		if (name) {
+			const chunk = this.namedChunks.get(name);
+			if (chunk !== undefined) {
+				return chunk;
+			}
+		}
+		const chunk = new Chunk(name);
+		this.chunks.push(chunk);
+		if (name) {
+			this.namedChunks.set(name, chunk);
+		}
+		return chunk;
+	}
+
+	/**
+	 * @param {Module} module module to assign depth
+	 * @returns {void}
+	 */
+	assignDepth(module) {
+		const queue = new Set([module]);
+		let depth;
+
+		module.depth = 0;
+
+		/**
+		 * @param {Module} module module for processeing
+		 * @returns {void}
+		 */
+		const enqueueJob = module => {
+			const d = module.depth;
+			if (typeof d === "number" && d <= depth) return;
+			queue.add(module);
+			module.depth = depth;
+		};
+
+		/**
+		 * @param {Dependency} dependency dependency to assign depth to
+		 * @returns {void}
+		 */
+		const assignDepthToDependency = dependency => {
+			if (dependency.module) {
+				enqueueJob(dependency.module);
+			}
+		};
+
+		/**
+		 * @param {DependenciesBlock} block block to assign depth to
+		 * @returns {void}
+		 */
+		const assignDepthToDependencyBlock = block => {
+			if (block.variables) {
+				iterationBlockVariable(block.variables, assignDepthToDependency);
+			}
+
+			if (block.dependencies) {
+				iterationOfArrayCallback(block.dependencies, assignDepthToDependency);
+			}
+
+			if (block.blocks) {
+				iterationOfArrayCallback(block.blocks, assignDepthToDependencyBlock);
+			}
+		};
+
+		for (module of queue) {
+			queue.delete(module);
+			depth = module.depth;
+
+			depth++;
+			assignDepthToDependencyBlock(module);
+		}
+	}
+
+	/**
+	 * @param {Module} module the module containing the dependency
+	 * @param {Dependency} dependency the dependency
+	 * @returns {DependencyReference} a reference for the dependency
+	 */
+	getDependencyReference(module, dependency) {
+		// TODO remove dep.getReference existence check in webpack 5
+		if (typeof dependency.getReference !== "function") return null;
+		const ref = dependency.getReference();
+		if (!ref) return null;
+		return this.hooks.dependencyReference.call(ref, dependency, module);
+	}
+
+	/**
+	 *
+	 * @param {Module} module module relationship for removal
+	 * @param {DependenciesBlockLike} block //TODO: good description
+	 * @returns {void}
+	 */
+	removeReasonsOfDependencyBlock(module, block) {
+		const iteratorDependency = d => {
+			if (!d.module) {
+				return;
+			}
+			if (d.module.removeReason(module, d)) {
+				for (const chunk of d.module.chunksIterable) {
+					this.patchChunksAfterReasonRemoval(d.module, chunk);
+				}
+			}
+		};
+
+		if (block.blocks) {
+			iterationOfArrayCallback(block.blocks, block =>
+				this.removeReasonsOfDependencyBlock(module, block)
+			);
+		}
+
+		if (block.dependencies) {
+			iterationOfArrayCallback(block.dependencies, iteratorDependency);
+		}
+
+		if (block.variables) {
+			iterationBlockVariable(block.variables, iteratorDependency);
+		}
+	}
+
+	/**
+	 * @param {Module} module module to patch tie
+	 * @param {Chunk} chunk chunk to patch tie
+	 * @returns {void}
+	 */
+	patchChunksAfterReasonRemoval(module, chunk) {
+		if (!module.hasReasons()) {
+			this.removeReasonsOfDependencyBlock(module, module);
+		}
+		if (!module.hasReasonForChunk(chunk)) {
+			if (module.removeChunk(chunk)) {
+				this.removeChunkFromDependencies(module, chunk);
+			}
+		}
+	}
+
+	/**
+	 *
+	 * @param {DependenciesBlock} block block tie for Chunk
+	 * @param {Chunk} chunk chunk to remove from dep
+	 * @returns {void}
+	 */
+	removeChunkFromDependencies(block, chunk) {
+		const iteratorDependency = d => {
+			if (!d.module) {
+				return;
+			}
+			this.patchChunksAfterReasonRemoval(d.module, chunk);
+		};
+
+		const blocks = block.blocks;
+		for (let indexBlock = 0; indexBlock < blocks.length; indexBlock++) {
+			const asyncBlock = blocks[indexBlock];
+			// Grab all chunks from the first Block's AsyncDepBlock
+			const chunks = asyncBlock.chunkGroup.chunks;
+			// For each chunk in chunkGroup
+			for (let indexChunk = 0; indexChunk < chunks.length; indexChunk++) {
+				const iteratedChunk = chunks[indexChunk];
+				asyncBlock.chunkGroup.removeChunk(iteratedChunk);
+				asyncBlock.chunkGroup.removeParent(iteratedChunk);
+				// Recurse
+				this.removeChunkFromDependencies(block, iteratedChunk);
+			}
+		}
+
+		if (block.dependencies) {
+			iterationOfArrayCallback(block.dependencies, iteratorDependency);
+		}
+
+		if (block.variables) {
+			iterationBlockVariable(block.variables, iteratorDependency);
+		}
+	}
+
+	applyModuleIds() {
+		const unusedIds = [];
+		let nextFreeModuleId = 0;
+		const usedIds = new Set();
+		if (this.usedModuleIds) {
+			for (const id of this.usedModuleIds) {
+				usedIds.add(id);
+			}
+		}
+
+		const modules1 = this.modules;
+		for (let indexModule1 = 0; indexModule1 < modules1.length; indexModule1++) {
+			const module1 = modules1[indexModule1];
+			if (module1.id !== null) {
+				usedIds.add(module1.id);
+			}
+		}
+
+		if (usedIds.size > 0) {
+			let usedIdMax = -1;
+			for (const usedIdKey of usedIds) {
+				if (typeof usedIdKey !== "number") {
+					continue;
+				}
+
+				usedIdMax = Math.max(usedIdMax, usedIdKey);
+			}
+
+			let lengthFreeModules = (nextFreeModuleId = usedIdMax + 1);
+
+			while (lengthFreeModules--) {
+				if (!usedIds.has(lengthFreeModules)) {
+					unusedIds.push(lengthFreeModules);
+				}
+			}
+		}
+
+		const modules2 = this.modules;
+		for (let indexModule2 = 0; indexModule2 < modules2.length; indexModule2++) {
+			const module2 = modules2[indexModule2];
+			if (module2.id === null) {
+				if (unusedIds.length > 0) {
+					module2.id = unusedIds.pop();
+				} else {
+					module2.id = nextFreeModuleId++;
+				}
+			}
+		}
+	}
+
+	applyChunkIds() {
+		/** @type {Set<number>} */
+		const usedIds = new Set();
+
+		// Get used ids from usedChunkIds property (i. e. from records)
+		if (this.usedChunkIds) {
+			for (const id of this.usedChunkIds) {
+				if (typeof id !== "number") {
+					continue;
+				}
+
+				usedIds.add(id);
+			}
+		}
+
+		// Get used ids from existing chunks
+		const chunks = this.chunks;
+		for (let indexChunk = 0; indexChunk < chunks.length; indexChunk++) {
+			const chunk = chunks[indexChunk];
+			const usedIdValue = chunk.id;
+
+			if (typeof usedIdValue !== "number") {
+				continue;
+			}
+
+			usedIds.add(usedIdValue);
+		}
+
+		// Calculate maximum assigned chunk id
+		let nextFreeChunkId = -1;
+		for (const id of usedIds) {
+			nextFreeChunkId = Math.max(nextFreeChunkId, id);
+		}
+		nextFreeChunkId++;
+
+		// Determine free chunk ids from 0 to maximum
+		/** @type {number[]} */
+		const unusedIds = [];
+		if (nextFreeChunkId > 0) {
+			let index = nextFreeChunkId;
+			while (index--) {
+				if (!usedIds.has(index)) {
+					unusedIds.push(index);
+				}
+			}
+		}
+
+		// Assign ids to chunk which has no id
+		for (let indexChunk = 0; indexChunk < chunks.length; indexChunk++) {
+			const chunk = chunks[indexChunk];
+			if (chunk.id === null) {
+				if (unusedIds.length > 0) {
+					chunk.id = unusedIds.pop();
+				} else {
+					chunk.id = nextFreeChunkId++;
+				}
+			}
+			if (!chunk.ids) {
+				chunk.ids = [chunk.id];
+			}
+		}
+	}
+
+	sortItemsWithModuleIds() {
+		this.modules.sort(byIdOrIdentifier);
+
+		const modules = this.modules;
+		for (let indexModule = 0; indexModule < modules.length; indexModule++) {
+			modules[indexModule].sortItems(false);
+		}
+
+		const chunks = this.chunks;
+		for (let indexChunk = 0; indexChunk < chunks.length; indexChunk++) {
+			chunks[indexChunk].sortItems();
+		}
+
+		chunks.sort((a, b) => a.compareTo(b));
+	}
+
+	sortItemsWithChunkIds() {
+		for (const chunkGroup of this.chunkGroups) {
+			chunkGroup.sortItems();
+		}
+
+		this.chunks.sort(byId);
+
+		for (
+			let indexModule = 0;
+			indexModule < this.modules.length;
+			indexModule++
+		) {
+			this.modules[indexModule].sortItems(true);
+		}
+
+		const chunks = this.chunks;
+		for (let indexChunk = 0; indexChunk < chunks.length; indexChunk++) {
+			chunks[indexChunk].sortItems();
+		}
+
+		/**
+		 * Used to sort errors and warnings in compilation. this.warnings, and
+		 * this.errors contribute to the compilation hash and therefore should be
+		 * updated whenever other references (having a chunk id) are sorted. This preserves the hash
+		 * integrity
+		 *
+		 * @param {WebpackError} a first WebpackError instance (including subclasses)
+		 * @param {WebpackError} b second WebpackError instance (including subclasses)
+		 * @returns {-1|0|1} sort order index
+		 */
+		const byMessage = (a, b) => {
+			const ma = `${a.message}`;
+			const mb = `${b.message}`;
+			if (ma < mb) return -1;
+			if (mb < ma) return 1;
+			return 0;
+		};
+
+		this.errors.sort(byMessage);
+		this.warnings.sort(byMessage);
+		this.children.sort(byNameOrHash);
+	}
+
+	summarizeDependencies() {
+		this.fileDependencies = new SortableSet(this.compilationDependencies);
+		this.contextDependencies = new SortableSet();
+		this.missingDependencies = new SortableSet();
+
+		for (
+			let indexChildren = 0;
+			indexChildren < this.children.length;
+			indexChildren++
+		) {
+			const child = this.children[indexChildren];
+
+			addAllToSet(this.fileDependencies, child.fileDependencies);
+			addAllToSet(this.contextDependencies, child.contextDependencies);
+			addAllToSet(this.missingDependencies, child.missingDependencies);
+		}
+
+		for (
+			let indexModule = 0;
+			indexModule < this.modules.length;
+			indexModule++
+		) {
+			const module = this.modules[indexModule];
+
+			if (module.buildInfo.fileDependencies) {
+				addAllToSet(this.fileDependencies, module.buildInfo.fileDependencies);
+			}
+			if (module.buildInfo.contextDependencies) {
+				addAllToSet(
+					this.contextDependencies,
+					module.buildInfo.contextDependencies
+				);
+			}
+		}
+		for (const error of this.errors) {
+			if (
+				typeof error.missing === "object" &&
+				error.missing &&
+				error.missing[Symbol.iterator]
+			) {
+				addAllToSet(this.missingDependencies, error.missing);
+			}
+		}
+		this.fileDependencies.sort();
+		this.contextDependencies.sort();
+		this.missingDependencies.sort();
+	}
+
+	createHash() {
+		const outputOptions = this.outputOptions;
+		const hashFunction = outputOptions.hashFunction;
+		const hashDigest = outputOptions.hashDigest;
+		const hashDigestLength = outputOptions.hashDigestLength;
+		const hash = createHash(hashFunction);
+		if (outputOptions.hashSalt) {
+			hash.update(outputOptions.hashSalt);
+		}
+		this.mainTemplate.updateHash(hash);
+		this.chunkTemplate.updateHash(hash);
+		for (const key of Object.keys(this.moduleTemplates).sort()) {
+			this.moduleTemplates[key].updateHash(hash);
+		}
+		for (const child of this.children) {
+			hash.update(child.hash);
+		}
+		for (const warning of this.warnings) {
+			hash.update(`${warning.message}`);
+		}
+		for (const error of this.errors) {
+			hash.update(`${error.message}`);
+		}
+		const modules = this.modules;
+		for (let i = 0; i < modules.length; i++) {
+			const module = modules[i];
+			const moduleHash = createHash(hashFunction);
+			module.updateHash(moduleHash);
+			module.hash = /** @type {string} */ (moduleHash.digest(hashDigest));
+			module.renderedHash = module.hash.substr(0, hashDigestLength);
+		}
+		// clone needed as sort below is inplace mutation
+		const chunks = this.chunks.slice();
+		/**
+		 * sort here will bring all "falsy" values to the beginning
+		 * this is needed as the "hasRuntime()" chunks are dependent on the
+		 * hashes of the non-runtime chunks.
+		 */
+		chunks.sort((a, b) => {
+			const aEntry = a.hasRuntime();
+			const bEntry = b.hasRuntime();
+			if (aEntry && !bEntry) return 1;
+			if (!aEntry && bEntry) return -1;
+			return byId(a, b);
+		});
+		for (let i = 0; i < chunks.length; i++) {
+			const chunk = chunks[i];
+			const chunkHash = createHash(hashFunction);
+			try {
+				if (outputOptions.hashSalt) {
+					chunkHash.update(outputOptions.hashSalt);
+				}
+				chunk.updateHash(chunkHash);
+				const template = chunk.hasRuntime()
+					? this.mainTemplate
+					: this.chunkTemplate;
+				template.updateHashForChunk(
+					chunkHash,
+					chunk,
+					this.moduleTemplates.javascript,
+					this.dependencyTemplates
+				);
+				this.hooks.chunkHash.call(chunk, chunkHash);
+				chunk.hash = /** @type {string} */ (chunkHash.digest(hashDigest));
+				hash.update(chunk.hash);
+				chunk.renderedHash = chunk.hash.substr(0, hashDigestLength);
+				this.hooks.contentHash.call(chunk);
+			} catch (err) {
+				this.errors.push(new ChunkRenderError(chunk, "", err));
+			}
+		}
+		this.fullHash = /** @type {string} */ (hash.digest(hashDigest));
+		this.hash = this.fullHash.substr(0, hashDigestLength);
+	}
+
+	/**
+	 * @param {string} update extra information
+	 * @returns {void}
+	 */
+	modifyHash(update) {
+		const outputOptions = this.outputOptions;
+		const hashFunction = outputOptions.hashFunction;
+		const hashDigest = outputOptions.hashDigest;
+		const hashDigestLength = outputOptions.hashDigestLength;
+		const hash = createHash(hashFunction);
+		hash.update(this.fullHash);
+		hash.update(update);
+		this.fullHash = /** @type {string} */ (hash.digest(hashDigest));
+		this.hash = this.fullHash.substr(0, hashDigestLength);
+	}
+
+	/**
+	 * @param {string} file file name
+	 * @param {Source} source asset source
+	 * @param {AssetInfo} assetInfo extra asset information
+	 * @returns {void}
+	 */
+	emitAsset(file, source, assetInfo = {}) {
+		if (this.assets[file]) {
+			if (!isSourceEqual(this.assets[file], source)) {
+				// TODO webpack 5: make this an error instead
+				this.warnings.push(
+					new WebpackError(
+						`Conflict: Multiple assets emit different content to the same filename ${file}`
+					)
+				);
+				this.assets[file] = source;
+				this.assetsInfo.set(file, assetInfo);
+				return;
+			}
+			const oldInfo = this.assetsInfo.get(file);
+			this.assetsInfo.set(file, Object.assign({}, oldInfo, assetInfo));
+			return;
+		}
+		this.assets[file] = source;
+		this.assetsInfo.set(file, assetInfo);
+	}
+
+	/**
+	 * @param {string} file file name
+	 * @param {Source | function(Source): Source} newSourceOrFunction new asset source or function converting old to new
+	 * @param {AssetInfo | function(AssetInfo | undefined): AssetInfo} assetInfoUpdateOrFunction new asset info or function converting old to new
+	 */
+	updateAsset(
+		file,
+		newSourceOrFunction,
+		assetInfoUpdateOrFunction = undefined
+	) {
+		if (!this.assets[file]) {
+			throw new Error(
+				`Called Compilation.updateAsset for not existing filename ${file}`
+			);
+		}
+		if (typeof newSourceOrFunction === "function") {
+			this.assets[file] = newSourceOrFunction(this.assets[file]);
+		} else {
+			this.assets[file] = newSourceOrFunction;
+		}
+		if (assetInfoUpdateOrFunction !== undefined) {
+			const oldInfo = this.assetsInfo.get(file);
+			if (typeof assetInfoUpdateOrFunction === "function") {
+				this.assetsInfo.set(file, assetInfoUpdateOrFunction(oldInfo || {}));
+			} else {
+				this.assetsInfo.set(
+					file,
+					Object.assign({}, oldInfo, assetInfoUpdateOrFunction)
+				);
+			}
+		}
+	}
+
+	getAssets() {
+		/** @type {Asset[]} */
+		const array = [];
+		for (const assetName of Object.keys(this.assets)) {
+			if (Object.prototype.hasOwnProperty.call(this.assets, assetName)) {
+				array.push({
+					name: assetName,
+					source: this.assets[assetName],
+					info: this.assetsInfo.get(assetName) || {}
+				});
+			}
+		}
+		return array;
+	}
+
+	/**
+	 * @param {string} name the name of the asset
+	 * @returns {Asset | undefined} the asset or undefined when not found
+	 */
+	getAsset(name) {
+		if (!Object.prototype.hasOwnProperty.call(this.assets, name))
+			return undefined;
+		return {
+			name,
+			source: this.assets[name],
+			info: this.assetsInfo.get(name) || {}
+		};
+	}
+
+	createModuleAssets() {
+		for (let i = 0; i < this.modules.length; i++) {
+			const module = this.modules[i];
+			if (module.buildInfo.assets) {
+				const assetsInfo = module.buildInfo.assetsInfo;
+				for (const assetName of Object.keys(module.buildInfo.assets)) {
+					const fileName = this.getPath(assetName);
+					this.emitAsset(
+						fileName,
+						module.buildInfo.assets[assetName],
+						assetsInfo ? assetsInfo.get(assetName) : undefined
+					);
+					this.hooks.moduleAsset.call(module, fileName);
+				}
+			}
+		}
+	}
+
+	createChunkAssets() {
+		const outputOptions = this.outputOptions;
+		const cachedSourceMap = new Map();
+		/** @type {Map<string, {hash: string, source: Source, chunk: Chunk}>} */
+		const alreadyWrittenFiles = new Map();
+		for (let i = 0; i < this.chunks.length; i++) {
+			const chunk = this.chunks[i];
+			chunk.files = [];
+			let source;
+			let file;
+			let filenameTemplate;
+			try {
+				const template = chunk.hasRuntime()
+					? this.mainTemplate
+					: this.chunkTemplate;
+				const manifest = template.getRenderManifest({
+					chunk,
+					hash: this.hash,
+					fullHash: this.fullHash,
+					outputOptions,
+					moduleTemplates: this.moduleTemplates,
+					dependencyTemplates: this.dependencyTemplates
+				}); // [{ render(), filenameTemplate, pathOptions, identifier, hash }]
+				for (const fileManifest of manifest) {
+					const cacheName = fileManifest.identifier;
+					const usedHash = fileManifest.hash;
+					filenameTemplate = fileManifest.filenameTemplate;
+					const pathAndInfo = this.getPathWithInfo(
+						filenameTemplate,
+						fileManifest.pathOptions
+					);
+					file = pathAndInfo.path;
+					const assetInfo = pathAndInfo.info;
+
+					// check if the same filename was already written by another chunk
+					const alreadyWritten = alreadyWrittenFiles.get(file);
+					if (alreadyWritten !== undefined) {
+						if (alreadyWritten.hash === usedHash) {
+							if (this.cache) {
+								this.cache[cacheName] = {
+									hash: usedHash,
+									source: alreadyWritten.source
+								};
+							}
+							chunk.files.push(file);
+							this.hooks.chunkAsset.call(chunk, file);
+							continue;
+						} else {
+							throw new Error(
+								`Conflict: Multiple chunks emit assets to the same filename ${file}` +
+									` (chunks ${alreadyWritten.chunk.id} and ${chunk.id})`
+							);
+						}
+					}
+					if (
+						this.cache &&
+						this.cache[cacheName] &&
+						this.cache[cacheName].hash === usedHash
+					) {
+						source = this.cache[cacheName].source;
+					} else {
+						source = fileManifest.render();
+						// Ensure that source is a cached source to avoid additional cost because of repeated access
+						if (!(source instanceof CachedSource)) {
+							const cacheEntry = cachedSourceMap.get(source);
+							if (cacheEntry) {
+								source = cacheEntry;
+							} else {
+								const cachedSource = new CachedSource(source);
+								cachedSourceMap.set(source, cachedSource);
+								source = cachedSource;
+							}
+						}
+						if (this.cache) {
+							this.cache[cacheName] = {
+								hash: usedHash,
+								source
+							};
+						}
+					}
+					this.emitAsset(file, source, assetInfo);
+					chunk.files.push(file);
+					this.hooks.chunkAsset.call(chunk, file);
+					alreadyWrittenFiles.set(file, {
+						hash: usedHash,
+						source,
+						chunk
+					});
+				}
+			} catch (err) {
+				this.errors.push(
+					new ChunkRenderError(chunk, file || filenameTemplate, err)
+				);
+			}
+		}
+	}
+
+	/**
+	 * @param {string} filename used to get asset path with hash
+	 * @param {TODO=} data // TODO: figure out this param type
+	 * @returns {string} interpolated path
+	 */
+	getPath(filename, data) {
+		data = data || {};
+		data.hash = data.hash || this.hash;
+		return this.mainTemplate.getAssetPath(filename, data);
+	}
+
+	/**
+	 * @param {string} filename used to get asset path with hash
+	 * @param {TODO=} data // TODO: figure out this param type
+	 * @returns {{ path: string, info: AssetInfo }} interpolated path and asset info
+	 */
+	getPathWithInfo(filename, data) {
+		data = data || {};
+		data.hash = data.hash || this.hash;
+		return this.mainTemplate.getAssetPathWithInfo(filename, data);
+	}
+
+	/**
+	 * This function allows you to run another instance of webpack inside of webpack however as
+	 * a child with different settings and configurations (if desired) applied. It copies all hooks, plugins
+	 * from parent (or top level compiler) and creates a child Compilation
+	 *
+	 * @param {string} name name of the child compiler
+	 * @param {TODO} outputOptions // Need to convert config schema to types for this
+	 * @param {Plugin[]} plugins webpack plugins that will be applied
+	 * @returns {Compiler} creates a child Compiler instance
+	 */
+	createChildCompiler(name, outputOptions, plugins) {
+		const idx = this.childrenCounters[name] || 0;
+		this.childrenCounters[name] = idx + 1;
+		return this.compiler.createChildCompiler(
+			this,
+			name,
+			idx,
+			outputOptions,
+			plugins
+		);
+	}
+
+	checkConstraints() {
+		/** @type {Set<number|string>} */
+		const usedIds = new Set();
+
+		const modules = this.modules;
+		for (let indexModule = 0; indexModule < modules.length; indexModule++) {
+			const moduleId = modules[indexModule].id;
+			if (moduleId === null) continue;
+			if (usedIds.has(moduleId)) {
+				throw new Error(`checkConstraints: duplicate module id ${moduleId}`);
+			}
+			usedIds.add(moduleId);
+		}
+
+		const chunks = this.chunks;
+		for (let indexChunk = 0; indexChunk < chunks.length; indexChunk++) {
+			const chunk = chunks[indexChunk];
+			if (chunks.indexOf(chunk) !== indexChunk) {
+				throw new Error(
+					`checkConstraints: duplicate chunk in compilation ${chunk.debugId}`
+				);
+			}
+		}
+
+		for (const chunkGroup of this.chunkGroups) {
+			chunkGroup.checkConstraints();
+		}
+	}
+}
+
+// TODO remove in webpack 5
+Compilation.prototype.applyPlugins = util.deprecate(
+	/**
+	 * @deprecated
+	 * @param {string} name Name
+	 * @param {any[]} args Other arguments
+	 * @returns {void}
+	 * @this {Compilation}
+	 */
+	function(name, ...args) {
+		this.hooks[
+			name.replace(/[- ]([a-z])/g, match => match[1].toUpperCase())
+		].call(...args);
+	},
+	"Compilation.applyPlugins is deprecated. Use new API on `.hooks` instead"
+);
+
+// TODO remove in webpack 5
+Object.defineProperty(Compilation.prototype, "moduleTemplate", {
+	configurable: false,
+	get: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {Compilation}
+		 * @returns {TODO} module template
+		 */
+		function() {
+			return this.moduleTemplates.javascript;
+		},
+		"Compilation.moduleTemplate: Use Compilation.moduleTemplates.javascript instead"
+	),
+	set: util.deprecate(
+		/**
+		 * @deprecated
+		 * @param {ModuleTemplate} value Template value
+		 * @this {Compilation}
+		 * @returns {void}
+		 */
+		function(value) {
+			this.moduleTemplates.javascript = value;
+		},
+		"Compilation.moduleTemplate: Use Compilation.moduleTemplates.javascript instead."
+	)
+});
+
+module.exports = Compilation;
diff --git a/node_modules/webpack/lib/Compiler.js b/node_modules/webpack/lib/Compiler.js
new file mode 100644
index 0000000..376aa28
--- /dev/null
+++ b/node_modules/webpack/lib/Compiler.js
@@ -0,0 +1,735 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const parseJson = require("json-parse-better-errors");
+const asyncLib = require("neo-async");
+const path = require("path");
+const { Source } = require("webpack-sources");
+const util = require("util");
+const {
+	Tapable,
+	SyncHook,
+	SyncBailHook,
+	AsyncParallelHook,
+	AsyncSeriesHook
+} = require("tapable");
+
+const Compilation = require("./Compilation");
+const Stats = require("./Stats");
+const Watching = require("./Watching");
+const NormalModuleFactory = require("./NormalModuleFactory");
+const ContextModuleFactory = require("./ContextModuleFactory");
+const ResolverFactory = require("./ResolverFactory");
+
+const RequestShortener = require("./RequestShortener");
+const { makePathsRelative } = require("./util/identifier");
+const ConcurrentCompilationError = require("./ConcurrentCompilationError");
+const { Logger } = require("./logging/Logger");
+
+/** @typedef {import("../declarations/WebpackOptions").Entry} Entry */
+/** @typedef {import("../declarations/WebpackOptions").WebpackOptions} WebpackOptions */
+
+/**
+ * @typedef {Object} CompilationParams
+ * @property {NormalModuleFactory} normalModuleFactory
+ * @property {ContextModuleFactory} contextModuleFactory
+ * @property {Set<string>} compilationDependencies
+ */
+
+class Compiler extends Tapable {
+	constructor(context) {
+		super();
+		this.hooks = {
+			/** @type {SyncBailHook<Compilation>} */
+			shouldEmit: new SyncBailHook(["compilation"]),
+			/** @type {AsyncSeriesHook<Stats>} */
+			done: new AsyncSeriesHook(["stats"]),
+			/** @type {AsyncSeriesHook<>} */
+			additionalPass: new AsyncSeriesHook([]),
+			/** @type {AsyncSeriesHook<Compiler>} */
+			beforeRun: new AsyncSeriesHook(["compiler"]),
+			/** @type {AsyncSeriesHook<Compiler>} */
+			run: new AsyncSeriesHook(["compiler"]),
+			/** @type {AsyncSeriesHook<Compilation>} */
+			emit: new AsyncSeriesHook(["compilation"]),
+			/** @type {AsyncSeriesHook<string, Buffer>} */
+			assetEmitted: new AsyncSeriesHook(["file", "content"]),
+			/** @type {AsyncSeriesHook<Compilation>} */
+			afterEmit: new AsyncSeriesHook(["compilation"]),
+
+			/** @type {SyncHook<Compilation, CompilationParams>} */
+			thisCompilation: new SyncHook(["compilation", "params"]),
+			/** @type {SyncHook<Compilation, CompilationParams>} */
+			compilation: new SyncHook(["compilation", "params"]),
+			/** @type {SyncHook<NormalModuleFactory>} */
+			normalModuleFactory: new SyncHook(["normalModuleFactory"]),
+			/** @type {SyncHook<ContextModuleFactory>}  */
+			contextModuleFactory: new SyncHook(["contextModulefactory"]),
+
+			/** @type {AsyncSeriesHook<CompilationParams>} */
+			beforeCompile: new AsyncSeriesHook(["params"]),
+			/** @type {SyncHook<CompilationParams>} */
+			compile: new SyncHook(["params"]),
+			/** @type {AsyncParallelHook<Compilation>} */
+			make: new AsyncParallelHook(["compilation"]),
+			/** @type {AsyncSeriesHook<Compilation>} */
+			afterCompile: new AsyncSeriesHook(["compilation"]),
+
+			/** @type {AsyncSeriesHook<Compiler>} */
+			watchRun: new AsyncSeriesHook(["compiler"]),
+			/** @type {SyncHook<Error>} */
+			failed: new SyncHook(["error"]),
+			/** @type {SyncHook<string, string>} */
+			invalid: new SyncHook(["filename", "changeTime"]),
+			/** @type {SyncHook} */
+			watchClose: new SyncHook([]),
+
+			/** @type {SyncBailHook<string, string, any[]>} */
+			infrastructureLog: new SyncBailHook(["origin", "type", "args"]),
+
+			// TODO the following hooks are weirdly located here
+			// TODO move them for webpack 5
+			/** @type {SyncHook} */
+			environment: new SyncHook([]),
+			/** @type {SyncHook} */
+			afterEnvironment: new SyncHook([]),
+			/** @type {SyncHook<Compiler>} */
+			afterPlugins: new SyncHook(["compiler"]),
+			/** @type {SyncHook<Compiler>} */
+			afterResolvers: new SyncHook(["compiler"]),
+			/** @type {SyncBailHook<string, Entry>} */
+			entryOption: new SyncBailHook(["context", "entry"])
+		};
+		// TODO webpack 5 remove this
+		this.hooks.infrastructurelog = this.hooks.infrastructureLog;
+
+		this._pluginCompat.tap("Compiler", options => {
+			switch (options.name) {
+				case "additional-pass":
+				case "before-run":
+				case "run":
+				case "emit":
+				case "after-emit":
+				case "before-compile":
+				case "make":
+				case "after-compile":
+				case "watch-run":
+					options.async = true;
+					break;
+			}
+		});
+
+		/** @type {string=} */
+		this.name = undefined;
+		/** @type {Compilation=} */
+		this.parentCompilation = undefined;
+		/** @type {string} */
+		this.outputPath = "";
+
+		this.outputFileSystem = null;
+		this.inputFileSystem = null;
+
+		/** @type {string|null} */
+		this.recordsInputPath = null;
+		/** @type {string|null} */
+		this.recordsOutputPath = null;
+		this.records = {};
+		this.removedFiles = new Set();
+		/** @type {Map<string, number>} */
+		this.fileTimestamps = new Map();
+		/** @type {Map<string, number>} */
+		this.contextTimestamps = new Map();
+		/** @type {ResolverFactory} */
+		this.resolverFactory = new ResolverFactory();
+
+		this.infrastructureLogger = undefined;
+
+		// TODO remove in webpack 5
+		this.resolvers = {
+			normal: {
+				plugins: util.deprecate((hook, fn) => {
+					this.resolverFactory.plugin("resolver normal", resolver => {
+						resolver.plugin(hook, fn);
+					});
+				}, "webpack: Using compiler.resolvers.normal is deprecated.\n" + 'Use compiler.resolverFactory.plugin("resolver normal", resolver => {\n  resolver.plugin(/* … */);\n}); instead.'),
+				apply: util.deprecate((...args) => {
+					this.resolverFactory.plugin("resolver normal", resolver => {
+						resolver.apply(...args);
+					});
+				}, "webpack: Using compiler.resolvers.normal is deprecated.\n" + 'Use compiler.resolverFactory.plugin("resolver normal", resolver => {\n  resolver.apply(/* … */);\n}); instead.')
+			},
+			loader: {
+				plugins: util.deprecate((hook, fn) => {
+					this.resolverFactory.plugin("resolver loader", resolver => {
+						resolver.plugin(hook, fn);
+					});
+				}, "webpack: Using compiler.resolvers.loader is deprecated.\n" + 'Use compiler.resolverFactory.plugin("resolver loader", resolver => {\n  resolver.plugin(/* … */);\n}); instead.'),
+				apply: util.deprecate((...args) => {
+					this.resolverFactory.plugin("resolver loader", resolver => {
+						resolver.apply(...args);
+					});
+				}, "webpack: Using compiler.resolvers.loader is deprecated.\n" + 'Use compiler.resolverFactory.plugin("resolver loader", resolver => {\n  resolver.apply(/* … */);\n}); instead.')
+			},
+			context: {
+				plugins: util.deprecate((hook, fn) => {
+					this.resolverFactory.plugin("resolver context", resolver => {
+						resolver.plugin(hook, fn);
+					});
+				}, "webpack: Using compiler.resolvers.context is deprecated.\n" + 'Use compiler.resolverFactory.plugin("resolver context", resolver => {\n  resolver.plugin(/* … */);\n}); instead.'),
+				apply: util.deprecate((...args) => {
+					this.resolverFactory.plugin("resolver context", resolver => {
+						resolver.apply(...args);
+					});
+				}, "webpack: Using compiler.resolvers.context is deprecated.\n" + 'Use compiler.resolverFactory.plugin("resolver context", resolver => {\n  resolver.apply(/* … */);\n}); instead.')
+			}
+		};
+
+		/** @type {WebpackOptions} */
+		this.options = /** @type {WebpackOptions} */ ({});
+
+		this.context = context;
+
+		this.requestShortener = new RequestShortener(context);
+
+		/** @type {boolean} */
+		this.running = false;
+
+		/** @type {boolean} */
+		this.watchMode = false;
+
+		/** @private @type {WeakMap<Source, { sizeOnlySource: SizeOnlySource, writtenTo: Map<string, number> }>} */
+		this._assetEmittingSourceCache = new WeakMap();
+		/** @private @type {Map<string, number>} */
+		this._assetEmittingWrittenFiles = new Map();
+	}
+
+	/**
+	 * @param {string | (function(): string)} name name of the logger, or function called once to get the logger name
+	 * @returns {Logger} a logger with that name
+	 */
+	getInfrastructureLogger(name) {
+		if (!name) {
+			throw new TypeError(
+				"Compiler.getInfrastructureLogger(name) called without a name"
+			);
+		}
+		return new Logger((type, args) => {
+			if (typeof name === "function") {
+				name = name();
+				if (!name) {
+					throw new TypeError(
+						"Compiler.getInfrastructureLogger(name) called with a function not returning a name"
+					);
+				}
+			}
+			if (this.hooks.infrastructureLog.call(name, type, args) === undefined) {
+				if (this.infrastructureLogger !== undefined) {
+					this.infrastructureLogger(name, type, args);
+				}
+			}
+		});
+	}
+
+	watch(watchOptions, handler) {
+		if (this.running) return handler(new ConcurrentCompilationError());
+
+		this.running = true;
+		this.watchMode = true;
+		this.fileTimestamps = new Map();
+		this.contextTimestamps = new Map();
+		this.removedFiles = new Set();
+		return new Watching(this, watchOptions, handler);
+	}
+
+	run(callback) {
+		if (this.running) return callback(new ConcurrentCompilationError());
+
+		const finalCallback = (err, stats) => {
+			this.running = false;
+
+			if (err) {
+				this.hooks.failed.call(err);
+			}
+
+			if (callback !== undefined) return callback(err, stats);
+		};
+
+		const startTime = Date.now();
+
+		this.running = true;
+
+		const onCompiled = (err, compilation) => {
+			if (err) return finalCallback(err);
+
+			if (this.hooks.shouldEmit.call(compilation) === false) {
+				const stats = new Stats(compilation);
+				stats.startTime = startTime;
+				stats.endTime = Date.now();
+				this.hooks.done.callAsync(stats, err => {
+					if (err) return finalCallback(err);
+					return finalCallback(null, stats);
+				});
+				return;
+			}
+
+			this.emitAssets(compilation, err => {
+				if (err) return finalCallback(err);
+
+				if (compilation.hooks.needAdditionalPass.call()) {
+					compilation.needAdditionalPass = true;
+
+					const stats = new Stats(compilation);
+					stats.startTime = startTime;
+					stats.endTime = Date.now();
+					this.hooks.done.callAsync(stats, err => {
+						if (err) return finalCallback(err);
+
+						this.hooks.additionalPass.callAsync(err => {
+							if (err) return finalCallback(err);
+							this.compile(onCompiled);
+						});
+					});
+					return;
+				}
+
+				this.emitRecords(err => {
+					if (err) return finalCallback(err);
+
+					const stats = new Stats(compilation);
+					stats.startTime = startTime;
+					stats.endTime = Date.now();
+					this.hooks.done.callAsync(stats, err => {
+						if (err) return finalCallback(err);
+						return finalCallback(null, stats);
+					});
+				});
+			});
+		};
+
+		this.hooks.beforeRun.callAsync(this, err => {
+			if (err) return finalCallback(err);
+
+			this.hooks.run.callAsync(this, err => {
+				if (err) return finalCallback(err);
+
+				this.readRecords(err => {
+					if (err) return finalCallback(err);
+
+					this.compile(onCompiled);
+				});
+			});
+		});
+	}
+
+	runAsChild(callback) {
+		this.compile((err, compilation) => {
+			if (err) return callback(err);
+
+			this.parentCompilation.children.push(compilation);
+			for (const { name, source, info } of compilation.getAssets()) {
+				this.parentCompilation.emitAsset(name, source, info);
+			}
+
+			const entries = Array.from(
+				compilation.entrypoints.values(),
+				ep => ep.chunks
+			).reduce((array, chunks) => {
+				return array.concat(chunks);
+			}, []);
+
+			return callback(null, entries, compilation);
+		});
+	}
+
+	purgeInputFileSystem() {
+		if (this.inputFileSystem && this.inputFileSystem.purge) {
+			this.inputFileSystem.purge();
+		}
+	}
+
+	emitAssets(compilation, callback) {
+		let outputPath;
+		const emitFiles = err => {
+			if (err) return callback(err);
+
+			asyncLib.forEachLimit(
+				compilation.getAssets(),
+				15,
+				({ name: file, source }, callback) => {
+					let targetFile = file;
+					const queryStringIdx = targetFile.indexOf("?");
+					if (queryStringIdx >= 0) {
+						targetFile = targetFile.substr(0, queryStringIdx);
+					}
+
+					const writeOut = err => {
+						if (err) return callback(err);
+						const targetPath = this.outputFileSystem.join(
+							outputPath,
+							targetFile
+						);
+						// TODO webpack 5 remove futureEmitAssets option and make it on by default
+						if (this.options.output.futureEmitAssets) {
+							// check if the target file has already been written by this Compiler
+							const targetFileGeneration = this._assetEmittingWrittenFiles.get(
+								targetPath
+							);
+
+							// create an cache entry for this Source if not already existing
+							let cacheEntry = this._assetEmittingSourceCache.get(source);
+							if (cacheEntry === undefined) {
+								cacheEntry = {
+									sizeOnlySource: undefined,
+									writtenTo: new Map()
+								};
+								this._assetEmittingSourceCache.set(source, cacheEntry);
+							}
+
+							// if the target file has already been written
+							if (targetFileGeneration !== undefined) {
+								// check if the Source has been written to this target file
+								const writtenGeneration = cacheEntry.writtenTo.get(targetPath);
+								if (writtenGeneration === targetFileGeneration) {
+									// if yes, we skip writing the file
+									// as it's already there
+									// (we assume one doesn't remove files while the Compiler is running)
+
+									compilation.updateAsset(file, cacheEntry.sizeOnlySource, {
+										size: cacheEntry.sizeOnlySource.size()
+									});
+
+									return callback();
+								}
+							}
+
+							// TODO webpack 5: if info.immutable check if file already exists in output
+							// skip emitting if it's already there
+
+							// get the binary (Buffer) content from the Source
+							/** @type {Buffer} */
+							let content;
+							if (typeof source.buffer === "function") {
+								content = source.buffer();
+							} else {
+								const bufferOrString = source.source();
+								if (Buffer.isBuffer(bufferOrString)) {
+									content = bufferOrString;
+								} else {
+									content = Buffer.from(bufferOrString, "utf8");
+								}
+							}
+
+							// Create a replacement resource which only allows to ask for size
+							// This allows to GC all memory allocated by the Source
+							// (expect when the Source is stored in any other cache)
+							cacheEntry.sizeOnlySource = new SizeOnlySource(content.length);
+							compilation.updateAsset(file, cacheEntry.sizeOnlySource, {
+								size: content.length
+							});
+
+							// Write the file to output file system
+							this.outputFileSystem.writeFile(targetPath, content, err => {
+								if (err) return callback(err);
+
+								// information marker that the asset has been emitted
+								compilation.emittedAssets.add(file);
+
+								// cache the information that the Source has been written to that location
+								const newGeneration =
+									targetFileGeneration === undefined
+										? 1
+										: targetFileGeneration + 1;
+								cacheEntry.writtenTo.set(targetPath, newGeneration);
+								this._assetEmittingWrittenFiles.set(targetPath, newGeneration);
+								this.hooks.assetEmitted.callAsync(file, content, callback);
+							});
+						} else {
+							if (source.existsAt === targetPath) {
+								source.emitted = false;
+								return callback();
+							}
+							let content = source.source();
+
+							if (!Buffer.isBuffer(content)) {
+								content = Buffer.from(content, "utf8");
+							}
+
+							source.existsAt = targetPath;
+							source.emitted = true;
+							this.outputFileSystem.writeFile(targetPath, content, err => {
+								if (err) return callback(err);
+								this.hooks.assetEmitted.callAsync(file, content, callback);
+							});
+						}
+					};
+
+					if (targetFile.match(/\/|\\/)) {
+						const dir = path.dirname(targetFile);
+						this.outputFileSystem.mkdirp(
+							this.outputFileSystem.join(outputPath, dir),
+							writeOut
+						);
+					} else {
+						writeOut();
+					}
+				},
+				err => {
+					if (err) return callback(err);
+
+					this.hooks.afterEmit.callAsync(compilation, err => {
+						if (err) return callback(err);
+
+						return callback();
+					});
+				}
+			);
+		};
+
+		this.hooks.emit.callAsync(compilation, err => {
+			if (err) return callback(err);
+			outputPath = compilation.getPath(this.outputPath);
+			this.outputFileSystem.mkdirp(outputPath, emitFiles);
+		});
+	}
+
+	emitRecords(callback) {
+		if (!this.recordsOutputPath) return callback();
+		const idx1 = this.recordsOutputPath.lastIndexOf("/");
+		const idx2 = this.recordsOutputPath.lastIndexOf("\\");
+		let recordsOutputPathDirectory = null;
+		if (idx1 > idx2) {
+			recordsOutputPathDirectory = this.recordsOutputPath.substr(0, idx1);
+		} else if (idx1 < idx2) {
+			recordsOutputPathDirectory = this.recordsOutputPath.substr(0, idx2);
+		}
+
+		const writeFile = () => {
+			this.outputFileSystem.writeFile(
+				this.recordsOutputPath,
+				JSON.stringify(this.records, undefined, 2),
+				callback
+			);
+		};
+
+		if (!recordsOutputPathDirectory) {
+			return writeFile();
+		}
+		this.outputFileSystem.mkdirp(recordsOutputPathDirectory, err => {
+			if (err) return callback(err);
+			writeFile();
+		});
+	}
+
+	readRecords(callback) {
+		if (!this.recordsInputPath) {
+			this.records = {};
+			return callback();
+		}
+		this.inputFileSystem.stat(this.recordsInputPath, err => {
+			// It doesn't exist
+			// We can ignore this.
+			if (err) return callback();
+
+			this.inputFileSystem.readFile(this.recordsInputPath, (err, content) => {
+				if (err) return callback(err);
+
+				try {
+					this.records = parseJson(content.toString("utf-8"));
+				} catch (e) {
+					e.message = "Cannot parse records: " + e.message;
+					return callback(e);
+				}
+
+				return callback();
+			});
+		});
+	}
+
+	createChildCompiler(
+		compilation,
+		compilerName,
+		compilerIndex,
+		outputOptions,
+		plugins
+	) {
+		const childCompiler = new Compiler(this.context);
+		if (Array.isArray(plugins)) {
+			for (const plugin of plugins) {
+				plugin.apply(childCompiler);
+			}
+		}
+		for (const name in this.hooks) {
+			if (
+				![
+					"make",
+					"compile",
+					"emit",
+					"afterEmit",
+					"invalid",
+					"done",
+					"thisCompilation"
+				].includes(name)
+			) {
+				if (childCompiler.hooks[name]) {
+					childCompiler.hooks[name].taps = this.hooks[name].taps.slice();
+				}
+			}
+		}
+		childCompiler.name = compilerName;
+		childCompiler.outputPath = this.outputPath;
+		childCompiler.inputFileSystem = this.inputFileSystem;
+		childCompiler.outputFileSystem = null;
+		childCompiler.resolverFactory = this.resolverFactory;
+		childCompiler.fileTimestamps = this.fileTimestamps;
+		childCompiler.contextTimestamps = this.contextTimestamps;
+
+		const relativeCompilerName = makePathsRelative(this.context, compilerName);
+		if (!this.records[relativeCompilerName]) {
+			this.records[relativeCompilerName] = [];
+		}
+		if (this.records[relativeCompilerName][compilerIndex]) {
+			childCompiler.records = this.records[relativeCompilerName][compilerIndex];
+		} else {
+			this.records[relativeCompilerName].push((childCompiler.records = {}));
+		}
+
+		childCompiler.options = Object.create(this.options);
+		childCompiler.options.output = Object.create(childCompiler.options.output);
+		for (const name in outputOptions) {
+			childCompiler.options.output[name] = outputOptions[name];
+		}
+		childCompiler.parentCompilation = compilation;
+
+		compilation.hooks.childCompiler.call(
+			childCompiler,
+			compilerName,
+			compilerIndex
+		);
+
+		return childCompiler;
+	}
+
+	isChild() {
+		return !!this.parentCompilation;
+	}
+
+	createCompilation() {
+		return new Compilation(this);
+	}
+
+	newCompilation(params) {
+		const compilation = this.createCompilation();
+		compilation.fileTimestamps = this.fileTimestamps;
+		compilation.contextTimestamps = this.contextTimestamps;
+		compilation.name = this.name;
+		compilation.records = this.records;
+		compilation.compilationDependencies = params.compilationDependencies;
+		this.hooks.thisCompilation.call(compilation, params);
+		this.hooks.compilation.call(compilation, params);
+		return compilation;
+	}
+
+	createNormalModuleFactory() {
+		const normalModuleFactory = new NormalModuleFactory(
+			this.options.context,
+			this.resolverFactory,
+			this.options.module || {}
+		);
+		this.hooks.normalModuleFactory.call(normalModuleFactory);
+		return normalModuleFactory;
+	}
+
+	createContextModuleFactory() {
+		const contextModuleFactory = new ContextModuleFactory(this.resolverFactory);
+		this.hooks.contextModuleFactory.call(contextModuleFactory);
+		return contextModuleFactory;
+	}
+
+	newCompilationParams() {
+		const params = {
+			normalModuleFactory: this.createNormalModuleFactory(),
+			contextModuleFactory: this.createContextModuleFactory(),
+			compilationDependencies: new Set()
+		};
+		return params;
+	}
+
+	compile(callback) {
+		const params = this.newCompilationParams();
+		this.hooks.beforeCompile.callAsync(params, err => {
+			if (err) return callback(err);
+
+			this.hooks.compile.call(params);
+
+			const compilation = this.newCompilation(params);
+
+			this.hooks.make.callAsync(compilation, err => {
+				if (err) return callback(err);
+
+				compilation.finish(err => {
+					if (err) return callback(err);
+
+					compilation.seal(err => {
+						if (err) return callback(err);
+
+						this.hooks.afterCompile.callAsync(compilation, err => {
+							if (err) return callback(err);
+
+							return callback(null, compilation);
+						});
+					});
+				});
+			});
+		});
+	}
+}
+
+module.exports = Compiler;
+
+class SizeOnlySource extends Source {
+	constructor(size) {
+		super();
+		this._size = size;
+	}
+
+	_error() {
+		return new Error(
+			"Content and Map of this Source is no longer available (only size() is supported)"
+		);
+	}
+
+	size() {
+		return this._size;
+	}
+
+	/**
+	 * @param {any} options options
+	 * @returns {string} the source
+	 */
+	source(options) {
+		throw this._error();
+	}
+
+	node() {
+		throw this._error();
+	}
+
+	listMap() {
+		throw this._error();
+	}
+
+	map() {
+		throw this._error();
+	}
+
+	listNode() {
+		throw this._error();
+	}
+
+	updateHash() {
+		throw this._error();
+	}
+}
diff --git a/node_modules/webpack/lib/ConcurrentCompilationError.js b/node_modules/webpack/lib/ConcurrentCompilationError.js
new file mode 100644
index 0000000..3b590e7
--- /dev/null
+++ b/node_modules/webpack/lib/ConcurrentCompilationError.js
@@ -0,0 +1,19 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Maksim Nazarjev @acupofspirt
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+module.exports = class ConcurrentCompilationError extends WebpackError {
+	constructor() {
+		super();
+
+		this.name = "ConcurrentCompilationError";
+		this.message =
+			"You ran Webpack twice. Each instance only supports a single concurrent compilation at a time.";
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/ConstPlugin.js b/node_modules/webpack/lib/ConstPlugin.js
new file mode 100644
index 0000000..6b05720
--- /dev/null
+++ b/node_modules/webpack/lib/ConstPlugin.js
@@ -0,0 +1,348 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ConstDependency = require("./dependencies/ConstDependency");
+const NullFactory = require("./NullFactory");
+const ParserHelpers = require("./ParserHelpers");
+
+const getQuery = request => {
+	const i = request.indexOf("?");
+	return i !== -1 ? request.substr(i) : "";
+};
+
+const collectDeclaration = (declarations, pattern) => {
+	const stack = [pattern];
+	while (stack.length > 0) {
+		const node = stack.pop();
+		switch (node.type) {
+			case "Identifier":
+				declarations.add(node.name);
+				break;
+			case "ArrayPattern":
+				for (const element of node.elements) {
+					if (element) {
+						stack.push(element);
+					}
+				}
+				break;
+			case "AssignmentPattern":
+				stack.push(node.left);
+				break;
+			case "ObjectPattern":
+				for (const property of node.properties) {
+					stack.push(property.value);
+				}
+				break;
+			case "RestElement":
+				stack.push(node.argument);
+				break;
+		}
+	}
+};
+
+const getHoistedDeclarations = (branch, includeFunctionDeclarations) => {
+	const declarations = new Set();
+	const stack = [branch];
+	while (stack.length > 0) {
+		const node = stack.pop();
+		// Some node could be `null` or `undefined`.
+		if (!node) continue;
+		switch (node.type) {
+			// Walk through control statements to look for hoisted declarations.
+			// Some branches are skipped since they do not allow declarations.
+			case "BlockStatement":
+				for (const stmt of node.body) {
+					stack.push(stmt);
+				}
+				break;
+			case "IfStatement":
+				stack.push(node.consequent);
+				stack.push(node.alternate);
+				break;
+			case "ForStatement":
+				stack.push(node.init);
+				stack.push(node.body);
+				break;
+			case "ForInStatement":
+			case "ForOfStatement":
+				stack.push(node.left);
+				stack.push(node.body);
+				break;
+			case "DoWhileStatement":
+			case "WhileStatement":
+			case "LabeledStatement":
+				stack.push(node.body);
+				break;
+			case "SwitchStatement":
+				for (const cs of node.cases) {
+					for (const consequent of cs.consequent) {
+						stack.push(consequent);
+					}
+				}
+				break;
+			case "TryStatement":
+				stack.push(node.block);
+				if (node.handler) {
+					stack.push(node.handler.body);
+				}
+				stack.push(node.finalizer);
+				break;
+			case "FunctionDeclaration":
+				if (includeFunctionDeclarations) {
+					collectDeclaration(declarations, node.id);
+				}
+				break;
+			case "VariableDeclaration":
+				if (node.kind === "var") {
+					for (const decl of node.declarations) {
+						collectDeclaration(declarations, decl.id);
+					}
+				}
+				break;
+		}
+	}
+	return Array.from(declarations);
+};
+
+class ConstPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"ConstPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+
+				const handler = parser => {
+					parser.hooks.statementIf.tap("ConstPlugin", statement => {
+						if (parser.scope.isAsmJs) return;
+						const param = parser.evaluateExpression(statement.test);
+						const bool = param.asBool();
+						if (typeof bool === "boolean") {
+							if (statement.test.type !== "Literal") {
+								const dep = new ConstDependency(`${bool}`, param.range);
+								dep.loc = statement.loc;
+								parser.state.current.addDependency(dep);
+							}
+							const branchToRemove = bool
+								? statement.alternate
+								: statement.consequent;
+							if (branchToRemove) {
+								// Before removing the dead branch, the hoisted declarations
+								// must be collected.
+								//
+								// Given the following code:
+								//
+								//     if (true) f() else g()
+								//     if (false) {
+								//       function f() {}
+								//       const g = function g() {}
+								//       if (someTest) {
+								//         let a = 1
+								//         var x, {y, z} = obj
+								//       }
+								//     } else {
+								//       …
+								//     }
+								//
+								// the generated code is:
+								//
+								//     if (true) f() else {}
+								//     if (false) {
+								//       var f, x, y, z;   (in loose mode)
+								//       var x, y, z;      (in strict mode)
+								//     } else {
+								//       …
+								//     }
+								//
+								// NOTE: When code runs in strict mode, `var` declarations
+								// are hoisted but `function` declarations don't.
+								//
+								let declarations;
+								if (parser.scope.isStrict) {
+									// If the code runs in strict mode, variable declarations
+									// using `var` must be hoisted.
+									declarations = getHoistedDeclarations(branchToRemove, false);
+								} else {
+									// Otherwise, collect all hoisted declaration.
+									declarations = getHoistedDeclarations(branchToRemove, true);
+								}
+								let replacement;
+								if (declarations.length > 0) {
+									replacement = `{ var ${declarations.join(", ")}; }`;
+								} else {
+									replacement = "{}";
+								}
+								const dep = new ConstDependency(
+									replacement,
+									branchToRemove.range
+								);
+								dep.loc = branchToRemove.loc;
+								parser.state.current.addDependency(dep);
+							}
+							return bool;
+						}
+					});
+					parser.hooks.expressionConditionalOperator.tap(
+						"ConstPlugin",
+						expression => {
+							if (parser.scope.isAsmJs) return;
+							const param = parser.evaluateExpression(expression.test);
+							const bool = param.asBool();
+							if (typeof bool === "boolean") {
+								if (expression.test.type !== "Literal") {
+									const dep = new ConstDependency(` ${bool}`, param.range);
+									dep.loc = expression.loc;
+									parser.state.current.addDependency(dep);
+								}
+								// Expressions do not hoist.
+								// It is safe to remove the dead branch.
+								//
+								// Given the following code:
+								//
+								//   false ? someExpression() : otherExpression();
+								//
+								// the generated code is:
+								//
+								//   false ? undefined : otherExpression();
+								//
+								const branchToRemove = bool
+									? expression.alternate
+									: expression.consequent;
+								const dep = new ConstDependency(
+									"undefined",
+									branchToRemove.range
+								);
+								dep.loc = branchToRemove.loc;
+								parser.state.current.addDependency(dep);
+								return bool;
+							}
+						}
+					);
+					parser.hooks.expressionLogicalOperator.tap(
+						"ConstPlugin",
+						expression => {
+							if (parser.scope.isAsmJs) return;
+							if (
+								expression.operator === "&&" ||
+								expression.operator === "||"
+							) {
+								const param = parser.evaluateExpression(expression.left);
+								const bool = param.asBool();
+								if (typeof bool === "boolean") {
+									// Expressions do not hoist.
+									// It is safe to remove the dead branch.
+									//
+									// ------------------------------------------
+									//
+									// Given the following code:
+									//
+									//   falsyExpression() && someExpression();
+									//
+									// the generated code is:
+									//
+									//   falsyExpression() && false;
+									//
+									// ------------------------------------------
+									//
+									// Given the following code:
+									//
+									//   truthyExpression() && someExpression();
+									//
+									// the generated code is:
+									//
+									//   true && someExpression();
+									//
+									// ------------------------------------------
+									//
+									// Given the following code:
+									//
+									//   truthyExpression() || someExpression();
+									//
+									// the generated code is:
+									//
+									//   truthyExpression() || false;
+									//
+									// ------------------------------------------
+									//
+									// Given the following code:
+									//
+									//   falsyExpression() || someExpression();
+									//
+									// the generated code is:
+									//
+									//   false && someExpression();
+									//
+									const keepRight =
+										(expression.operator === "&&" && bool) ||
+										(expression.operator === "||" && !bool);
+
+									if (param.isBoolean() || keepRight) {
+										// for case like
+										//
+										//   return'development'===process.env.NODE_ENV&&'foo'
+										//
+										// we need a space before the bool to prevent result like
+										//
+										//   returnfalse&&'foo'
+										//
+										const dep = new ConstDependency(` ${bool}`, param.range);
+										dep.loc = expression.loc;
+										parser.state.current.addDependency(dep);
+									} else {
+										parser.walkExpression(expression.left);
+									}
+									if (!keepRight) {
+										const dep = new ConstDependency(
+											"false",
+											expression.right.range
+										);
+										dep.loc = expression.loc;
+										parser.state.current.addDependency(dep);
+									}
+									return keepRight;
+								}
+							}
+						}
+					);
+					parser.hooks.evaluateIdentifier
+						.for("__resourceQuery")
+						.tap("ConstPlugin", expr => {
+							if (parser.scope.isAsmJs) return;
+							if (!parser.state.module) return;
+							return ParserHelpers.evaluateToString(
+								getQuery(parser.state.module.resource)
+							)(expr);
+						});
+					parser.hooks.expression
+						.for("__resourceQuery")
+						.tap("ConstPlugin", () => {
+							if (parser.scope.isAsmJs) return;
+							if (!parser.state.module) return;
+							parser.state.current.addVariable(
+								"__resourceQuery",
+								JSON.stringify(getQuery(parser.state.module.resource))
+							);
+							return true;
+						});
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("ConstPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("ConstPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/esm")
+					.tap("ConstPlugin", handler);
+			}
+		);
+	}
+}
+
+module.exports = ConstPlugin;
diff --git a/node_modules/webpack/lib/ContextExclusionPlugin.js b/node_modules/webpack/lib/ContextExclusionPlugin.js
new file mode 100644
index 0000000..0b1dda0
--- /dev/null
+++ b/node_modules/webpack/lib/ContextExclusionPlugin.js
@@ -0,0 +1,28 @@
+"use strict";
+
+/** @typedef {import("./Compiler")} Compiler */
+/** @typedef {import("./ContextModuleFactory")} ContextModuleFactory */
+
+class ContextExclusionPlugin {
+	/**
+	 * @param {RegExp} negativeMatcher Matcher regular expression
+	 */
+	constructor(negativeMatcher) {
+		this.negativeMatcher = negativeMatcher;
+	}
+
+	/**
+	 * Apply the plugin
+	 * @param {Compiler} compiler Webpack Compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.contextModuleFactory.tap("ContextExclusionPlugin", cmf => {
+			cmf.hooks.contextModuleFiles.tap("ContextExclusionPlugin", files => {
+				return files.filter(filePath => !this.negativeMatcher.test(filePath));
+			});
+		});
+	}
+}
+
+module.exports = ContextExclusionPlugin;
diff --git a/node_modules/webpack/lib/ContextModule.js b/node_modules/webpack/lib/ContextModule.js
new file mode 100644
index 0000000..f7fae13
--- /dev/null
+++ b/node_modules/webpack/lib/ContextModule.js
@@ -0,0 +1,872 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const util = require("util");
+const { OriginalSource, RawSource } = require("webpack-sources");
+const Module = require("./Module");
+const AsyncDependenciesBlock = require("./AsyncDependenciesBlock");
+const Template = require("./Template");
+const contextify = require("./util/identifier").contextify;
+
+/** @typedef {"sync" | "eager" | "weak" | "async-weak" | "lazy" | "lazy-once"} ContextMode Context mode */
+/** @typedef {import("./dependencies/ContextElementDependency")} ContextElementDependency */
+
+/**
+ * @callback ResolveDependenciesCallback
+ * @param {Error=} err
+ * @param {ContextElementDependency[]} dependencies
+ */
+
+/**
+ * @callback ResolveDependencies
+ * @param {TODO} fs
+ * @param {TODO} options
+ * @param {ResolveDependenciesCallback} callback
+ */
+
+class ContextModule extends Module {
+	// type ContextMode = "sync" | "eager" | "weak" | "async-weak" | "lazy" | "lazy-once"
+	// type ContextOptions = { resource: string, recursive: boolean, regExp: RegExp, addon?: string, mode?: ContextMode, chunkName?: string, include?: RegExp, exclude?: RegExp, groupOptions?: Object }
+	// resolveDependencies: (fs: FS, options: ContextOptions, (err: Error?, dependencies: Dependency[]) => void) => void
+	// options: ContextOptions
+	/**
+	 * @param {ResolveDependencies} resolveDependencies function to get dependencies in this context
+	 * @param {TODO} options options object
+	 */
+	constructor(resolveDependencies, options) {
+		let resource;
+		let resourceQuery;
+		const queryIdx = options.resource.indexOf("?");
+		if (queryIdx >= 0) {
+			resource = options.resource.substr(0, queryIdx);
+			resourceQuery = options.resource.substr(queryIdx);
+		} else {
+			resource = options.resource;
+			resourceQuery = "";
+		}
+
+		super("javascript/dynamic", resource);
+
+		// Info from Factory
+		this.resolveDependencies = resolveDependencies;
+		this.options = Object.assign({}, options, {
+			resource: resource,
+			resourceQuery: resourceQuery
+		});
+		if (options.resolveOptions !== undefined) {
+			this.resolveOptions = options.resolveOptions;
+		}
+
+		// Info from Build
+		this._contextDependencies = new Set([this.context]);
+
+		if (typeof options.mode !== "string") {
+			throw new Error("options.mode is a required option");
+		}
+
+		this._identifier = this._createIdentifier();
+	}
+
+	updateCacheModule(module) {
+		this.resolveDependencies = module.resolveDependencies;
+		this.options = module.options;
+		this.resolveOptions = module.resolveOptions;
+	}
+
+	prettyRegExp(regexString) {
+		// remove the "/" at the front and the beginning
+		// "/foo/" -> "foo"
+		return regexString.substring(1, regexString.length - 1);
+	}
+
+	_createIdentifier() {
+		let identifier = this.context;
+		if (this.options.resourceQuery) {
+			identifier += ` ${this.options.resourceQuery}`;
+		}
+		if (this.options.mode) {
+			identifier += ` ${this.options.mode}`;
+		}
+		if (!this.options.recursive) {
+			identifier += " nonrecursive";
+		}
+		if (this.options.addon) {
+			identifier += ` ${this.options.addon}`;
+		}
+		if (this.options.regExp) {
+			identifier += ` ${this.options.regExp}`;
+		}
+		if (this.options.include) {
+			identifier += ` include: ${this.options.include}`;
+		}
+		if (this.options.exclude) {
+			identifier += ` exclude: ${this.options.exclude}`;
+		}
+		if (this.options.groupOptions) {
+			identifier += ` groupOptions: ${JSON.stringify(
+				this.options.groupOptions
+			)}`;
+		}
+		if (this.options.namespaceObject === "strict") {
+			identifier += " strict namespace object";
+		} else if (this.options.namespaceObject) {
+			identifier += " namespace object";
+		}
+
+		return identifier;
+	}
+
+	identifier() {
+		return this._identifier;
+	}
+
+	readableIdentifier(requestShortener) {
+		let identifier = requestShortener.shorten(this.context);
+		if (this.options.resourceQuery) {
+			identifier += ` ${this.options.resourceQuery}`;
+		}
+		if (this.options.mode) {
+			identifier += ` ${this.options.mode}`;
+		}
+		if (!this.options.recursive) {
+			identifier += " nonrecursive";
+		}
+		if (this.options.addon) {
+			identifier += ` ${requestShortener.shorten(this.options.addon)}`;
+		}
+		if (this.options.regExp) {
+			identifier += ` ${this.prettyRegExp(this.options.regExp + "")}`;
+		}
+		if (this.options.include) {
+			identifier += ` include: ${this.prettyRegExp(this.options.include + "")}`;
+		}
+		if (this.options.exclude) {
+			identifier += ` exclude: ${this.prettyRegExp(this.options.exclude + "")}`;
+		}
+		if (this.options.groupOptions) {
+			const groupOptions = this.options.groupOptions;
+			for (const key of Object.keys(groupOptions)) {
+				identifier += ` ${key}: ${groupOptions[key]}`;
+			}
+		}
+		if (this.options.namespaceObject === "strict") {
+			identifier += " strict namespace object";
+		} else if (this.options.namespaceObject) {
+			identifier += " namespace object";
+		}
+
+		return identifier;
+	}
+
+	libIdent(options) {
+		let identifier = contextify(options.context, this.context);
+		if (this.options.mode) {
+			identifier += ` ${this.options.mode}`;
+		}
+		if (this.options.recursive) {
+			identifier += " recursive";
+		}
+		if (this.options.addon) {
+			identifier += ` ${contextify(options.context, this.options.addon)}`;
+		}
+		if (this.options.regExp) {
+			identifier += ` ${this.prettyRegExp(this.options.regExp + "")}`;
+		}
+		if (this.options.include) {
+			identifier += ` include: ${this.prettyRegExp(this.options.include + "")}`;
+		}
+		if (this.options.exclude) {
+			identifier += ` exclude: ${this.prettyRegExp(this.options.exclude + "")}`;
+		}
+
+		return identifier;
+	}
+
+	needRebuild(fileTimestamps, contextTimestamps) {
+		const ts = contextTimestamps.get(this.context);
+		if (!ts) {
+			return true;
+		}
+
+		return ts >= this.buildInfo.builtTime;
+	}
+
+	build(options, compilation, resolver, fs, callback) {
+		this.built = true;
+		this.buildMeta = {};
+		this.buildInfo = {
+			builtTime: Date.now(),
+			contextDependencies: this._contextDependencies
+		};
+		this.resolveDependencies(fs, this.options, (err, dependencies) => {
+			if (err) return callback(err);
+
+			// abort if something failed
+			// this will create an empty context
+			if (!dependencies) {
+				callback();
+				return;
+			}
+
+			// enhance dependencies with meta info
+			for (const dep of dependencies) {
+				dep.loc = {
+					name: dep.userRequest
+				};
+				dep.request = this.options.addon + dep.request;
+			}
+
+			if (this.options.mode === "sync" || this.options.mode === "eager") {
+				// if we have an sync or eager context
+				// just add all dependencies and continue
+				this.dependencies = dependencies;
+			} else if (this.options.mode === "lazy-once") {
+				// for the lazy-once mode create a new async dependency block
+				// and add that block to this context
+				if (dependencies.length > 0) {
+					const block = new AsyncDependenciesBlock(
+						Object.assign({}, this.options.groupOptions, {
+							name: this.options.chunkName
+						}),
+						this
+					);
+					for (const dep of dependencies) {
+						block.addDependency(dep);
+					}
+					this.addBlock(block);
+				}
+			} else if (
+				this.options.mode === "weak" ||
+				this.options.mode === "async-weak"
+			) {
+				// we mark all dependencies as weak
+				for (const dep of dependencies) {
+					dep.weak = true;
+				}
+				this.dependencies = dependencies;
+			} else if (this.options.mode === "lazy") {
+				// if we are lazy create a new async dependency block per dependency
+				// and add all blocks to this context
+				let index = 0;
+				for (const dep of dependencies) {
+					let chunkName = this.options.chunkName;
+					if (chunkName) {
+						if (!/\[(index|request)\]/.test(chunkName)) {
+							chunkName += "[index]";
+						}
+						chunkName = chunkName.replace(/\[index\]/g, index++);
+						chunkName = chunkName.replace(
+							/\[request\]/g,
+							Template.toPath(dep.userRequest)
+						);
+					}
+					const block = new AsyncDependenciesBlock(
+						Object.assign({}, this.options.groupOptions, {
+							name: chunkName
+						}),
+						dep.module,
+						dep.loc,
+						dep.userRequest
+					);
+					block.addDependency(dep);
+					this.addBlock(block);
+				}
+			} else {
+				callback(
+					new Error(`Unsupported mode "${this.options.mode}" in context`)
+				);
+				return;
+			}
+			callback();
+		});
+	}
+
+	getUserRequestMap(dependencies) {
+		// if we filter first we get a new array
+		// therefor we dont need to create a clone of dependencies explicitly
+		// therefore the order of this is !important!
+		return dependencies
+			.filter(dependency => dependency.module)
+			.sort((a, b) => {
+				if (a.userRequest === b.userRequest) {
+					return 0;
+				}
+				return a.userRequest < b.userRequest ? -1 : 1;
+			})
+			.reduce((map, dep) => {
+				map[dep.userRequest] = dep.module.id;
+				return map;
+			}, Object.create(null));
+	}
+
+	getFakeMap(dependencies) {
+		if (!this.options.namespaceObject) {
+			return 9;
+		}
+		// if we filter first we get a new array
+		// therefor we dont need to create a clone of dependencies explicitly
+		// therefore the order of this is !important!
+		let hasNonHarmony = false;
+		let hasNamespace = false;
+		let hasNamed = false;
+		const fakeMap = dependencies
+			.filter(dependency => dependency.module)
+			.sort((a, b) => {
+				return b.module.id - a.module.id;
+			})
+			.reduce((map, dep) => {
+				const exportsType =
+					dep.module.buildMeta && dep.module.buildMeta.exportsType;
+				const id = dep.module.id;
+				if (!exportsType) {
+					map[id] = this.options.namespaceObject === "strict" ? 1 : 7;
+					hasNonHarmony = true;
+				} else if (exportsType === "namespace") {
+					map[id] = 9;
+					hasNamespace = true;
+				} else if (exportsType === "named") {
+					map[id] = 3;
+					hasNamed = true;
+				}
+				return map;
+			}, Object.create(null));
+		if (!hasNamespace && hasNonHarmony && !hasNamed) {
+			return this.options.namespaceObject === "strict" ? 1 : 7;
+		}
+		if (hasNamespace && !hasNonHarmony && !hasNamed) {
+			return 9;
+		}
+		if (!hasNamespace && !hasNonHarmony && hasNamed) {
+			return 3;
+		}
+		if (!hasNamespace && !hasNonHarmony && !hasNamed) {
+			return 9;
+		}
+		return fakeMap;
+	}
+
+	getFakeMapInitStatement(fakeMap) {
+		return typeof fakeMap === "object"
+			? `var fakeMap = ${JSON.stringify(fakeMap, null, "\t")};`
+			: "";
+	}
+
+	getReturn(type) {
+		if (type === 9) {
+			return "__webpack_require__(id)";
+		}
+		return `__webpack_require__.t(id, ${type})`;
+	}
+
+	getReturnModuleObjectSource(fakeMap, fakeMapDataExpression = "fakeMap[id]") {
+		if (typeof fakeMap === "number") {
+			return `return ${this.getReturn(fakeMap)};`;
+		}
+		return `return __webpack_require__.t(id, ${fakeMapDataExpression})`;
+	}
+
+	getSyncSource(dependencies, id) {
+		const map = this.getUserRequestMap(dependencies);
+		const fakeMap = this.getFakeMap(dependencies);
+		const returnModuleObject = this.getReturnModuleObjectSource(fakeMap);
+
+		return `var map = ${JSON.stringify(map, null, "\t")};
+${this.getFakeMapInitStatement(fakeMap)}
+
+function webpackContext(req) {
+	var id = webpackContextResolve(req);
+	${returnModuleObject}
+}
+function webpackContextResolve(req) {
+	if(!__webpack_require__.o(map, req)) {
+		var e = new Error("Cannot find module '" + req + "'");
+		e.code = 'MODULE_NOT_FOUND';
+		throw e;
+	}
+	return map[req];
+}
+webpackContext.keys = function webpackContextKeys() {
+	return Object.keys(map);
+};
+webpackContext.resolve = webpackContextResolve;
+module.exports = webpackContext;
+webpackContext.id = ${JSON.stringify(id)};`;
+	}
+
+	getWeakSyncSource(dependencies, id) {
+		const map = this.getUserRequestMap(dependencies);
+		const fakeMap = this.getFakeMap(dependencies);
+		const returnModuleObject = this.getReturnModuleObjectSource(fakeMap);
+
+		return `var map = ${JSON.stringify(map, null, "\t")};
+${this.getFakeMapInitStatement(fakeMap)}
+
+function webpackContext(req) {
+	var id = webpackContextResolve(req);
+	if(!__webpack_require__.m[id]) {
+		var e = new Error("Module '" + req + "' ('" + id + "') is not available (weak dependency)");
+		e.code = 'MODULE_NOT_FOUND';
+		throw e;
+	}
+	${returnModuleObject}
+}
+function webpackContextResolve(req) {
+	if(!__webpack_require__.o(map, req)) {
+		var e = new Error("Cannot find module '" + req + "'");
+		e.code = 'MODULE_NOT_FOUND';
+		throw e;
+	}
+	return map[req];
+}
+webpackContext.keys = function webpackContextKeys() {
+	return Object.keys(map);
+};
+webpackContext.resolve = webpackContextResolve;
+webpackContext.id = ${JSON.stringify(id)};
+module.exports = webpackContext;`;
+	}
+
+	getAsyncWeakSource(dependencies, id) {
+		const map = this.getUserRequestMap(dependencies);
+		const fakeMap = this.getFakeMap(dependencies);
+		const returnModuleObject = this.getReturnModuleObjectSource(fakeMap);
+
+		return `var map = ${JSON.stringify(map, null, "\t")};
+${this.getFakeMapInitStatement(fakeMap)}
+
+function webpackAsyncContext(req) {
+	return webpackAsyncContextResolve(req).then(function(id) {
+		if(!__webpack_require__.m[id]) {
+			var e = new Error("Module '" + req + "' ('" + id + "') is not available (weak dependency)");
+			e.code = 'MODULE_NOT_FOUND';
+			throw e;
+		}
+		${returnModuleObject}
+	});
+}
+function webpackAsyncContextResolve(req) {
+	// Here Promise.resolve().then() is used instead of new Promise() to prevent
+	// uncaught exception popping up in devtools
+	return Promise.resolve().then(function() {
+		if(!__webpack_require__.o(map, req)) {
+			var e = new Error("Cannot find module '" + req + "'");
+			e.code = 'MODULE_NOT_FOUND';
+			throw e;
+		}
+		return map[req];
+	});
+}
+webpackAsyncContext.keys = function webpackAsyncContextKeys() {
+	return Object.keys(map);
+};
+webpackAsyncContext.resolve = webpackAsyncContextResolve;
+webpackAsyncContext.id = ${JSON.stringify(id)};
+module.exports = webpackAsyncContext;`;
+	}
+
+	getEagerSource(dependencies, id) {
+		const map = this.getUserRequestMap(dependencies);
+		const fakeMap = this.getFakeMap(dependencies);
+		const thenFunction =
+			fakeMap !== 9
+				? `function(id) {
+		${this.getReturnModuleObjectSource(fakeMap)}
+	}`
+				: "__webpack_require__";
+		return `var map = ${JSON.stringify(map, null, "\t")};
+${this.getFakeMapInitStatement(fakeMap)}
+
+function webpackAsyncContext(req) {
+	return webpackAsyncContextResolve(req).then(${thenFunction});
+}
+function webpackAsyncContextResolve(req) {
+	// Here Promise.resolve().then() is used instead of new Promise() to prevent
+	// uncaught exception popping up in devtools
+	return Promise.resolve().then(function() {
+		if(!__webpack_require__.o(map, req)) {
+			var e = new Error("Cannot find module '" + req + "'");
+			e.code = 'MODULE_NOT_FOUND';
+			throw e;
+		}
+		return map[req];
+	});
+}
+webpackAsyncContext.keys = function webpackAsyncContextKeys() {
+	return Object.keys(map);
+};
+webpackAsyncContext.resolve = webpackAsyncContextResolve;
+webpackAsyncContext.id = ${JSON.stringify(id)};
+module.exports = webpackAsyncContext;`;
+	}
+
+	getLazyOnceSource(block, dependencies, id, runtimeTemplate) {
+		const promise = runtimeTemplate.blockPromise({
+			block,
+			message: "lazy-once context"
+		});
+		const map = this.getUserRequestMap(dependencies);
+		const fakeMap = this.getFakeMap(dependencies);
+		const thenFunction =
+			fakeMap !== 9
+				? `function(id) {
+		${this.getReturnModuleObjectSource(fakeMap)};
+	}`
+				: "__webpack_require__";
+
+		return `var map = ${JSON.stringify(map, null, "\t")};
+${this.getFakeMapInitStatement(fakeMap)}
+
+function webpackAsyncContext(req) {
+	return webpackAsyncContextResolve(req).then(${thenFunction});
+}
+function webpackAsyncContextResolve(req) {
+	return ${promise}.then(function() {
+		if(!__webpack_require__.o(map, req)) {
+			var e = new Error("Cannot find module '" + req + "'");
+			e.code = 'MODULE_NOT_FOUND';
+			throw e;
+		}
+		return map[req];
+	});
+}
+webpackAsyncContext.keys = function webpackAsyncContextKeys() {
+	return Object.keys(map);
+};
+webpackAsyncContext.resolve = webpackAsyncContextResolve;
+webpackAsyncContext.id = ${JSON.stringify(id)};
+module.exports = webpackAsyncContext;`;
+	}
+
+	getLazySource(blocks, id) {
+		let hasMultipleOrNoChunks = false;
+		let hasNoChunk = true;
+		const fakeMap = this.getFakeMap(blocks.map(b => b.dependencies[0]));
+		const hasFakeMap = typeof fakeMap === "object";
+		const map = blocks
+			.filter(block => block.dependencies[0].module)
+			.map(block => {
+				const chunks = block.chunkGroup ? block.chunkGroup.chunks : [];
+				if (chunks.length > 0) {
+					hasNoChunk = false;
+				}
+				if (chunks.length !== 1) {
+					hasMultipleOrNoChunks = true;
+				}
+				return {
+					dependency: block.dependencies[0],
+					block: block,
+					userRequest: block.dependencies[0].userRequest,
+					chunks
+				};
+			})
+			.sort((a, b) => {
+				if (a.userRequest === b.userRequest) return 0;
+				return a.userRequest < b.userRequest ? -1 : 1;
+			})
+			.reduce((map, item) => {
+				const chunks = item.chunks;
+
+				if (hasNoChunk && !hasFakeMap) {
+					map[item.userRequest] = item.dependency.module.id;
+				} else {
+					const arrayStart = [item.dependency.module.id];
+					if (typeof fakeMap === "object") {
+						arrayStart.push(fakeMap[item.dependency.module.id]);
+					}
+					map[item.userRequest] = arrayStart.concat(
+						chunks.map(chunk => chunk.id)
+					);
+				}
+
+				return map;
+			}, Object.create(null));
+
+		const shortMode = hasNoChunk && !hasFakeMap;
+		const chunksStartPosition = hasFakeMap ? 2 : 1;
+		const requestPrefix = hasNoChunk
+			? "Promise.resolve()"
+			: hasMultipleOrNoChunks
+			? `Promise.all(ids.slice(${chunksStartPosition}).map(__webpack_require__.e))`
+			: `__webpack_require__.e(ids[${chunksStartPosition}])`;
+		const returnModuleObject = this.getReturnModuleObjectSource(
+			fakeMap,
+			shortMode ? "invalid" : "ids[1]"
+		);
+
+		const webpackAsyncContext =
+			requestPrefix === "Promise.resolve()"
+				? `${shortMode ? "" : ""}
+function webpackAsyncContext(req) {
+	return Promise.resolve().then(function() {
+		if(!__webpack_require__.o(map, req)) {
+			var e = new Error("Cannot find module '" + req + "'");
+			e.code = 'MODULE_NOT_FOUND';
+			throw e;
+		}
+
+		${shortMode ? "var id = map[req];" : "var ids = map[req], id = ids[0];"}
+		${returnModuleObject}
+	});
+}`
+				: `function webpackAsyncContext(req) {
+	if(!__webpack_require__.o(map, req)) {
+		return Promise.resolve().then(function() {
+			var e = new Error("Cannot find module '" + req + "'");
+			e.code = 'MODULE_NOT_FOUND';
+			throw e;
+		});
+	}
+
+	var ids = map[req], id = ids[0];
+	return ${requestPrefix}.then(function() {
+		${returnModuleObject}
+	});
+}`;
+
+		return `var map = ${JSON.stringify(map, null, "\t")};
+${webpackAsyncContext}
+webpackAsyncContext.keys = function webpackAsyncContextKeys() {
+	return Object.keys(map);
+};
+webpackAsyncContext.id = ${JSON.stringify(id)};
+module.exports = webpackAsyncContext;`;
+	}
+
+	getSourceForEmptyContext(id) {
+		return `function webpackEmptyContext(req) {
+	var e = new Error("Cannot find module '" + req + "'");
+	e.code = 'MODULE_NOT_FOUND';
+	throw e;
+}
+webpackEmptyContext.keys = function() { return []; };
+webpackEmptyContext.resolve = webpackEmptyContext;
+module.exports = webpackEmptyContext;
+webpackEmptyContext.id = ${JSON.stringify(id)};`;
+	}
+
+	getSourceForEmptyAsyncContext(id) {
+		return `function webpackEmptyAsyncContext(req) {
+	// Here Promise.resolve().then() is used instead of new Promise() to prevent
+	// uncaught exception popping up in devtools
+	return Promise.resolve().then(function() {
+		var e = new Error("Cannot find module '" + req + "'");
+		e.code = 'MODULE_NOT_FOUND';
+		throw e;
+	});
+}
+webpackEmptyAsyncContext.keys = function() { return []; };
+webpackEmptyAsyncContext.resolve = webpackEmptyAsyncContext;
+module.exports = webpackEmptyAsyncContext;
+webpackEmptyAsyncContext.id = ${JSON.stringify(id)};`;
+	}
+
+	getSourceString(asyncMode, runtimeTemplate) {
+		if (asyncMode === "lazy") {
+			if (this.blocks && this.blocks.length > 0) {
+				return this.getLazySource(this.blocks, this.id);
+			}
+			return this.getSourceForEmptyAsyncContext(this.id);
+		}
+		if (asyncMode === "eager") {
+			if (this.dependencies && this.dependencies.length > 0) {
+				return this.getEagerSource(this.dependencies, this.id);
+			}
+			return this.getSourceForEmptyAsyncContext(this.id);
+		}
+		if (asyncMode === "lazy-once") {
+			const block = this.blocks[0];
+			if (block) {
+				return this.getLazyOnceSource(
+					block,
+					block.dependencies,
+					this.id,
+					runtimeTemplate
+				);
+			}
+			return this.getSourceForEmptyAsyncContext(this.id);
+		}
+		if (asyncMode === "async-weak") {
+			if (this.dependencies && this.dependencies.length > 0) {
+				return this.getAsyncWeakSource(this.dependencies, this.id);
+			}
+			return this.getSourceForEmptyAsyncContext(this.id);
+		}
+		if (asyncMode === "weak") {
+			if (this.dependencies && this.dependencies.length > 0) {
+				return this.getWeakSyncSource(this.dependencies, this.id);
+			}
+		}
+		if (this.dependencies && this.dependencies.length > 0) {
+			return this.getSyncSource(this.dependencies, this.id);
+		}
+		return this.getSourceForEmptyContext(this.id);
+	}
+
+	getSource(sourceString) {
+		if (this.useSourceMap) {
+			return new OriginalSource(sourceString, this.identifier());
+		}
+		return new RawSource(sourceString);
+	}
+
+	source(dependencyTemplates, runtimeTemplate) {
+		return this.getSource(
+			this.getSourceString(this.options.mode, runtimeTemplate)
+		);
+	}
+
+	size() {
+		// base penalty
+		const initialSize = 160;
+
+		// if we dont have dependencies we stop here.
+		return this.dependencies.reduce((size, dependency) => {
+			const element = /** @type {ContextElementDependency} */ (dependency);
+			return size + 5 + element.userRequest.length;
+		}, initialSize);
+	}
+}
+
+// TODO remove in webpack 5
+Object.defineProperty(ContextModule.prototype, "recursive", {
+	configurable: false,
+	get: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @returns {boolean} is recursive
+		 */
+		function() {
+			return this.options.recursive;
+		},
+		"ContextModule.recursive has been moved to ContextModule.options.recursive"
+	),
+	set: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @param {boolean} value is recursive
+		 * @returns {void}
+		 */
+		function(value) {
+			this.options.recursive = value;
+		},
+		"ContextModule.recursive has been moved to ContextModule.options.recursive"
+	)
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(ContextModule.prototype, "regExp", {
+	configurable: false,
+	get: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @returns {RegExp} regular expression
+		 */
+		function() {
+			return this.options.regExp;
+		},
+		"ContextModule.regExp has been moved to ContextModule.options.regExp"
+	),
+	set: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @param {RegExp} value Regular expression
+		 * @returns {void}
+		 */
+		function(value) {
+			this.options.regExp = value;
+		},
+		"ContextModule.regExp has been moved to ContextModule.options.regExp"
+	)
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(ContextModule.prototype, "addon", {
+	configurable: false,
+	get: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @returns {string} addon
+		 */
+		function() {
+			return this.options.addon;
+		},
+		"ContextModule.addon has been moved to ContextModule.options.addon"
+	),
+	set: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @param {string} value addon
+		 * @returns {void}
+		 */
+		function(value) {
+			this.options.addon = value;
+		},
+		"ContextModule.addon has been moved to ContextModule.options.addon"
+	)
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(ContextModule.prototype, "async", {
+	configurable: false,
+	get: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @returns {boolean} is async
+		 */
+		function() {
+			return this.options.mode;
+		},
+		"ContextModule.async has been moved to ContextModule.options.mode"
+	),
+	set: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @param {ContextMode} value Context mode
+		 * @returns {void}
+		 */
+		function(value) {
+			this.options.mode = value;
+		},
+		"ContextModule.async has been moved to ContextModule.options.mode"
+	)
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(ContextModule.prototype, "chunkName", {
+	configurable: false,
+	get: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @returns {string} chunk name
+		 */
+		function() {
+			return this.options.chunkName;
+		},
+		"ContextModule.chunkName has been moved to ContextModule.options.chunkName"
+	),
+	set: util.deprecate(
+		/**
+		 * @deprecated
+		 * @this {ContextModule}
+		 * @param {string} value chunk name
+		 * @returns {void}
+		 */
+		function(value) {
+			this.options.chunkName = value;
+		},
+		"ContextModule.chunkName has been moved to ContextModule.options.chunkName"
+	)
+});
+
+module.exports = ContextModule;
diff --git a/node_modules/webpack/lib/ContextModuleFactory.js b/node_modules/webpack/lib/ContextModuleFactory.js
new file mode 100644
index 0000000..f594112
--- /dev/null
+++ b/node_modules/webpack/lib/ContextModuleFactory.js
@@ -0,0 +1,262 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const asyncLib = require("neo-async");
+const path = require("path");
+
+const {
+	Tapable,
+	AsyncSeriesWaterfallHook,
+	SyncWaterfallHook
+} = require("tapable");
+const ContextModule = require("./ContextModule");
+const ContextElementDependency = require("./dependencies/ContextElementDependency");
+
+/** @typedef {import("./Module")} Module */
+
+const EMPTY_RESOLVE_OPTIONS = {};
+
+module.exports = class ContextModuleFactory extends Tapable {
+	constructor(resolverFactory) {
+		super();
+		this.hooks = {
+			/** @type {AsyncSeriesWaterfallHook<TODO>} */
+			beforeResolve: new AsyncSeriesWaterfallHook(["data"]),
+			/** @type {AsyncSeriesWaterfallHook<TODO>} */
+			afterResolve: new AsyncSeriesWaterfallHook(["data"]),
+			/** @type {SyncWaterfallHook<string[]>} */
+			contextModuleFiles: new SyncWaterfallHook(["files"]),
+			/** @type {SyncWaterfallHook<TODO[]>} */
+			alternatives: new AsyncSeriesWaterfallHook(["modules"])
+		};
+		this._pluginCompat.tap("ContextModuleFactory", options => {
+			switch (options.name) {
+				case "before-resolve":
+				case "after-resolve":
+				case "alternatives":
+					options.async = true;
+					break;
+			}
+		});
+		this.resolverFactory = resolverFactory;
+	}
+
+	create(data, callback) {
+		const context = data.context;
+		const dependencies = data.dependencies;
+		const resolveOptions = data.resolveOptions;
+		const dependency = dependencies[0];
+		this.hooks.beforeResolve.callAsync(
+			Object.assign(
+				{
+					context: context,
+					dependencies: dependencies,
+					resolveOptions
+				},
+				dependency.options
+			),
+			(err, beforeResolveResult) => {
+				if (err) return callback(err);
+
+				// Ignored
+				if (!beforeResolveResult) return callback();
+
+				const context = beforeResolveResult.context;
+				const request = beforeResolveResult.request;
+				const resolveOptions = beforeResolveResult.resolveOptions;
+
+				let loaders,
+					resource,
+					loadersPrefix = "";
+				const idx = request.lastIndexOf("!");
+				if (idx >= 0) {
+					let loadersRequest = request.substr(0, idx + 1);
+					let i;
+					for (
+						i = 0;
+						i < loadersRequest.length && loadersRequest[i] === "!";
+						i++
+					) {
+						loadersPrefix += "!";
+					}
+					loadersRequest = loadersRequest
+						.substr(i)
+						.replace(/!+$/, "")
+						.replace(/!!+/g, "!");
+					if (loadersRequest === "") {
+						loaders = [];
+					} else {
+						loaders = loadersRequest.split("!");
+					}
+					resource = request.substr(idx + 1);
+				} else {
+					loaders = [];
+					resource = request;
+				}
+
+				const contextResolver = this.resolverFactory.get(
+					"context",
+					resolveOptions || EMPTY_RESOLVE_OPTIONS
+				);
+				const loaderResolver = this.resolverFactory.get(
+					"loader",
+					EMPTY_RESOLVE_OPTIONS
+				);
+
+				asyncLib.parallel(
+					[
+						callback => {
+							contextResolver.resolve(
+								{},
+								context,
+								resource,
+								{},
+								(err, result) => {
+									if (err) return callback(err);
+									callback(null, result);
+								}
+							);
+						},
+						callback => {
+							asyncLib.map(
+								loaders,
+								(loader, callback) => {
+									loaderResolver.resolve(
+										{},
+										context,
+										loader,
+										{},
+										(err, result) => {
+											if (err) return callback(err);
+											callback(null, result);
+										}
+									);
+								},
+								callback
+							);
+						}
+					],
+					(err, result) => {
+						if (err) return callback(err);
+
+						this.hooks.afterResolve.callAsync(
+							Object.assign(
+								{
+									addon:
+										loadersPrefix +
+										result[1].join("!") +
+										(result[1].length > 0 ? "!" : ""),
+									resource: result[0],
+									resolveDependencies: this.resolveDependencies.bind(this)
+								},
+								beforeResolveResult
+							),
+							(err, result) => {
+								if (err) return callback(err);
+
+								// Ignored
+								if (!result) return callback();
+
+								return callback(
+									null,
+									new ContextModule(result.resolveDependencies, result)
+								);
+							}
+						);
+					}
+				);
+			}
+		);
+	}
+
+	resolveDependencies(fs, options, callback) {
+		const cmf = this;
+		let resource = options.resource;
+		let resourceQuery = options.resourceQuery;
+		let recursive = options.recursive;
+		let regExp = options.regExp;
+		let include = options.include;
+		let exclude = options.exclude;
+		if (!regExp || !resource) return callback(null, []);
+
+		const addDirectory = (directory, callback) => {
+			fs.readdir(directory, (err, files) => {
+				if (err) return callback(err);
+				files = cmf.hooks.contextModuleFiles.call(files);
+				if (!files || files.length === 0) return callback(null, []);
+				asyncLib.map(
+					files.filter(p => p.indexOf(".") !== 0),
+					(segment, callback) => {
+						const subResource = path.join(directory, segment);
+
+						if (!exclude || !subResource.match(exclude)) {
+							fs.stat(subResource, (err, stat) => {
+								if (err) {
+									if (err.code === "ENOENT") {
+										// ENOENT is ok here because the file may have been deleted between
+										// the readdir and stat calls.
+										return callback();
+									} else {
+										return callback(err);
+									}
+								}
+
+								if (stat.isDirectory()) {
+									if (!recursive) return callback();
+									addDirectory.call(this, subResource, callback);
+								} else if (
+									stat.isFile() &&
+									(!include || subResource.match(include))
+								) {
+									const obj = {
+										context: resource,
+										request:
+											"." +
+											subResource.substr(resource.length).replace(/\\/g, "/")
+									};
+
+									this.hooks.alternatives.callAsync(
+										[obj],
+										(err, alternatives) => {
+											if (err) return callback(err);
+											alternatives = alternatives
+												.filter(obj => regExp.test(obj.request))
+												.map(obj => {
+													const dep = new ContextElementDependency(
+														obj.request + resourceQuery,
+														obj.request
+													);
+													dep.optional = true;
+													return dep;
+												});
+											callback(null, alternatives);
+										}
+									);
+								} else {
+									callback();
+								}
+							});
+						} else {
+							callback();
+						}
+					},
+					(err, result) => {
+						if (err) return callback(err);
+
+						if (!result) return callback(null, []);
+
+						callback(
+							null,
+							result.filter(Boolean).reduce((a, i) => a.concat(i), [])
+						);
+					}
+				);
+			});
+		};
+
+		addDirectory(resource, callback);
+	}
+};
diff --git a/node_modules/webpack/lib/ContextReplacementPlugin.js b/node_modules/webpack/lib/ContextReplacementPlugin.js
new file mode 100644
index 0000000..5523c8a
--- /dev/null
+++ b/node_modules/webpack/lib/ContextReplacementPlugin.js
@@ -0,0 +1,133 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+const ContextElementDependency = require("./dependencies/ContextElementDependency");
+
+class ContextReplacementPlugin {
+	constructor(
+		resourceRegExp,
+		newContentResource,
+		newContentRecursive,
+		newContentRegExp
+	) {
+		this.resourceRegExp = resourceRegExp;
+
+		if (typeof newContentResource === "function") {
+			this.newContentCallback = newContentResource;
+		} else if (
+			typeof newContentResource === "string" &&
+			typeof newContentRecursive === "object"
+		) {
+			this.newContentResource = newContentResource;
+			this.newContentCreateContextMap = (fs, callback) => {
+				callback(null, newContentRecursive);
+			};
+		} else if (
+			typeof newContentResource === "string" &&
+			typeof newContentRecursive === "function"
+		) {
+			this.newContentResource = newContentResource;
+			this.newContentCreateContextMap = newContentRecursive;
+		} else {
+			if (typeof newContentResource !== "string") {
+				newContentRegExp = newContentRecursive;
+				newContentRecursive = newContentResource;
+				newContentResource = undefined;
+			}
+			if (typeof newContentRecursive !== "boolean") {
+				newContentRegExp = newContentRecursive;
+				newContentRecursive = undefined;
+			}
+			this.newContentResource = newContentResource;
+			this.newContentRecursive = newContentRecursive;
+			this.newContentRegExp = newContentRegExp;
+		}
+	}
+
+	apply(compiler) {
+		const resourceRegExp = this.resourceRegExp;
+		const newContentCallback = this.newContentCallback;
+		const newContentResource = this.newContentResource;
+		const newContentRecursive = this.newContentRecursive;
+		const newContentRegExp = this.newContentRegExp;
+		const newContentCreateContextMap = this.newContentCreateContextMap;
+
+		compiler.hooks.contextModuleFactory.tap("ContextReplacementPlugin", cmf => {
+			cmf.hooks.beforeResolve.tap("ContextReplacementPlugin", result => {
+				if (!result) return;
+				if (resourceRegExp.test(result.request)) {
+					if (newContentResource !== undefined) {
+						result.request = newContentResource;
+					}
+					if (newContentRecursive !== undefined) {
+						result.recursive = newContentRecursive;
+					}
+					if (newContentRegExp !== undefined) {
+						result.regExp = newContentRegExp;
+					}
+					if (typeof newContentCallback === "function") {
+						newContentCallback(result);
+					} else {
+						for (const d of result.dependencies) {
+							if (d.critical) d.critical = false;
+						}
+					}
+				}
+				return result;
+			});
+			cmf.hooks.afterResolve.tap("ContextReplacementPlugin", result => {
+				if (!result) return;
+				if (resourceRegExp.test(result.resource)) {
+					if (newContentResource !== undefined) {
+						result.resource = path.resolve(result.resource, newContentResource);
+					}
+					if (newContentRecursive !== undefined) {
+						result.recursive = newContentRecursive;
+					}
+					if (newContentRegExp !== undefined) {
+						result.regExp = newContentRegExp;
+					}
+					if (typeof newContentCreateContextMap === "function") {
+						result.resolveDependencies = createResolveDependenciesFromContextMap(
+							newContentCreateContextMap
+						);
+					}
+					if (typeof newContentCallback === "function") {
+						const origResource = result.resource;
+						newContentCallback(result);
+						if (result.resource !== origResource) {
+							result.resource = path.resolve(origResource, result.resource);
+						}
+					} else {
+						for (const d of result.dependencies) {
+							if (d.critical) d.critical = false;
+						}
+					}
+				}
+				return result;
+			});
+		});
+	}
+}
+
+const createResolveDependenciesFromContextMap = createContextMap => {
+	const resolveDependenciesFromContextMap = (fs, options, callback) => {
+		createContextMap(fs, (err, map) => {
+			if (err) return callback(err);
+			const dependencies = Object.keys(map).map(key => {
+				return new ContextElementDependency(
+					map[key] + options.resourceQuery,
+					key
+				);
+			});
+			callback(null, dependencies);
+		});
+	};
+	return resolveDependenciesFromContextMap;
+};
+
+module.exports = ContextReplacementPlugin;
diff --git a/node_modules/webpack/lib/DefinePlugin.js b/node_modules/webpack/lib/DefinePlugin.js
new file mode 100644
index 0000000..ceb4c84
--- /dev/null
+++ b/node_modules/webpack/lib/DefinePlugin.js
@@ -0,0 +1,289 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ConstDependency = require("./dependencies/ConstDependency");
+const BasicEvaluatedExpression = require("./BasicEvaluatedExpression");
+const ParserHelpers = require("./ParserHelpers");
+const NullFactory = require("./NullFactory");
+
+/** @typedef {import("./Compiler")} Compiler */
+/** @typedef {import("./Parser")} Parser */
+/** @typedef {null|undefined|RegExp|Function|string|number} CodeValuePrimitive */
+/** @typedef {CodeValuePrimitive|Record<string, CodeValuePrimitive>|RuntimeValue} CodeValue */
+
+class RuntimeValue {
+	constructor(fn, fileDependencies) {
+		this.fn = fn;
+		this.fileDependencies = fileDependencies || [];
+	}
+
+	exec(parser) {
+		if (this.fileDependencies === true) {
+			parser.state.module.buildInfo.cacheable = false;
+		} else {
+			for (const fileDependency of this.fileDependencies) {
+				parser.state.module.buildInfo.fileDependencies.add(fileDependency);
+			}
+		}
+
+		return this.fn({ module: parser.state.module });
+	}
+}
+
+const stringifyObj = (obj, parser) => {
+	return (
+		"Object({" +
+		Object.keys(obj)
+			.map(key => {
+				const code = obj[key];
+				return JSON.stringify(key) + ":" + toCode(code, parser);
+			})
+			.join(",") +
+		"})"
+	);
+};
+
+/**
+ * Convert code to a string that evaluates
+ * @param {CodeValue} code Code to evaluate
+ * @param {Parser} parser Parser
+ * @returns {string} code converted to string that evaluates
+ */
+const toCode = (code, parser) => {
+	if (code === null) {
+		return "null";
+	}
+	if (code === undefined) {
+		return "undefined";
+	}
+	if (code instanceof RuntimeValue) {
+		return toCode(code.exec(parser), parser);
+	}
+	if (code instanceof RegExp && code.toString) {
+		return code.toString();
+	}
+	if (typeof code === "function" && code.toString) {
+		return "(" + code.toString() + ")";
+	}
+	if (typeof code === "object") {
+		return stringifyObj(code, parser);
+	}
+	return code + "";
+};
+
+class DefinePlugin {
+	/**
+	 * Create a new define plugin
+	 * @param {Record<string, CodeValue>} definitions A map of global object definitions
+	 */
+	constructor(definitions) {
+		this.definitions = definitions;
+	}
+
+	static runtimeValue(fn, fileDependencies) {
+		return new RuntimeValue(fn, fileDependencies);
+	}
+
+	/**
+	 * Apply the plugin
+	 * @param {Compiler} compiler Webpack compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		const definitions = this.definitions;
+		compiler.hooks.compilation.tap(
+			"DefinePlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+
+				/**
+				 * Handler
+				 * @param {Parser} parser Parser
+				 * @returns {void}
+				 */
+				const handler = parser => {
+					/**
+					 * Walk definitions
+					 * @param {Object} definitions Definitions map
+					 * @param {string} prefix Prefix string
+					 * @returns {void}
+					 */
+					const walkDefinitions = (definitions, prefix) => {
+						Object.keys(definitions).forEach(key => {
+							const code = definitions[key];
+							if (
+								code &&
+								typeof code === "object" &&
+								!(code instanceof RuntimeValue) &&
+								!(code instanceof RegExp)
+							) {
+								walkDefinitions(code, prefix + key + ".");
+								applyObjectDefine(prefix + key, code);
+								return;
+							}
+							applyDefineKey(prefix, key);
+							applyDefine(prefix + key, code);
+						});
+					};
+
+					/**
+					 * Apply define key
+					 * @param {string} prefix Prefix
+					 * @param {string} key Key
+					 * @returns {void}
+					 */
+					const applyDefineKey = (prefix, key) => {
+						const splittedKey = key.split(".");
+						splittedKey.slice(1).forEach((_, i) => {
+							const fullKey = prefix + splittedKey.slice(0, i + 1).join(".");
+							parser.hooks.canRename
+								.for(fullKey)
+								.tap("DefinePlugin", ParserHelpers.approve);
+						});
+					};
+
+					/**
+					 * Apply Code
+					 * @param {string} key Key
+					 * @param {CodeValue} code Code
+					 * @returns {void}
+					 */
+					const applyDefine = (key, code) => {
+						const isTypeof = /^typeof\s+/.test(key);
+						if (isTypeof) key = key.replace(/^typeof\s+/, "");
+						let recurse = false;
+						let recurseTypeof = false;
+						if (!isTypeof) {
+							parser.hooks.canRename
+								.for(key)
+								.tap("DefinePlugin", ParserHelpers.approve);
+							parser.hooks.evaluateIdentifier
+								.for(key)
+								.tap("DefinePlugin", expr => {
+									/**
+									 * this is needed in case there is a recursion in the DefinePlugin
+									 * to prevent an endless recursion
+									 * e.g.: new DefinePlugin({
+									 * "a": "b",
+									 * "b": "a"
+									 * });
+									 */
+									if (recurse) return;
+									recurse = true;
+									const res = parser.evaluate(toCode(code, parser));
+									recurse = false;
+									res.setRange(expr.range);
+									return res;
+								});
+							parser.hooks.expression.for(key).tap("DefinePlugin", expr => {
+								const strCode = toCode(code, parser);
+								if (/__webpack_require__/.test(strCode)) {
+									return ParserHelpers.toConstantDependencyWithWebpackRequire(
+										parser,
+										strCode
+									)(expr);
+								} else {
+									return ParserHelpers.toConstantDependency(
+										parser,
+										strCode
+									)(expr);
+								}
+							});
+						}
+						parser.hooks.evaluateTypeof.for(key).tap("DefinePlugin", expr => {
+							/**
+							 * this is needed in case there is a recursion in the DefinePlugin
+							 * to prevent an endless recursion
+							 * e.g.: new DefinePlugin({
+							 * "typeof a": "typeof b",
+							 * "typeof b": "typeof a"
+							 * });
+							 */
+							if (recurseTypeof) return;
+							recurseTypeof = true;
+							const typeofCode = isTypeof
+								? toCode(code, parser)
+								: "typeof (" + toCode(code, parser) + ")";
+							const res = parser.evaluate(typeofCode);
+							recurseTypeof = false;
+							res.setRange(expr.range);
+							return res;
+						});
+						parser.hooks.typeof.for(key).tap("DefinePlugin", expr => {
+							const typeofCode = isTypeof
+								? toCode(code, parser)
+								: "typeof (" + toCode(code, parser) + ")";
+							const res = parser.evaluate(typeofCode);
+							if (!res.isString()) return;
+							return ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify(res.string)
+							).bind(parser)(expr);
+						});
+					};
+
+					/**
+					 * Apply Object
+					 * @param {string} key Key
+					 * @param {Object} obj Object
+					 * @returns {void}
+					 */
+					const applyObjectDefine = (key, obj) => {
+						parser.hooks.canRename
+							.for(key)
+							.tap("DefinePlugin", ParserHelpers.approve);
+						parser.hooks.evaluateIdentifier
+							.for(key)
+							.tap("DefinePlugin", expr =>
+								new BasicEvaluatedExpression().setTruthy().setRange(expr.range)
+							);
+						parser.hooks.evaluateTypeof.for(key).tap("DefinePlugin", expr => {
+							return ParserHelpers.evaluateToString("object")(expr);
+						});
+						parser.hooks.expression.for(key).tap("DefinePlugin", expr => {
+							const strCode = stringifyObj(obj, parser);
+
+							if (/__webpack_require__/.test(strCode)) {
+								return ParserHelpers.toConstantDependencyWithWebpackRequire(
+									parser,
+									strCode
+								)(expr);
+							} else {
+								return ParserHelpers.toConstantDependency(
+									parser,
+									strCode
+								)(expr);
+							}
+						});
+						parser.hooks.typeof.for(key).tap("DefinePlugin", expr => {
+							return ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify("object")
+							)(expr);
+						});
+					};
+
+					walkDefinitions(definitions, "");
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("DefinePlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("DefinePlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/esm")
+					.tap("DefinePlugin", handler);
+			}
+		);
+	}
+}
+module.exports = DefinePlugin;
diff --git a/node_modules/webpack/lib/DelegatedModule.js b/node_modules/webpack/lib/DelegatedModule.js
new file mode 100644
index 0000000..170ceca
--- /dev/null
+++ b/node_modules/webpack/lib/DelegatedModule.js
@@ -0,0 +1,114 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { OriginalSource, RawSource } = require("webpack-sources");
+
+const Module = require("./Module");
+const WebpackMissingModule = require("./dependencies/WebpackMissingModule");
+const DelegatedSourceDependency = require("./dependencies/DelegatedSourceDependency");
+const DelegatedExportsDependency = require("./dependencies/DelegatedExportsDependency");
+
+/** @typedef {import("./dependencies/ModuleDependency")} ModuleDependency */
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+class DelegatedModule extends Module {
+	constructor(sourceRequest, data, type, userRequest, originalRequest) {
+		super("javascript/dynamic", null);
+
+		// Info from Factory
+		this.sourceRequest = sourceRequest;
+		this.request = data.id;
+		this.type = type;
+		this.userRequest = userRequest;
+		this.originalRequest = originalRequest;
+		this.delegateData = data;
+
+		// Build info
+		this.delegatedSourceDependency = undefined;
+	}
+
+	libIdent(options) {
+		return typeof this.originalRequest === "string"
+			? this.originalRequest
+			: this.originalRequest.libIdent(options);
+	}
+
+	identifier() {
+		return `delegated ${JSON.stringify(this.request)} from ${
+			this.sourceRequest
+		}`;
+	}
+
+	readableIdentifier() {
+		return `delegated ${this.userRequest} from ${this.sourceRequest}`;
+	}
+
+	needRebuild() {
+		return false;
+	}
+
+	build(options, compilation, resolver, fs, callback) {
+		this.built = true;
+		this.buildMeta = Object.assign({}, this.delegateData.buildMeta);
+		this.buildInfo = {};
+		this.delegatedSourceDependency = new DelegatedSourceDependency(
+			this.sourceRequest
+		);
+		this.addDependency(this.delegatedSourceDependency);
+		this.addDependency(
+			new DelegatedExportsDependency(this, this.delegateData.exports || true)
+		);
+		callback();
+	}
+
+	source(depTemplates, runtime) {
+		const dep = /** @type {DelegatedSourceDependency} */ (this.dependencies[0]);
+		const sourceModule = dep.module;
+		let str;
+
+		if (!sourceModule) {
+			str = WebpackMissingModule.moduleCode(this.sourceRequest);
+		} else {
+			str = `module.exports = (${runtime.moduleExports({
+				module: sourceModule,
+				request: dep.request
+			})})`;
+
+			switch (this.type) {
+				case "require":
+					str += `(${JSON.stringify(this.request)})`;
+					break;
+				case "object":
+					str += `[${JSON.stringify(this.request)}]`;
+					break;
+			}
+
+			str += ";";
+		}
+
+		if (this.useSourceMap) {
+			return new OriginalSource(str, this.identifier());
+		} else {
+			return new RawSource(str);
+		}
+	}
+
+	size() {
+		return 42;
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track dependencies
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update(this.type);
+		hash.update(JSON.stringify(this.request));
+		super.updateHash(hash);
+	}
+}
+
+module.exports = DelegatedModule;
diff --git a/node_modules/webpack/lib/DelegatedModuleFactoryPlugin.js b/node_modules/webpack/lib/DelegatedModuleFactoryPlugin.js
new file mode 100644
index 0000000..a0a05a4
--- /dev/null
+++ b/node_modules/webpack/lib/DelegatedModuleFactoryPlugin.js
@@ -0,0 +1,95 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DelegatedModule = require("./DelegatedModule");
+
+// options.source
+// options.type
+// options.context
+// options.scope
+// options.content
+class DelegatedModuleFactoryPlugin {
+	constructor(options) {
+		this.options = options;
+		options.type = options.type || "require";
+		options.extensions = options.extensions || [
+			"",
+			".wasm",
+			".mjs",
+			".js",
+			".json"
+		];
+	}
+
+	apply(normalModuleFactory) {
+		const scope = this.options.scope;
+		if (scope) {
+			normalModuleFactory.hooks.factory.tap(
+				"DelegatedModuleFactoryPlugin",
+				factory => (data, callback) => {
+					const dependency = data.dependencies[0];
+					const request = dependency.request;
+					if (request && request.indexOf(scope + "/") === 0) {
+						const innerRequest = "." + request.substr(scope.length);
+						let resolved;
+						if (innerRequest in this.options.content) {
+							resolved = this.options.content[innerRequest];
+							return callback(
+								null,
+								new DelegatedModule(
+									this.options.source,
+									resolved,
+									this.options.type,
+									innerRequest,
+									request
+								)
+							);
+						}
+						for (let i = 0; i < this.options.extensions.length; i++) {
+							const extension = this.options.extensions[i];
+							const requestPlusExt = innerRequest + extension;
+							if (requestPlusExt in this.options.content) {
+								resolved = this.options.content[requestPlusExt];
+								return callback(
+									null,
+									new DelegatedModule(
+										this.options.source,
+										resolved,
+										this.options.type,
+										requestPlusExt,
+										request + extension
+									)
+								);
+							}
+						}
+					}
+					return factory(data, callback);
+				}
+			);
+		} else {
+			normalModuleFactory.hooks.module.tap(
+				"DelegatedModuleFactoryPlugin",
+				module => {
+					if (module.libIdent) {
+						const request = module.libIdent(this.options);
+						if (request && request in this.options.content) {
+							const resolved = this.options.content[request];
+							return new DelegatedModule(
+								this.options.source,
+								resolved,
+								this.options.type,
+								request,
+								module
+							);
+						}
+					}
+					return module;
+				}
+			);
+		}
+	}
+}
+module.exports = DelegatedModuleFactoryPlugin;
diff --git a/node_modules/webpack/lib/DelegatedPlugin.js b/node_modules/webpack/lib/DelegatedPlugin.js
new file mode 100644
index 0000000..714eb85
--- /dev/null
+++ b/node_modules/webpack/lib/DelegatedPlugin.js
@@ -0,0 +1,39 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const DelegatedModuleFactoryPlugin = require("./DelegatedModuleFactoryPlugin");
+const DelegatedSourceDependency = require("./dependencies/DelegatedSourceDependency");
+const DelegatedExportsDependency = require("./dependencies/DelegatedExportsDependency");
+const NullFactory = require("./NullFactory");
+
+class DelegatedPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"DelegatedPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					DelegatedSourceDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyFactories.set(
+					DelegatedExportsDependency,
+					new NullFactory()
+				);
+			}
+		);
+
+		compiler.hooks.compile.tap("DelegatedPlugin", ({ normalModuleFactory }) => {
+			new DelegatedModuleFactoryPlugin(this.options).apply(normalModuleFactory);
+		});
+	}
+}
+
+module.exports = DelegatedPlugin;
diff --git a/node_modules/webpack/lib/DependenciesBlock.js b/node_modules/webpack/lib/DependenciesBlock.js
new file mode 100644
index 0000000..142f3ea
--- /dev/null
+++ b/node_modules/webpack/lib/DependenciesBlock.js
@@ -0,0 +1,124 @@
+/*
+ MIT License http://www.opensource.org/licenses/mit-license.php
+ Author Tobias Koppers @sokra
+ */
+"use strict";
+
+const DependenciesBlockVariable = require("./DependenciesBlockVariable");
+
+/** @typedef {import("./ChunkGroup")} ChunkGroup */
+/** @typedef {import("./Dependency")} Dependency */
+/** @typedef {import("./AsyncDependenciesBlock")} AsyncDependenciesBlock */
+/** @typedef {import("./DependenciesBlockVariable")} DependenciesBlockVariable */
+/** @typedef {(d: Dependency) => boolean} DependencyFilterFunction */
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+class DependenciesBlock {
+	constructor() {
+		/** @type {Dependency[]} */
+		this.dependencies = [];
+		/** @type {AsyncDependenciesBlock[]} */
+		this.blocks = [];
+		/** @type {DependenciesBlockVariable[]} */
+		this.variables = [];
+	}
+
+	/**
+	 * Adds a DependencyBlock to DependencyBlock relationship.
+	 * This is used for when a Module has a AsyncDependencyBlock tie (for code-splitting)
+	 *
+	 * @param {AsyncDependenciesBlock} block block being added
+	 * @returns {void}
+	 */
+	addBlock(block) {
+		this.blocks.push(block);
+		block.parent = this;
+	}
+
+	/**
+	 * @param {string} name name of dependency
+	 * @param {string} expression expression string for variable
+	 * @param {Dependency[]} dependencies dependency instances tied to variable
+	 * @returns {void}
+	 */
+	addVariable(name, expression, dependencies) {
+		for (let v of this.variables) {
+			if (v.name === name && v.expression === expression) {
+				return;
+			}
+		}
+		this.variables.push(
+			new DependenciesBlockVariable(name, expression, dependencies)
+		);
+	}
+
+	/**
+	 * @param {Dependency} dependency dependency being tied to block.
+	 * This is an "edge" pointing to another "node" on module graph.
+	 * @returns {void}
+	 */
+	addDependency(dependency) {
+		this.dependencies.push(dependency);
+	}
+
+	/**
+	 * @param {Dependency} dependency dependency being removed
+	 * @returns {void}
+	 */
+	removeDependency(dependency) {
+		const idx = this.dependencies.indexOf(dependency);
+		if (idx >= 0) {
+			this.dependencies.splice(idx, 1);
+		}
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track dependencies
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		for (const dep of this.dependencies) dep.updateHash(hash);
+		for (const block of this.blocks) block.updateHash(hash);
+		for (const variable of this.variables) variable.updateHash(hash);
+	}
+
+	disconnect() {
+		for (const dep of this.dependencies) dep.disconnect();
+		for (const block of this.blocks) block.disconnect();
+		for (const variable of this.variables) variable.disconnect();
+	}
+
+	unseal() {
+		for (const block of this.blocks) block.unseal();
+	}
+
+	/**
+	 * @param {DependencyFilterFunction} filter filter function for dependencies, gets passed all dependency ties from current instance
+	 * @returns {boolean} returns boolean for filter
+	 */
+	hasDependencies(filter) {
+		if (filter) {
+			for (const dep of this.dependencies) {
+				if (filter(dep)) return true;
+			}
+		} else {
+			if (this.dependencies.length > 0) {
+				return true;
+			}
+		}
+
+		for (const block of this.blocks) {
+			if (block.hasDependencies(filter)) return true;
+		}
+		for (const variable of this.variables) {
+			if (variable.hasDependencies(filter)) return true;
+		}
+		return false;
+	}
+
+	sortItems() {
+		for (const block of this.blocks) block.sortItems();
+	}
+}
+
+module.exports = DependenciesBlock;
diff --git a/node_modules/webpack/lib/DependenciesBlockVariable.js b/node_modules/webpack/lib/DependenciesBlockVariable.js
new file mode 100644
index 0000000..c4ed916
--- /dev/null
+++ b/node_modules/webpack/lib/DependenciesBlockVariable.js
@@ -0,0 +1,72 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { RawSource, ReplaceSource } = require("webpack-sources");
+
+/** @typedef {import("./Dependency")} Dependency */
+/** @typedef {import("./Dependency").DependencyTemplate} DependencyTemplate */
+/** @typedef {import("./RuntimeTemplate")} RuntimeTemplate */
+/** @typedef {import("./util/createHash").Hash} Hash */
+/** @typedef {(d: Dependency) => boolean} DependencyFilterFunction */
+/** @typedef {Map<Function, DependencyTemplate>} DependencyTemplates */
+
+class DependenciesBlockVariable {
+	/**
+	 * Creates an instance of DependenciesBlockVariable.
+	 * @param {string} name name of DependenciesBlockVariable
+	 * @param {string} expression expression string
+	 * @param {Dependency[]=} dependencies dependencies tied to this varaiable
+	 */
+	constructor(name, expression, dependencies) {
+		this.name = name;
+		this.expression = expression;
+		this.dependencies = dependencies || [];
+	}
+
+	/**
+	 * @param {Hash} hash hash for instance to update
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update(this.name);
+		hash.update(this.expression);
+		for (const d of this.dependencies) {
+			d.updateHash(hash);
+		}
+	}
+
+	/**
+	 * @param {DependencyTemplates} dependencyTemplates Dependency constructors and templates Map.
+	 * @param {RuntimeTemplate} runtimeTemplate runtimeTemplate to generate expression souce
+	 * @returns {ReplaceSource} returns constructed source for expression via templates
+	 */
+	expressionSource(dependencyTemplates, runtimeTemplate) {
+		const source = new ReplaceSource(new RawSource(this.expression));
+		for (const dep of this.dependencies) {
+			const template = dependencyTemplates.get(dep.constructor);
+			if (!template) {
+				throw new Error(`No template for dependency: ${dep.constructor.name}`);
+			}
+			template.apply(dep, source, runtimeTemplate, dependencyTemplates);
+		}
+		return source;
+	}
+
+	disconnect() {
+		for (const d of this.dependencies) {
+			d.disconnect();
+		}
+	}
+
+	hasDependencies(filter) {
+		if (filter) {
+			return this.dependencies.some(filter);
+		}
+		return this.dependencies.length > 0;
+	}
+}
+
+module.exports = DependenciesBlockVariable;
diff --git a/node_modules/webpack/lib/Dependency.js b/node_modules/webpack/lib/Dependency.js
new file mode 100644
index 0000000..6d27b1e
--- /dev/null
+++ b/node_modules/webpack/lib/Dependency.js
@@ -0,0 +1,89 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const util = require("util");
+const compareLocations = require("./compareLocations");
+const DependencyReference = require("./dependencies/DependencyReference");
+
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("./RuntimeTemplate")} RuntimeTemplate */
+
+/**
+ * @typedef {Object} DependencyTemplate
+ * @property {function(Dependency, Source, RuntimeTemplate, Map<Function, DependencyTemplate>): void} apply
+ */
+
+/** @typedef {Object} SourcePosition
+ *  @property {number} line
+ *  @property {number=} column
+ */
+
+/** @typedef {Object} RealDependencyLocation
+ *  @property {SourcePosition} start
+ *  @property {SourcePosition=} end
+ *  @property {number=} index
+ */
+
+/** @typedef {Object} SynteticDependencyLocation
+ *  @property {string} name
+ *  @property {number=} index
+ */
+
+/** @typedef {SynteticDependencyLocation|RealDependencyLocation} DependencyLocation */
+
+class Dependency {
+	constructor() {
+		/** @type {Module|null} */
+		this.module = null;
+		// TODO remove in webpack 5
+		/** @type {boolean} */
+		this.weak = false;
+		/** @type {boolean} */
+		this.optional = false;
+		/** @type {DependencyLocation} */
+		this.loc = undefined;
+	}
+
+	getResourceIdentifier() {
+		return null;
+	}
+
+	// Returns the referenced module and export
+	getReference() {
+		if (!this.module) return null;
+		return new DependencyReference(this.module, true, this.weak);
+	}
+
+	// Returns the exported names
+	getExports() {
+		return null;
+	}
+
+	getWarnings() {
+		return null;
+	}
+
+	getErrors() {
+		return null;
+	}
+
+	updateHash(hash) {
+		hash.update((this.module && this.module.id) + "");
+	}
+
+	disconnect() {
+		this.module = null;
+	}
+}
+
+// TODO remove in webpack 5
+Dependency.compare = util.deprecate(
+	(a, b) => compareLocations(a.loc, b.loc),
+	"Dependency.compare is deprecated and will be removed in the next major version"
+);
+
+module.exports = Dependency;
diff --git a/node_modules/webpack/lib/DllEntryPlugin.js b/node_modules/webpack/lib/DllEntryPlugin.js
new file mode 100644
index 0000000..562628d
--- /dev/null
+++ b/node_modules/webpack/lib/DllEntryPlugin.js
@@ -0,0 +1,54 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DllEntryDependency = require("./dependencies/DllEntryDependency");
+const SingleEntryDependency = require("./dependencies/SingleEntryDependency");
+const DllModuleFactory = require("./DllModuleFactory");
+
+class DllEntryPlugin {
+	constructor(context, entries, name) {
+		this.context = context;
+		this.entries = entries;
+		this.name = name;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"DllEntryPlugin",
+			(compilation, { normalModuleFactory }) => {
+				const dllModuleFactory = new DllModuleFactory();
+				compilation.dependencyFactories.set(
+					DllEntryDependency,
+					dllModuleFactory
+				);
+				compilation.dependencyFactories.set(
+					SingleEntryDependency,
+					normalModuleFactory
+				);
+			}
+		);
+		compiler.hooks.make.tapAsync("DllEntryPlugin", (compilation, callback) => {
+			compilation.addEntry(
+				this.context,
+				new DllEntryDependency(
+					this.entries.map((e, idx) => {
+						const dep = new SingleEntryDependency(e);
+						dep.loc = {
+							name: this.name,
+							index: idx
+						};
+						return dep;
+					}),
+					this.name
+				),
+				this.name,
+				callback
+			);
+		});
+	}
+}
+
+module.exports = DllEntryPlugin;
diff --git a/node_modules/webpack/lib/DllModule.js b/node_modules/webpack/lib/DllModule.js
new file mode 100644
index 0000000..0cd9cbc
--- /dev/null
+++ b/node_modules/webpack/lib/DllModule.js
@@ -0,0 +1,60 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+	*/
+"use strict";
+
+const { RawSource } = require("webpack-sources");
+const Module = require("./Module");
+
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+class DllModule extends Module {
+	constructor(context, dependencies, name, type) {
+		super("javascript/dynamic", context);
+
+		// Info from Factory
+		this.dependencies = dependencies;
+		this.name = name;
+		this.type = type;
+	}
+
+	identifier() {
+		return `dll ${this.name}`;
+	}
+
+	readableIdentifier() {
+		return `dll ${this.name}`;
+	}
+
+	build(options, compilation, resolver, fs, callback) {
+		this.built = true;
+		this.buildMeta = {};
+		this.buildInfo = {};
+		return callback();
+	}
+
+	source() {
+		return new RawSource("module.exports = __webpack_require__;");
+	}
+
+	needRebuild() {
+		return false;
+	}
+
+	size() {
+		return 12;
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track dependencies
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update("dll module");
+		hash.update(this.name || "");
+		super.updateHash(hash);
+	}
+}
+
+module.exports = DllModule;
diff --git a/node_modules/webpack/lib/DllModuleFactory.js b/node_modules/webpack/lib/DllModuleFactory.js
new file mode 100644
index 0000000..f5d12dd
--- /dev/null
+++ b/node_modules/webpack/lib/DllModuleFactory.js
@@ -0,0 +1,29 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { Tapable } = require("tapable");
+const DllModule = require("./DllModule");
+
+class DllModuleFactory extends Tapable {
+	constructor() {
+		super();
+		this.hooks = {};
+	}
+	create(data, callback) {
+		const dependency = data.dependencies[0];
+		callback(
+			null,
+			new DllModule(
+				data.context,
+				dependency.dependencies,
+				dependency.name,
+				dependency.type
+			)
+		);
+	}
+}
+
+module.exports = DllModuleFactory;
diff --git a/node_modules/webpack/lib/DllPlugin.js b/node_modules/webpack/lib/DllPlugin.js
new file mode 100644
index 0000000..ffd62cf
--- /dev/null
+++ b/node_modules/webpack/lib/DllPlugin.js
@@ -0,0 +1,49 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+	*/
+"use strict";
+
+const DllEntryPlugin = require("./DllEntryPlugin");
+const FlagAllModulesAsUsedPlugin = require("./FlagAllModulesAsUsedPlugin");
+const LibManifestPlugin = require("./LibManifestPlugin");
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/DllPlugin.json");
+
+/** @typedef {import("../declarations/plugins/DllPlugin").DllPluginOptions} DllPluginOptions */
+
+class DllPlugin {
+	/**
+	 * @param {DllPluginOptions} options options object
+	 */
+	constructor(options) {
+		validateOptions(schema, options, "Dll Plugin");
+		this.options = options;
+	}
+
+	apply(compiler) {
+		compiler.hooks.entryOption.tap("DllPlugin", (context, entry) => {
+			const itemToPlugin = (item, name) => {
+				if (Array.isArray(item)) {
+					return new DllEntryPlugin(context, item, name);
+				}
+				throw new Error("DllPlugin: supply an Array as entry");
+			};
+			if (typeof entry === "object" && !Array.isArray(entry)) {
+				Object.keys(entry).forEach(name => {
+					itemToPlugin(entry[name], name).apply(compiler);
+				});
+			} else {
+				itemToPlugin(entry, "main").apply(compiler);
+			}
+			return true;
+		});
+		new LibManifestPlugin(this.options).apply(compiler);
+		if (!this.options.entryOnly) {
+			new FlagAllModulesAsUsedPlugin("DllPlugin").apply(compiler);
+		}
+	}
+}
+
+module.exports = DllPlugin;
diff --git a/node_modules/webpack/lib/DllReferencePlugin.js b/node_modules/webpack/lib/DllReferencePlugin.js
new file mode 100644
index 0000000..62e26d8
--- /dev/null
+++ b/node_modules/webpack/lib/DllReferencePlugin.js
@@ -0,0 +1,156 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const parseJson = require("json-parse-better-errors");
+const DelegatedSourceDependency = require("./dependencies/DelegatedSourceDependency");
+const DelegatedModuleFactoryPlugin = require("./DelegatedModuleFactoryPlugin");
+const ExternalModuleFactoryPlugin = require("./ExternalModuleFactoryPlugin");
+const DelegatedExportsDependency = require("./dependencies/DelegatedExportsDependency");
+const NullFactory = require("./NullFactory");
+const makePathsRelative = require("./util/identifier").makePathsRelative;
+const WebpackError = require("./WebpackError");
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/DllReferencePlugin.json");
+
+/** @typedef {import("../declarations/plugins/DllReferencePlugin").DllReferencePluginOptions} DllReferencePluginOptions */
+/** @typedef {import("../declarations/plugins/DllReferencePlugin").DllReferencePluginOptionsManifest} DllReferencePluginOptionsManifest */
+
+class DllReferencePlugin {
+	/**
+	 * @param {DllReferencePluginOptions} options options object
+	 */
+	constructor(options) {
+		validateOptions(schema, options, "Dll Reference Plugin");
+		this.options = options;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"DllReferencePlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					DelegatedSourceDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyFactories.set(
+					DelegatedExportsDependency,
+					new NullFactory()
+				);
+			}
+		);
+
+		compiler.hooks.beforeCompile.tapAsync(
+			"DllReferencePlugin",
+			(params, callback) => {
+				if ("manifest" in this.options) {
+					const manifest = this.options.manifest;
+					if (typeof manifest === "string") {
+						params.compilationDependencies.add(manifest);
+						compiler.inputFileSystem.readFile(manifest, (err, result) => {
+							if (err) return callback(err);
+							// Catch errors parsing the manifest so that blank
+							// or malformed manifest files don't kill the process.
+							try {
+								params["dll reference " + manifest] = parseJson(
+									result.toString("utf-8")
+								);
+							} catch (e) {
+								// Store the error in the params so that it can
+								// be added as a compilation error later on.
+								const manifestPath = makePathsRelative(
+									compiler.options.context,
+									manifest
+								);
+								params[
+									"dll reference parse error " + manifest
+								] = new DllManifestError(manifestPath, e.message);
+							}
+							return callback();
+						});
+						return;
+					}
+				}
+				return callback();
+			}
+		);
+
+		compiler.hooks.compile.tap("DllReferencePlugin", params => {
+			let name = this.options.name;
+			let sourceType = this.options.sourceType;
+			let content =
+				"content" in this.options ? this.options.content : undefined;
+			if ("manifest" in this.options) {
+				let manifestParameter = this.options.manifest;
+				let manifest;
+				if (typeof manifestParameter === "string") {
+					// If there was an error parsing the manifest
+					// file, exit now because the error will be added
+					// as a compilation error in the "compilation" hook.
+					if (params["dll reference parse error " + manifestParameter]) {
+						return;
+					}
+					manifest =
+						/** @type {DllReferencePluginOptionsManifest} */ (params[
+							"dll reference " + manifestParameter
+						]);
+				} else {
+					manifest = manifestParameter;
+				}
+				if (manifest) {
+					if (!name) name = manifest.name;
+					if (!sourceType) sourceType = manifest.type;
+					if (!content) content = manifest.content;
+				}
+			}
+			const externals = {};
+			const source = "dll-reference " + name;
+			externals[source] = name;
+			const normalModuleFactory = params.normalModuleFactory;
+			new ExternalModuleFactoryPlugin(sourceType || "var", externals).apply(
+				normalModuleFactory
+			);
+			new DelegatedModuleFactoryPlugin({
+				source: source,
+				type: this.options.type,
+				scope: this.options.scope,
+				context: this.options.context || compiler.options.context,
+				content,
+				extensions: this.options.extensions
+			}).apply(normalModuleFactory);
+		});
+
+		compiler.hooks.compilation.tap(
+			"DllReferencePlugin",
+			(compilation, params) => {
+				if ("manifest" in this.options) {
+					let manifest = this.options.manifest;
+					if (typeof manifest === "string") {
+						// If there was an error parsing the manifest file, add the
+						// error as a compilation error to make the compilation fail.
+						let e = params["dll reference parse error " + manifest];
+						if (e) {
+							compilation.errors.push(e);
+						}
+					}
+				}
+			}
+		);
+	}
+}
+
+class DllManifestError extends WebpackError {
+	constructor(filename, message) {
+		super();
+
+		this.name = "DllManifestError";
+		this.message = `Dll manifest ${filename}\n${message}`;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = DllReferencePlugin;
diff --git a/node_modules/webpack/lib/DynamicEntryPlugin.js b/node_modules/webpack/lib/DynamicEntryPlugin.js
new file mode 100644
index 0000000..be9b237
--- /dev/null
+++ b/node_modules/webpack/lib/DynamicEntryPlugin.js
@@ -0,0 +1,94 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Naoyuki Kanezawa @nkzawa
+*/
+"use strict";
+
+const MultiEntryDependency = require("./dependencies/MultiEntryDependency");
+const SingleEntryDependency = require("./dependencies/SingleEntryDependency");
+const MultiModuleFactory = require("./MultiModuleFactory");
+const MultiEntryPlugin = require("./MultiEntryPlugin");
+const SingleEntryPlugin = require("./SingleEntryPlugin");
+
+/** @typedef {import("../declarations/WebpackOptions").EntryDynamic} EntryDynamic */
+/** @typedef {import("../declarations/WebpackOptions").EntryStatic} EntryStatic */
+/** @typedef {import("./Compiler")} Compiler */
+
+class DynamicEntryPlugin {
+	/**
+	 * @param {string} context the context path
+	 * @param {EntryDynamic} entry the entry value
+	 */
+	constructor(context, entry) {
+		this.context = context;
+		this.entry = entry;
+	}
+
+	/**
+	 * @param {Compiler} compiler the compiler instance
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"DynamicEntryPlugin",
+			(compilation, { normalModuleFactory }) => {
+				const multiModuleFactory = new MultiModuleFactory();
+
+				compilation.dependencyFactories.set(
+					MultiEntryDependency,
+					multiModuleFactory
+				);
+				compilation.dependencyFactories.set(
+					SingleEntryDependency,
+					normalModuleFactory
+				);
+			}
+		);
+
+		compiler.hooks.make.tapAsync(
+			"DynamicEntryPlugin",
+			(compilation, callback) => {
+				/**
+				 * @param {string|string[]} entry entry value or array of entry values
+				 * @param {string} name name of entry
+				 * @returns {Promise<EntryStatic>} returns the promise resolving the Compilation#addEntry function
+				 */
+				const addEntry = (entry, name) => {
+					const dep = DynamicEntryPlugin.createDependency(entry, name);
+					return new Promise((resolve, reject) => {
+						compilation.addEntry(this.context, dep, name, err => {
+							if (err) return reject(err);
+							resolve();
+						});
+					});
+				};
+
+				Promise.resolve(this.entry()).then(entry => {
+					if (typeof entry === "string" || Array.isArray(entry)) {
+						addEntry(entry, "main").then(() => callback(), callback);
+					} else if (typeof entry === "object") {
+						Promise.all(
+							Object.keys(entry).map(name => {
+								return addEntry(entry[name], name);
+							})
+						).then(() => callback(), callback);
+					}
+				});
+			}
+		);
+	}
+}
+
+module.exports = DynamicEntryPlugin;
+/**
+ * @param {string|string[]} entry entry value or array of entry paths
+ * @param {string} name name of entry
+ * @returns {SingleEntryDependency|MultiEntryDependency} returns dep
+ */
+DynamicEntryPlugin.createDependency = (entry, name) => {
+	if (Array.isArray(entry)) {
+		return MultiEntryPlugin.createDependency(entry, name);
+	} else {
+		return SingleEntryPlugin.createDependency(entry, name);
+	}
+};
diff --git a/node_modules/webpack/lib/EntryModuleNotFoundError.js b/node_modules/webpack/lib/EntryModuleNotFoundError.js
new file mode 100644
index 0000000..b2458d6
--- /dev/null
+++ b/node_modules/webpack/lib/EntryModuleNotFoundError.js
@@ -0,0 +1,21 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+class EntryModuleNotFoundError extends WebpackError {
+	constructor(err) {
+		super("Entry module not found: " + err);
+
+		this.name = "EntryModuleNotFoundError";
+		this.details = err.details;
+		this.error = err;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = EntryModuleNotFoundError;
diff --git a/node_modules/webpack/lib/EntryOptionPlugin.js b/node_modules/webpack/lib/EntryOptionPlugin.js
new file mode 100644
index 0000000..ddda157
--- /dev/null
+++ b/node_modules/webpack/lib/EntryOptionPlugin.js
@@ -0,0 +1,46 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const SingleEntryPlugin = require("./SingleEntryPlugin");
+const MultiEntryPlugin = require("./MultiEntryPlugin");
+const DynamicEntryPlugin = require("./DynamicEntryPlugin");
+
+/** @typedef {import("../declarations/WebpackOptions").EntryItem} EntryItem */
+/** @typedef {import("./Compiler")} Compiler */
+
+/**
+ * @param {string} context context path
+ * @param {EntryItem} item entry array or single path
+ * @param {string} name entry key name
+ * @returns {SingleEntryPlugin | MultiEntryPlugin} returns either a single or multi entry plugin
+ */
+const itemToPlugin = (context, item, name) => {
+	if (Array.isArray(item)) {
+		return new MultiEntryPlugin(context, item, name);
+	}
+	return new SingleEntryPlugin(context, item, name);
+};
+
+module.exports = class EntryOptionPlugin {
+	/**
+	 * @param {Compiler} compiler the compiler instance one is tapping into
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.entryOption.tap("EntryOptionPlugin", (context, entry) => {
+			if (typeof entry === "string" || Array.isArray(entry)) {
+				itemToPlugin(context, entry, "main").apply(compiler);
+			} else if (typeof entry === "object") {
+				for (const name of Object.keys(entry)) {
+					itemToPlugin(context, entry[name], name).apply(compiler);
+				}
+			} else if (typeof entry === "function") {
+				new DynamicEntryPlugin(context, entry).apply(compiler);
+			}
+			return true;
+		});
+	}
+};
diff --git a/node_modules/webpack/lib/Entrypoint.js b/node_modules/webpack/lib/Entrypoint.js
new file mode 100644
index 0000000..d82158a
--- /dev/null
+++ b/node_modules/webpack/lib/Entrypoint.js
@@ -0,0 +1,64 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ChunkGroup = require("./ChunkGroup");
+
+/** @typedef {import("./Chunk")} Chunk */
+
+/**
+ * Entrypoint serves as an encapsulation primitive for chunks that are
+ * a part of a single ChunkGroup. They represent all bundles that need to be loaded for a
+ * single instance of a page. Multi-page application architectures will typically yield multiple Entrypoint objects
+ * inside of the compilation, whereas a Single Page App may only contain one with many lazy-loaded chunks.
+ */
+class Entrypoint extends ChunkGroup {
+	/**
+	 * Creates an instance of Entrypoint.
+	 * @param {string} name the name of the entrypoint
+	 */
+	constructor(name) {
+		super(name);
+		/** @type {Chunk=} */
+		this.runtimeChunk = undefined;
+	}
+
+	/**
+	 * isInitial will always return true for Entrypoint ChunkGroup.
+	 * @returns {true} returns true as all entrypoints are initial ChunkGroups
+	 */
+	isInitial() {
+		return true;
+	}
+
+	/**
+	 * Sets the runtimeChunk for an entrypoint.
+	 * @param {Chunk} chunk the chunk being set as the runtime chunk.
+	 * @returns {void}
+	 */
+	setRuntimeChunk(chunk) {
+		this.runtimeChunk = chunk;
+	}
+
+	/**
+	 * Fetches the chunk reference containing the webpack bootstrap code
+	 * @returns {Chunk} returns the runtime chunk or first chunk in `this.chunks`
+	 */
+	getRuntimeChunk() {
+		return this.runtimeChunk || this.chunks[0];
+	}
+
+	/**
+	 * @param {Chunk} oldChunk chunk to be replaced
+	 * @param {Chunk} newChunk New chunk that will be replaced with
+	 * @returns {boolean} returns true if the replacement was successful
+	 */
+	replaceChunk(oldChunk, newChunk) {
+		if (this.runtimeChunk === oldChunk) this.runtimeChunk = newChunk;
+		return super.replaceChunk(oldChunk, newChunk);
+	}
+}
+
+module.exports = Entrypoint;
diff --git a/node_modules/webpack/lib/EnvironmentPlugin.js b/node_modules/webpack/lib/EnvironmentPlugin.js
new file mode 100644
index 0000000..c9fafaa
--- /dev/null
+++ b/node_modules/webpack/lib/EnvironmentPlugin.js
@@ -0,0 +1,72 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Authors Simen Brekken @simenbrekken, Einar Löve @einarlove
+*/
+
+"use strict";
+
+/** @typedef {import("./Compiler")} Compiler */
+
+const WebpackError = require("./WebpackError");
+const DefinePlugin = require("./DefinePlugin");
+
+const needsEnvVarFix =
+	["8", "9"].indexOf(process.versions.node.split(".")[0]) >= 0 &&
+	process.platform === "win32";
+
+class EnvironmentPlugin {
+	constructor(...keys) {
+		if (keys.length === 1 && Array.isArray(keys[0])) {
+			this.keys = keys[0];
+			this.defaultValues = {};
+		} else if (keys.length === 1 && keys[0] && typeof keys[0] === "object") {
+			this.keys = Object.keys(keys[0]);
+			this.defaultValues = keys[0];
+		} else {
+			this.keys = keys;
+			this.defaultValues = {};
+		}
+	}
+
+	/**
+	 * @param {Compiler} compiler webpack compiler instance
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		const definitions = this.keys.reduce((defs, key) => {
+			// TODO remove once the fix has made its way into Node 8.
+			// Work around https://github.com/nodejs/node/pull/18463,
+			// affecting Node 8 & 9 by performing an OS-level
+			// operation that always succeeds before reading
+			// environment variables:
+			if (needsEnvVarFix) require("os").cpus();
+
+			const value =
+				process.env[key] !== undefined
+					? process.env[key]
+					: this.defaultValues[key];
+
+			if (value === undefined) {
+				compiler.hooks.thisCompilation.tap("EnvironmentPlugin", compilation => {
+					const error = new WebpackError(
+						`EnvironmentPlugin - ${key} environment variable is undefined.\n\n` +
+							"You can pass an object with default values to suppress this warning.\n" +
+							"See https://webpack.js.org/plugins/environment-plugin for example."
+					);
+
+					error.name = "EnvVariableNotDefinedError";
+					compilation.warnings.push(error);
+				});
+			}
+
+			defs[`process.env.${key}`] =
+				value === undefined ? "undefined" : JSON.stringify(value);
+
+			return defs;
+		}, {});
+
+		new DefinePlugin(definitions).apply(compiler);
+	}
+}
+
+module.exports = EnvironmentPlugin;
diff --git a/node_modules/webpack/lib/ErrorHelpers.js b/node_modules/webpack/lib/ErrorHelpers.js
new file mode 100644
index 0000000..900ae4d
--- /dev/null
+++ b/node_modules/webpack/lib/ErrorHelpers.js
@@ -0,0 +1,60 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const loaderFlag = "LOADER_EXECUTION";
+
+const webpackOptionsFlag = "WEBPACK_OPTIONS";
+
+exports.cutOffByFlag = (stack, flag) => {
+	stack = stack.split("\n");
+	for (let i = 0; i < stack.length; i++) {
+		if (stack[i].includes(flag)) {
+			stack.length = i;
+		}
+	}
+	return stack.join("\n");
+};
+
+exports.cutOffLoaderExecution = stack =>
+	exports.cutOffByFlag(stack, loaderFlag);
+
+exports.cutOffWebpackOptions = stack =>
+	exports.cutOffByFlag(stack, webpackOptionsFlag);
+
+exports.cutOffMultilineMessage = (stack, message) => {
+	stack = stack.split("\n");
+	message = message.split("\n");
+
+	return stack
+		.reduce(
+			(acc, line, idx) =>
+				line.includes(message[idx]) ? acc : acc.concat(line),
+			[]
+		)
+		.join("\n");
+};
+
+exports.cutOffMessage = (stack, message) => {
+	const nextLine = stack.indexOf("\n");
+	if (nextLine === -1) {
+		return stack === message ? "" : stack;
+	} else {
+		const firstLine = stack.substr(0, nextLine);
+		return firstLine === message ? stack.substr(nextLine + 1) : stack;
+	}
+};
+
+exports.cleanUp = (stack, message) => {
+	stack = exports.cutOffLoaderExecution(stack);
+	stack = exports.cutOffMessage(stack, message);
+	return stack;
+};
+
+exports.cleanUpWebpackOptions = (stack, message) => {
+	stack = exports.cutOffWebpackOptions(stack);
+	stack = exports.cutOffMultilineMessage(stack, message);
+	return stack;
+};
diff --git a/node_modules/webpack/lib/EvalDevToolModulePlugin.js b/node_modules/webpack/lib/EvalDevToolModulePlugin.js
new file mode 100644
index 0000000..2af11f9
--- /dev/null
+++ b/node_modules/webpack/lib/EvalDevToolModulePlugin.js
@@ -0,0 +1,27 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const EvalDevToolModuleTemplatePlugin = require("./EvalDevToolModuleTemplatePlugin");
+
+class EvalDevToolModulePlugin {
+	constructor(options) {
+		this.sourceUrlComment = options.sourceUrlComment;
+		this.moduleFilenameTemplate = options.moduleFilenameTemplate;
+		this.namespace = options.namespace;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap("EvalDevToolModulePlugin", compilation => {
+			new EvalDevToolModuleTemplatePlugin({
+				sourceUrlComment: this.sourceUrlComment,
+				moduleFilenameTemplate: this.moduleFilenameTemplate,
+				namespace: this.namespace
+			}).apply(compilation.moduleTemplates.javascript);
+		});
+	}
+}
+
+module.exports = EvalDevToolModulePlugin;
diff --git a/node_modules/webpack/lib/EvalDevToolModuleTemplatePlugin.js b/node_modules/webpack/lib/EvalDevToolModuleTemplatePlugin.js
new file mode 100644
index 0000000..ab5dd1a
--- /dev/null
+++ b/node_modules/webpack/lib/EvalDevToolModuleTemplatePlugin.js
@@ -0,0 +1,61 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { RawSource } = require("webpack-sources");
+const ModuleFilenameHelpers = require("./ModuleFilenameHelpers");
+
+const cache = new WeakMap();
+
+class EvalDevToolModuleTemplatePlugin {
+	constructor(options) {
+		this.sourceUrlComment = options.sourceUrlComment || "\n//# sourceURL=[url]";
+		this.moduleFilenameTemplate =
+			options.moduleFilenameTemplate ||
+			"webpack://[namespace]/[resourcePath]?[loaders]";
+		this.namespace = options.namespace || "";
+	}
+
+	apply(moduleTemplate) {
+		moduleTemplate.hooks.module.tap(
+			"EvalDevToolModuleTemplatePlugin",
+			(source, module) => {
+				const cacheEntry = cache.get(source);
+				if (cacheEntry !== undefined) return cacheEntry;
+				const content = source.source();
+				const str = ModuleFilenameHelpers.createFilename(
+					module,
+					{
+						moduleFilenameTemplate: this.moduleFilenameTemplate,
+						namespace: this.namespace
+					},
+					moduleTemplate.runtimeTemplate.requestShortener
+				);
+				const footer =
+					"\n" +
+					this.sourceUrlComment.replace(
+						/\[url\]/g,
+						encodeURI(str)
+							.replace(/%2F/g, "/")
+							.replace(/%20/g, "_")
+							.replace(/%5E/g, "^")
+							.replace(/%5C/g, "\\")
+							.replace(/^\//, "")
+					);
+				const result = new RawSource(
+					`eval(${JSON.stringify(content + footer)});`
+				);
+				cache.set(source, result);
+				return result;
+			}
+		);
+		moduleTemplate.hooks.hash.tap("EvalDevToolModuleTemplatePlugin", hash => {
+			hash.update("EvalDevToolModuleTemplatePlugin");
+			hash.update("2");
+		});
+	}
+}
+
+module.exports = EvalDevToolModuleTemplatePlugin;
diff --git a/node_modules/webpack/lib/EvalSourceMapDevToolModuleTemplatePlugin.js b/node_modules/webpack/lib/EvalSourceMapDevToolModuleTemplatePlugin.js
new file mode 100644
index 0000000..73659fc
--- /dev/null
+++ b/node_modules/webpack/lib/EvalSourceMapDevToolModuleTemplatePlugin.js
@@ -0,0 +1,120 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { RawSource } = require("webpack-sources");
+const ModuleFilenameHelpers = require("./ModuleFilenameHelpers");
+const { absolutify } = require("./util/identifier");
+
+const cache = new WeakMap();
+
+class EvalSourceMapDevToolModuleTemplatePlugin {
+	constructor(compilation, options) {
+		this.compilation = compilation;
+		this.sourceMapComment =
+			options.append || "//# sourceURL=[module]\n//# sourceMappingURL=[url]";
+		this.moduleFilenameTemplate =
+			options.moduleFilenameTemplate ||
+			"webpack://[namespace]/[resource-path]?[hash]";
+		this.namespace = options.namespace || "";
+		this.options = options;
+	}
+
+	apply(moduleTemplate) {
+		const self = this;
+		const options = this.options;
+		const matchModule = ModuleFilenameHelpers.matchObject.bind(
+			ModuleFilenameHelpers,
+			options
+		);
+		moduleTemplate.hooks.module.tap(
+			"EvalSourceMapDevToolModuleTemplatePlugin",
+			(source, module) => {
+				const cachedSource = cache.get(source);
+				if (cachedSource !== undefined) {
+					return cachedSource;
+				}
+
+				if (!matchModule(module.resource)) {
+					return source;
+				}
+
+				/** @type {{ [key: string]: TODO; }} */
+				let sourceMap;
+				let content;
+				if (source.sourceAndMap) {
+					const sourceAndMap = source.sourceAndMap(options);
+					sourceMap = sourceAndMap.map;
+					content = sourceAndMap.source;
+				} else {
+					sourceMap = source.map(options);
+					content = source.source();
+				}
+				if (!sourceMap) {
+					return source;
+				}
+
+				// Clone (flat) the sourcemap to ensure that the mutations below do not persist.
+				sourceMap = Object.keys(sourceMap).reduce((obj, key) => {
+					obj[key] = sourceMap[key];
+					return obj;
+				}, {});
+				const context = this.compilation.compiler.options.context;
+				const modules = sourceMap.sources.map(source => {
+					if (source.startsWith("webpack://")) {
+						source = absolutify(context, source.slice(10));
+					}
+					const module = self.compilation.findModule(source);
+					return module || source;
+				});
+				let moduleFilenames = modules.map(module => {
+					return ModuleFilenameHelpers.createFilename(
+						module,
+						{
+							moduleFilenameTemplate: self.moduleFilenameTemplate,
+							namespace: self.namespace
+						},
+						moduleTemplate.runtimeTemplate.requestShortener
+					);
+				});
+				moduleFilenames = ModuleFilenameHelpers.replaceDuplicates(
+					moduleFilenames,
+					(filename, i, n) => {
+						for (let j = 0; j < n; j++) filename += "*";
+						return filename;
+					}
+				);
+				sourceMap.sources = moduleFilenames;
+				sourceMap.sourceRoot = options.sourceRoot || "";
+				sourceMap.file = `${module.id}.js`;
+
+				const footer =
+					self.sourceMapComment.replace(
+						/\[url\]/g,
+						`data:application/json;charset=utf-8;base64,${Buffer.from(
+							JSON.stringify(sourceMap),
+							"utf8"
+						).toString("base64")}`
+					) + `\n//# sourceURL=webpack-internal:///${module.id}\n`; // workaround for chrome bug
+
+				const evalSource = new RawSource(
+					`eval(${JSON.stringify(content + footer)});`
+				);
+
+				cache.set(source, evalSource);
+
+				return evalSource;
+			}
+		);
+		moduleTemplate.hooks.hash.tap(
+			"EvalSourceMapDevToolModuleTemplatePlugin",
+			hash => {
+				hash.update("eval-source-map");
+				hash.update("2");
+			}
+		);
+	}
+}
+module.exports = EvalSourceMapDevToolModuleTemplatePlugin;
diff --git a/node_modules/webpack/lib/EvalSourceMapDevToolPlugin.js b/node_modules/webpack/lib/EvalSourceMapDevToolPlugin.js
new file mode 100644
index 0000000..daf9aad
--- /dev/null
+++ b/node_modules/webpack/lib/EvalSourceMapDevToolPlugin.js
@@ -0,0 +1,41 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const EvalSourceMapDevToolModuleTemplatePlugin = require("./EvalSourceMapDevToolModuleTemplatePlugin");
+const SourceMapDevToolModuleOptionsPlugin = require("./SourceMapDevToolModuleOptionsPlugin");
+
+class EvalSourceMapDevToolPlugin {
+	constructor(options) {
+		if (arguments.length > 1) {
+			throw new Error(
+				"EvalSourceMapDevToolPlugin only takes one argument (pass an options object)"
+			);
+		}
+		if (typeof options === "string") {
+			options = {
+				append: options
+			};
+		}
+		if (!options) options = {};
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		compiler.hooks.compilation.tap(
+			"EvalSourceMapDevToolPlugin",
+			compilation => {
+				new SourceMapDevToolModuleOptionsPlugin(options).apply(compilation);
+				new EvalSourceMapDevToolModuleTemplatePlugin(
+					compilation,
+					options
+				).apply(compilation.moduleTemplates.javascript);
+			}
+		);
+	}
+}
+
+module.exports = EvalSourceMapDevToolPlugin;
diff --git a/node_modules/webpack/lib/ExportPropertyMainTemplatePlugin.js b/node_modules/webpack/lib/ExportPropertyMainTemplatePlugin.js
new file mode 100644
index 0000000..90df031
--- /dev/null
+++ b/node_modules/webpack/lib/ExportPropertyMainTemplatePlugin.js
@@ -0,0 +1,53 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+
+/** @typedef {import("./Compilation")} Compilation */
+
+/**
+ * @param {string[]} accessor the accessor to convert to path
+ * @returns {string} the path
+ */
+const accessorToObjectAccess = accessor => {
+	return accessor.map(a => `[${JSON.stringify(a)}]`).join("");
+};
+
+class ExportPropertyMainTemplatePlugin {
+	/**
+	 * @param {string|string[]} property the name of the property to export
+	 */
+	constructor(property) {
+		this.property = property;
+	}
+
+	/**
+	 * @param {Compilation} compilation the compilation instance
+	 * @returns {void}
+	 */
+	apply(compilation) {
+		const { mainTemplate, chunkTemplate } = compilation;
+
+		const onRenderWithEntry = (source, chunk, hash) => {
+			const postfix = `${accessorToObjectAccess([].concat(this.property))}`;
+			return new ConcatSource(source, postfix);
+		};
+
+		for (const template of [mainTemplate, chunkTemplate]) {
+			template.hooks.renderWithEntry.tap(
+				"ExportPropertyMainTemplatePlugin",
+				onRenderWithEntry
+			);
+		}
+
+		mainTemplate.hooks.hash.tap("ExportPropertyMainTemplatePlugin", hash => {
+			hash.update("export property");
+			hash.update(`${this.property}`);
+		});
+	}
+}
+
+module.exports = ExportPropertyMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/ExtendedAPIPlugin.js b/node_modules/webpack/lib/ExtendedAPIPlugin.js
new file mode 100644
index 0000000..e41defb
--- /dev/null
+++ b/node_modules/webpack/lib/ExtendedAPIPlugin.js
@@ -0,0 +1,88 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Template = require("./Template");
+const ConstDependency = require("./dependencies/ConstDependency");
+const ParserHelpers = require("./ParserHelpers");
+const NullFactory = require("./NullFactory");
+
+const REPLACEMENTS = {
+	// eslint-disable-next-line camelcase
+	__webpack_hash__: "__webpack_require__.h",
+	// eslint-disable-next-line camelcase
+	__webpack_chunkname__: "__webpack_require__.cn"
+};
+const REPLACEMENT_TYPES = {
+	// eslint-disable-next-line camelcase
+	__webpack_hash__: "string",
+	// eslint-disable-next-line camelcase
+	__webpack_chunkname__: "string"
+};
+
+class ExtendedAPIPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"ExtendedAPIPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+
+				const mainTemplate = compilation.mainTemplate;
+				mainTemplate.hooks.requireExtensions.tap(
+					"ExtendedAPIPlugin",
+					(source, chunk, hash) => {
+						const buf = [source];
+						buf.push("");
+						buf.push("// __webpack_hash__");
+						buf.push(`${mainTemplate.requireFn}.h = ${JSON.stringify(hash)};`);
+						buf.push("");
+						buf.push("// __webpack_chunkname__");
+						buf.push(
+							`${mainTemplate.requireFn}.cn = ${JSON.stringify(chunk.name)};`
+						);
+						return Template.asString(buf);
+					}
+				);
+				mainTemplate.hooks.globalHash.tap("ExtendedAPIPlugin", () => true);
+
+				const handler = (parser, parserOptions) => {
+					Object.keys(REPLACEMENTS).forEach(key => {
+						parser.hooks.expression
+							.for(key)
+							.tap(
+								"ExtendedAPIPlugin",
+								ParserHelpers.toConstantDependencyWithWebpackRequire(
+									parser,
+									REPLACEMENTS[key]
+								)
+							);
+						parser.hooks.evaluateTypeof
+							.for(key)
+							.tap(
+								"ExtendedAPIPlugin",
+								ParserHelpers.evaluateToString(REPLACEMENT_TYPES[key])
+							);
+					});
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("ExtendedAPIPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("ExtendedAPIPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/esm")
+					.tap("ExtendedAPIPlugin", handler);
+			}
+		);
+	}
+}
+
+module.exports = ExtendedAPIPlugin;
diff --git a/node_modules/webpack/lib/ExternalModule.js b/node_modules/webpack/lib/ExternalModule.js
new file mode 100644
index 0000000..e2da635
--- /dev/null
+++ b/node_modules/webpack/lib/ExternalModule.js
@@ -0,0 +1,179 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { OriginalSource, RawSource } = require("webpack-sources");
+const Module = require("./Module");
+const WebpackMissingModule = require("./dependencies/WebpackMissingModule");
+const Template = require("./Template");
+
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+class ExternalModule extends Module {
+	constructor(request, type, userRequest) {
+		super("javascript/dynamic", null);
+
+		// Info from Factory
+		this.request = request;
+		this.externalType = type;
+		this.userRequest = userRequest;
+		this.external = true;
+	}
+
+	libIdent() {
+		return this.userRequest;
+	}
+
+	chunkCondition(chunk) {
+		return chunk.hasEntryModule();
+	}
+
+	identifier() {
+		return "external " + JSON.stringify(this.request);
+	}
+
+	readableIdentifier() {
+		return "external " + JSON.stringify(this.request);
+	}
+
+	needRebuild() {
+		return false;
+	}
+
+	build(options, compilation, resolver, fs, callback) {
+		this.built = true;
+		this.buildMeta = {};
+		this.buildInfo = {};
+		callback();
+	}
+
+	getSourceForGlobalVariableExternal(variableName, type) {
+		if (!Array.isArray(variableName)) {
+			// make it an array as the look up works the same basically
+			variableName = [variableName];
+		}
+
+		// needed for e.g. window["some"]["thing"]
+		const objectLookup = variableName
+			.map(r => `[${JSON.stringify(r)}]`)
+			.join("");
+		return `(function() { module.exports = ${type}${objectLookup}; }());`;
+	}
+
+	getSourceForCommonJsExternal(moduleAndSpecifiers) {
+		if (!Array.isArray(moduleAndSpecifiers)) {
+			return `module.exports = require(${JSON.stringify(
+				moduleAndSpecifiers
+			)});`;
+		}
+
+		const moduleName = moduleAndSpecifiers[0];
+		const objectLookup = moduleAndSpecifiers
+			.slice(1)
+			.map(r => `[${JSON.stringify(r)}]`)
+			.join("");
+		return `module.exports = require(${JSON.stringify(
+			moduleName
+		)})${objectLookup};`;
+	}
+
+	checkExternalVariable(variableToCheck, request) {
+		return `if(typeof ${variableToCheck} === 'undefined') {${WebpackMissingModule.moduleCode(
+			request
+		)}}\n`;
+	}
+
+	getSourceForAmdOrUmdExternal(id, optional, request) {
+		const externalVariable = `__WEBPACK_EXTERNAL_MODULE_${Template.toIdentifier(
+			`${id}`
+		)}__`;
+		const missingModuleError = optional
+			? this.checkExternalVariable(externalVariable, request)
+			: "";
+		return `${missingModuleError}module.exports = ${externalVariable};`;
+	}
+
+	getSourceForDefaultCase(optional, request) {
+		if (!Array.isArray(request)) {
+			// make it an array as the look up works the same basically
+			request = [request];
+		}
+
+		const variableName = request[0];
+		const missingModuleError = optional
+			? this.checkExternalVariable(variableName, request.join("."))
+			: "";
+		const objectLookup = request
+			.slice(1)
+			.map(r => `[${JSON.stringify(r)}]`)
+			.join("");
+		return `${missingModuleError}module.exports = ${variableName}${objectLookup};`;
+	}
+
+	getSourceString(runtime) {
+		const request =
+			typeof this.request === "object" && !Array.isArray(this.request)
+				? this.request[this.externalType]
+				: this.request;
+		switch (this.externalType) {
+			case "this":
+			case "window":
+			case "self":
+				return this.getSourceForGlobalVariableExternal(
+					request,
+					this.externalType
+				);
+			case "global":
+				return this.getSourceForGlobalVariableExternal(
+					request,
+					runtime.outputOptions.globalObject
+				);
+			case "commonjs":
+			case "commonjs2":
+				return this.getSourceForCommonJsExternal(request);
+			case "amd":
+			case "amd-require":
+			case "umd":
+			case "umd2":
+			case "system":
+				return this.getSourceForAmdOrUmdExternal(
+					this.id,
+					this.optional,
+					request
+				);
+			default:
+				return this.getSourceForDefaultCase(this.optional, request);
+		}
+	}
+
+	getSource(sourceString) {
+		if (this.useSourceMap) {
+			return new OriginalSource(sourceString, this.identifier());
+		}
+
+		return new RawSource(sourceString);
+	}
+
+	source(dependencyTemplates, runtime) {
+		return this.getSource(this.getSourceString(runtime));
+	}
+
+	size() {
+		return 42;
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track dependencies
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update(this.externalType);
+		hash.update(JSON.stringify(this.request));
+		hash.update(JSON.stringify(Boolean(this.optional)));
+		super.updateHash(hash);
+	}
+}
+
+module.exports = ExternalModule;
diff --git a/node_modules/webpack/lib/ExternalModuleFactoryPlugin.js b/node_modules/webpack/lib/ExternalModuleFactoryPlugin.js
new file mode 100644
index 0000000..b75cc74
--- /dev/null
+++ b/node_modules/webpack/lib/ExternalModuleFactoryPlugin.js
@@ -0,0 +1,110 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ExternalModule = require("./ExternalModule");
+
+class ExternalModuleFactoryPlugin {
+	constructor(type, externals) {
+		this.type = type;
+		this.externals = externals;
+	}
+
+	apply(normalModuleFactory) {
+		const globalType = this.type;
+		normalModuleFactory.hooks.factory.tap(
+			"ExternalModuleFactoryPlugin",
+			factory => (data, callback) => {
+				const context = data.context;
+				const dependency = data.dependencies[0];
+
+				const handleExternal = (value, type, callback) => {
+					if (typeof type === "function") {
+						callback = type;
+						type = undefined;
+					}
+					if (value === false) return factory(data, callback);
+					if (value === true) value = dependency.request;
+					if (type === undefined && /^[a-z0-9]+ /.test(value)) {
+						const idx = value.indexOf(" ");
+						type = value.substr(0, idx);
+						value = value.substr(idx + 1);
+					}
+					callback(
+						null,
+						new ExternalModule(value, type || globalType, dependency.request)
+					);
+					return true;
+				};
+
+				const handleExternals = (externals, callback) => {
+					if (typeof externals === "string") {
+						if (externals === dependency.request) {
+							return handleExternal(dependency.request, callback);
+						}
+					} else if (Array.isArray(externals)) {
+						let i = 0;
+						const next = () => {
+							let asyncFlag;
+							const handleExternalsAndCallback = (err, module) => {
+								if (err) return callback(err);
+								if (!module) {
+									if (asyncFlag) {
+										asyncFlag = false;
+										return;
+									}
+									return next();
+								}
+								callback(null, module);
+							};
+
+							do {
+								asyncFlag = true;
+								if (i >= externals.length) return callback();
+								handleExternals(externals[i++], handleExternalsAndCallback);
+							} while (!asyncFlag);
+							asyncFlag = false;
+						};
+
+						next();
+						return;
+					} else if (externals instanceof RegExp) {
+						if (externals.test(dependency.request)) {
+							return handleExternal(dependency.request, callback);
+						}
+					} else if (typeof externals === "function") {
+						externals.call(
+							null,
+							context,
+							dependency.request,
+							(err, value, type) => {
+								if (err) return callback(err);
+								if (value !== undefined) {
+									handleExternal(value, type, callback);
+								} else {
+									callback();
+								}
+							}
+						);
+						return;
+					} else if (
+						typeof externals === "object" &&
+						Object.prototype.hasOwnProperty.call(externals, dependency.request)
+					) {
+						return handleExternal(externals[dependency.request], callback);
+					}
+					callback();
+				};
+
+				handleExternals(this.externals, (err, module) => {
+					if (err) return callback(err);
+					if (!module) return handleExternal(false, callback);
+					return callback(null, module);
+				});
+			}
+		);
+	}
+}
+module.exports = ExternalModuleFactoryPlugin;
diff --git a/node_modules/webpack/lib/ExternalsPlugin.js b/node_modules/webpack/lib/ExternalsPlugin.js
new file mode 100644
index 0000000..697f1aa
--- /dev/null
+++ b/node_modules/webpack/lib/ExternalsPlugin.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ExternalModuleFactoryPlugin = require("./ExternalModuleFactoryPlugin");
+
+class ExternalsPlugin {
+	constructor(type, externals) {
+		this.type = type;
+		this.externals = externals;
+	}
+	apply(compiler) {
+		compiler.hooks.compile.tap("ExternalsPlugin", ({ normalModuleFactory }) => {
+			new ExternalModuleFactoryPlugin(this.type, this.externals).apply(
+				normalModuleFactory
+			);
+		});
+	}
+}
+
+module.exports = ExternalsPlugin;
diff --git a/node_modules/webpack/lib/FlagAllModulesAsUsedPlugin.js b/node_modules/webpack/lib/FlagAllModulesAsUsedPlugin.js
new file mode 100644
index 0000000..db783cf
--- /dev/null
+++ b/node_modules/webpack/lib/FlagAllModulesAsUsedPlugin.js
@@ -0,0 +1,38 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+/** @typedef {import("./Compiler")} Compiler */
+
+class FlagAllModulesAsUsedPlugin {
+	constructor(explanation) {
+		this.explanation = explanation;
+	}
+
+	/**
+	 * @param {Compiler} compiler webpack compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"FlagAllModulesAsUsedPlugin",
+			compilation => {
+				compilation.hooks.optimizeDependencies.tap(
+					"FlagAllModulesAsUsedPlugin",
+					modules => {
+						for (const module of modules) {
+							module.used = true;
+							module.usedExports = true;
+							module.addReason(null, null, this.explanation);
+						}
+					}
+				);
+			}
+		);
+	}
+}
+
+module.exports = FlagAllModulesAsUsedPlugin;
diff --git a/node_modules/webpack/lib/FlagDependencyExportsPlugin.js b/node_modules/webpack/lib/FlagDependencyExportsPlugin.js
new file mode 100644
index 0000000..72231df
--- /dev/null
+++ b/node_modules/webpack/lib/FlagDependencyExportsPlugin.js
@@ -0,0 +1,174 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Queue = require("./util/Queue");
+
+const addToSet = (a, b) => {
+	for (const item of b) {
+		a.add(item);
+	}
+};
+
+class FlagDependencyExportsPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"FlagDependencyExportsPlugin",
+			compilation => {
+				compilation.hooks.finishModules.tap(
+					"FlagDependencyExportsPlugin",
+					modules => {
+						const dependencies = new Map();
+
+						const queue = new Queue();
+
+						let module;
+						let moduleWithExports;
+						let moduleProvidedExports;
+						let providedExportsAreTemporary;
+
+						const processDependenciesBlock = depBlock => {
+							for (const dep of depBlock.dependencies) {
+								if (processDependency(dep)) return true;
+							}
+							for (const variable of depBlock.variables) {
+								for (const dep of variable.dependencies) {
+									if (processDependency(dep)) return true;
+								}
+							}
+							for (const block of depBlock.blocks) {
+								if (processDependenciesBlock(block)) return true;
+							}
+							return false;
+						};
+
+						const processDependency = dep => {
+							const exportDesc = dep.getExports && dep.getExports();
+							if (!exportDesc) return;
+							moduleWithExports = true;
+							const exports = exportDesc.exports;
+							// break early if it's only in the worst state
+							if (module.buildMeta.providedExports === true) {
+								return true;
+							}
+							// break if it should move to the worst state
+							if (exports === true) {
+								module.buildMeta.providedExports = true;
+								return true;
+							}
+							// merge in new exports
+							if (Array.isArray(exports)) {
+								addToSet(moduleProvidedExports, exports);
+							}
+							// store dependencies
+							const exportDeps = exportDesc.dependencies;
+							if (exportDeps) {
+								providedExportsAreTemporary = true;
+								for (const exportDependency of exportDeps) {
+									// add dependency for this module
+									const set = dependencies.get(exportDependency);
+									if (set === undefined) {
+										dependencies.set(exportDependency, new Set([module]));
+									} else {
+										set.add(module);
+									}
+								}
+							}
+							return false;
+						};
+
+						const notifyDependencies = () => {
+							const deps = dependencies.get(module);
+							if (deps !== undefined) {
+								for (const dep of deps) {
+									queue.enqueue(dep);
+								}
+							}
+						};
+
+						const notifyDependenciesIfDifferent = (set, array) => {
+							const deps = dependencies.get(module);
+							if (deps !== undefined) {
+								if (set.size === array.length) {
+									let i = 0;
+									let different = false;
+									for (const item of set) {
+										if (item !== array[i++]) {
+											different = true;
+											break;
+										}
+									}
+									if (!different) return;
+								}
+								for (const dep of deps) {
+									queue.enqueue(dep);
+								}
+							}
+						};
+
+						// Start with all modules without provided exports
+						for (const module of modules) {
+							if (module.buildInfo.temporaryProvidedExports) {
+								// Clear exports when they are temporary
+								// and recreate them
+								module.buildMeta.providedExports = null;
+								queue.enqueue(module);
+							} else if (!module.buildMeta.providedExports) {
+								queue.enqueue(module);
+							}
+						}
+
+						while (queue.length > 0) {
+							module = queue.dequeue();
+
+							if (module.buildMeta.providedExports !== true) {
+								moduleWithExports =
+									module.buildMeta && module.buildMeta.exportsType;
+								moduleProvidedExports = new Set();
+								providedExportsAreTemporary = false;
+								processDependenciesBlock(module);
+								module.buildInfo.temporaryProvidedExports = providedExportsAreTemporary;
+								if (!moduleWithExports) {
+									notifyDependencies();
+									module.buildMeta.providedExports = true;
+								} else if (module.buildMeta.providedExports === true) {
+									notifyDependencies();
+								} else if (!module.buildMeta.providedExports) {
+									notifyDependencies();
+									module.buildMeta.providedExports = Array.from(
+										moduleProvidedExports
+									);
+								} else {
+									notifyDependenciesIfDifferent(
+										moduleProvidedExports,
+										module.buildMeta.providedExports
+									);
+									module.buildMeta.providedExports = Array.from(
+										moduleProvidedExports
+									);
+								}
+							}
+						}
+					}
+				);
+				const providedExportsCache = new WeakMap();
+				compilation.hooks.rebuildModule.tap(
+					"FlagDependencyExportsPlugin",
+					module => {
+						providedExportsCache.set(module, module.buildMeta.providedExports);
+					}
+				);
+				compilation.hooks.finishRebuildingModule.tap(
+					"FlagDependencyExportsPlugin",
+					module => {
+						module.buildMeta.providedExports = providedExportsCache.get(module);
+					}
+				);
+			}
+		);
+	}
+}
+
+module.exports = FlagDependencyExportsPlugin;
diff --git a/node_modules/webpack/lib/FlagDependencyUsagePlugin.js b/node_modules/webpack/lib/FlagDependencyUsagePlugin.js
new file mode 100644
index 0000000..2f2a52e
--- /dev/null
+++ b/node_modules/webpack/lib/FlagDependencyUsagePlugin.js
@@ -0,0 +1,116 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./DependenciesBlock")} DependenciesBlock */
+
+/** @typedef {false | true | string[]} UsedExports */
+
+const addToSet = (a, b) => {
+	for (const item of b) {
+		if (!a.includes(item)) a.push(item);
+	}
+	return a;
+};
+
+const isSubset = (biggerSet, subset) => {
+	if (biggerSet === true) return true;
+	if (subset === true) return false;
+	return subset.every(item => biggerSet.indexOf(item) >= 0);
+};
+
+class FlagDependencyUsagePlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap("FlagDependencyUsagePlugin", compilation => {
+			compilation.hooks.optimizeDependencies.tap(
+				"FlagDependencyUsagePlugin",
+				modules => {
+					const processModule = (module, usedExports) => {
+						module.used = true;
+						if (module.usedExports === true) return;
+						if (usedExports === true) {
+							module.usedExports = true;
+						} else if (Array.isArray(usedExports)) {
+							const old = module.usedExports ? module.usedExports.length : -1;
+							module.usedExports = addToSet(
+								module.usedExports || [],
+								usedExports
+							);
+							if (module.usedExports.length === old) {
+								return;
+							}
+						} else if (Array.isArray(module.usedExports)) {
+							return;
+						} else {
+							module.usedExports = false;
+						}
+
+						// for a module without side effects we stop tracking usage here when no export is used
+						// This module won't be evaluated in this case
+						if (module.factoryMeta.sideEffectFree) {
+							if (module.usedExports === false) return;
+							if (
+								Array.isArray(module.usedExports) &&
+								module.usedExports.length === 0
+							)
+								return;
+						}
+
+						queue.push([module, module, module.usedExports]);
+					};
+
+					const processDependenciesBlock = (module, depBlock, usedExports) => {
+						for (const dep of depBlock.dependencies) {
+							processDependency(module, dep);
+						}
+						for (const variable of depBlock.variables) {
+							for (const dep of variable.dependencies) {
+								processDependency(module, dep);
+							}
+						}
+						for (const block of depBlock.blocks) {
+							queue.push([module, block, usedExports]);
+						}
+					};
+
+					const processDependency = (module, dep) => {
+						const reference = compilation.getDependencyReference(module, dep);
+						if (!reference) return;
+						const referenceModule = reference.module;
+						const importedNames = reference.importedNames;
+						const oldUsed = referenceModule.used;
+						const oldUsedExports = referenceModule.usedExports;
+						if (
+							!oldUsed ||
+							(importedNames &&
+								(!oldUsedExports || !isSubset(oldUsedExports, importedNames)))
+						) {
+							processModule(referenceModule, importedNames);
+						}
+					};
+
+					for (const module of modules) {
+						if (!module.used) module.used = false;
+					}
+
+					/** @type {[Module, DependenciesBlock, UsedExports][]} */
+					const queue = [];
+					for (const preparedEntrypoint of compilation._preparedEntrypoints) {
+						if (preparedEntrypoint.module) {
+							processModule(preparedEntrypoint.module, true);
+						}
+					}
+
+					while (queue.length) {
+						const queueItem = queue.pop();
+						processDependenciesBlock(queueItem[0], queueItem[1], queueItem[2]);
+					}
+				}
+			);
+		});
+	}
+}
+module.exports = FlagDependencyUsagePlugin;
diff --git a/node_modules/webpack/lib/FlagInitialModulesAsUsedPlugin.js b/node_modules/webpack/lib/FlagInitialModulesAsUsedPlugin.js
new file mode 100644
index 0000000..7272ddb
--- /dev/null
+++ b/node_modules/webpack/lib/FlagInitialModulesAsUsedPlugin.js
@@ -0,0 +1,36 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class FlagInitialModulesAsUsedPlugin {
+	constructor(explanation) {
+		this.explanation = explanation;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"FlagInitialModulesAsUsedPlugin",
+			compilation => {
+				compilation.hooks.afterOptimizeChunks.tap(
+					"FlagInitialModulesAsUsedPlugin",
+					chunks => {
+						for (const chunk of chunks) {
+							if (!chunk.isOnlyInitial()) {
+								return;
+							}
+							for (const module of chunk.modulesIterable) {
+								module.used = true;
+								module.usedExports = true;
+								module.addReason(null, null, this.explanation);
+							}
+						}
+					}
+				);
+			}
+		);
+	}
+}
+
+module.exports = FlagInitialModulesAsUsedPlugin;
diff --git a/node_modules/webpack/lib/FunctionModulePlugin.js b/node_modules/webpack/lib/FunctionModulePlugin.js
new file mode 100644
index 0000000..fc4b270
--- /dev/null
+++ b/node_modules/webpack/lib/FunctionModulePlugin.js
@@ -0,0 +1,19 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const FunctionModuleTemplatePlugin = require("./FunctionModuleTemplatePlugin");
+
+class FunctionModulePlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap("FunctionModulePlugin", compilation => {
+			new FunctionModuleTemplatePlugin().apply(
+				compilation.moduleTemplates.javascript
+			);
+		});
+	}
+}
+
+module.exports = FunctionModulePlugin;
diff --git a/node_modules/webpack/lib/FunctionModuleTemplatePlugin.js b/node_modules/webpack/lib/FunctionModuleTemplatePlugin.js
new file mode 100644
index 0000000..3402d99
--- /dev/null
+++ b/node_modules/webpack/lib/FunctionModuleTemplatePlugin.js
@@ -0,0 +1,102 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+const Template = require("./Template");
+
+class FunctionModuleTemplatePlugin {
+	apply(moduleTemplate) {
+		moduleTemplate.hooks.render.tap(
+			"FunctionModuleTemplatePlugin",
+			(moduleSource, module) => {
+				const source = new ConcatSource();
+				const args = [module.moduleArgument];
+				// TODO remove HACK checking type for javascript
+				if (module.type && module.type.startsWith("javascript")) {
+					args.push(module.exportsArgument);
+					if (module.hasDependencies(d => d.requireWebpackRequire !== false)) {
+						args.push("__webpack_require__");
+					}
+				} else if (module.type && module.type.startsWith("json")) {
+					// no additional arguments needed
+				} else {
+					args.push(module.exportsArgument, "__webpack_require__");
+				}
+				source.add("/***/ (function(" + args.join(", ") + ") {\n\n");
+				if (module.buildInfo.strict) source.add('"use strict";\n');
+				source.add(moduleSource);
+				source.add("\n\n/***/ })");
+				return source;
+			}
+		);
+
+		moduleTemplate.hooks.package.tap(
+			"FunctionModuleTemplatePlugin",
+			(moduleSource, module) => {
+				if (moduleTemplate.runtimeTemplate.outputOptions.pathinfo) {
+					const source = new ConcatSource();
+					const req = module.readableIdentifier(
+						moduleTemplate.runtimeTemplate.requestShortener
+					);
+					const reqStr = req.replace(/\*\//g, "*_/");
+					const reqStrStar = "*".repeat(reqStr.length);
+					source.add("/*!****" + reqStrStar + "****!*\\\n");
+					source.add("  !*** " + reqStr + " ***!\n");
+					source.add("  \\****" + reqStrStar + "****/\n");
+					if (
+						Array.isArray(module.buildMeta.providedExports) &&
+						module.buildMeta.providedExports.length === 0
+					) {
+						source.add(Template.toComment("no exports provided") + "\n");
+					} else if (Array.isArray(module.buildMeta.providedExports)) {
+						source.add(
+							Template.toComment(
+								"exports provided: " +
+									module.buildMeta.providedExports.join(", ")
+							) + "\n"
+						);
+					} else if (module.buildMeta.providedExports) {
+						source.add(Template.toComment("no static exports found") + "\n");
+					}
+					if (
+						Array.isArray(module.usedExports) &&
+						module.usedExports.length === 0
+					) {
+						source.add(Template.toComment("no exports used") + "\n");
+					} else if (Array.isArray(module.usedExports)) {
+						source.add(
+							Template.toComment(
+								"exports used: " + module.usedExports.join(", ")
+							) + "\n"
+						);
+					} else if (module.usedExports) {
+						source.add(Template.toComment("all exports used") + "\n");
+					}
+					if (module.optimizationBailout) {
+						for (const text of module.optimizationBailout) {
+							let code;
+							if (typeof text === "function") {
+								code = text(moduleTemplate.runtimeTemplate.requestShortener);
+							} else {
+								code = text;
+							}
+							source.add(Template.toComment(`${code}`) + "\n");
+						}
+					}
+					source.add(moduleSource);
+					return source;
+				}
+				return moduleSource;
+			}
+		);
+
+		moduleTemplate.hooks.hash.tap("FunctionModuleTemplatePlugin", hash => {
+			hash.update("FunctionModuleTemplatePlugin");
+			hash.update("2");
+		});
+	}
+}
+module.exports = FunctionModuleTemplatePlugin;
diff --git a/node_modules/webpack/lib/Generator.js b/node_modules/webpack/lib/Generator.js
new file mode 100644
index 0000000..655a9b1
--- /dev/null
+++ b/node_modules/webpack/lib/Generator.js
@@ -0,0 +1,60 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+/** @typedef {import("./NormalModule")} NormalModule */
+/** @typedef {import("./RuntimeTemplate")} RuntimeTemplate */
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("./Dependency").DependencyTemplate} DependencyTemplate */
+
+/**
+ *
+ */
+class Generator {
+	static byType(map) {
+		return new ByTypeGenerator(map);
+	}
+
+	/**
+	 * @abstract
+	 * @param {NormalModule} module module for which the code should be generated
+	 * @param {Map<Function, DependencyTemplate>} dependencyTemplates mapping from dependencies to templates
+	 * @param {RuntimeTemplate} runtimeTemplate the runtime template
+	 * @param {string} type which kind of code should be generated
+	 * @returns {Source} generated code
+	 */
+	generate(module, dependencyTemplates, runtimeTemplate, type) {
+		throw new Error("Generator.generate: must be overridden");
+	}
+}
+
+class ByTypeGenerator extends Generator {
+	constructor(map) {
+		super();
+		this.map = map;
+	}
+
+	/**
+	 * @param {NormalModule} module module for which the code should be generated
+	 * @param {Map<Function, DependencyTemplate>} dependencyTemplates mapping from dependencies to templates
+	 * @param {RuntimeTemplate} runtimeTemplate the runtime template
+	 * @param {string} type which kind of code should be generated
+	 * @returns {Source} generated code
+	 */
+	generate(module, dependencyTemplates, runtimeTemplate, type) {
+		const generator = this.map[type];
+		if (!generator) {
+			throw new Error(`Generator.byType: no generator specified for ${type}`);
+		}
+		return generator.generate(
+			module,
+			dependencyTemplates,
+			runtimeTemplate,
+			type
+		);
+	}
+}
+
+module.exports = Generator;
diff --git a/node_modules/webpack/lib/GraphHelpers.js b/node_modules/webpack/lib/GraphHelpers.js
new file mode 100644
index 0000000..73c5674
--- /dev/null
+++ b/node_modules/webpack/lib/GraphHelpers.js
@@ -0,0 +1,65 @@
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("./ChunkGroup")} ChunkGroup */
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./DependenciesBlock")} DependenciesBlock */
+/** @typedef {import("./AsyncDependenciesBlock")} AsyncDependenciesBlock */
+
+/**
+ * @param {ChunkGroup} chunkGroup the ChunkGroup to connect
+ * @param {Chunk} chunk chunk to tie to ChunkGroup
+ * @returns {void}
+ */
+const connectChunkGroupAndChunk = (chunkGroup, chunk) => {
+	if (chunkGroup.pushChunk(chunk)) {
+		chunk.addGroup(chunkGroup);
+	}
+};
+
+/**
+ * @param {ChunkGroup} parent parent ChunkGroup to connect
+ * @param {ChunkGroup} child child ChunkGroup to connect
+ * @returns {void}
+ */
+const connectChunkGroupParentAndChild = (parent, child) => {
+	if (parent.addChild(child)) {
+		child.addParent(parent);
+	}
+};
+
+/**
+ * @param {Chunk} chunk Chunk to connect to Module
+ * @param {Module} module Module to connect to Chunk
+ * @returns {void}
+ */
+const connectChunkAndModule = (chunk, module) => {
+	if (module.addChunk(chunk)) {
+		chunk.addModule(module);
+	}
+};
+
+/**
+ * @param {Chunk} chunk Chunk being disconnected
+ * @param {Module} module Module being disconnected
+ * @returns {void}
+ */
+const disconnectChunkAndModule = (chunk, module) => {
+	chunk.removeModule(module);
+	module.removeChunk(chunk);
+};
+
+/**
+ * @param {AsyncDependenciesBlock} depBlock DepBlock being tied to ChunkGroup
+ * @param {ChunkGroup} chunkGroup ChunkGroup being tied to DepBlock
+ * @returns {void}
+ */
+const connectDependenciesBlockAndChunkGroup = (depBlock, chunkGroup) => {
+	if (chunkGroup.addBlock(depBlock)) {
+		depBlock.chunkGroup = chunkGroup;
+	}
+};
+
+exports.connectChunkGroupAndChunk = connectChunkGroupAndChunk;
+exports.connectChunkGroupParentAndChild = connectChunkGroupParentAndChild;
+exports.connectChunkAndModule = connectChunkAndModule;
+exports.disconnectChunkAndModule = disconnectChunkAndModule;
+exports.connectDependenciesBlockAndChunkGroup = connectDependenciesBlockAndChunkGroup;
diff --git a/node_modules/webpack/lib/HarmonyLinkingError.js b/node_modules/webpack/lib/HarmonyLinkingError.js
new file mode 100644
index 0000000..78ce16d
--- /dev/null
+++ b/node_modules/webpack/lib/HarmonyLinkingError.js
@@ -0,0 +1,17 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+module.exports = class HarmonyLinkingError extends WebpackError {
+	/** @param {string} message Error message */
+	constructor(message) {
+		super(message);
+		this.name = "HarmonyLinkingError";
+		this.hideStack = true;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/HashedModuleIdsPlugin.js b/node_modules/webpack/lib/HashedModuleIdsPlugin.js
new file mode 100644
index 0000000..7a860f7
--- /dev/null
+++ b/node_modules/webpack/lib/HashedModuleIdsPlugin.js
@@ -0,0 +1,63 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const createHash = require("./util/createHash");
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/HashedModuleIdsPlugin.json");
+
+/** @typedef {import("../declarations/plugins/HashedModuleIdsPlugin").HashedModuleIdsPluginOptions} HashedModuleIdsPluginOptions */
+
+class HashedModuleIdsPlugin {
+	/**
+	 * @param {HashedModuleIdsPluginOptions=} options options object
+	 */
+	constructor(options) {
+		if (!options) options = {};
+
+		validateOptions(schema, options, "Hashed Module Ids Plugin");
+
+		/** @type {HashedModuleIdsPluginOptions} */
+		this.options = Object.assign(
+			{
+				context: null,
+				hashFunction: "md4",
+				hashDigest: "base64",
+				hashDigestLength: 4
+			},
+			options
+		);
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		compiler.hooks.compilation.tap("HashedModuleIdsPlugin", compilation => {
+			const usedIds = new Set();
+			compilation.hooks.beforeModuleIds.tap(
+				"HashedModuleIdsPlugin",
+				modules => {
+					for (const module of modules) {
+						if (module.id === null && module.libIdent) {
+							const id = module.libIdent({
+								context: this.options.context || compiler.options.context
+							});
+							const hash = createHash(options.hashFunction);
+							hash.update(id);
+							const hashId = /** @type {string} */ (hash.digest(
+								options.hashDigest
+							));
+							let len = options.hashDigestLength;
+							while (usedIds.has(hashId.substr(0, len))) len++;
+							module.id = hashId.substr(0, len);
+							usedIds.add(module.id);
+						}
+					}
+				}
+			);
+		});
+	}
+}
+
+module.exports = HashedModuleIdsPlugin;
diff --git a/node_modules/webpack/lib/HotModuleReplacement.runtime.js b/node_modules/webpack/lib/HotModuleReplacement.runtime.js
new file mode 100644
index 0000000..02b3e8c
--- /dev/null
+++ b/node_modules/webpack/lib/HotModuleReplacement.runtime.js
@@ -0,0 +1,721 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+// eslint-disable no-unused-vars
+var $hash$ = undefined;
+var $requestTimeout$ = undefined;
+var installedModules = undefined;
+var $require$ = undefined;
+var hotDownloadManifest = undefined;
+var hotDownloadUpdateChunk = undefined;
+var hotDisposeChunk = undefined;
+var modules = undefined;
+var chunkId = undefined;
+
+module.exports = function() {
+	var hotApplyOnUpdate = true;
+	// eslint-disable-next-line no-unused-vars
+	var hotCurrentHash = $hash$;
+	var hotRequestTimeout = $requestTimeout$;
+	var hotCurrentModuleData = {};
+	var hotCurrentChildModule;
+	// eslint-disable-next-line no-unused-vars
+	var hotCurrentParents = [];
+	// eslint-disable-next-line no-unused-vars
+	var hotCurrentParentsTemp = [];
+
+	// eslint-disable-next-line no-unused-vars
+	function hotCreateRequire(moduleId) {
+		var me = installedModules[moduleId];
+		if (!me) return $require$;
+		var fn = function(request) {
+			if (me.hot.active) {
+				if (installedModules[request]) {
+					if (installedModules[request].parents.indexOf(moduleId) === -1) {
+						installedModules[request].parents.push(moduleId);
+					}
+				} else {
+					hotCurrentParents = [moduleId];
+					hotCurrentChildModule = request;
+				}
+				if (me.children.indexOf(request) === -1) {
+					me.children.push(request);
+				}
+			} else {
+				console.warn(
+					"[HMR] unexpected require(" +
+						request +
+						") from disposed module " +
+						moduleId
+				);
+				hotCurrentParents = [];
+			}
+			return $require$(request);
+		};
+		var ObjectFactory = function ObjectFactory(name) {
+			return {
+				configurable: true,
+				enumerable: true,
+				get: function() {
+					return $require$[name];
+				},
+				set: function(value) {
+					$require$[name] = value;
+				}
+			};
+		};
+		for (var name in $require$) {
+			if (
+				Object.prototype.hasOwnProperty.call($require$, name) &&
+				name !== "e" &&
+				name !== "t"
+			) {
+				Object.defineProperty(fn, name, ObjectFactory(name));
+			}
+		}
+		fn.e = function(chunkId) {
+			if (hotStatus === "ready") hotSetStatus("prepare");
+			hotChunksLoading++;
+			return $require$.e(chunkId).then(finishChunkLoading, function(err) {
+				finishChunkLoading();
+				throw err;
+			});
+
+			function finishChunkLoading() {
+				hotChunksLoading--;
+				if (hotStatus === "prepare") {
+					if (!hotWaitingFilesMap[chunkId]) {
+						hotEnsureUpdateChunk(chunkId);
+					}
+					if (hotChunksLoading === 0 && hotWaitingFiles === 0) {
+						hotUpdateDownloaded();
+					}
+				}
+			}
+		};
+		fn.t = function(value, mode) {
+			if (mode & 1) value = fn(value);
+			return $require$.t(value, mode & ~1);
+		};
+		return fn;
+	}
+
+	// eslint-disable-next-line no-unused-vars
+	function hotCreateModule(moduleId) {
+		var hot = {
+			// private stuff
+			_acceptedDependencies: {},
+			_declinedDependencies: {},
+			_selfAccepted: false,
+			_selfDeclined: false,
+			_selfInvalidated: false,
+			_disposeHandlers: [],
+			_main: hotCurrentChildModule !== moduleId,
+
+			// Module API
+			active: true,
+			accept: function(dep, callback) {
+				if (dep === undefined) hot._selfAccepted = true;
+				else if (typeof dep === "function") hot._selfAccepted = dep;
+				else if (typeof dep === "object")
+					for (var i = 0; i < dep.length; i++)
+						hot._acceptedDependencies[dep[i]] = callback || function() {};
+				else hot._acceptedDependencies[dep] = callback || function() {};
+			},
+			decline: function(dep) {
+				if (dep === undefined) hot._selfDeclined = true;
+				else if (typeof dep === "object")
+					for (var i = 0; i < dep.length; i++)
+						hot._declinedDependencies[dep[i]] = true;
+				else hot._declinedDependencies[dep] = true;
+			},
+			dispose: function(callback) {
+				hot._disposeHandlers.push(callback);
+			},
+			addDisposeHandler: function(callback) {
+				hot._disposeHandlers.push(callback);
+			},
+			removeDisposeHandler: function(callback) {
+				var idx = hot._disposeHandlers.indexOf(callback);
+				if (idx >= 0) hot._disposeHandlers.splice(idx, 1);
+			},
+			invalidate: function() {
+				this._selfInvalidated = true;
+				switch (hotStatus) {
+					case "idle":
+						hotUpdate = {};
+						hotUpdate[moduleId] = modules[moduleId];
+						hotSetStatus("ready");
+						break;
+					case "ready":
+						hotApplyInvalidatedModule(moduleId);
+						break;
+					case "prepare":
+					case "check":
+					case "dispose":
+					case "apply":
+						(hotQueuedInvalidatedModules =
+							hotQueuedInvalidatedModules || []).push(moduleId);
+						break;
+					default:
+						// ignore requests in error states
+						break;
+				}
+			},
+
+			// Management API
+			check: hotCheck,
+			apply: hotApply,
+			status: function(l) {
+				if (!l) return hotStatus;
+				hotStatusHandlers.push(l);
+			},
+			addStatusHandler: function(l) {
+				hotStatusHandlers.push(l);
+			},
+			removeStatusHandler: function(l) {
+				var idx = hotStatusHandlers.indexOf(l);
+				if (idx >= 0) hotStatusHandlers.splice(idx, 1);
+			},
+
+			//inherit from previous dispose call
+			data: hotCurrentModuleData[moduleId]
+		};
+		hotCurrentChildModule = undefined;
+		return hot;
+	}
+
+	var hotStatusHandlers = [];
+	var hotStatus = "idle";
+
+	function hotSetStatus(newStatus) {
+		hotStatus = newStatus;
+		for (var i = 0; i < hotStatusHandlers.length; i++)
+			hotStatusHandlers[i].call(null, newStatus);
+	}
+
+	// while downloading
+	var hotWaitingFiles = 0;
+	var hotChunksLoading = 0;
+	var hotWaitingFilesMap = {};
+	var hotRequestedFilesMap = {};
+	var hotAvailableFilesMap = {};
+	var hotDeferred;
+
+	// The update info
+	var hotUpdate, hotUpdateNewHash, hotQueuedInvalidatedModules;
+
+	function toModuleId(id) {
+		var isNumber = +id + "" === id;
+		return isNumber ? +id : id;
+	}
+
+	function hotCheck(apply) {
+		if (hotStatus !== "idle") {
+			throw new Error("check() is only allowed in idle status");
+		}
+		hotApplyOnUpdate = apply;
+		hotSetStatus("check");
+		return hotDownloadManifest(hotRequestTimeout).then(function(update) {
+			if (!update) {
+				hotSetStatus(hotApplyInvalidatedModules() ? "ready" : "idle");
+				return null;
+			}
+			hotRequestedFilesMap = {};
+			hotWaitingFilesMap = {};
+			hotAvailableFilesMap = update.c;
+			hotUpdateNewHash = update.h;
+
+			hotSetStatus("prepare");
+			var promise = new Promise(function(resolve, reject) {
+				hotDeferred = {
+					resolve: resolve,
+					reject: reject
+				};
+			});
+			hotUpdate = {};
+			/*foreachInstalledChunks*/
+			// eslint-disable-next-line no-lone-blocks
+			{
+				hotEnsureUpdateChunk(chunkId);
+			}
+			if (
+				hotStatus === "prepare" &&
+				hotChunksLoading === 0 &&
+				hotWaitingFiles === 0
+			) {
+				hotUpdateDownloaded();
+			}
+			return promise;
+		});
+	}
+
+	// eslint-disable-next-line no-unused-vars
+	function hotAddUpdateChunk(chunkId, moreModules) {
+		if (!hotAvailableFilesMap[chunkId] || !hotRequestedFilesMap[chunkId])
+			return;
+		hotRequestedFilesMap[chunkId] = false;
+		for (var moduleId in moreModules) {
+			if (Object.prototype.hasOwnProperty.call(moreModules, moduleId)) {
+				hotUpdate[moduleId] = moreModules[moduleId];
+			}
+		}
+		if (--hotWaitingFiles === 0 && hotChunksLoading === 0) {
+			hotUpdateDownloaded();
+		}
+	}
+
+	function hotEnsureUpdateChunk(chunkId) {
+		if (!hotAvailableFilesMap[chunkId]) {
+			hotWaitingFilesMap[chunkId] = true;
+		} else {
+			hotRequestedFilesMap[chunkId] = true;
+			hotWaitingFiles++;
+			hotDownloadUpdateChunk(chunkId);
+		}
+	}
+
+	function hotUpdateDownloaded() {
+		hotSetStatus("ready");
+		var deferred = hotDeferred;
+		hotDeferred = null;
+		if (!deferred) return;
+		if (hotApplyOnUpdate) {
+			// Wrap deferred object in Promise to mark it as a well-handled Promise to
+			// avoid triggering uncaught exception warning in Chrome.
+			// See https://bugs.chromium.org/p/chromium/issues/detail?id=465666
+			Promise.resolve()
+				.then(function() {
+					return hotApply(hotApplyOnUpdate);
+				})
+				.then(
+					function(result) {
+						deferred.resolve(result);
+					},
+					function(err) {
+						deferred.reject(err);
+					}
+				);
+		} else {
+			var outdatedModules = [];
+			for (var id in hotUpdate) {
+				if (Object.prototype.hasOwnProperty.call(hotUpdate, id)) {
+					outdatedModules.push(toModuleId(id));
+				}
+			}
+			deferred.resolve(outdatedModules);
+		}
+	}
+
+	function hotApply(options) {
+		if (hotStatus !== "ready")
+			throw new Error("apply() is only allowed in ready status");
+		options = options || {};
+		return hotApplyInternal(options);
+	}
+
+	function hotApplyInternal(options) {
+		hotApplyInvalidatedModules();
+
+		var cb;
+		var i;
+		var j;
+		var module;
+		var moduleId;
+
+		function getAffectedStuff(updateModuleId) {
+			var outdatedModules = [updateModuleId];
+			var outdatedDependencies = {};
+
+			var queue = outdatedModules.map(function(id) {
+				return {
+					chain: [id],
+					id: id
+				};
+			});
+			while (queue.length > 0) {
+				var queueItem = queue.pop();
+				var moduleId = queueItem.id;
+				var chain = queueItem.chain;
+				module = installedModules[moduleId];
+				if (
+					!module ||
+					(module.hot._selfAccepted && !module.hot._selfInvalidated)
+				)
+					continue;
+				if (module.hot._selfDeclined) {
+					return {
+						type: "self-declined",
+						chain: chain,
+						moduleId: moduleId
+					};
+				}
+				if (module.hot._main) {
+					return {
+						type: "unaccepted",
+						chain: chain,
+						moduleId: moduleId
+					};
+				}
+				for (var i = 0; i < module.parents.length; i++) {
+					var parentId = module.parents[i];
+					var parent = installedModules[parentId];
+					if (!parent) continue;
+					if (parent.hot._declinedDependencies[moduleId]) {
+						return {
+							type: "declined",
+							chain: chain.concat([parentId]),
+							moduleId: moduleId,
+							parentId: parentId
+						};
+					}
+					if (outdatedModules.indexOf(parentId) !== -1) continue;
+					if (parent.hot._acceptedDependencies[moduleId]) {
+						if (!outdatedDependencies[parentId])
+							outdatedDependencies[parentId] = [];
+						addAllToSet(outdatedDependencies[parentId], [moduleId]);
+						continue;
+					}
+					delete outdatedDependencies[parentId];
+					outdatedModules.push(parentId);
+					queue.push({
+						chain: chain.concat([parentId]),
+						id: parentId
+					});
+				}
+			}
+
+			return {
+				type: "accepted",
+				moduleId: updateModuleId,
+				outdatedModules: outdatedModules,
+				outdatedDependencies: outdatedDependencies
+			};
+		}
+
+		function addAllToSet(a, b) {
+			for (var i = 0; i < b.length; i++) {
+				var item = b[i];
+				if (a.indexOf(item) === -1) a.push(item);
+			}
+		}
+
+		// at begin all updates modules are outdated
+		// the "outdated" status can propagate to parents if they don't accept the children
+		var outdatedDependencies = {};
+		var outdatedModules = [];
+		var appliedUpdate = {};
+
+		var warnUnexpectedRequire = function warnUnexpectedRequire() {
+			console.warn(
+				"[HMR] unexpected require(" + result.moduleId + ") to disposed module"
+			);
+		};
+
+		for (var id in hotUpdate) {
+			if (Object.prototype.hasOwnProperty.call(hotUpdate, id)) {
+				moduleId = toModuleId(id);
+				/** @type {TODO} */
+				var result;
+				if (hotUpdate[id]) {
+					result = getAffectedStuff(moduleId);
+				} else {
+					result = {
+						type: "disposed",
+						moduleId: id
+					};
+				}
+				/** @type {Error|false} */
+				var abortError = false;
+				var doApply = false;
+				var doDispose = false;
+				var chainInfo = "";
+				if (result.chain) {
+					chainInfo = "\nUpdate propagation: " + result.chain.join(" -> ");
+				}
+				switch (result.type) {
+					case "self-declined":
+						if (options.onDeclined) options.onDeclined(result);
+						if (!options.ignoreDeclined)
+							abortError = new Error(
+								"Aborted because of self decline: " +
+									result.moduleId +
+									chainInfo
+							);
+						break;
+					case "declined":
+						if (options.onDeclined) options.onDeclined(result);
+						if (!options.ignoreDeclined)
+							abortError = new Error(
+								"Aborted because of declined dependency: " +
+									result.moduleId +
+									" in " +
+									result.parentId +
+									chainInfo
+							);
+						break;
+					case "unaccepted":
+						if (options.onUnaccepted) options.onUnaccepted(result);
+						if (!options.ignoreUnaccepted)
+							abortError = new Error(
+								"Aborted because " + moduleId + " is not accepted" + chainInfo
+							);
+						break;
+					case "accepted":
+						if (options.onAccepted) options.onAccepted(result);
+						doApply = true;
+						break;
+					case "disposed":
+						if (options.onDisposed) options.onDisposed(result);
+						doDispose = true;
+						break;
+					default:
+						throw new Error("Unexception type " + result.type);
+				}
+				if (abortError) {
+					hotSetStatus("abort");
+					return Promise.reject(abortError);
+				}
+				if (doApply) {
+					appliedUpdate[moduleId] = hotUpdate[moduleId];
+					addAllToSet(outdatedModules, result.outdatedModules);
+					for (moduleId in result.outdatedDependencies) {
+						if (
+							Object.prototype.hasOwnProperty.call(
+								result.outdatedDependencies,
+								moduleId
+							)
+						) {
+							if (!outdatedDependencies[moduleId])
+								outdatedDependencies[moduleId] = [];
+							addAllToSet(
+								outdatedDependencies[moduleId],
+								result.outdatedDependencies[moduleId]
+							);
+						}
+					}
+				}
+				if (doDispose) {
+					addAllToSet(outdatedModules, [result.moduleId]);
+					appliedUpdate[moduleId] = warnUnexpectedRequire;
+				}
+			}
+		}
+
+		// Store self accepted outdated modules to require them later by the module system
+		var outdatedSelfAcceptedModules = [];
+		for (i = 0; i < outdatedModules.length; i++) {
+			moduleId = outdatedModules[i];
+			if (
+				installedModules[moduleId] &&
+				installedModules[moduleId].hot._selfAccepted &&
+				// removed self-accepted modules should not be required
+				appliedUpdate[moduleId] !== warnUnexpectedRequire &&
+				// when called invalidate self-accepting is not possible
+				!installedModules[moduleId].hot._selfInvalidated
+			) {
+				outdatedSelfAcceptedModules.push({
+					module: moduleId,
+					parents: installedModules[moduleId].parents.slice(),
+					errorHandler: installedModules[moduleId].hot._selfAccepted
+				});
+			}
+		}
+
+		// Now in "dispose" phase
+		hotSetStatus("dispose");
+		Object.keys(hotAvailableFilesMap).forEach(function(chunkId) {
+			if (hotAvailableFilesMap[chunkId] === false) {
+				hotDisposeChunk(chunkId);
+			}
+		});
+
+		var idx;
+		var queue = outdatedModules.slice();
+		while (queue.length > 0) {
+			moduleId = queue.pop();
+			module = installedModules[moduleId];
+			if (!module) continue;
+
+			var data = {};
+
+			// Call dispose handlers
+			var disposeHandlers = module.hot._disposeHandlers;
+			for (j = 0; j < disposeHandlers.length; j++) {
+				cb = disposeHandlers[j];
+				cb(data);
+			}
+			hotCurrentModuleData[moduleId] = data;
+
+			// disable module (this disables requires from this module)
+			module.hot.active = false;
+
+			// remove module from cache
+			delete installedModules[moduleId];
+
+			// when disposing there is no need to call dispose handler
+			delete outdatedDependencies[moduleId];
+
+			// remove "parents" references from all children
+			for (j = 0; j < module.children.length; j++) {
+				var child = installedModules[module.children[j]];
+				if (!child) continue;
+				idx = child.parents.indexOf(moduleId);
+				if (idx >= 0) {
+					child.parents.splice(idx, 1);
+				}
+			}
+		}
+
+		// remove outdated dependency from module children
+		var dependency;
+		var moduleOutdatedDependencies;
+		for (moduleId in outdatedDependencies) {
+			if (
+				Object.prototype.hasOwnProperty.call(outdatedDependencies, moduleId)
+			) {
+				module = installedModules[moduleId];
+				if (module) {
+					moduleOutdatedDependencies = outdatedDependencies[moduleId];
+					for (j = 0; j < moduleOutdatedDependencies.length; j++) {
+						dependency = moduleOutdatedDependencies[j];
+						idx = module.children.indexOf(dependency);
+						if (idx >= 0) module.children.splice(idx, 1);
+					}
+				}
+			}
+		}
+
+		// Now in "apply" phase
+		hotSetStatus("apply");
+
+		if (hotUpdateNewHash !== undefined) {
+			hotCurrentHash = hotUpdateNewHash;
+			hotUpdateNewHash = undefined;
+		}
+		hotUpdate = undefined;
+
+		// insert new code
+		for (moduleId in appliedUpdate) {
+			if (Object.prototype.hasOwnProperty.call(appliedUpdate, moduleId)) {
+				modules[moduleId] = appliedUpdate[moduleId];
+			}
+		}
+
+		// call accept handlers
+		var error = null;
+		for (moduleId in outdatedDependencies) {
+			if (
+				Object.prototype.hasOwnProperty.call(outdatedDependencies, moduleId)
+			) {
+				module = installedModules[moduleId];
+				if (module) {
+					moduleOutdatedDependencies = outdatedDependencies[moduleId];
+					var callbacks = [];
+					for (i = 0; i < moduleOutdatedDependencies.length; i++) {
+						dependency = moduleOutdatedDependencies[i];
+						cb = module.hot._acceptedDependencies[dependency];
+						if (cb) {
+							if (callbacks.indexOf(cb) !== -1) continue;
+							callbacks.push(cb);
+						}
+					}
+					for (i = 0; i < callbacks.length; i++) {
+						cb = callbacks[i];
+						try {
+							cb(moduleOutdatedDependencies);
+						} catch (err) {
+							if (options.onErrored) {
+								options.onErrored({
+									type: "accept-errored",
+									moduleId: moduleId,
+									dependencyId: moduleOutdatedDependencies[i],
+									error: err
+								});
+							}
+							if (!options.ignoreErrored) {
+								if (!error) error = err;
+							}
+						}
+					}
+				}
+			}
+		}
+
+		// Load self accepted modules
+		for (i = 0; i < outdatedSelfAcceptedModules.length; i++) {
+			var item = outdatedSelfAcceptedModules[i];
+			moduleId = item.module;
+			hotCurrentParents = item.parents;
+			hotCurrentChildModule = moduleId;
+			try {
+				$require$(moduleId);
+			} catch (err) {
+				if (typeof item.errorHandler === "function") {
+					try {
+						item.errorHandler(err);
+					} catch (err2) {
+						if (options.onErrored) {
+							options.onErrored({
+								type: "self-accept-error-handler-errored",
+								moduleId: moduleId,
+								error: err2,
+								originalError: err
+							});
+						}
+						if (!options.ignoreErrored) {
+							if (!error) error = err2;
+						}
+						if (!error) error = err;
+					}
+				} else {
+					if (options.onErrored) {
+						options.onErrored({
+							type: "self-accept-errored",
+							moduleId: moduleId,
+							error: err
+						});
+					}
+					if (!options.ignoreErrored) {
+						if (!error) error = err;
+					}
+				}
+			}
+		}
+
+		// handle errors in accept handlers and self accepted module load
+		if (error) {
+			hotSetStatus("fail");
+			return Promise.reject(error);
+		}
+
+		if (hotQueuedInvalidatedModules) {
+			return hotApplyInternal(options).then(function(list) {
+				outdatedModules.forEach(function(moduleId) {
+					if (list.indexOf(moduleId) < 0) list.push(moduleId);
+				});
+				return list;
+			});
+		}
+
+		hotSetStatus("idle");
+		return new Promise(function(resolve) {
+			resolve(outdatedModules);
+		});
+	}
+
+	function hotApplyInvalidatedModules() {
+		if (hotQueuedInvalidatedModules) {
+			if (!hotUpdate) hotUpdate = {};
+			hotQueuedInvalidatedModules.forEach(hotApplyInvalidatedModule);
+			hotQueuedInvalidatedModules = undefined;
+			return true;
+		}
+	}
+
+	function hotApplyInvalidatedModule(moduleId) {
+		if (!Object.prototype.hasOwnProperty.call(hotUpdate, moduleId))
+			hotUpdate[moduleId] = modules[moduleId];
+	}
+};
diff --git a/node_modules/webpack/lib/HotModuleReplacementPlugin.js b/node_modules/webpack/lib/HotModuleReplacementPlugin.js
new file mode 100644
index 0000000..58a1f1f
--- /dev/null
+++ b/node_modules/webpack/lib/HotModuleReplacementPlugin.js
@@ -0,0 +1,425 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { SyncBailHook } = require("tapable");
+const { RawSource } = require("webpack-sources");
+const Template = require("./Template");
+const ModuleHotAcceptDependency = require("./dependencies/ModuleHotAcceptDependency");
+const ModuleHotDeclineDependency = require("./dependencies/ModuleHotDeclineDependency");
+const ConstDependency = require("./dependencies/ConstDependency");
+const NullFactory = require("./NullFactory");
+const ParserHelpers = require("./ParserHelpers");
+
+module.exports = class HotModuleReplacementPlugin {
+	constructor(options) {
+		this.options = options || {};
+		this.multiStep = this.options.multiStep;
+		this.fullBuildTimeout = this.options.fullBuildTimeout || 200;
+		this.requestTimeout = this.options.requestTimeout || 10000;
+	}
+
+	apply(compiler) {
+		const multiStep = this.multiStep;
+		const fullBuildTimeout = this.fullBuildTimeout;
+		const requestTimeout = this.requestTimeout;
+		const hotUpdateChunkFilename =
+			compiler.options.output.hotUpdateChunkFilename;
+		const hotUpdateMainFilename = compiler.options.output.hotUpdateMainFilename;
+		compiler.hooks.additionalPass.tapAsync(
+			"HotModuleReplacementPlugin",
+			callback => {
+				if (multiStep) return setTimeout(callback, fullBuildTimeout);
+				return callback();
+			}
+		);
+
+		const addParserPlugins = (parser, parserOptions) => {
+			parser.hooks.expression
+				.for("__webpack_hash__")
+				.tap(
+					"HotModuleReplacementPlugin",
+					ParserHelpers.toConstantDependencyWithWebpackRequire(
+						parser,
+						"__webpack_require__.h()"
+					)
+				);
+			parser.hooks.evaluateTypeof
+				.for("__webpack_hash__")
+				.tap(
+					"HotModuleReplacementPlugin",
+					ParserHelpers.evaluateToString("string")
+				);
+			parser.hooks.evaluateIdentifier.for("module.hot").tap(
+				{
+					name: "HotModuleReplacementPlugin",
+					before: "NodeStuffPlugin"
+				},
+				expr => {
+					return ParserHelpers.evaluateToIdentifier(
+						"module.hot",
+						!!parser.state.compilation.hotUpdateChunkTemplate
+					)(expr);
+				}
+			);
+			// TODO webpack 5: refactor this, no custom hooks
+			if (!parser.hooks.hotAcceptCallback) {
+				parser.hooks.hotAcceptCallback = new SyncBailHook([
+					"expression",
+					"requests"
+				]);
+			}
+			if (!parser.hooks.hotAcceptWithoutCallback) {
+				parser.hooks.hotAcceptWithoutCallback = new SyncBailHook([
+					"expression",
+					"requests"
+				]);
+			}
+			parser.hooks.call
+				.for("module.hot.accept")
+				.tap("HotModuleReplacementPlugin", expr => {
+					if (!parser.state.compilation.hotUpdateChunkTemplate) {
+						return false;
+					}
+					if (expr.arguments.length >= 1) {
+						const arg = parser.evaluateExpression(expr.arguments[0]);
+						let params = [];
+						let requests = [];
+						if (arg.isString()) {
+							params = [arg];
+						} else if (arg.isArray()) {
+							params = arg.items.filter(param => param.isString());
+						}
+						if (params.length > 0) {
+							params.forEach((param, idx) => {
+								const request = param.string;
+								const dep = new ModuleHotAcceptDependency(request, param.range);
+								dep.optional = true;
+								dep.loc = Object.create(expr.loc);
+								dep.loc.index = idx;
+								parser.state.module.addDependency(dep);
+								requests.push(request);
+							});
+							if (expr.arguments.length > 1) {
+								parser.hooks.hotAcceptCallback.call(
+									expr.arguments[1],
+									requests
+								);
+								parser.walkExpression(expr.arguments[1]); // other args are ignored
+								return true;
+							} else {
+								parser.hooks.hotAcceptWithoutCallback.call(expr, requests);
+								return true;
+							}
+						}
+					}
+				});
+			parser.hooks.call
+				.for("module.hot.decline")
+				.tap("HotModuleReplacementPlugin", expr => {
+					if (!parser.state.compilation.hotUpdateChunkTemplate) {
+						return false;
+					}
+					if (expr.arguments.length === 1) {
+						const arg = parser.evaluateExpression(expr.arguments[0]);
+						let params = [];
+						if (arg.isString()) {
+							params = [arg];
+						} else if (arg.isArray()) {
+							params = arg.items.filter(param => param.isString());
+						}
+						params.forEach((param, idx) => {
+							const dep = new ModuleHotDeclineDependency(
+								param.string,
+								param.range
+							);
+							dep.optional = true;
+							dep.loc = Object.create(expr.loc);
+							dep.loc.index = idx;
+							parser.state.module.addDependency(dep);
+						});
+					}
+				});
+			parser.hooks.expression
+				.for("module.hot")
+				.tap("HotModuleReplacementPlugin", ParserHelpers.skipTraversal);
+		};
+
+		compiler.hooks.compilation.tap(
+			"HotModuleReplacementPlugin",
+			(compilation, { normalModuleFactory }) => {
+				// This applies the HMR plugin only to the targeted compiler
+				// It should not affect child compilations
+				if (compilation.compiler !== compiler) return;
+
+				const hotUpdateChunkTemplate = compilation.hotUpdateChunkTemplate;
+				if (!hotUpdateChunkTemplate) return;
+
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					ModuleHotAcceptDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					ModuleHotAcceptDependency,
+					new ModuleHotAcceptDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					ModuleHotDeclineDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					ModuleHotDeclineDependency,
+					new ModuleHotDeclineDependency.Template()
+				);
+
+				compilation.hooks.record.tap(
+					"HotModuleReplacementPlugin",
+					(compilation, records) => {
+						if (records.hash === compilation.hash) return;
+						records.hash = compilation.hash;
+						records.moduleHashs = {};
+						for (const module of compilation.modules) {
+							const identifier = module.identifier();
+							records.moduleHashs[identifier] = module.hash;
+						}
+						records.chunkHashs = {};
+						for (const chunk of compilation.chunks) {
+							records.chunkHashs[chunk.id] = chunk.hash;
+						}
+						records.chunkModuleIds = {};
+						for (const chunk of compilation.chunks) {
+							records.chunkModuleIds[chunk.id] = Array.from(
+								chunk.modulesIterable,
+								m => m.id
+							);
+						}
+					}
+				);
+				let initialPass = false;
+				let recompilation = false;
+				compilation.hooks.afterHash.tap("HotModuleReplacementPlugin", () => {
+					let records = compilation.records;
+					if (!records) {
+						initialPass = true;
+						return;
+					}
+					if (!records.hash) initialPass = true;
+					const preHash = records.preHash || "x";
+					const prepreHash = records.prepreHash || "x";
+					if (preHash === compilation.hash) {
+						recompilation = true;
+						compilation.modifyHash(prepreHash);
+						return;
+					}
+					records.prepreHash = records.hash || "x";
+					records.preHash = compilation.hash;
+					compilation.modifyHash(records.prepreHash);
+				});
+				compilation.hooks.shouldGenerateChunkAssets.tap(
+					"HotModuleReplacementPlugin",
+					() => {
+						if (multiStep && !recompilation && !initialPass) return false;
+					}
+				);
+				compilation.hooks.needAdditionalPass.tap(
+					"HotModuleReplacementPlugin",
+					() => {
+						if (multiStep && !recompilation && !initialPass) return true;
+					}
+				);
+				compilation.hooks.additionalChunkAssets.tap(
+					"HotModuleReplacementPlugin",
+					() => {
+						const records = compilation.records;
+						if (records.hash === compilation.hash) return;
+						if (
+							!records.moduleHashs ||
+							!records.chunkHashs ||
+							!records.chunkModuleIds
+						)
+							return;
+						for (const module of compilation.modules) {
+							const identifier = module.identifier();
+							let hash = module.hash;
+							module.hotUpdate = records.moduleHashs[identifier] !== hash;
+						}
+						const hotUpdateMainContent = {
+							h: compilation.hash,
+							c: {}
+						};
+						for (const key of Object.keys(records.chunkHashs)) {
+							const chunkId = isNaN(+key) ? key : +key;
+							const currentChunk = compilation.chunks.find(
+								chunk => `${chunk.id}` === key
+							);
+							if (currentChunk) {
+								const newModules = currentChunk
+									.getModules()
+									.filter(module => module.hotUpdate);
+								const allModules = new Set();
+								for (const module of currentChunk.modulesIterable) {
+									allModules.add(module.id);
+								}
+								const removedModules = records.chunkModuleIds[chunkId].filter(
+									id => !allModules.has(id)
+								);
+								if (newModules.length > 0 || removedModules.length > 0) {
+									const source = hotUpdateChunkTemplate.render(
+										chunkId,
+										newModules,
+										removedModules,
+										compilation.hash,
+										compilation.moduleTemplates.javascript,
+										compilation.dependencyTemplates
+									);
+									const {
+										path: filename,
+										info: assetInfo
+									} = compilation.getPathWithInfo(hotUpdateChunkFilename, {
+										hash: records.hash,
+										chunk: currentChunk
+									});
+									compilation.additionalChunkAssets.push(filename);
+									compilation.emitAsset(
+										filename,
+										source,
+										Object.assign({ hotModuleReplacement: true }, assetInfo)
+									);
+									hotUpdateMainContent.c[chunkId] = true;
+									currentChunk.files.push(filename);
+									compilation.hooks.chunkAsset.call(currentChunk, filename);
+								}
+							} else {
+								hotUpdateMainContent.c[chunkId] = false;
+							}
+						}
+						const source = new RawSource(JSON.stringify(hotUpdateMainContent));
+						const {
+							path: filename,
+							info: assetInfo
+						} = compilation.getPathWithInfo(hotUpdateMainFilename, {
+							hash: records.hash
+						});
+						compilation.emitAsset(
+							filename,
+							source,
+							Object.assign({ hotModuleReplacement: true }, assetInfo)
+						);
+					}
+				);
+
+				const mainTemplate = compilation.mainTemplate;
+
+				mainTemplate.hooks.hash.tap("HotModuleReplacementPlugin", hash => {
+					hash.update("HotMainTemplateDecorator");
+				});
+
+				mainTemplate.hooks.moduleRequire.tap(
+					"HotModuleReplacementPlugin",
+					(_, chunk, hash, varModuleId) => {
+						return `hotCreateRequire(${varModuleId})`;
+					}
+				);
+
+				mainTemplate.hooks.requireExtensions.tap(
+					"HotModuleReplacementPlugin",
+					source => {
+						const buf = [source];
+						buf.push("");
+						buf.push("// __webpack_hash__");
+						buf.push(
+							mainTemplate.requireFn +
+								".h = function() { return hotCurrentHash; };"
+						);
+						return Template.asString(buf);
+					}
+				);
+
+				const needChunkLoadingCode = chunk => {
+					for (const chunkGroup of chunk.groupsIterable) {
+						if (chunkGroup.chunks.length > 1) return true;
+						if (chunkGroup.getNumberOfChildren() > 0) return true;
+					}
+					return false;
+				};
+
+				mainTemplate.hooks.bootstrap.tap(
+					"HotModuleReplacementPlugin",
+					(source, chunk, hash) => {
+						source = mainTemplate.hooks.hotBootstrap.call(source, chunk, hash);
+						return Template.asString([
+							source,
+							"",
+							hotInitCode
+								.replace(/\$require\$/g, mainTemplate.requireFn)
+								.replace(/\$hash\$/g, JSON.stringify(hash))
+								.replace(/\$requestTimeout\$/g, requestTimeout)
+								.replace(
+									/\/\*foreachInstalledChunks\*\//g,
+									needChunkLoadingCode(chunk)
+										? "for(var chunkId in installedChunks)"
+										: `var chunkId = ${JSON.stringify(chunk.id)};`
+								)
+						]);
+					}
+				);
+
+				mainTemplate.hooks.globalHash.tap(
+					"HotModuleReplacementPlugin",
+					() => true
+				);
+
+				mainTemplate.hooks.currentHash.tap(
+					"HotModuleReplacementPlugin",
+					(_, length) => {
+						if (isFinite(length)) {
+							return `hotCurrentHash.substr(0, ${length})`;
+						} else {
+							return "hotCurrentHash";
+						}
+					}
+				);
+
+				mainTemplate.hooks.moduleObj.tap(
+					"HotModuleReplacementPlugin",
+					(source, chunk, hash, varModuleId) => {
+						return Template.asString([
+							`${source},`,
+							`hot: hotCreateModule(${varModuleId}),`,
+							"parents: (hotCurrentParentsTemp = hotCurrentParents, hotCurrentParents = [], hotCurrentParentsTemp),",
+							"children: []"
+						]);
+					}
+				);
+
+				// TODO add HMR support for javascript/esm
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("HotModuleReplacementPlugin", addParserPlugins);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("HotModuleReplacementPlugin", addParserPlugins);
+
+				compilation.hooks.normalModuleLoader.tap(
+					"HotModuleReplacementPlugin",
+					context => {
+						context.hot = true;
+					}
+				);
+			}
+		);
+	}
+};
+
+const hotInitCode = Template.getFunctionContent(
+	require("./HotModuleReplacement.runtime")
+);
diff --git a/node_modules/webpack/lib/HotUpdateChunk.js b/node_modules/webpack/lib/HotUpdateChunk.js
new file mode 100644
index 0000000..8845643
--- /dev/null
+++ b/node_modules/webpack/lib/HotUpdateChunk.js
@@ -0,0 +1,17 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Chunk = require("./Chunk");
+
+class HotUpdateChunk extends Chunk {
+	constructor() {
+		super();
+		/** @type {(string|number)[]} */
+		this.removedModules = undefined;
+	}
+}
+
+module.exports = HotUpdateChunk;
diff --git a/node_modules/webpack/lib/HotUpdateChunkTemplate.js b/node_modules/webpack/lib/HotUpdateChunkTemplate.js
new file mode 100644
index 0000000..92ab8db
--- /dev/null
+++ b/node_modules/webpack/lib/HotUpdateChunkTemplate.js
@@ -0,0 +1,78 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Template = require("./Template");
+const HotUpdateChunk = require("./HotUpdateChunk");
+const { Tapable, SyncWaterfallHook, SyncHook } = require("tapable");
+
+module.exports = class HotUpdateChunkTemplate extends Tapable {
+	constructor(outputOptions) {
+		super();
+		this.outputOptions = outputOptions || {};
+		this.hooks = {
+			modules: new SyncWaterfallHook([
+				"source",
+				"modules",
+				"removedModules",
+				"moduleTemplate",
+				"dependencyTemplates"
+			]),
+			render: new SyncWaterfallHook([
+				"source",
+				"modules",
+				"removedModules",
+				"hash",
+				"id",
+				"moduleTemplate",
+				"dependencyTemplates"
+			]),
+			hash: new SyncHook(["hash"])
+		};
+	}
+
+	render(
+		id,
+		modules,
+		removedModules,
+		hash,
+		moduleTemplate,
+		dependencyTemplates
+	) {
+		const hotUpdateChunk = new HotUpdateChunk();
+		hotUpdateChunk.id = id;
+		hotUpdateChunk.setModules(modules);
+		hotUpdateChunk.removedModules = removedModules;
+		const modulesSource = Template.renderChunkModules(
+			hotUpdateChunk,
+			m => typeof m.source === "function",
+			moduleTemplate,
+			dependencyTemplates
+		);
+		const core = this.hooks.modules.call(
+			modulesSource,
+			modules,
+			removedModules,
+			moduleTemplate,
+			dependencyTemplates
+		);
+		const source = this.hooks.render.call(
+			core,
+			modules,
+			removedModules,
+			hash,
+			id,
+			moduleTemplate,
+			dependencyTemplates
+		);
+		return source;
+	}
+
+	updateHash(hash) {
+		hash.update("HotUpdateChunkTemplate");
+		hash.update("1");
+		this.hooks.hash.call(hash);
+	}
+};
diff --git a/node_modules/webpack/lib/IgnorePlugin.js b/node_modules/webpack/lib/IgnorePlugin.js
new file mode 100644
index 0000000..cd824db
--- /dev/null
+++ b/node_modules/webpack/lib/IgnorePlugin.js
@@ -0,0 +1,91 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/IgnorePlugin.json");
+
+/** @typedef {import("../declarations/plugins/IgnorePlugin").IgnorePluginOptions} IgnorePluginOptions */
+/** @typedef {import("./Compiler")} Compiler */
+
+class IgnorePlugin {
+	/**
+	 * @param {IgnorePluginOptions} options IgnorePlugin options
+	 */
+	constructor(options) {
+		// TODO webpack 5 remove this compat-layer
+		if (arguments.length > 1 || options instanceof RegExp) {
+			options = {
+				resourceRegExp: arguments[0],
+				contextRegExp: arguments[1]
+			};
+		}
+
+		validateOptions(schema, options, "IgnorePlugin");
+		this.options = options;
+
+		/** @private @type {Function} */
+		this.checkIgnore = this.checkIgnore.bind(this);
+	}
+
+	/**
+	 * Note that if "contextRegExp" is given, both the "resourceRegExp"
+	 * and "contextRegExp" have to match.
+	 *
+	 * @param {TODO} result result
+	 * @returns {TODO|null} returns result or null if result should be ignored
+	 */
+	checkIgnore(result) {
+		if (!result) return result;
+
+		if (
+			"checkResource" in this.options &&
+			this.options.checkResource &&
+			this.options.checkResource(result.request, result.context)
+		) {
+			// TODO webpack 5 remove checkContext, as checkResource already gets context
+			if ("checkContext" in this.options && this.options.checkContext) {
+				if (this.options.checkContext(result.context)) {
+					return null;
+				}
+			} else {
+				return null;
+			}
+		}
+
+		if (
+			"resourceRegExp" in this.options &&
+			this.options.resourceRegExp &&
+			this.options.resourceRegExp.test(result.request)
+		) {
+			if ("contextRegExp" in this.options && this.options.contextRegExp) {
+				// if "contextRegExp" is given,
+				// both the "resourceRegExp" and "contextRegExp" have to match.
+				if (this.options.contextRegExp.test(result.context)) {
+					return null;
+				}
+			} else {
+				return null;
+			}
+		}
+
+		return result;
+	}
+
+	/**
+	 * @param {Compiler} compiler Webpack Compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.normalModuleFactory.tap("IgnorePlugin", nmf => {
+			nmf.hooks.beforeResolve.tap("IgnorePlugin", this.checkIgnore);
+		});
+		compiler.hooks.contextModuleFactory.tap("IgnorePlugin", cmf => {
+			cmf.hooks.beforeResolve.tap("IgnorePlugin", this.checkIgnore);
+		});
+	}
+}
+
+module.exports = IgnorePlugin;
diff --git a/node_modules/webpack/lib/JavascriptGenerator.js b/node_modules/webpack/lib/JavascriptGenerator.js
new file mode 100644
index 0000000..882f7d4
--- /dev/null
+++ b/node_modules/webpack/lib/JavascriptGenerator.js
@@ -0,0 +1,229 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { RawSource, ReplaceSource } = require("webpack-sources");
+
+// TODO: clean up this file
+// replace with newer constructs
+
+// TODO: remove DependencyVariables and replace them with something better
+
+class JavascriptGenerator {
+	generate(module, dependencyTemplates, runtimeTemplate) {
+		const originalSource = module.originalSource();
+		if (!originalSource) {
+			return new RawSource("throw new Error('No source available');");
+		}
+
+		const source = new ReplaceSource(originalSource);
+
+		this.sourceBlock(
+			module,
+			module,
+			[],
+			dependencyTemplates,
+			source,
+			runtimeTemplate
+		);
+
+		return source;
+	}
+
+	sourceBlock(
+		module,
+		block,
+		availableVars,
+		dependencyTemplates,
+		source,
+		runtimeTemplate
+	) {
+		for (const dependency of block.dependencies) {
+			this.sourceDependency(
+				dependency,
+				dependencyTemplates,
+				source,
+				runtimeTemplate
+			);
+		}
+
+		/**
+		 * Get the variables of all blocks that we need to inject.
+		 * These will contain the variable name and its expression.
+		 * The name will be added as a parameter in a IIFE the expression as its value.
+		 */
+		const vars = block.variables.reduce((result, value) => {
+			const variable = this.sourceVariables(
+				value,
+				availableVars,
+				dependencyTemplates,
+				runtimeTemplate
+			);
+
+			if (variable) {
+				result.push(variable);
+			}
+
+			return result;
+		}, []);
+
+		/**
+		 * if we actually have variables
+		 * this is important as how #splitVariablesInUniqueNamedChunks works
+		 * it will always return an array in an array which would lead to a IIFE wrapper around
+		 * a module if we do this with an empty vars array.
+		 */
+		if (vars.length > 0) {
+			/**
+			 * Split all variables up into chunks of unique names.
+			 * e.g. imagine you have the following variable names that need to be injected:
+			 * [foo, bar, baz, foo, some, more]
+			 * we can not inject "foo" twice, therefore we just make two IIFEs like so:
+			 * (function(foo, bar, baz){
+			 *   (function(foo, some, more){
+			 *     …
+			 *   }(…));
+			 * }(…));
+			 *
+			 * "splitVariablesInUniqueNamedChunks" splits the variables shown above up to this:
+			 * [[foo, bar, baz], [foo, some, more]]
+			 */
+			const injectionVariableChunks = this.splitVariablesInUniqueNamedChunks(
+				vars
+			);
+
+			// create all the beginnings of IIFEs
+			const functionWrapperStarts = injectionVariableChunks.map(
+				variableChunk => {
+					return this.variableInjectionFunctionWrapperStartCode(
+						variableChunk.map(variable => variable.name)
+					);
+				}
+			);
+
+			// and all the ends
+			const functionWrapperEnds = injectionVariableChunks.map(variableChunk => {
+				return this.variableInjectionFunctionWrapperEndCode(
+					module,
+					variableChunk.map(variable => variable.expression),
+					block
+				);
+			});
+
+			// join them to one big string
+			const varStartCode = functionWrapperStarts.join("");
+
+			// reverse the ends first before joining them, as the last added must be the inner most
+			const varEndCode = functionWrapperEnds.reverse().join("");
+
+			// if we have anything, add it to the source
+			if (varStartCode && varEndCode) {
+				const start = block.range ? block.range[0] : -10;
+				const end = block.range
+					? block.range[1]
+					: module.originalSource().size() + 1;
+				source.insert(start + 0.5, varStartCode);
+				source.insert(end + 0.5, "\n/* WEBPACK VAR INJECTION */" + varEndCode);
+			}
+		}
+
+		for (const childBlock of block.blocks) {
+			this.sourceBlock(
+				module,
+				childBlock,
+				availableVars.concat(vars),
+				dependencyTemplates,
+				source,
+				runtimeTemplate
+			);
+		}
+	}
+
+	sourceDependency(dependency, dependencyTemplates, source, runtimeTemplate) {
+		const template = dependencyTemplates.get(dependency.constructor);
+		if (!template) {
+			throw new Error(
+				"No template for dependency: " + dependency.constructor.name
+			);
+		}
+		template.apply(dependency, source, runtimeTemplate, dependencyTemplates);
+	}
+
+	sourceVariables(
+		variable,
+		availableVars,
+		dependencyTemplates,
+		runtimeTemplate
+	) {
+		const name = variable.name;
+		const expr = variable.expressionSource(
+			dependencyTemplates,
+			runtimeTemplate
+		);
+
+		if (
+			availableVars.some(
+				v => v.name === name && v.expression.source() === expr.source()
+			)
+		) {
+			return;
+		}
+		return {
+			name: name,
+			expression: expr
+		};
+	}
+
+	/*
+	 * creates the start part of a IIFE around the module to inject a variable name
+	 * (function(…){   <- this part
+	 * }.call(…))
+	 */
+	variableInjectionFunctionWrapperStartCode(varNames) {
+		const args = varNames.join(", ");
+		return `/* WEBPACK VAR INJECTION */(function(${args}) {`;
+	}
+
+	contextArgument(module, block) {
+		if (this === block) {
+			return module.exportsArgument;
+		}
+		return "this";
+	}
+
+	/*
+	 * creates the end part of a IIFE around the module to inject a variable name
+	 * (function(…){
+	 * }.call(…))   <- this part
+	 */
+	variableInjectionFunctionWrapperEndCode(module, varExpressions, block) {
+		const firstParam = this.contextArgument(module, block);
+		const furtherParams = varExpressions.map(e => e.source()).join(", ");
+		return `}.call(${firstParam}, ${furtherParams}))`;
+	}
+
+	splitVariablesInUniqueNamedChunks(vars) {
+		const startState = [[]];
+		return vars.reduce((chunks, variable) => {
+			const current = chunks[chunks.length - 1];
+			// check if variable with same name exists already
+			// if so create a new chunk of variables.
+			const variableNameAlreadyExists = current.some(
+				v => v.name === variable.name
+			);
+
+			if (variableNameAlreadyExists) {
+				// start new chunk with current variable
+				chunks.push([variable]);
+			} else {
+				// else add it to current chunk
+				current.push(variable);
+			}
+			return chunks;
+		}, startState);
+	}
+}
+
+module.exports = JavascriptGenerator;
diff --git a/node_modules/webpack/lib/JavascriptModulesPlugin.js b/node_modules/webpack/lib/JavascriptModulesPlugin.js
new file mode 100644
index 0000000..2c1bbe4
--- /dev/null
+++ b/node_modules/webpack/lib/JavascriptModulesPlugin.js
@@ -0,0 +1,185 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Parser = require("./Parser");
+const Template = require("./Template");
+const { ConcatSource } = require("webpack-sources");
+const JavascriptGenerator = require("./JavascriptGenerator");
+const createHash = require("./util/createHash");
+
+class JavascriptModulesPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"JavascriptModulesPlugin",
+			(compilation, { normalModuleFactory }) => {
+				normalModuleFactory.hooks.createParser
+					.for("javascript/auto")
+					.tap("JavascriptModulesPlugin", options => {
+						return new Parser(options, "auto");
+					});
+				normalModuleFactory.hooks.createParser
+					.for("javascript/dynamic")
+					.tap("JavascriptModulesPlugin", options => {
+						return new Parser(options, "script");
+					});
+				normalModuleFactory.hooks.createParser
+					.for("javascript/esm")
+					.tap("JavascriptModulesPlugin", options => {
+						return new Parser(options, "module");
+					});
+				normalModuleFactory.hooks.createGenerator
+					.for("javascript/auto")
+					.tap("JavascriptModulesPlugin", () => {
+						return new JavascriptGenerator();
+					});
+				normalModuleFactory.hooks.createGenerator
+					.for("javascript/dynamic")
+					.tap("JavascriptModulesPlugin", () => {
+						return new JavascriptGenerator();
+					});
+				normalModuleFactory.hooks.createGenerator
+					.for("javascript/esm")
+					.tap("JavascriptModulesPlugin", () => {
+						return new JavascriptGenerator();
+					});
+				compilation.mainTemplate.hooks.renderManifest.tap(
+					"JavascriptModulesPlugin",
+					(result, options) => {
+						const chunk = options.chunk;
+						const hash = options.hash;
+						const fullHash = options.fullHash;
+						const outputOptions = options.outputOptions;
+						const moduleTemplates = options.moduleTemplates;
+						const dependencyTemplates = options.dependencyTemplates;
+
+						const filenameTemplate =
+							chunk.filenameTemplate || outputOptions.filename;
+
+						const useChunkHash = compilation.mainTemplate.useChunkHash(chunk);
+
+						result.push({
+							render: () =>
+								compilation.mainTemplate.render(
+									hash,
+									chunk,
+									moduleTemplates.javascript,
+									dependencyTemplates
+								),
+							filenameTemplate,
+							pathOptions: {
+								noChunkHash: !useChunkHash,
+								contentHashType: "javascript",
+								chunk
+							},
+							identifier: `chunk${chunk.id}`,
+							hash: useChunkHash ? chunk.hash : fullHash
+						});
+						return result;
+					}
+				);
+				compilation.mainTemplate.hooks.modules.tap(
+					"JavascriptModulesPlugin",
+					(source, chunk, hash, moduleTemplate, dependencyTemplates) => {
+						return Template.renderChunkModules(
+							chunk,
+							m => typeof m.source === "function",
+							moduleTemplate,
+							dependencyTemplates,
+							"/******/ "
+						);
+					}
+				);
+				compilation.chunkTemplate.hooks.renderManifest.tap(
+					"JavascriptModulesPlugin",
+					(result, options) => {
+						const chunk = options.chunk;
+						const outputOptions = options.outputOptions;
+						const moduleTemplates = options.moduleTemplates;
+						const dependencyTemplates = options.dependencyTemplates;
+						const filenameTemplate =
+							chunk.filenameTemplate || outputOptions.chunkFilename;
+
+						result.push({
+							render: () =>
+								this.renderJavascript(
+									compilation.chunkTemplate,
+									chunk,
+									moduleTemplates.javascript,
+									dependencyTemplates
+								),
+							filenameTemplate,
+							pathOptions: {
+								chunk,
+								contentHashType: "javascript"
+							},
+							identifier: `chunk${chunk.id}`,
+							hash: chunk.hash
+						});
+
+						return result;
+					}
+				);
+				compilation.hooks.contentHash.tap("JavascriptModulesPlugin", chunk => {
+					const outputOptions = compilation.outputOptions;
+					const {
+						hashSalt,
+						hashDigest,
+						hashDigestLength,
+						hashFunction
+					} = outputOptions;
+					const hash = createHash(hashFunction);
+					if (hashSalt) hash.update(hashSalt);
+					const template = chunk.hasRuntime()
+						? compilation.mainTemplate
+						: compilation.chunkTemplate;
+					hash.update(`${chunk.id} `);
+					hash.update(chunk.ids ? chunk.ids.join(",") : "");
+					template.updateHashForChunk(
+						hash,
+						chunk,
+						compilation.moduleTemplates.javascript,
+						compilation.dependencyTemplates
+					);
+					for (const m of chunk.modulesIterable) {
+						if (typeof m.source === "function") {
+							hash.update(m.hash);
+						}
+					}
+					const digest = /** @type {string} */ (hash.digest(hashDigest));
+					chunk.contentHash.javascript = digest.substr(0, hashDigestLength);
+				});
+			}
+		);
+	}
+
+	renderJavascript(chunkTemplate, chunk, moduleTemplate, dependencyTemplates) {
+		const moduleSources = Template.renderChunkModules(
+			chunk,
+			m => typeof m.source === "function",
+			moduleTemplate,
+			dependencyTemplates
+		);
+		const core = chunkTemplate.hooks.modules.call(
+			moduleSources,
+			chunk,
+			moduleTemplate,
+			dependencyTemplates
+		);
+		let source = chunkTemplate.hooks.render.call(
+			core,
+			chunk,
+			moduleTemplate,
+			dependencyTemplates
+		);
+		if (chunk.hasEntryModule()) {
+			source = chunkTemplate.hooks.renderWithEntry.call(source, chunk);
+		}
+		chunk.rendered = true;
+		return new ConcatSource(source, ";");
+	}
+}
+
+module.exports = JavascriptModulesPlugin;
diff --git a/node_modules/webpack/lib/JsonGenerator.js b/node_modules/webpack/lib/JsonGenerator.js
new file mode 100644
index 0000000..bac87c4
--- /dev/null
+++ b/node_modules/webpack/lib/JsonGenerator.js
@@ -0,0 +1,57 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource, RawSource } = require("webpack-sources");
+
+const stringifySafe = data => {
+	const stringified = JSON.stringify(data);
+	if (!stringified) {
+		return undefined; // Invalid JSON
+	}
+
+	return stringified.replace(/\u2028|\u2029/g, str =>
+		str === "\u2029" ? "\\u2029" : "\\u2028"
+	); // invalid in JavaScript but valid JSON
+};
+
+class JsonGenerator {
+	generate(module, dependencyTemplates, runtimeTemplate) {
+		const source = new ConcatSource();
+		const data = module.buildInfo.jsonData;
+		if (data === undefined) {
+			return new RawSource(
+				runtimeTemplate.missingModuleStatement({
+					request: module.rawRequest
+				})
+			);
+		}
+		let finalJson;
+		if (
+			Array.isArray(module.buildMeta.providedExports) &&
+			!module.isUsed("default")
+		) {
+			// Only some exports are used: We can optimize here, by only generating a part of the JSON
+			const reducedJson = {};
+			for (const exportName of module.buildMeta.providedExports) {
+				if (exportName === "default") continue;
+				const used = module.isUsed(exportName);
+				if (used) {
+					reducedJson[used] = data[exportName];
+				}
+			}
+			finalJson = reducedJson;
+		} else {
+			finalJson = data;
+		}
+		// Use JSON because JSON.parse() is much faster than JavaScript evaluation
+		const jsonSource = JSON.stringify(stringifySafe(finalJson));
+		const jsonExpr = `JSON.parse(${jsonSource})`;
+		source.add(`${module.moduleArgument}.exports = ${jsonExpr};`);
+		return source;
+	}
+}
+
+module.exports = JsonGenerator;
diff --git a/node_modules/webpack/lib/JsonModulesPlugin.js b/node_modules/webpack/lib/JsonModulesPlugin.js
new file mode 100644
index 0000000..20b8a03
--- /dev/null
+++ b/node_modules/webpack/lib/JsonModulesPlugin.js
@@ -0,0 +1,30 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const JsonParser = require("./JsonParser");
+const JsonGenerator = require("./JsonGenerator");
+
+class JsonModulesPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"JsonModulesPlugin",
+			(compilation, { normalModuleFactory }) => {
+				normalModuleFactory.hooks.createParser
+					.for("json")
+					.tap("JsonModulesPlugin", () => {
+						return new JsonParser();
+					});
+				normalModuleFactory.hooks.createGenerator
+					.for("json")
+					.tap("JsonModulesPlugin", () => {
+						return new JsonGenerator();
+					});
+			}
+		);
+	}
+}
+
+module.exports = JsonModulesPlugin;
diff --git a/node_modules/webpack/lib/JsonParser.js b/node_modules/webpack/lib/JsonParser.js
new file mode 100644
index 0000000..f0c5977
--- /dev/null
+++ b/node_modules/webpack/lib/JsonParser.js
@@ -0,0 +1,27 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const parseJson = require("json-parse-better-errors");
+const JsonExportsDependency = require("./dependencies/JsonExportsDependency");
+
+class JsonParser {
+	constructor(options) {
+		this.options = options;
+	}
+
+	parse(source, state) {
+		const data = parseJson(source[0] === "\ufeff" ? source.slice(1) : source);
+		state.module.buildInfo.jsonData = data;
+		state.module.buildMeta.exportsType = "named";
+		if (typeof data === "object" && data) {
+			state.module.addDependency(new JsonExportsDependency(Object.keys(data)));
+		}
+		state.module.addDependency(new JsonExportsDependency(["default"]));
+		return state;
+	}
+}
+
+module.exports = JsonParser;
diff --git a/node_modules/webpack/lib/LibManifestPlugin.js b/node_modules/webpack/lib/LibManifestPlugin.js
new file mode 100644
index 0000000..05e98b0
--- /dev/null
+++ b/node_modules/webpack/lib/LibManifestPlugin.js
@@ -0,0 +1,90 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+const asyncLib = require("neo-async");
+const SingleEntryDependency = require("./dependencies/SingleEntryDependency");
+
+class LibManifestPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compiler) {
+		compiler.hooks.emit.tapAsync(
+			"LibManifestPlugin",
+			(compilation, callback) => {
+				asyncLib.forEach(
+					compilation.chunks,
+					(chunk, callback) => {
+						if (!chunk.isOnlyInitial()) {
+							callback();
+							return;
+						}
+						const targetPath = compilation.getPath(this.options.path, {
+							hash: compilation.hash,
+							chunk
+						});
+						const name =
+							this.options.name &&
+							compilation.getPath(this.options.name, {
+								hash: compilation.hash,
+								chunk
+							});
+						const manifest = {
+							name,
+							type: this.options.type,
+							content: Array.from(chunk.modulesIterable, module => {
+								if (
+									this.options.entryOnly &&
+									!module.reasons.some(
+										r => r.dependency instanceof SingleEntryDependency
+									)
+								) {
+									return;
+								}
+								if (module.libIdent) {
+									const ident = module.libIdent({
+										context: this.options.context || compiler.options.context
+									});
+									if (ident) {
+										return {
+											ident,
+											data: {
+												id: module.id,
+												buildMeta: module.buildMeta
+											}
+										};
+									}
+								}
+							})
+								.filter(Boolean)
+								.reduce((obj, item) => {
+									obj[item.ident] = item.data;
+									return obj;
+								}, Object.create(null))
+						};
+						// Apply formatting to content if format flag is true;
+						const manifestContent = this.options.format
+							? JSON.stringify(manifest, null, 2)
+							: JSON.stringify(manifest);
+						const content = Buffer.from(manifestContent, "utf8");
+						compiler.outputFileSystem.mkdirp(path.dirname(targetPath), err => {
+							if (err) return callback(err);
+							compiler.outputFileSystem.writeFile(
+								targetPath,
+								content,
+								callback
+							);
+						});
+					},
+					callback
+				);
+			}
+		);
+	}
+}
+module.exports = LibManifestPlugin;
diff --git a/node_modules/webpack/lib/LibraryTemplatePlugin.js b/node_modules/webpack/lib/LibraryTemplatePlugin.js
new file mode 100644
index 0000000..87b558c
--- /dev/null
+++ b/node_modules/webpack/lib/LibraryTemplatePlugin.js
@@ -0,0 +1,186 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const SetVarMainTemplatePlugin = require("./SetVarMainTemplatePlugin");
+
+/** @typedef {import("../declarations/WebpackOptions").LibraryCustomUmdObject} LibraryCustomUmdObject */
+/** @typedef {import("./Compiler")} Compiler */
+
+/**
+ * @param {string[]} accessor the accessor to convert to path
+ * @returns {string} the path
+ */
+const accessorToObjectAccess = accessor => {
+	return accessor.map(a => `[${JSON.stringify(a)}]`).join("");
+};
+
+/**
+ * @param {string=} base the path prefix
+ * @param {string|string[]|LibraryCustomUmdObject} accessor the accessor
+ * @param {"amd" | "commonjs" | "root"} umdProperty property used when a custom umd object is provided
+ * @param {string=} joinWith the element separator
+ * @returns {string} the path
+ */
+const accessorAccess = (base, accessor, umdProperty, joinWith = "; ") => {
+	const normalizedAccessor =
+		typeof accessor === "object" && !Array.isArray(accessor)
+			? accessor[umdProperty]
+			: accessor;
+	const accessors = Array.isArray(normalizedAccessor)
+		? normalizedAccessor
+		: [normalizedAccessor];
+	return accessors
+		.map((_, idx) => {
+			const a = base
+				? base + accessorToObjectAccess(accessors.slice(0, idx + 1))
+				: accessors[0] + accessorToObjectAccess(accessors.slice(1, idx + 1));
+			if (idx === accessors.length - 1) return a;
+			if (idx === 0 && base === undefined) {
+				return `${a} = typeof ${a} === "object" ? ${a} : {}`;
+			}
+			return `${a} = ${a} || {}`;
+		})
+		.join(joinWith);
+};
+
+class LibraryTemplatePlugin {
+	/**
+	 * @param {string|string[]|LibraryCustomUmdObject} name name of library
+	 * @param {string} target type of library
+	 * @param {boolean} umdNamedDefine setting this to true will name the UMD module
+	 * @param {string|TODO} auxiliaryComment comment in the UMD wrapper
+	 * @param {string|string[]} exportProperty which export should be exposed as library
+	 */
+	constructor(name, target, umdNamedDefine, auxiliaryComment, exportProperty) {
+		this.name = name;
+		this.target = target;
+		this.umdNamedDefine = umdNamedDefine;
+		this.auxiliaryComment = auxiliaryComment;
+		this.exportProperty = exportProperty;
+	}
+
+	/**
+	 * @param {Compiler} compiler the compiler instance
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap("LibraryTemplatePlugin", compilation => {
+			if (this.exportProperty) {
+				const ExportPropertyMainTemplatePlugin = require("./ExportPropertyMainTemplatePlugin");
+				new ExportPropertyMainTemplatePlugin(this.exportProperty).apply(
+					compilation
+				);
+			}
+			switch (this.target) {
+				case "var":
+					if (
+						!this.name ||
+						(typeof this.name === "object" && !Array.isArray(this.name))
+					) {
+						throw new Error(
+							"library name must be set and not an UMD custom object for non-UMD target"
+						);
+					}
+					new SetVarMainTemplatePlugin(
+						`var ${accessorAccess(undefined, this.name, "root")}`,
+						false
+					).apply(compilation);
+					break;
+				case "assign":
+					new SetVarMainTemplatePlugin(
+						accessorAccess(undefined, this.name, "root"),
+						false
+					).apply(compilation);
+					break;
+				case "this":
+				case "self":
+				case "window":
+					if (this.name) {
+						new SetVarMainTemplatePlugin(
+							accessorAccess(this.target, this.name, "root"),
+							false
+						).apply(compilation);
+					} else {
+						new SetVarMainTemplatePlugin(this.target, true).apply(compilation);
+					}
+					break;
+				case "global":
+					if (this.name) {
+						new SetVarMainTemplatePlugin(
+							accessorAccess(
+								compilation.runtimeTemplate.outputOptions.globalObject,
+								this.name,
+								"root"
+							),
+							false
+						).apply(compilation);
+					} else {
+						new SetVarMainTemplatePlugin(
+							compilation.runtimeTemplate.outputOptions.globalObject,
+							true
+						).apply(compilation);
+					}
+					break;
+				case "commonjs":
+					if (this.name) {
+						new SetVarMainTemplatePlugin(
+							accessorAccess("exports", this.name, "commonjs"),
+							false
+						).apply(compilation);
+					} else {
+						new SetVarMainTemplatePlugin("exports", true).apply(compilation);
+					}
+					break;
+				case "commonjs2":
+				case "commonjs-module":
+					new SetVarMainTemplatePlugin("module.exports", false).apply(
+						compilation
+					);
+					break;
+				case "amd":
+				case "amd-require": {
+					const AmdMainTemplatePlugin = require("./AmdMainTemplatePlugin");
+					if (this.name && typeof this.name !== "string") {
+						throw new Error("library name must be a string for amd target");
+					}
+					new AmdMainTemplatePlugin({
+						name: this.name,
+						requireAsWrapper: this.target === "amd-require"
+					}).apply(compilation);
+					break;
+				}
+				case "umd":
+				case "umd2": {
+					const UmdMainTemplatePlugin = require("./UmdMainTemplatePlugin");
+					new UmdMainTemplatePlugin(this.name, {
+						optionalAmdExternalAsGlobal: this.target === "umd2",
+						namedDefine: this.umdNamedDefine,
+						auxiliaryComment: this.auxiliaryComment
+					}).apply(compilation);
+					break;
+				}
+				case "jsonp": {
+					const JsonpExportMainTemplatePlugin = require("./web/JsonpExportMainTemplatePlugin");
+					if (typeof this.name !== "string")
+						throw new Error("library name must be a string for jsonp target");
+					new JsonpExportMainTemplatePlugin(this.name).apply(compilation);
+					break;
+				}
+				case "system": {
+					const SystemMainTemplatePlugin = require("./SystemMainTemplatePlugin");
+					new SystemMainTemplatePlugin({
+						name: this.name
+					}).apply(compilation);
+					break;
+				}
+				default:
+					throw new Error(`${this.target} is not a valid Library target`);
+			}
+		});
+	}
+}
+
+module.exports = LibraryTemplatePlugin;
diff --git a/node_modules/webpack/lib/LoaderOptionsPlugin.js b/node_modules/webpack/lib/LoaderOptionsPlugin.js
new file mode 100644
index 0000000..651987b
--- /dev/null
+++ b/node_modules/webpack/lib/LoaderOptionsPlugin.js
@@ -0,0 +1,58 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ModuleFilenameHelpers = require("./ModuleFilenameHelpers");
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/LoaderOptionsPlugin.json");
+
+/** @typedef {import("../declarations/plugins/LoaderOptionsPlugin").LoaderOptionsPluginOptions} LoaderOptionsPluginOptions */
+
+class LoaderOptionsPlugin {
+	/**
+	 * @param {LoaderOptionsPluginOptions} options options object
+	 */
+	constructor(options) {
+		validateOptions(schema, options || {}, "Loader Options Plugin");
+
+		if (typeof options !== "object") options = {};
+		if (!options.test) {
+			options.test = {
+				test: () => true
+			};
+		}
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		compiler.hooks.compilation.tap("LoaderOptionsPlugin", compilation => {
+			compilation.hooks.normalModuleLoader.tap(
+				"LoaderOptionsPlugin",
+				(context, module) => {
+					const resource = module.resource;
+					if (!resource) return;
+					const i = resource.indexOf("?");
+					if (
+						ModuleFilenameHelpers.matchObject(
+							options,
+							i < 0 ? resource : resource.substr(0, i)
+						)
+					) {
+						for (const key of Object.keys(options)) {
+							if (key === "include" || key === "exclude" || key === "test") {
+								continue;
+							}
+							context[key] = options[key];
+						}
+					}
+				}
+			);
+		});
+	}
+}
+
+module.exports = LoaderOptionsPlugin;
diff --git a/node_modules/webpack/lib/LoaderTargetPlugin.js b/node_modules/webpack/lib/LoaderTargetPlugin.js
new file mode 100644
index 0000000..99ffbc9
--- /dev/null
+++ b/node_modules/webpack/lib/LoaderTargetPlugin.js
@@ -0,0 +1,24 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class LoaderTargetPlugin {
+	constructor(target) {
+		this.target = target;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap("LoaderTargetPlugin", compilation => {
+			compilation.hooks.normalModuleLoader.tap(
+				"LoaderTargetPlugin",
+				loaderContext => {
+					loaderContext.target = this.target;
+				}
+			);
+		});
+	}
+}
+
+module.exports = LoaderTargetPlugin;
diff --git a/node_modules/webpack/lib/MainTemplate.js b/node_modules/webpack/lib/MainTemplate.js
new file mode 100644
index 0000000..5134106
--- /dev/null
+++ b/node_modules/webpack/lib/MainTemplate.js
@@ -0,0 +1,568 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const {
+	ConcatSource,
+	OriginalSource,
+	PrefixSource,
+	RawSource
+} = require("webpack-sources");
+const {
+	Tapable,
+	SyncWaterfallHook,
+	SyncHook,
+	SyncBailHook
+} = require("tapable");
+const Template = require("./Template");
+
+/** @typedef {import("webpack-sources").ConcatSource} ConcatSource */
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("./ModuleTemplate")} ModuleTemplate */
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("./Module")} Module} */
+/** @typedef {import("./util/createHash").Hash} Hash} */
+/** @typedef {import("./Dependency").DependencyTemplate} DependencyTemplate} */
+
+/**
+ * @typedef {Object} RenderManifestOptions
+ * @property {Chunk} chunk the chunk used to render
+ * @property {string} hash
+ * @property {string} fullHash
+ * @property {TODO} outputOptions
+ * @property {{javascript: ModuleTemplate, webassembly: ModuleTemplate}} moduleTemplates
+ * @property {Map<TODO, TODO>} dependencyTemplates
+ */
+
+// require function shortcuts:
+// __webpack_require__.s = the module id of the entry point
+// __webpack_require__.c = the module cache
+// __webpack_require__.m = the module functions
+// __webpack_require__.p = the bundle public path
+// __webpack_require__.i = the identity function used for harmony imports
+// __webpack_require__.e = the chunk ensure function
+// __webpack_require__.d = the exported property define getter function
+// __webpack_require__.o = Object.prototype.hasOwnProperty.call
+// __webpack_require__.r = define compatibility on export
+// __webpack_require__.t = create a fake namespace object
+// __webpack_require__.n = compatibility get default export
+// __webpack_require__.h = the webpack hash
+// __webpack_require__.w = an object containing all installed WebAssembly.Instance export objects keyed by module id
+// __webpack_require__.oe = the uncaught error handler for the webpack runtime
+// __webpack_require__.nc = the script nonce
+
+module.exports = class MainTemplate extends Tapable {
+	/**
+	 *
+	 * @param {TODO=} outputOptions output options for the MainTemplate
+	 */
+	constructor(outputOptions) {
+		super();
+		/** @type {TODO?} */
+		this.outputOptions = outputOptions || {};
+		this.hooks = {
+			/** @type {SyncWaterfallHook<TODO[], RenderManifestOptions>} */
+			renderManifest: new SyncWaterfallHook(["result", "options"]),
+			modules: new SyncWaterfallHook([
+				"modules",
+				"chunk",
+				"hash",
+				"moduleTemplate",
+				"dependencyTemplates"
+			]),
+			moduleObj: new SyncWaterfallHook([
+				"source",
+				"chunk",
+				"hash",
+				"moduleIdExpression"
+			]),
+			requireEnsure: new SyncWaterfallHook([
+				"source",
+				"chunk",
+				"hash",
+				"chunkIdExpression"
+			]),
+			bootstrap: new SyncWaterfallHook([
+				"source",
+				"chunk",
+				"hash",
+				"moduleTemplate",
+				"dependencyTemplates"
+			]),
+			localVars: new SyncWaterfallHook(["source", "chunk", "hash"]),
+			require: new SyncWaterfallHook(["source", "chunk", "hash"]),
+			requireExtensions: new SyncWaterfallHook(["source", "chunk", "hash"]),
+			/** @type {SyncWaterfallHook<string, Chunk, string>} */
+			beforeStartup: new SyncWaterfallHook(["source", "chunk", "hash"]),
+			/** @type {SyncWaterfallHook<string, Chunk, string>} */
+			startup: new SyncWaterfallHook(["source", "chunk", "hash"]),
+			/** @type {SyncWaterfallHook<string, Chunk, string>} */
+			afterStartup: new SyncWaterfallHook(["source", "chunk", "hash"]),
+			render: new SyncWaterfallHook([
+				"source",
+				"chunk",
+				"hash",
+				"moduleTemplate",
+				"dependencyTemplates"
+			]),
+			renderWithEntry: new SyncWaterfallHook(["source", "chunk", "hash"]),
+			moduleRequire: new SyncWaterfallHook([
+				"source",
+				"chunk",
+				"hash",
+				"moduleIdExpression"
+			]),
+			addModule: new SyncWaterfallHook([
+				"source",
+				"chunk",
+				"hash",
+				"moduleIdExpression",
+				"moduleExpression"
+			]),
+			currentHash: new SyncWaterfallHook(["source", "requestedLength"]),
+			assetPath: new SyncWaterfallHook(["path", "options", "assetInfo"]),
+			hash: new SyncHook(["hash"]),
+			hashForChunk: new SyncHook(["hash", "chunk"]),
+			globalHashPaths: new SyncWaterfallHook(["paths"]),
+			globalHash: new SyncBailHook(["chunk", "paths"]),
+
+			// TODO this should be moved somewhere else
+			// It's weird here
+			hotBootstrap: new SyncWaterfallHook(["source", "chunk", "hash"])
+		};
+		this.hooks.startup.tap("MainTemplate", (source, chunk, hash) => {
+			/** @type {string[]} */
+			const buf = [];
+			if (chunk.entryModule) {
+				buf.push("// Load entry module and return exports");
+				buf.push(
+					`return ${this.renderRequireFunctionForModule(
+						hash,
+						chunk,
+						JSON.stringify(chunk.entryModule.id)
+					)}(${this.requireFn}.s = ${JSON.stringify(chunk.entryModule.id)});`
+				);
+			}
+			return Template.asString(buf);
+		});
+		this.hooks.render.tap(
+			"MainTemplate",
+			(bootstrapSource, chunk, hash, moduleTemplate, dependencyTemplates) => {
+				const source = new ConcatSource();
+				source.add("/******/ (function(modules) { // webpackBootstrap\n");
+				source.add(new PrefixSource("/******/", bootstrapSource));
+				source.add("/******/ })\n");
+				source.add(
+					"/************************************************************************/\n"
+				);
+				source.add("/******/ (");
+				source.add(
+					this.hooks.modules.call(
+						new RawSource(""),
+						chunk,
+						hash,
+						moduleTemplate,
+						dependencyTemplates
+					)
+				);
+				source.add(")");
+				return source;
+			}
+		);
+		this.hooks.localVars.tap("MainTemplate", (source, chunk, hash) => {
+			return Template.asString([
+				source,
+				"// The module cache",
+				"var installedModules = {};"
+			]);
+		});
+		this.hooks.require.tap("MainTemplate", (source, chunk, hash) => {
+			return Template.asString([
+				source,
+				"// Check if module is in cache",
+				"if(installedModules[moduleId]) {",
+				Template.indent("return installedModules[moduleId].exports;"),
+				"}",
+				"// Create a new module (and put it into the cache)",
+				"var module = installedModules[moduleId] = {",
+				Template.indent(this.hooks.moduleObj.call("", chunk, hash, "moduleId")),
+				"};",
+				"",
+				Template.asString(
+					outputOptions.strictModuleExceptionHandling
+						? [
+								"// Execute the module function",
+								"var threw = true;",
+								"try {",
+								Template.indent([
+									`modules[moduleId].call(module.exports, module, module.exports, ${this.renderRequireFunctionForModule(
+										hash,
+										chunk,
+										"moduleId"
+									)});`,
+									"threw = false;"
+								]),
+								"} finally {",
+								Template.indent([
+									"if(threw) delete installedModules[moduleId];"
+								]),
+								"}"
+						  ]
+						: [
+								"// Execute the module function",
+								`modules[moduleId].call(module.exports, module, module.exports, ${this.renderRequireFunctionForModule(
+									hash,
+									chunk,
+									"moduleId"
+								)});`
+						  ]
+				),
+				"",
+				"// Flag the module as loaded",
+				"module.l = true;",
+				"",
+				"// Return the exports of the module",
+				"return module.exports;"
+			]);
+		});
+		this.hooks.moduleObj.tap(
+			"MainTemplate",
+			(source, chunk, hash, varModuleId) => {
+				return Template.asString(["i: moduleId,", "l: false,", "exports: {}"]);
+			}
+		);
+		this.hooks.requireExtensions.tap("MainTemplate", (source, chunk, hash) => {
+			const buf = [];
+			const chunkMaps = chunk.getChunkMaps();
+			// Check if there are non initial chunks which need to be imported using require-ensure
+			if (Object.keys(chunkMaps.hash).length) {
+				buf.push("// This file contains only the entry chunk.");
+				buf.push("// The chunk loading function for additional chunks");
+				buf.push(`${this.requireFn}.e = function requireEnsure(chunkId) {`);
+				buf.push(Template.indent("var promises = [];"));
+				buf.push(
+					Template.indent(
+						this.hooks.requireEnsure.call("", chunk, hash, "chunkId")
+					)
+				);
+				buf.push(Template.indent("return Promise.all(promises);"));
+				buf.push("};");
+			} else if (
+				chunk.hasModuleInGraph(m =>
+					m.blocks.some(b => b.chunkGroup && b.chunkGroup.chunks.length > 0)
+				)
+			) {
+				// There async blocks in the graph, so we need to add an empty requireEnsure
+				// function anyway. This can happen with multiple entrypoints.
+				buf.push("// The chunk loading function for additional chunks");
+				buf.push("// Since all referenced chunks are already included");
+				buf.push("// in this file, this function is empty here.");
+				buf.push(`${this.requireFn}.e = function requireEnsure() {`);
+				buf.push(Template.indent("return Promise.resolve();"));
+				buf.push("};");
+			}
+			buf.push("");
+			buf.push("// expose the modules object (__webpack_modules__)");
+			buf.push(`${this.requireFn}.m = modules;`);
+
+			buf.push("");
+			buf.push("// expose the module cache");
+			buf.push(`${this.requireFn}.c = installedModules;`);
+
+			buf.push("");
+			buf.push("// define getter function for harmony exports");
+			buf.push(`${this.requireFn}.d = function(exports, name, getter) {`);
+			buf.push(
+				Template.indent([
+					`if(!${this.requireFn}.o(exports, name)) {`,
+					Template.indent([
+						"Object.defineProperty(exports, name, { enumerable: true, get: getter });"
+					]),
+					"}"
+				])
+			);
+			buf.push("};");
+
+			buf.push("");
+			buf.push("// define __esModule on exports");
+			buf.push(`${this.requireFn}.r = function(exports) {`);
+			buf.push(
+				Template.indent([
+					"if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {",
+					Template.indent([
+						"Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });"
+					]),
+					"}",
+					"Object.defineProperty(exports, '__esModule', { value: true });"
+				])
+			);
+			buf.push("};");
+
+			buf.push("");
+			buf.push("// create a fake namespace object");
+			buf.push("// mode & 1: value is a module id, require it");
+			buf.push("// mode & 2: merge all properties of value into the ns");
+			buf.push("// mode & 4: return value when already ns object");
+			buf.push("// mode & 8|1: behave like require");
+			buf.push(`${this.requireFn}.t = function(value, mode) {`);
+			buf.push(
+				Template.indent([
+					`if(mode & 1) value = ${this.requireFn}(value);`,
+					`if(mode & 8) return value;`,
+					"if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;",
+					"var ns = Object.create(null);",
+					`${this.requireFn}.r(ns);`,
+					"Object.defineProperty(ns, 'default', { enumerable: true, value: value });",
+					"if(mode & 2 && typeof value != 'string') for(var key in value) " +
+						`${this.requireFn}.d(ns, key, function(key) { ` +
+						"return value[key]; " +
+						"}.bind(null, key));",
+					"return ns;"
+				])
+			);
+			buf.push("};");
+
+			buf.push("");
+			buf.push(
+				"// getDefaultExport function for compatibility with non-harmony modules"
+			);
+			buf.push(this.requireFn + ".n = function(module) {");
+			buf.push(
+				Template.indent([
+					"var getter = module && module.__esModule ?",
+					Template.indent([
+						"function getDefault() { return module['default']; } :",
+						"function getModuleExports() { return module; };"
+					]),
+					`${this.requireFn}.d(getter, 'a', getter);`,
+					"return getter;"
+				])
+			);
+			buf.push("};");
+
+			buf.push("");
+			buf.push("// Object.prototype.hasOwnProperty.call");
+			buf.push(
+				`${this.requireFn}.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };`
+			);
+
+			const publicPath = this.getPublicPath({
+				hash: hash
+			});
+			buf.push("");
+			buf.push("// __webpack_public_path__");
+			buf.push(`${this.requireFn}.p = ${JSON.stringify(publicPath)};`);
+			return Template.asString(buf);
+		});
+
+		this.requireFn = "__webpack_require__";
+	}
+
+	/**
+	 *
+	 * @param {RenderManifestOptions} options render manifest options
+	 * @returns {TODO[]} returns render manifest
+	 */
+	getRenderManifest(options) {
+		const result = [];
+
+		this.hooks.renderManifest.call(result, options);
+
+		return result;
+	}
+
+	/**
+	 * TODO webpack 5: remove moduleTemplate and dependencyTemplates
+	 * @param {string} hash hash to be used for render call
+	 * @param {Chunk} chunk Chunk instance
+	 * @param {ModuleTemplate} moduleTemplate ModuleTemplate instance for render
+	 * @param {Map<Function, DependencyTemplate>} dependencyTemplates dependency templates
+	 * @returns {string[]} the generated source of the bootstrap code
+	 */
+	renderBootstrap(hash, chunk, moduleTemplate, dependencyTemplates) {
+		const buf = [];
+		buf.push(
+			this.hooks.bootstrap.call(
+				"",
+				chunk,
+				hash,
+				moduleTemplate,
+				dependencyTemplates
+			)
+		);
+		buf.push(this.hooks.localVars.call("", chunk, hash));
+		buf.push("");
+		buf.push("// The require function");
+		buf.push(`function ${this.requireFn}(moduleId) {`);
+		buf.push(Template.indent(this.hooks.require.call("", chunk, hash)));
+		buf.push("}");
+		buf.push("");
+		buf.push(
+			Template.asString(this.hooks.requireExtensions.call("", chunk, hash))
+		);
+		buf.push("");
+		buf.push(Template.asString(this.hooks.beforeStartup.call("", chunk, hash)));
+		const afterStartupCode = Template.asString(
+			this.hooks.afterStartup.call("", chunk, hash)
+		);
+		if (afterStartupCode) {
+			// TODO webpack 5: this is a bit hacky to avoid a breaking change
+			// change it to a better way
+			buf.push("var startupResult = (function() {");
+		}
+		buf.push(Template.asString(this.hooks.startup.call("", chunk, hash)));
+		if (afterStartupCode) {
+			buf.push("})();");
+			buf.push(afterStartupCode);
+			buf.push("return startupResult;");
+		}
+		return buf;
+	}
+
+	/**
+	 * @param {string} hash hash to be used for render call
+	 * @param {Chunk} chunk Chunk instance
+	 * @param {ModuleTemplate} moduleTemplate ModuleTemplate instance for render
+	 * @param {Map<Function, DependencyTemplate>} dependencyTemplates dependency templates
+	 * @returns {ConcatSource} the newly generated source from rendering
+	 */
+	render(hash, chunk, moduleTemplate, dependencyTemplates) {
+		const buf = this.renderBootstrap(
+			hash,
+			chunk,
+			moduleTemplate,
+			dependencyTemplates
+		);
+		let source = this.hooks.render.call(
+			new OriginalSource(
+				Template.prefix(buf, " \t") + "\n",
+				"webpack/bootstrap"
+			),
+			chunk,
+			hash,
+			moduleTemplate,
+			dependencyTemplates
+		);
+		if (chunk.hasEntryModule()) {
+			source = this.hooks.renderWithEntry.call(source, chunk, hash);
+		}
+		if (!source) {
+			throw new Error(
+				"Compiler error: MainTemplate plugin 'render' should return something"
+			);
+		}
+		chunk.rendered = true;
+		return new ConcatSource(source, ";");
+	}
+
+	/**
+	 *
+	 * @param {string} hash hash for render fn
+	 * @param {Chunk} chunk Chunk instance for require
+	 * @param {(number|string)=} varModuleId module id
+	 * @returns {TODO} the moduleRequire hook call return signature
+	 */
+	renderRequireFunctionForModule(hash, chunk, varModuleId) {
+		return this.hooks.moduleRequire.call(
+			this.requireFn,
+			chunk,
+			hash,
+			varModuleId
+		);
+	}
+
+	/**
+	 *
+	 * @param {string} hash hash for render add fn
+	 * @param {Chunk} chunk Chunk instance for require add fn
+	 * @param {(string|number)=} varModuleId module id
+	 * @param {Module} varModule Module instance
+	 * @returns {TODO} renderAddModule call
+	 */
+	renderAddModule(hash, chunk, varModuleId, varModule) {
+		return this.hooks.addModule.call(
+			`modules[${varModuleId}] = ${varModule};`,
+			chunk,
+			hash,
+			varModuleId,
+			varModule
+		);
+	}
+
+	/**
+	 *
+	 * @param {string} hash string hash
+	 * @param {number=} length length
+	 * @returns {string} call hook return
+	 */
+	renderCurrentHashCode(hash, length) {
+		length = length || Infinity;
+		return this.hooks.currentHash.call(
+			JSON.stringify(hash.substr(0, length)),
+			length
+		);
+	}
+
+	/**
+	 *
+	 * @param {object} options get public path options
+	 * @returns {string} hook call
+	 */
+	getPublicPath(options) {
+		return this.hooks.assetPath.call(
+			this.outputOptions.publicPath || "",
+			options
+		);
+	}
+
+	getAssetPath(path, options) {
+		return this.hooks.assetPath.call(path, options);
+	}
+
+	getAssetPathWithInfo(path, options) {
+		const assetInfo = {};
+		// TODO webpack 5: refactor assetPath hook to receive { path, info } object
+		const newPath = this.hooks.assetPath.call(path, options, assetInfo);
+		return { path: newPath, info: assetInfo };
+	}
+
+	/**
+	 * Updates hash with information from this template
+	 * @param {Hash} hash the hash to update
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update("maintemplate");
+		hash.update("3");
+		this.hooks.hash.call(hash);
+	}
+
+	/**
+	 * TODO webpack 5: remove moduleTemplate and dependencyTemplates
+	 * Updates hash with chunk-specific information from this template
+	 * @param {Hash} hash the hash to update
+	 * @param {Chunk} chunk the chunk
+	 * @param {ModuleTemplate} moduleTemplate ModuleTemplate instance for render
+	 * @param {Map<Function, DependencyTemplate>} dependencyTemplates dependency templates
+	 * @returns {void}
+	 */
+	updateHashForChunk(hash, chunk, moduleTemplate, dependencyTemplates) {
+		this.updateHash(hash);
+		this.hooks.hashForChunk.call(hash, chunk);
+		for (const line of this.renderBootstrap(
+			"0000",
+			chunk,
+			moduleTemplate,
+			dependencyTemplates
+		)) {
+			hash.update(line);
+		}
+	}
+
+	useChunkHash(chunk) {
+		const paths = this.hooks.globalHashPaths.call([]);
+		return !this.hooks.globalHash.call(chunk, paths);
+	}
+};
diff --git a/node_modules/webpack/lib/MemoryOutputFileSystem.js b/node_modules/webpack/lib/MemoryOutputFileSystem.js
new file mode 100644
index 0000000..8476148
--- /dev/null
+++ b/node_modules/webpack/lib/MemoryOutputFileSystem.js
@@ -0,0 +1,5 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+module.exports = require("memory-fs");
diff --git a/node_modules/webpack/lib/Module.js b/node_modules/webpack/lib/Module.js
new file mode 100644
index 0000000..3fb571c
--- /dev/null
+++ b/node_modules/webpack/lib/Module.js
@@ -0,0 +1,435 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const util = require("util");
+
+const DependenciesBlock = require("./DependenciesBlock");
+const ModuleReason = require("./ModuleReason");
+const SortableSet = require("./util/SortableSet");
+const Template = require("./Template");
+
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("./RequestShortener")} RequestShortener */
+/** @typedef {import("./WebpackError")} WebpackError */
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+const EMPTY_RESOLVE_OPTIONS = {};
+
+let debugId = 1000;
+
+const sortById = (a, b) => {
+	return a.id - b.id;
+};
+
+const sortByDebugId = (a, b) => {
+	return a.debugId - b.debugId;
+};
+
+/** @typedef {(requestShortener: RequestShortener) => string} OptimizationBailoutFunction */
+
+class Module extends DependenciesBlock {
+	constructor(type, context = null) {
+		super();
+		/** @type {string} */
+		this.type = type;
+		/** @type {string} */
+		this.context = context;
+
+		// Unique Id
+		/** @type {number} */
+		this.debugId = debugId++;
+
+		// Hash
+		/** @type {string} */
+		this.hash = undefined;
+		/** @type {string} */
+		this.renderedHash = undefined;
+
+		// Info from Factory
+		/** @type {TODO} */
+		this.resolveOptions = EMPTY_RESOLVE_OPTIONS;
+		/** @type {object} */
+		this.factoryMeta = {};
+
+		// Info from Build
+		/** @type {WebpackError[]} */
+		this.warnings = [];
+		/** @type {WebpackError[]} */
+		this.errors = [];
+		/** @type {object} */
+		this.buildMeta = undefined;
+		/** @type {object} */
+		this.buildInfo = undefined;
+
+		// Graph (per Compilation)
+		/** @type {ModuleReason[]} */
+		this.reasons = [];
+		/** @type {SortableSet<Chunk>} */
+		this._chunks = new SortableSet(undefined, sortById);
+
+		// Info from Compilation (per Compilation)
+		/** @type {number|string} */
+		this.id = null;
+		/** @type {number} */
+		this.index = null;
+		/** @type {number} */
+		this.index2 = null;
+		/** @type {number} */
+		this.depth = null;
+		/** @type {Module} */
+		this.issuer = null;
+		/** @type {undefined | object} */
+		this.profile = undefined;
+		/** @type {boolean} */
+		this.prefetched = false;
+		/** @type {boolean} */
+		this.built = false;
+
+		// Info from Optimization (per Compilation)
+		/** @type {null | boolean} */
+		this.used = null;
+		/** @type {false | true | string[]} */
+		this.usedExports = null;
+		/** @type {(string | OptimizationBailoutFunction)[]} */
+		this.optimizationBailout = [];
+
+		// delayed operations
+		/** @type {undefined | {oldChunk: Chunk, newChunks: Chunk[]}[] } */
+		this._rewriteChunkInReasons = undefined;
+
+		/** @type {boolean} */
+		this.useSourceMap = false;
+
+		// info from build
+		this._source = null;
+	}
+
+	get exportsArgument() {
+		return (this.buildInfo && this.buildInfo.exportsArgument) || "exports";
+	}
+
+	get moduleArgument() {
+		return (this.buildInfo && this.buildInfo.moduleArgument) || "module";
+	}
+
+	disconnect() {
+		this.hash = undefined;
+		this.renderedHash = undefined;
+
+		this.reasons.length = 0;
+		this._rewriteChunkInReasons = undefined;
+		this._chunks.clear();
+
+		this.id = null;
+		this.index = null;
+		this.index2 = null;
+		this.depth = null;
+		this.issuer = null;
+		this.profile = undefined;
+		this.prefetched = false;
+		this.built = false;
+
+		this.used = null;
+		this.usedExports = null;
+		this.optimizationBailout.length = 0;
+		super.disconnect();
+	}
+
+	unseal() {
+		this.id = null;
+		this.index = null;
+		this.index2 = null;
+		this.depth = null;
+		this._chunks.clear();
+		super.unseal();
+	}
+
+	setChunks(chunks) {
+		this._chunks = new SortableSet(chunks, sortById);
+	}
+
+	addChunk(chunk) {
+		if (this._chunks.has(chunk)) return false;
+		this._chunks.add(chunk);
+		return true;
+	}
+
+	removeChunk(chunk) {
+		if (this._chunks.delete(chunk)) {
+			chunk.removeModule(this);
+			return true;
+		}
+		return false;
+	}
+
+	isInChunk(chunk) {
+		return this._chunks.has(chunk);
+	}
+
+	isEntryModule() {
+		for (const chunk of this._chunks) {
+			if (chunk.entryModule === this) return true;
+		}
+		return false;
+	}
+
+	get optional() {
+		return (
+			this.reasons.length > 0 &&
+			this.reasons.every(r => r.dependency && r.dependency.optional)
+		);
+	}
+
+	/**
+	 * @returns {Chunk[]} all chunks which contain the module
+	 */
+	getChunks() {
+		return Array.from(this._chunks);
+	}
+
+	getNumberOfChunks() {
+		return this._chunks.size;
+	}
+
+	get chunksIterable() {
+		return this._chunks;
+	}
+
+	hasEqualsChunks(otherModule) {
+		if (this._chunks.size !== otherModule._chunks.size) return false;
+		this._chunks.sortWith(sortByDebugId);
+		otherModule._chunks.sortWith(sortByDebugId);
+		const a = this._chunks[Symbol.iterator]();
+		const b = otherModule._chunks[Symbol.iterator]();
+		// eslint-disable-next-line no-constant-condition
+		while (true) {
+			const aItem = a.next();
+			const bItem = b.next();
+			if (aItem.done) return true;
+			if (aItem.value !== bItem.value) return false;
+		}
+	}
+
+	addReason(module, dependency, explanation) {
+		this.reasons.push(new ModuleReason(module, dependency, explanation));
+	}
+
+	removeReason(module, dependency) {
+		for (let i = 0; i < this.reasons.length; i++) {
+			let r = this.reasons[i];
+			if (r.module === module && r.dependency === dependency) {
+				this.reasons.splice(i, 1);
+				return true;
+			}
+		}
+		return false;
+	}
+
+	hasReasonForChunk(chunk) {
+		if (this._rewriteChunkInReasons) {
+			for (const operation of this._rewriteChunkInReasons) {
+				this._doRewriteChunkInReasons(operation.oldChunk, operation.newChunks);
+			}
+			this._rewriteChunkInReasons = undefined;
+		}
+		for (let i = 0; i < this.reasons.length; i++) {
+			if (this.reasons[i].hasChunk(chunk)) return true;
+		}
+		return false;
+	}
+
+	hasReasons() {
+		return this.reasons.length > 0;
+	}
+
+	rewriteChunkInReasons(oldChunk, newChunks) {
+		// This is expensive. Delay operation until we really need the data
+		if (this._rewriteChunkInReasons === undefined) {
+			this._rewriteChunkInReasons = [];
+		}
+		this._rewriteChunkInReasons.push({
+			oldChunk,
+			newChunks
+		});
+	}
+
+	_doRewriteChunkInReasons(oldChunk, newChunks) {
+		for (let i = 0; i < this.reasons.length; i++) {
+			this.reasons[i].rewriteChunks(oldChunk, newChunks);
+		}
+	}
+
+	/**
+	 * @param {string=} exportName the name of the export
+	 * @returns {boolean|string} false if the export isn't used, true if no exportName is provided and the module is used, or the name to access it if the export is used
+	 */
+	isUsed(exportName) {
+		if (!exportName) return this.used !== false;
+		if (this.used === null || this.usedExports === null) return exportName;
+		if (!this.used) return false;
+		if (!this.usedExports) return false;
+		if (this.usedExports === true) return exportName;
+		let idx = this.usedExports.indexOf(exportName);
+		if (idx < 0) return false;
+
+		// Mangle export name if possible
+		if (this.isProvided(exportName)) {
+			if (this.buildMeta.exportsType === "namespace") {
+				return Template.numberToIdentifer(idx);
+			}
+			if (
+				this.buildMeta.exportsType === "named" &&
+				!this.usedExports.includes("default")
+			) {
+				return Template.numberToIdentifer(idx);
+			}
+		}
+		return exportName;
+	}
+
+	isProvided(exportName) {
+		if (!Array.isArray(this.buildMeta.providedExports)) return null;
+		return this.buildMeta.providedExports.includes(exportName);
+	}
+
+	toString() {
+		return `Module[${this.id || this.debugId}]`;
+	}
+
+	needRebuild(fileTimestamps, contextTimestamps) {
+		return true;
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track dependencies
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update(`${this.id}`);
+		hash.update(JSON.stringify(this.usedExports));
+		super.updateHash(hash);
+	}
+
+	sortItems(sortChunks) {
+		super.sortItems();
+		if (sortChunks) this._chunks.sort();
+		this.reasons.sort((a, b) => {
+			if (a.module === b.module) return 0;
+			if (!a.module) return -1;
+			if (!b.module) return 1;
+			return sortById(a.module, b.module);
+		});
+		if (Array.isArray(this.usedExports)) {
+			this.usedExports.sort();
+		}
+	}
+
+	unbuild() {
+		this.dependencies.length = 0;
+		this.blocks.length = 0;
+		this.variables.length = 0;
+		this.buildMeta = undefined;
+		this.buildInfo = undefined;
+		this.disconnect();
+	}
+
+	get arguments() {
+		throw new Error("Module.arguments was removed, there is no replacement.");
+	}
+
+	set arguments(value) {
+		throw new Error("Module.arguments was removed, there is no replacement.");
+	}
+}
+
+// TODO remove in webpack 5
+Object.defineProperty(Module.prototype, "forEachChunk", {
+	configurable: false,
+	value: util.deprecate(
+		/**
+		 * @deprecated
+		 * @param {function(any, any, Set<any>): void} fn callback function
+		 * @returns {void}
+		 * @this {Module}
+		 */
+		function(fn) {
+			this._chunks.forEach(fn);
+		},
+		"Module.forEachChunk: Use for(const chunk of module.chunksIterable) instead"
+	)
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(Module.prototype, "mapChunks", {
+	configurable: false,
+	value: util.deprecate(
+		/**
+		 * @deprecated
+		 * @param {function(any, any): void} fn Mapper function
+		 * @returns {Array<TODO>} Array of chunks mapped
+		 * @this {Module}
+		 */
+		function(fn) {
+			return Array.from(this._chunks, fn);
+		},
+		"Module.mapChunks: Use Array.from(module.chunksIterable, fn) instead"
+	)
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(Module.prototype, "entry", {
+	configurable: false,
+	get() {
+		throw new Error("Module.entry was removed. Use Chunk.entryModule");
+	},
+	set() {
+		throw new Error("Module.entry was removed. Use Chunk.entryModule");
+	}
+});
+
+// TODO remove in webpack 5
+Object.defineProperty(Module.prototype, "meta", {
+	configurable: false,
+	get: util.deprecate(
+		/**
+		 * @deprecated
+		 * @returns {void}
+		 * @this {Module}
+		 */
+		function() {
+			return this.buildMeta;
+		},
+		"Module.meta was renamed to Module.buildMeta"
+	),
+	set: util.deprecate(
+		/**
+		 * @deprecated
+		 * @param {TODO} value Value
+		 * @returns {void}
+		 * @this {Module}
+		 */
+		function(value) {
+			this.buildMeta = value;
+		},
+		"Module.meta was renamed to Module.buildMeta"
+	)
+});
+
+/** @type {function(): string} */
+Module.prototype.identifier = null;
+
+/** @type {function(RequestShortener): string} */
+Module.prototype.readableIdentifier = null;
+
+Module.prototype.build = null;
+Module.prototype.source = null;
+Module.prototype.size = null;
+Module.prototype.nameForCondition = null;
+/** @type {null | function(Chunk): boolean} */
+Module.prototype.chunkCondition = null;
+Module.prototype.updateCacheModule = null;
+
+module.exports = Module;
diff --git a/node_modules/webpack/lib/ModuleBuildError.js b/node_modules/webpack/lib/ModuleBuildError.js
new file mode 100644
index 0000000..d6b498e
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleBuildError.js
@@ -0,0 +1,52 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+const { cutOffLoaderExecution } = require("./ErrorHelpers");
+
+class ModuleBuildError extends WebpackError {
+	constructor(module, err, { from = null } = {}) {
+		let message = "Module build failed";
+		let details = undefined;
+		if (from) {
+			message += ` (from ${from}):\n`;
+		} else {
+			message += ": ";
+		}
+		if (err !== null && typeof err === "object") {
+			if (typeof err.stack === "string" && err.stack) {
+				const stack = cutOffLoaderExecution(err.stack);
+				if (!err.hideStack) {
+					message += stack;
+				} else {
+					details = stack;
+					if (typeof err.message === "string" && err.message) {
+						message += err.message;
+					} else {
+						message += err;
+					}
+				}
+			} else if (typeof err.message === "string" && err.message) {
+				message += err.message;
+			} else {
+				message += err;
+			}
+		} else {
+			message = err;
+		}
+
+		super(message);
+
+		this.name = "ModuleBuildError";
+		this.details = details;
+		this.module = module;
+		this.error = err;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = ModuleBuildError;
diff --git a/node_modules/webpack/lib/ModuleDependencyError.js b/node_modules/webpack/lib/ModuleDependencyError.js
new file mode 100644
index 0000000..cb16cc3
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleDependencyError.js
@@ -0,0 +1,35 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+/** @typedef {import("./Module")} Module */
+
+class ModuleDependencyError extends WebpackError {
+	/**
+	 * Creates an instance of ModuleDependencyError.
+	 * @param {Module} module module tied to dependency
+	 * @param {Error} err error thrown
+	 * @param {TODO} loc location of dependency
+	 */
+	constructor(module, err, loc) {
+		super(err.message);
+
+		this.name = "ModuleDependencyError";
+		this.details = err.stack
+			.split("\n")
+			.slice(1)
+			.join("\n");
+		this.module = module;
+		this.loc = loc;
+		this.error = err;
+		this.origin = module.issuer;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = ModuleDependencyError;
diff --git a/node_modules/webpack/lib/ModuleDependencyWarning.js b/node_modules/webpack/lib/ModuleDependencyWarning.js
new file mode 100644
index 0000000..be62791
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleDependencyWarning.js
@@ -0,0 +1,25 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+module.exports = class ModuleDependencyWarning extends WebpackError {
+	constructor(module, err, loc) {
+		super(err.message);
+
+		this.name = "ModuleDependencyWarning";
+		this.details = err.stack
+			.split("\n")
+			.slice(1)
+			.join("\n");
+		this.module = module;
+		this.loc = loc;
+		this.error = err;
+		this.origin = module.issuer;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/ModuleError.js b/node_modules/webpack/lib/ModuleError.js
new file mode 100644
index 0000000..7079d61
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleError.js
@@ -0,0 +1,36 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+const { cleanUp } = require("./ErrorHelpers");
+
+class ModuleError extends WebpackError {
+	constructor(module, err, { from = null } = {}) {
+		let message = "Module Error";
+		if (from) {
+			message += ` (from ${from}):\n`;
+		} else {
+			message += ": ";
+		}
+		if (err && typeof err === "object" && err.message) {
+			message += err.message;
+		} else if (err) {
+			message += err;
+		}
+		super(message);
+		this.name = "ModuleError";
+		this.module = module;
+		this.error = err;
+		this.details =
+			err && typeof err === "object" && err.stack
+				? cleanUp(err.stack, this.message)
+				: undefined;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = ModuleError;
diff --git a/node_modules/webpack/lib/ModuleFilenameHelpers.js b/node_modules/webpack/lib/ModuleFilenameHelpers.js
new file mode 100644
index 0000000..bd0742b
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleFilenameHelpers.js
@@ -0,0 +1,179 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const createHash = require("./util/createHash");
+
+const ModuleFilenameHelpers = exports;
+
+ModuleFilenameHelpers.ALL_LOADERS_RESOURCE = "[all-loaders][resource]";
+ModuleFilenameHelpers.REGEXP_ALL_LOADERS_RESOURCE = /\[all-?loaders\]\[resource\]/gi;
+ModuleFilenameHelpers.LOADERS_RESOURCE = "[loaders][resource]";
+ModuleFilenameHelpers.REGEXP_LOADERS_RESOURCE = /\[loaders\]\[resource\]/gi;
+ModuleFilenameHelpers.RESOURCE = "[resource]";
+ModuleFilenameHelpers.REGEXP_RESOURCE = /\[resource\]/gi;
+ModuleFilenameHelpers.ABSOLUTE_RESOURCE_PATH = "[absolute-resource-path]";
+ModuleFilenameHelpers.REGEXP_ABSOLUTE_RESOURCE_PATH = /\[abs(olute)?-?resource-?path\]/gi;
+ModuleFilenameHelpers.RESOURCE_PATH = "[resource-path]";
+ModuleFilenameHelpers.REGEXP_RESOURCE_PATH = /\[resource-?path\]/gi;
+ModuleFilenameHelpers.ALL_LOADERS = "[all-loaders]";
+ModuleFilenameHelpers.REGEXP_ALL_LOADERS = /\[all-?loaders\]/gi;
+ModuleFilenameHelpers.LOADERS = "[loaders]";
+ModuleFilenameHelpers.REGEXP_LOADERS = /\[loaders\]/gi;
+ModuleFilenameHelpers.QUERY = "[query]";
+ModuleFilenameHelpers.REGEXP_QUERY = /\[query\]/gi;
+ModuleFilenameHelpers.ID = "[id]";
+ModuleFilenameHelpers.REGEXP_ID = /\[id\]/gi;
+ModuleFilenameHelpers.HASH = "[hash]";
+ModuleFilenameHelpers.REGEXP_HASH = /\[hash\]/gi;
+ModuleFilenameHelpers.NAMESPACE = "[namespace]";
+ModuleFilenameHelpers.REGEXP_NAMESPACE = /\[namespace\]/gi;
+
+const getAfter = (str, token) => {
+	const idx = str.indexOf(token);
+	return idx < 0 ? "" : str.substr(idx);
+};
+
+const getBefore = (str, token) => {
+	const idx = str.lastIndexOf(token);
+	return idx < 0 ? "" : str.substr(0, idx);
+};
+
+const getHash = str => {
+	const hash = createHash("md4");
+	hash.update(str);
+	const digest = /** @type {string} */ (hash.digest("hex"));
+	return digest.substr(0, 4);
+};
+
+const asRegExp = test => {
+	if (typeof test === "string") {
+		test = new RegExp("^" + test.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"));
+	}
+	return test;
+};
+
+ModuleFilenameHelpers.createFilename = (module, options, requestShortener) => {
+	const opts = Object.assign(
+		{
+			namespace: "",
+			moduleFilenameTemplate: ""
+		},
+		typeof options === "object"
+			? options
+			: {
+					moduleFilenameTemplate: options
+			  }
+	);
+
+	let absoluteResourcePath;
+	let hash;
+	let identifier;
+	let moduleId;
+	let shortIdentifier;
+	if (module === undefined) module = "";
+	if (typeof module === "string") {
+		shortIdentifier = requestShortener.shorten(module);
+		identifier = shortIdentifier;
+		moduleId = "";
+		absoluteResourcePath = module.split("!").pop();
+		hash = getHash(identifier);
+	} else {
+		shortIdentifier = module.readableIdentifier(requestShortener);
+		identifier = requestShortener.shorten(module.identifier());
+		moduleId = module.id;
+		absoluteResourcePath = module
+			.identifier()
+			.split("!")
+			.pop();
+		hash = getHash(identifier);
+	}
+	const resource = shortIdentifier.split("!").pop();
+	const loaders = getBefore(shortIdentifier, "!");
+	const allLoaders = getBefore(identifier, "!");
+	const query = getAfter(resource, "?");
+	const resourcePath = resource.substr(0, resource.length - query.length);
+	if (typeof opts.moduleFilenameTemplate === "function") {
+		return opts.moduleFilenameTemplate({
+			identifier: identifier,
+			shortIdentifier: shortIdentifier,
+			resource: resource,
+			resourcePath: resourcePath,
+			absoluteResourcePath: absoluteResourcePath,
+			allLoaders: allLoaders,
+			query: query,
+			moduleId: moduleId,
+			hash: hash,
+			namespace: opts.namespace
+		});
+	}
+	return opts.moduleFilenameTemplate
+		.replace(ModuleFilenameHelpers.REGEXP_ALL_LOADERS_RESOURCE, identifier)
+		.replace(ModuleFilenameHelpers.REGEXP_LOADERS_RESOURCE, shortIdentifier)
+		.replace(ModuleFilenameHelpers.REGEXP_RESOURCE, resource)
+		.replace(ModuleFilenameHelpers.REGEXP_RESOURCE_PATH, resourcePath)
+		.replace(
+			ModuleFilenameHelpers.REGEXP_ABSOLUTE_RESOURCE_PATH,
+			absoluteResourcePath
+		)
+		.replace(ModuleFilenameHelpers.REGEXP_ALL_LOADERS, allLoaders)
+		.replace(ModuleFilenameHelpers.REGEXP_LOADERS, loaders)
+		.replace(ModuleFilenameHelpers.REGEXP_QUERY, query)
+		.replace(ModuleFilenameHelpers.REGEXP_ID, moduleId)
+		.replace(ModuleFilenameHelpers.REGEXP_HASH, hash)
+		.replace(ModuleFilenameHelpers.REGEXP_NAMESPACE, opts.namespace);
+};
+
+ModuleFilenameHelpers.replaceDuplicates = (array, fn, comparator) => {
+	const countMap = Object.create(null);
+	const posMap = Object.create(null);
+	array.forEach((item, idx) => {
+		countMap[item] = countMap[item] || [];
+		countMap[item].push(idx);
+		posMap[item] = 0;
+	});
+	if (comparator) {
+		Object.keys(countMap).forEach(item => {
+			countMap[item].sort(comparator);
+		});
+	}
+	return array.map((item, i) => {
+		if (countMap[item].length > 1) {
+			if (comparator && countMap[item][0] === i) return item;
+			return fn(item, i, posMap[item]++);
+		} else {
+			return item;
+		}
+	});
+};
+
+ModuleFilenameHelpers.matchPart = (str, test) => {
+	if (!test) return true;
+	test = asRegExp(test);
+	if (Array.isArray(test)) {
+		return test.map(asRegExp).some(regExp => regExp.test(str));
+	} else {
+		return test.test(str);
+	}
+};
+
+ModuleFilenameHelpers.matchObject = (obj, str) => {
+	if (obj.test) {
+		if (!ModuleFilenameHelpers.matchPart(str, obj.test)) {
+			return false;
+		}
+	}
+	if (obj.include) {
+		if (!ModuleFilenameHelpers.matchPart(str, obj.include)) {
+			return false;
+		}
+	}
+	if (obj.exclude) {
+		if (ModuleFilenameHelpers.matchPart(str, obj.exclude)) {
+			return false;
+		}
+	}
+	return true;
+};
diff --git a/node_modules/webpack/lib/ModuleNotFoundError.js b/node_modules/webpack/lib/ModuleNotFoundError.js
new file mode 100644
index 0000000..cdfc314
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleNotFoundError.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+class ModuleNotFoundError extends WebpackError {
+	constructor(module, err) {
+		super("Module not found: " + err);
+
+		this.name = "ModuleNotFoundError";
+		this.details = err.details;
+		this.missing = err.missing;
+		this.module = module;
+		this.error = err;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = ModuleNotFoundError;
diff --git a/node_modules/webpack/lib/ModuleParseError.js b/node_modules/webpack/lib/ModuleParseError.js
new file mode 100644
index 0000000..2ff22b7
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleParseError.js
@@ -0,0 +1,67 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+/** @typedef {import("./Module")} Module */
+
+class ModuleParseError extends WebpackError {
+	/**
+	 * @param {Module} module the errored module
+	 * @param {string} source source code
+	 * @param {Error&any} err the parse error
+	 * @param {string[]} loaders the loaders used
+	 */
+	constructor(module, source, err, loaders) {
+		let message = "Module parse failed: " + err.message;
+		let loc = undefined;
+		if (loaders.length >= 1) {
+			message += `\nFile was processed with these loaders:${loaders
+				.map(loader => `\n * ${loader}`)
+				.join("")}`;
+			message +=
+				"\nYou may need an additional loader to handle the result of these loaders.";
+		} else {
+			message +=
+				"\nYou may need an appropriate loader to handle this file type, currently no loaders are configured to process this file. See https://webpack.js.org/concepts#loaders";
+		}
+		if (
+			err.loc &&
+			typeof err.loc === "object" &&
+			typeof err.loc.line === "number"
+		) {
+			var lineNumber = err.loc.line;
+			if (/[\0\u0001\u0002\u0003\u0004\u0005\u0006\u0007]/.test(source)) {
+				// binary file
+				message += "\n(Source code omitted for this binary file)";
+			} else {
+				const sourceLines = source.split(/\r?\n/);
+				const start = Math.max(0, lineNumber - 3);
+				const linesBefore = sourceLines.slice(start, lineNumber - 1);
+				const theLine = sourceLines[lineNumber - 1];
+				const linesAfter = sourceLines.slice(lineNumber, lineNumber + 2);
+				message +=
+					linesBefore.map(l => `\n| ${l}`).join("") +
+					`\n> ${theLine}` +
+					linesAfter.map(l => `\n| ${l}`).join("");
+			}
+			loc = err.loc;
+		} else {
+			message += "\n" + err.stack;
+		}
+
+		super(message);
+
+		this.name = "ModuleParseError";
+		this.module = module;
+		this.loc = loc;
+		this.error = err;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = ModuleParseError;
diff --git a/node_modules/webpack/lib/ModuleReason.js b/node_modules/webpack/lib/ModuleReason.js
new file mode 100644
index 0000000..3697f84
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleReason.js
@@ -0,0 +1,48 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./Dependency")} Dependency */
+
+class ModuleReason {
+	/**
+	 * @param {Module} module the referencing module
+	 * @param {Dependency} dependency the referencing dependency
+	 * @param {string=} explanation some extra detail
+	 */
+	constructor(module, dependency, explanation) {
+		this.module = module;
+		this.dependency = dependency;
+		this.explanation = explanation;
+		this._chunks = null;
+	}
+
+	hasChunk(chunk) {
+		if (this._chunks) {
+			if (this._chunks.has(chunk)) return true;
+		} else if (this.module && this.module._chunks.has(chunk)) return true;
+		return false;
+	}
+
+	rewriteChunks(oldChunk, newChunks) {
+		if (!this._chunks) {
+			if (this.module) {
+				if (!this.module._chunks.has(oldChunk)) return;
+				this._chunks = new Set(this.module._chunks);
+			} else {
+				this._chunks = new Set();
+			}
+		}
+		if (this._chunks.has(oldChunk)) {
+			this._chunks.delete(oldChunk);
+			for (let i = 0; i < newChunks.length; i++) {
+				this._chunks.add(newChunks[i]);
+			}
+		}
+	}
+}
+
+module.exports = ModuleReason;
diff --git a/node_modules/webpack/lib/ModuleTemplate.js b/node_modules/webpack/lib/ModuleTemplate.js
new file mode 100644
index 0000000..06e787e
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleTemplate.js
@@ -0,0 +1,93 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { Tapable, SyncWaterfallHook, SyncHook } = require("tapable");
+
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("./Module")} Module */
+
+module.exports = class ModuleTemplate extends Tapable {
+	constructor(runtimeTemplate, type) {
+		super();
+		this.runtimeTemplate = runtimeTemplate;
+		this.type = type;
+		this.hooks = {
+			content: new SyncWaterfallHook([
+				"source",
+				"module",
+				"options",
+				"dependencyTemplates"
+			]),
+			module: new SyncWaterfallHook([
+				"source",
+				"module",
+				"options",
+				"dependencyTemplates"
+			]),
+			render: new SyncWaterfallHook([
+				"source",
+				"module",
+				"options",
+				"dependencyTemplates"
+			]),
+			package: new SyncWaterfallHook([
+				"source",
+				"module",
+				"options",
+				"dependencyTemplates"
+			]),
+			hash: new SyncHook(["hash"])
+		};
+	}
+
+	/**
+	 * @param {Module} module the module
+	 * @param {TODO} dependencyTemplates templates for dependencies
+	 * @param {TODO} options render options
+	 * @returns {Source} the source
+	 */
+	render(module, dependencyTemplates, options) {
+		try {
+			const moduleSource = module.source(
+				dependencyTemplates,
+				this.runtimeTemplate,
+				this.type
+			);
+			const moduleSourcePostContent = this.hooks.content.call(
+				moduleSource,
+				module,
+				options,
+				dependencyTemplates
+			);
+			const moduleSourcePostModule = this.hooks.module.call(
+				moduleSourcePostContent,
+				module,
+				options,
+				dependencyTemplates
+			);
+			const moduleSourcePostRender = this.hooks.render.call(
+				moduleSourcePostModule,
+				module,
+				options,
+				dependencyTemplates
+			);
+			return this.hooks.package.call(
+				moduleSourcePostRender,
+				module,
+				options,
+				dependencyTemplates
+			);
+		} catch (e) {
+			e.message = `${module.identifier()}\n${e.message}`;
+			throw e;
+		}
+	}
+
+	updateHash(hash) {
+		hash.update("1");
+		this.hooks.hash.call(hash);
+	}
+};
diff --git a/node_modules/webpack/lib/ModuleWarning.js b/node_modules/webpack/lib/ModuleWarning.js
new file mode 100644
index 0000000..1306819
--- /dev/null
+++ b/node_modules/webpack/lib/ModuleWarning.js
@@ -0,0 +1,36 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+const { cleanUp } = require("./ErrorHelpers");
+
+class ModuleWarning extends WebpackError {
+	constructor(module, warning, { from = null } = {}) {
+		let message = "Module Warning";
+		if (from) {
+			message += ` (from ${from}):\n`;
+		} else {
+			message += ": ";
+		}
+		if (warning && typeof warning === "object" && warning.message) {
+			message += warning.message;
+		} else if (warning) {
+			message += warning;
+		}
+		super(message);
+		this.name = "ModuleWarning";
+		this.module = module;
+		this.warning = warning;
+		this.details =
+			warning && typeof warning === "object" && warning.stack
+				? cleanUp(warning.stack, this.message)
+				: undefined;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = ModuleWarning;
diff --git a/node_modules/webpack/lib/MultiCompiler.js b/node_modules/webpack/lib/MultiCompiler.js
new file mode 100644
index 0000000..e9c3005
--- /dev/null
+++ b/node_modules/webpack/lib/MultiCompiler.js
@@ -0,0 +1,290 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { Tapable, SyncHook, MultiHook } = require("tapable");
+const asyncLib = require("neo-async");
+const MultiWatching = require("./MultiWatching");
+const MultiStats = require("./MultiStats");
+const ConcurrentCompilationError = require("./ConcurrentCompilationError");
+
+module.exports = class MultiCompiler extends Tapable {
+	constructor(compilers) {
+		super();
+		this.hooks = {
+			done: new SyncHook(["stats"]),
+			invalid: new MultiHook(compilers.map(c => c.hooks.invalid)),
+			run: new MultiHook(compilers.map(c => c.hooks.run)),
+			watchClose: new SyncHook([]),
+			watchRun: new MultiHook(compilers.map(c => c.hooks.watchRun)),
+			infrastructureLog: new MultiHook(
+				compilers.map(c => c.hooks.infrastructureLog)
+			)
+		};
+		if (!Array.isArray(compilers)) {
+			compilers = Object.keys(compilers).map(name => {
+				compilers[name].name = name;
+				return compilers[name];
+			});
+		}
+		this.compilers = compilers;
+		let doneCompilers = 0;
+		let compilerStats = [];
+		let index = 0;
+		for (const compiler of this.compilers) {
+			let compilerDone = false;
+			const compilerIndex = index++;
+			// eslint-disable-next-line no-loop-func
+			compiler.hooks.done.tap("MultiCompiler", stats => {
+				if (!compilerDone) {
+					compilerDone = true;
+					doneCompilers++;
+				}
+				compilerStats[compilerIndex] = stats;
+				if (doneCompilers === this.compilers.length) {
+					this.hooks.done.call(new MultiStats(compilerStats));
+				}
+			});
+			// eslint-disable-next-line no-loop-func
+			compiler.hooks.invalid.tap("MultiCompiler", () => {
+				if (compilerDone) {
+					compilerDone = false;
+					doneCompilers--;
+				}
+			});
+		}
+		this.running = false;
+	}
+
+	get outputPath() {
+		let commonPath = this.compilers[0].outputPath;
+		for (const compiler of this.compilers) {
+			while (
+				compiler.outputPath.indexOf(commonPath) !== 0 &&
+				/[/\\]/.test(commonPath)
+			) {
+				commonPath = commonPath.replace(/[/\\][^/\\]*$/, "");
+			}
+		}
+
+		if (!commonPath && this.compilers[0].outputPath[0] === "/") return "/";
+		return commonPath;
+	}
+
+	get inputFileSystem() {
+		throw new Error("Cannot read inputFileSystem of a MultiCompiler");
+	}
+
+	get outputFileSystem() {
+		throw new Error("Cannot read outputFileSystem of a MultiCompiler");
+	}
+
+	set inputFileSystem(value) {
+		for (const compiler of this.compilers) {
+			compiler.inputFileSystem = value;
+		}
+	}
+
+	set outputFileSystem(value) {
+		for (const compiler of this.compilers) {
+			compiler.outputFileSystem = value;
+		}
+	}
+
+	getInfrastructureLogger(name) {
+		return this.compilers[0].getInfrastructureLogger(name);
+	}
+
+	validateDependencies(callback) {
+		const edges = new Set();
+		const missing = [];
+		const targetFound = compiler => {
+			for (const edge of edges) {
+				if (edge.target === compiler) {
+					return true;
+				}
+			}
+			return false;
+		};
+		const sortEdges = (e1, e2) => {
+			return (
+				e1.source.name.localeCompare(e2.source.name) ||
+				e1.target.name.localeCompare(e2.target.name)
+			);
+		};
+		for (const source of this.compilers) {
+			if (source.dependencies) {
+				for (const dep of source.dependencies) {
+					const target = this.compilers.find(c => c.name === dep);
+					if (!target) {
+						missing.push(dep);
+					} else {
+						edges.add({
+							source,
+							target
+						});
+					}
+				}
+			}
+		}
+		const errors = missing.map(m => `Compiler dependency \`${m}\` not found.`);
+		const stack = this.compilers.filter(c => !targetFound(c));
+		while (stack.length > 0) {
+			const current = stack.pop();
+			for (const edge of edges) {
+				if (edge.source === current) {
+					edges.delete(edge);
+					const target = edge.target;
+					if (!targetFound(target)) {
+						stack.push(target);
+					}
+				}
+			}
+		}
+		if (edges.size > 0) {
+			const lines = Array.from(edges)
+				.sort(sortEdges)
+				.map(edge => `${edge.source.name} -> ${edge.target.name}`);
+			lines.unshift("Circular dependency found in compiler dependencies.");
+			errors.unshift(lines.join("\n"));
+		}
+		if (errors.length > 0) {
+			const message = errors.join("\n");
+			callback(new Error(message));
+			return false;
+		}
+		return true;
+	}
+
+	runWithDependencies(compilers, fn, callback) {
+		const fulfilledNames = new Set();
+		let remainingCompilers = compilers;
+		const isDependencyFulfilled = d => fulfilledNames.has(d);
+		const getReadyCompilers = () => {
+			let readyCompilers = [];
+			let list = remainingCompilers;
+			remainingCompilers = [];
+			for (const c of list) {
+				const ready =
+					!c.dependencies || c.dependencies.every(isDependencyFulfilled);
+				if (ready) {
+					readyCompilers.push(c);
+				} else {
+					remainingCompilers.push(c);
+				}
+			}
+			return readyCompilers;
+		};
+		const runCompilers = callback => {
+			if (remainingCompilers.length === 0) return callback();
+			asyncLib.map(
+				getReadyCompilers(),
+				(compiler, callback) => {
+					fn(compiler, err => {
+						if (err) return callback(err);
+						fulfilledNames.add(compiler.name);
+						runCompilers(callback);
+					});
+				},
+				callback
+			);
+		};
+		runCompilers(callback);
+	}
+
+	watch(watchOptions, handler) {
+		if (this.running) return handler(new ConcurrentCompilationError());
+
+		let watchings = [];
+		let allStats = this.compilers.map(() => null);
+		let compilerStatus = this.compilers.map(() => false);
+		if (this.validateDependencies(handler)) {
+			this.running = true;
+			this.runWithDependencies(
+				this.compilers,
+				(compiler, callback) => {
+					const compilerIdx = this.compilers.indexOf(compiler);
+					let firstRun = true;
+					let watching = compiler.watch(
+						Array.isArray(watchOptions)
+							? watchOptions[compilerIdx]
+							: watchOptions,
+						(err, stats) => {
+							if (err) handler(err);
+							if (stats) {
+								allStats[compilerIdx] = stats;
+								compilerStatus[compilerIdx] = "new";
+								if (compilerStatus.every(Boolean)) {
+									const freshStats = allStats.filter((s, idx) => {
+										return compilerStatus[idx] === "new";
+									});
+									compilerStatus.fill(true);
+									const multiStats = new MultiStats(freshStats);
+									handler(null, multiStats);
+								}
+							}
+							if (firstRun && !err) {
+								firstRun = false;
+								callback();
+							}
+						}
+					);
+					watchings.push(watching);
+				},
+				() => {
+					// ignore
+				}
+			);
+		}
+
+		return new MultiWatching(watchings, this);
+	}
+
+	run(callback) {
+		if (this.running) {
+			return callback(new ConcurrentCompilationError());
+		}
+
+		const finalCallback = (err, stats) => {
+			this.running = false;
+
+			if (callback !== undefined) {
+				return callback(err, stats);
+			}
+		};
+
+		const allStats = this.compilers.map(() => null);
+		if (this.validateDependencies(callback)) {
+			this.running = true;
+			this.runWithDependencies(
+				this.compilers,
+				(compiler, callback) => {
+					const compilerIdx = this.compilers.indexOf(compiler);
+					compiler.run((err, stats) => {
+						if (err) {
+							return callback(err);
+						}
+						allStats[compilerIdx] = stats;
+						callback();
+					});
+				},
+				err => {
+					if (err) {
+						return finalCallback(err);
+					}
+					finalCallback(null, new MultiStats(allStats));
+				}
+			);
+		}
+	}
+
+	purgeInputFileSystem() {
+		for (const compiler of this.compilers) {
+			if (compiler.inputFileSystem && compiler.inputFileSystem.purge) {
+				compiler.inputFileSystem.purge();
+			}
+		}
+	}
+};
diff --git a/node_modules/webpack/lib/MultiEntryPlugin.js b/node_modules/webpack/lib/MultiEntryPlugin.js
new file mode 100644
index 0000000..b38a823
--- /dev/null
+++ b/node_modules/webpack/lib/MultiEntryPlugin.js
@@ -0,0 +1,80 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const MultiEntryDependency = require("./dependencies/MultiEntryDependency");
+const SingleEntryDependency = require("./dependencies/SingleEntryDependency");
+const MultiModuleFactory = require("./MultiModuleFactory");
+
+/** @typedef {import("./Compiler")} Compiler */
+
+class MultiEntryPlugin {
+	/**
+	 * The MultiEntryPlugin is invoked whenever this.options.entry value is an array of paths
+	 * @param {string} context context path
+	 * @param {string[]} entries array of entry paths
+	 * @param {string} name entry key name
+	 */
+	constructor(context, entries, name) {
+		this.context = context;
+		this.entries = entries;
+		this.name = name;
+	}
+
+	/**
+	 * @param {Compiler} compiler the compiler instance
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"MultiEntryPlugin",
+			(compilation, { normalModuleFactory }) => {
+				const multiModuleFactory = new MultiModuleFactory();
+
+				compilation.dependencyFactories.set(
+					MultiEntryDependency,
+					multiModuleFactory
+				);
+				compilation.dependencyFactories.set(
+					SingleEntryDependency,
+					normalModuleFactory
+				);
+			}
+		);
+
+		compiler.hooks.make.tapAsync(
+			"MultiEntryPlugin",
+			(compilation, callback) => {
+				const { context, entries, name } = this;
+
+				const dep = MultiEntryPlugin.createDependency(entries, name);
+				compilation.addEntry(context, dep, name, callback);
+			}
+		);
+	}
+
+	/**
+	 * @param {string[]} entries each entry path string
+	 * @param {string} name name of the entry
+	 * @returns {MultiEntryDependency} returns a constructed Dependency
+	 */
+	static createDependency(entries, name) {
+		return new MultiEntryDependency(
+			entries.map((e, idx) => {
+				const dep = new SingleEntryDependency(e);
+				// Because entrypoints are not dependencies found in an
+				// existing module, we give it a synthetic id
+				dep.loc = {
+					name,
+					index: idx
+				};
+				return dep;
+			}),
+			name
+		);
+	}
+}
+
+module.exports = MultiEntryPlugin;
diff --git a/node_modules/webpack/lib/MultiModule.js b/node_modules/webpack/lib/MultiModule.js
new file mode 100644
index 0000000..c8e5d57
--- /dev/null
+++ b/node_modules/webpack/lib/MultiModule.js
@@ -0,0 +1,87 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Module = require("./Module");
+const Template = require("./Template");
+const { RawSource } = require("webpack-sources");
+
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+class MultiModule extends Module {
+	constructor(context, dependencies, name) {
+		super("javascript/dynamic", context);
+
+		// Info from Factory
+		this.dependencies = dependencies;
+		this.name = name;
+		this._identifier = `multi ${this.dependencies
+			.map(d => d.request)
+			.join(" ")}`;
+	}
+
+	identifier() {
+		return this._identifier;
+	}
+
+	readableIdentifier(requestShortener) {
+		return `multi ${this.dependencies
+			.map(d => requestShortener.shorten(d.request))
+			.join(" ")}`;
+	}
+
+	build(options, compilation, resolver, fs, callback) {
+		this.built = true;
+		this.buildMeta = {};
+		this.buildInfo = {};
+		return callback();
+	}
+
+	needRebuild() {
+		return false;
+	}
+
+	size() {
+		return 16 + this.dependencies.length * 12;
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track dependencies
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update("multi module");
+		hash.update(this.name || "");
+		super.updateHash(hash);
+	}
+
+	source(dependencyTemplates, runtimeTemplate) {
+		const str = [];
+		let idx = 0;
+		for (const dep of this.dependencies) {
+			if (dep.module) {
+				if (idx === this.dependencies.length - 1) {
+					str.push("module.exports = ");
+				}
+				str.push("__webpack_require__(");
+				if (runtimeTemplate.outputOptions.pathinfo) {
+					str.push(Template.toComment(dep.request));
+				}
+				str.push(`${JSON.stringify(dep.module.id)}`);
+				str.push(")");
+			} else {
+				const content = require("./dependencies/WebpackMissingModule").module(
+					dep.request
+				);
+				str.push(content);
+			}
+			str.push(";\n");
+			idx++;
+		}
+		return new RawSource(str.join(""));
+	}
+}
+
+module.exports = MultiModule;
diff --git a/node_modules/webpack/lib/MultiModuleFactory.js b/node_modules/webpack/lib/MultiModuleFactory.js
new file mode 100644
index 0000000..5d29b20
--- /dev/null
+++ b/node_modules/webpack/lib/MultiModuleFactory.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { Tapable } = require("tapable");
+const MultiModule = require("./MultiModule");
+
+module.exports = class MultiModuleFactory extends Tapable {
+	constructor() {
+		super();
+		this.hooks = {};
+	}
+
+	create(data, callback) {
+		const dependency = data.dependencies[0];
+		callback(
+			null,
+			new MultiModule(data.context, dependency.dependencies, dependency.name)
+		);
+	}
+};
diff --git a/node_modules/webpack/lib/MultiStats.js b/node_modules/webpack/lib/MultiStats.js
new file mode 100644
index 0000000..1a5fcf2
--- /dev/null
+++ b/node_modules/webpack/lib/MultiStats.js
@@ -0,0 +1,92 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Stats = require("./Stats");
+
+const optionOrFallback = (optionValue, fallbackValue) =>
+	optionValue !== undefined ? optionValue : fallbackValue;
+
+class MultiStats {
+	constructor(stats) {
+		this.stats = stats;
+		this.hash = stats.map(stat => stat.hash).join("");
+	}
+
+	hasErrors() {
+		return this.stats
+			.map(stat => stat.hasErrors())
+			.reduce((a, b) => a || b, false);
+	}
+
+	hasWarnings() {
+		return this.stats
+			.map(stat => stat.hasWarnings())
+			.reduce((a, b) => a || b, false);
+	}
+
+	toJson(options, forToString) {
+		if (typeof options === "boolean" || typeof options === "string") {
+			options = Stats.presetToOptions(options);
+		} else if (!options) {
+			options = {};
+		}
+		const jsons = this.stats.map((stat, idx) => {
+			const childOptions = Stats.getChildOptions(options, idx);
+			const obj = stat.toJson(childOptions, forToString);
+			obj.name = stat.compilation && stat.compilation.name;
+			return obj;
+		});
+		const showVersion =
+			options.version === undefined
+				? jsons.every(j => j.version)
+				: options.version !== false;
+		const showHash =
+			options.hash === undefined
+				? jsons.every(j => j.hash)
+				: options.hash !== false;
+		if (showVersion) {
+			for (const j of jsons) {
+				delete j.version;
+			}
+		}
+		const obj = {
+			errors: jsons.reduce((arr, j) => {
+				return arr.concat(
+					j.errors.map(msg => {
+						return `(${j.name}) ${msg}`;
+					})
+				);
+			}, []),
+			warnings: jsons.reduce((arr, j) => {
+				return arr.concat(
+					j.warnings.map(msg => {
+						return `(${j.name}) ${msg}`;
+					})
+				);
+			}, [])
+		};
+		if (showVersion) obj.version = require("../package.json").version;
+		if (showHash) obj.hash = this.hash;
+		if (options.children !== false) obj.children = jsons;
+		return obj;
+	}
+
+	toString(options) {
+		if (typeof options === "boolean" || typeof options === "string") {
+			options = Stats.presetToOptions(options);
+		} else if (!options) {
+			options = {};
+		}
+
+		const useColors = optionOrFallback(options.colors, false);
+
+		const obj = this.toJson(options, true);
+
+		return Stats.jsonToString(obj, useColors);
+	}
+}
+
+module.exports = MultiStats;
diff --git a/node_modules/webpack/lib/MultiWatching.js b/node_modules/webpack/lib/MultiWatching.js
new file mode 100644
index 0000000..c16d3af
--- /dev/null
+++ b/node_modules/webpack/lib/MultiWatching.js
@@ -0,0 +1,50 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const asyncLib = require("neo-async");
+
+class MultiWatching {
+	constructor(watchings, compiler) {
+		this.watchings = watchings;
+		this.compiler = compiler;
+	}
+
+	invalidate() {
+		for (const watching of this.watchings) {
+			watching.invalidate();
+		}
+	}
+
+	suspend() {
+		for (const watching of this.watchings) {
+			watching.suspend();
+		}
+	}
+
+	resume() {
+		for (const watching of this.watchings) {
+			watching.resume();
+		}
+	}
+
+	close(callback) {
+		asyncLib.forEach(
+			this.watchings,
+			(watching, finishedCallback) => {
+				watching.close(finishedCallback);
+			},
+			err => {
+				this.compiler.hooks.watchClose.call();
+				if (typeof callback === "function") {
+					this.compiler.running = false;
+					callback(err);
+				}
+			}
+		);
+	}
+}
+
+module.exports = MultiWatching;
diff --git a/node_modules/webpack/lib/NamedChunksPlugin.js b/node_modules/webpack/lib/NamedChunksPlugin.js
new file mode 100644
index 0000000..0cb5b6b
--- /dev/null
+++ b/node_modules/webpack/lib/NamedChunksPlugin.js
@@ -0,0 +1,29 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class NamedChunksPlugin {
+	static defaultNameResolver(chunk) {
+		return chunk.name || null;
+	}
+
+	constructor(nameResolver) {
+		this.nameResolver = nameResolver || NamedChunksPlugin.defaultNameResolver;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap("NamedChunksPlugin", compilation => {
+			compilation.hooks.beforeChunkIds.tap("NamedChunksPlugin", chunks => {
+				for (const chunk of chunks) {
+					if (chunk.id === null) {
+						chunk.id = this.nameResolver(chunk);
+					}
+				}
+			});
+		});
+	}
+}
+
+module.exports = NamedChunksPlugin;
diff --git a/node_modules/webpack/lib/NamedModulesPlugin.js b/node_modules/webpack/lib/NamedModulesPlugin.js
new file mode 100644
index 0000000..2d84aaf
--- /dev/null
+++ b/node_modules/webpack/lib/NamedModulesPlugin.js
@@ -0,0 +1,58 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const createHash = require("./util/createHash");
+const RequestShortener = require("./RequestShortener");
+
+const getHash = str => {
+	const hash = createHash("md4");
+	hash.update(str);
+	const digest = /** @type {string} */ (hash.digest("hex"));
+	return digest.substr(0, 4);
+};
+
+class NamedModulesPlugin {
+	constructor(options) {
+		this.options = options || {};
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap("NamedModulesPlugin", compilation => {
+			compilation.hooks.beforeModuleIds.tap("NamedModulesPlugin", modules => {
+				const namedModules = new Map();
+				const context = this.options.context || compiler.options.context;
+
+				for (const module of modules) {
+					if (module.id === null && module.libIdent) {
+						module.id = module.libIdent({ context });
+					}
+
+					if (module.id !== null) {
+						const namedModule = namedModules.get(module.id);
+						if (namedModule !== undefined) {
+							namedModule.push(module);
+						} else {
+							namedModules.set(module.id, [module]);
+						}
+					}
+				}
+
+				for (const namedModule of namedModules.values()) {
+					if (namedModule.length > 1) {
+						for (const module of namedModule) {
+							const requestShortener = new RequestShortener(context);
+							module.id = `${module.id}?${getHash(
+								requestShortener.shorten(module.identifier())
+							)}`;
+						}
+					}
+				}
+			});
+		});
+	}
+}
+
+module.exports = NamedModulesPlugin;
diff --git a/node_modules/webpack/lib/NoEmitOnErrorsPlugin.js b/node_modules/webpack/lib/NoEmitOnErrorsPlugin.js
new file mode 100644
index 0000000..2c37c49
--- /dev/null
+++ b/node_modules/webpack/lib/NoEmitOnErrorsPlugin.js
@@ -0,0 +1,20 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class NoEmitOnErrorsPlugin {
+	apply(compiler) {
+		compiler.hooks.shouldEmit.tap("NoEmitOnErrorsPlugin", compilation => {
+			if (compilation.getStats().hasErrors()) return false;
+		});
+		compiler.hooks.compilation.tap("NoEmitOnErrorsPlugin", compilation => {
+			compilation.hooks.shouldRecord.tap("NoEmitOnErrorsPlugin", () => {
+				if (compilation.getStats().hasErrors()) return false;
+			});
+		});
+	}
+}
+
+module.exports = NoEmitOnErrorsPlugin;
diff --git a/node_modules/webpack/lib/NoModeWarning.js b/node_modules/webpack/lib/NoModeWarning.js
new file mode 100644
index 0000000..4bd3c3f
--- /dev/null
+++ b/node_modules/webpack/lib/NoModeWarning.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+module.exports = class NoModeWarning extends WebpackError {
+	constructor(modules) {
+		super();
+
+		this.name = "NoModeWarning";
+		this.message =
+			"configuration\n" +
+			"The 'mode' option has not been set, webpack will fallback to 'production' for this value. " +
+			"Set 'mode' option to 'development' or 'production' to enable defaults for each environment.\n" +
+			"You can also set it to 'none' to disable any default behavior. " +
+			"Learn more: https://webpack.js.org/configuration/mode/";
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/NodeStuffPlugin.js b/node_modules/webpack/lib/NodeStuffPlugin.js
new file mode 100644
index 0000000..5b38268
--- /dev/null
+++ b/node_modules/webpack/lib/NodeStuffPlugin.js
@@ -0,0 +1,118 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+const ParserHelpers = require("./ParserHelpers");
+const ConstDependency = require("./dependencies/ConstDependency");
+
+const NullFactory = require("./NullFactory");
+
+class NodeStuffPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		compiler.hooks.compilation.tap(
+			"NodeStuffPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+
+				const handler = (parser, parserOptions) => {
+					if (parserOptions.node === false) return;
+
+					let localOptions = options;
+					if (parserOptions.node) {
+						localOptions = Object.assign({}, localOptions, parserOptions.node);
+					}
+
+					const setConstant = (expressionName, value) => {
+						parser.hooks.expression
+							.for(expressionName)
+							.tap("NodeStuffPlugin", () => {
+								parser.state.current.addVariable(
+									expressionName,
+									JSON.stringify(value)
+								);
+								return true;
+							});
+					};
+
+					const setModuleConstant = (expressionName, fn) => {
+						parser.hooks.expression
+							.for(expressionName)
+							.tap("NodeStuffPlugin", () => {
+								parser.state.current.addVariable(
+									expressionName,
+									JSON.stringify(fn(parser.state.module))
+								);
+								return true;
+							});
+					};
+					const context = compiler.context;
+					if (localOptions.__filename) {
+						if (localOptions.__filename === "mock") {
+							setConstant("__filename", "/index.js");
+						} else {
+							setModuleConstant("__filename", module =>
+								path.relative(context, module.resource)
+							);
+						}
+						parser.hooks.evaluateIdentifier
+							.for("__filename")
+							.tap("NodeStuffPlugin", expr => {
+								if (!parser.state.module) return;
+								const resource = parser.state.module.resource;
+								const i = resource.indexOf("?");
+								return ParserHelpers.evaluateToString(
+									i < 0 ? resource : resource.substr(0, i)
+								)(expr);
+							});
+					}
+					if (localOptions.__dirname) {
+						if (localOptions.__dirname === "mock") {
+							setConstant("__dirname", "/");
+						} else {
+							setModuleConstant("__dirname", module =>
+								path.relative(context, module.context)
+							);
+						}
+						parser.hooks.evaluateIdentifier
+							.for("__dirname")
+							.tap("NodeStuffPlugin", expr => {
+								if (!parser.state.module) return;
+								return ParserHelpers.evaluateToString(
+									parser.state.module.context
+								)(expr);
+							});
+					}
+					parser.hooks.expression
+						.for("require.extensions")
+						.tap(
+							"NodeStuffPlugin",
+							ParserHelpers.expressionIsUnsupported(
+								parser,
+								"require.extensions is not supported by webpack. Use a loader instead."
+							)
+						);
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("NodeStuffPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("NodeStuffPlugin", handler);
+			}
+		);
+	}
+}
+module.exports = NodeStuffPlugin;
diff --git a/node_modules/webpack/lib/NormalModule.js b/node_modules/webpack/lib/NormalModule.js
new file mode 100644
index 0000000..76aa1bd
--- /dev/null
+++ b/node_modules/webpack/lib/NormalModule.js
@@ -0,0 +1,582 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const NativeModule = require("module");
+
+const {
+	CachedSource,
+	LineToLineMappedSource,
+	OriginalSource,
+	RawSource,
+	SourceMapSource
+} = require("webpack-sources");
+const { getContext, runLoaders } = require("loader-runner");
+
+const WebpackError = require("./WebpackError");
+const Module = require("./Module");
+const ModuleParseError = require("./ModuleParseError");
+const ModuleBuildError = require("./ModuleBuildError");
+const ModuleError = require("./ModuleError");
+const ModuleWarning = require("./ModuleWarning");
+const createHash = require("./util/createHash");
+const contextify = require("./util/identifier").contextify;
+
+/** @typedef {import("./util/createHash").Hash} Hash */
+
+const asString = buf => {
+	if (Buffer.isBuffer(buf)) {
+		return buf.toString("utf-8");
+	}
+	return buf;
+};
+
+const asBuffer = str => {
+	if (!Buffer.isBuffer(str)) {
+		return Buffer.from(str, "utf-8");
+	}
+	return str;
+};
+
+class NonErrorEmittedError extends WebpackError {
+	constructor(error) {
+		super();
+
+		this.name = "NonErrorEmittedError";
+		this.message = "(Emitted value instead of an instance of Error) " + error;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+/**
+ * @typedef {Object} CachedSourceEntry
+ * @property {TODO} source the generated source
+ * @property {string} hash the hash value
+ */
+
+class NormalModule extends Module {
+	constructor({
+		type,
+		request,
+		userRequest,
+		rawRequest,
+		loaders,
+		resource,
+		matchResource,
+		parser,
+		generator,
+		resolveOptions
+	}) {
+		super(type, getContext(resource));
+
+		// Info from Factory
+		this.request = request;
+		this.userRequest = userRequest;
+		this.rawRequest = rawRequest;
+		this.binary = type.startsWith("webassembly");
+		this.parser = parser;
+		this.generator = generator;
+		this.resource = resource;
+		this.matchResource = matchResource;
+		this.loaders = loaders;
+		if (resolveOptions !== undefined) this.resolveOptions = resolveOptions;
+
+		// Info from Build
+		this.error = null;
+		this._source = null;
+		this._sourceSize = null;
+		this._buildHash = "";
+		this.buildTimestamp = undefined;
+		/** @private @type {Map<string, CachedSourceEntry>} */
+		this._cachedSources = new Map();
+
+		// Options for the NormalModule set by plugins
+		// TODO refactor this -> options object filled from Factory
+		this.useSourceMap = false;
+		this.lineToLine = false;
+
+		// Cache
+		this._lastSuccessfulBuildMeta = {};
+	}
+
+	identifier() {
+		return this.request;
+	}
+
+	readableIdentifier(requestShortener) {
+		return requestShortener.shorten(this.userRequest);
+	}
+
+	libIdent(options) {
+		return contextify(options.context, this.userRequest);
+	}
+
+	nameForCondition() {
+		const resource = this.matchResource || this.resource;
+		const idx = resource.indexOf("?");
+		if (idx >= 0) return resource.substr(0, idx);
+		return resource;
+	}
+
+	updateCacheModule(module) {
+		this.type = module.type;
+		this.request = module.request;
+		this.userRequest = module.userRequest;
+		this.rawRequest = module.rawRequest;
+		this.parser = module.parser;
+		this.generator = module.generator;
+		this.resource = module.resource;
+		this.matchResource = module.matchResource;
+		this.loaders = module.loaders;
+		this.resolveOptions = module.resolveOptions;
+	}
+
+	createSourceForAsset(name, content, sourceMap) {
+		if (!sourceMap) {
+			return new RawSource(content);
+		}
+
+		if (typeof sourceMap === "string") {
+			return new OriginalSource(content, sourceMap);
+		}
+
+		return new SourceMapSource(content, name, sourceMap);
+	}
+
+	createLoaderContext(resolver, options, compilation, fs) {
+		const requestShortener = compilation.runtimeTemplate.requestShortener;
+		const getCurrentLoaderName = () => {
+			const currentLoader = this.getCurrentLoader(loaderContext);
+			if (!currentLoader) return "(not in loader scope)";
+			return requestShortener.shorten(currentLoader.loader);
+		};
+		const loaderContext = {
+			version: 2,
+			emitWarning: warning => {
+				if (!(warning instanceof Error)) {
+					warning = new NonErrorEmittedError(warning);
+				}
+				this.warnings.push(
+					new ModuleWarning(this, warning, {
+						from: getCurrentLoaderName()
+					})
+				);
+			},
+			emitError: error => {
+				if (!(error instanceof Error)) {
+					error = new NonErrorEmittedError(error);
+				}
+				this.errors.push(
+					new ModuleError(this, error, {
+						from: getCurrentLoaderName()
+					})
+				);
+			},
+			getLogger: name => {
+				const currentLoader = this.getCurrentLoader(loaderContext);
+				return compilation.getLogger(() =>
+					[currentLoader && currentLoader.loader, name, this.identifier()]
+						.filter(Boolean)
+						.join("|")
+				);
+			},
+			// TODO remove in webpack 5
+			exec: (code, filename) => {
+				// @ts-ignore Argument of type 'this' is not assignable to parameter of type 'Module'.
+				const module = new NativeModule(filename, this);
+				// @ts-ignore _nodeModulePaths is deprecated and undocumented Node.js API
+				module.paths = NativeModule._nodeModulePaths(this.context);
+				module.filename = filename;
+				module._compile(code, filename);
+				return module.exports;
+			},
+			resolve(context, request, callback) {
+				resolver.resolve({}, context, request, {}, callback);
+			},
+			getResolve(options) {
+				const child = options ? resolver.withOptions(options) : resolver;
+				return (context, request, callback) => {
+					if (callback) {
+						child.resolve({}, context, request, {}, callback);
+					} else {
+						return new Promise((resolve, reject) => {
+							child.resolve({}, context, request, {}, (err, result) => {
+								if (err) reject(err);
+								else resolve(result);
+							});
+						});
+					}
+				};
+			},
+			emitFile: (name, content, sourceMap, assetInfo) => {
+				if (!this.buildInfo.assets) {
+					this.buildInfo.assets = Object.create(null);
+					this.buildInfo.assetsInfo = new Map();
+				}
+				this.buildInfo.assets[name] = this.createSourceForAsset(
+					name,
+					content,
+					sourceMap
+				);
+				this.buildInfo.assetsInfo.set(name, assetInfo);
+			},
+			rootContext: options.context,
+			webpack: true,
+			sourceMap: !!this.useSourceMap,
+			mode: options.mode || "production",
+			_module: this,
+			_compilation: compilation,
+			_compiler: compilation.compiler,
+			fs: fs
+		};
+
+		compilation.hooks.normalModuleLoader.call(loaderContext, this);
+		if (options.loader) {
+			Object.assign(loaderContext, options.loader);
+		}
+
+		return loaderContext;
+	}
+
+	getCurrentLoader(loaderContext, index = loaderContext.loaderIndex) {
+		if (
+			this.loaders &&
+			this.loaders.length &&
+			index < this.loaders.length &&
+			index >= 0 &&
+			this.loaders[index]
+		) {
+			return this.loaders[index];
+		}
+		return null;
+	}
+
+	createSource(source, resourceBuffer, sourceMap) {
+		// if there is no identifier return raw source
+		if (!this.identifier) {
+			return new RawSource(source);
+		}
+
+		// from here on we assume we have an identifier
+		const identifier = this.identifier();
+
+		if (this.lineToLine && resourceBuffer) {
+			return new LineToLineMappedSource(
+				source,
+				identifier,
+				asString(resourceBuffer)
+			);
+		}
+
+		if (this.useSourceMap && sourceMap) {
+			return new SourceMapSource(source, identifier, sourceMap);
+		}
+
+		if (Buffer.isBuffer(source)) {
+			// @ts-ignore
+			// TODO We need to fix @types/webpack-sources to allow RawSource to take a Buffer | string
+			return new RawSource(source);
+		}
+
+		return new OriginalSource(source, identifier);
+	}
+
+	doBuild(options, compilation, resolver, fs, callback) {
+		const loaderContext = this.createLoaderContext(
+			resolver,
+			options,
+			compilation,
+			fs
+		);
+
+		runLoaders(
+			{
+				resource: this.resource,
+				loaders: this.loaders,
+				context: loaderContext,
+				readResource: fs.readFile.bind(fs)
+			},
+			(err, result) => {
+				if (result) {
+					this.buildInfo.cacheable = result.cacheable;
+					this.buildInfo.fileDependencies = new Set(result.fileDependencies);
+					this.buildInfo.contextDependencies = new Set(
+						result.contextDependencies
+					);
+				}
+
+				if (err) {
+					if (!(err instanceof Error)) {
+						err = new NonErrorEmittedError(err);
+					}
+					const currentLoader = this.getCurrentLoader(loaderContext);
+					const error = new ModuleBuildError(this, err, {
+						from:
+							currentLoader &&
+							compilation.runtimeTemplate.requestShortener.shorten(
+								currentLoader.loader
+							)
+					});
+					return callback(error);
+				}
+
+				const resourceBuffer = result.resourceBuffer;
+				const source = result.result[0];
+				const sourceMap = result.result.length >= 1 ? result.result[1] : null;
+				const extraInfo = result.result.length >= 2 ? result.result[2] : null;
+
+				if (!Buffer.isBuffer(source) && typeof source !== "string") {
+					const currentLoader = this.getCurrentLoader(loaderContext, 0);
+					const err = new Error(
+						`Final loader (${
+							currentLoader
+								? compilation.runtimeTemplate.requestShortener.shorten(
+										currentLoader.loader
+								  )
+								: "unknown"
+						}) didn't return a Buffer or String`
+					);
+					const error = new ModuleBuildError(this, err);
+					return callback(error);
+				}
+
+				this._source = this.createSource(
+					this.binary ? asBuffer(source) : asString(source),
+					resourceBuffer,
+					sourceMap
+				);
+				this._sourceSize = null;
+				this._ast =
+					typeof extraInfo === "object" &&
+					extraInfo !== null &&
+					extraInfo.webpackAST !== undefined
+						? extraInfo.webpackAST
+						: null;
+				return callback();
+			}
+		);
+	}
+
+	markModuleAsErrored(error) {
+		// Restore build meta from successful build to keep importing state
+		this.buildMeta = Object.assign({}, this._lastSuccessfulBuildMeta);
+		this.error = error;
+		this.errors.push(this.error);
+		this._source = new RawSource(
+			"throw new Error(" + JSON.stringify(this.error.message) + ");"
+		);
+		this._sourceSize = null;
+		this._ast = null;
+	}
+
+	applyNoParseRule(rule, content) {
+		// must start with "rule" if rule is a string
+		if (typeof rule === "string") {
+			return content.indexOf(rule) === 0;
+		}
+
+		if (typeof rule === "function") {
+			return rule(content);
+		}
+		// we assume rule is a regexp
+		return rule.test(content);
+	}
+
+	// check if module should not be parsed
+	// returns "true" if the module should !not! be parsed
+	// returns "false" if the module !must! be parsed
+	shouldPreventParsing(noParseRule, request) {
+		// if no noParseRule exists, return false
+		// the module !must! be parsed.
+		if (!noParseRule) {
+			return false;
+		}
+
+		// we only have one rule to check
+		if (!Array.isArray(noParseRule)) {
+			// returns "true" if the module is !not! to be parsed
+			return this.applyNoParseRule(noParseRule, request);
+		}
+
+		for (let i = 0; i < noParseRule.length; i++) {
+			const rule = noParseRule[i];
+			// early exit on first truthy match
+			// this module is !not! to be parsed
+			if (this.applyNoParseRule(rule, request)) {
+				return true;
+			}
+		}
+		// no match found, so this module !should! be parsed
+		return false;
+	}
+
+	_initBuildHash(compilation) {
+		const hash = createHash(compilation.outputOptions.hashFunction);
+		if (this._source) {
+			hash.update("source");
+			this._source.updateHash(hash);
+		}
+		hash.update("meta");
+		hash.update(JSON.stringify(this.buildMeta));
+		this._buildHash = /** @type {string} */ (hash.digest("hex"));
+	}
+
+	build(options, compilation, resolver, fs, callback) {
+		this.buildTimestamp = Date.now();
+		this.built = true;
+		this._source = null;
+		this._sourceSize = null;
+		this._ast = null;
+		this._buildHash = "";
+		this.error = null;
+		this.errors.length = 0;
+		this.warnings.length = 0;
+		this.buildMeta = {};
+		this.buildInfo = {
+			cacheable: false,
+			fileDependencies: new Set(),
+			contextDependencies: new Set(),
+			assets: undefined,
+			assetsInfo: undefined
+		};
+
+		return this.doBuild(options, compilation, resolver, fs, err => {
+			this._cachedSources.clear();
+
+			// if we have an error mark module as failed and exit
+			if (err) {
+				this.markModuleAsErrored(err);
+				this._initBuildHash(compilation);
+				return callback();
+			}
+
+			// check if this module should !not! be parsed.
+			// if so, exit here;
+			const noParseRule = options.module && options.module.noParse;
+			if (this.shouldPreventParsing(noParseRule, this.request)) {
+				this._initBuildHash(compilation);
+				return callback();
+			}
+
+			const handleParseError = e => {
+				const source = this._source.source();
+				const loaders = this.loaders.map(item =>
+					contextify(options.context, item.loader)
+				);
+				const error = new ModuleParseError(this, source, e, loaders);
+				this.markModuleAsErrored(error);
+				this._initBuildHash(compilation);
+				return callback();
+			};
+
+			const handleParseResult = result => {
+				this._lastSuccessfulBuildMeta = this.buildMeta;
+				this._initBuildHash(compilation);
+				return callback();
+			};
+
+			try {
+				const result = this.parser.parse(
+					this._ast || this._source.source(),
+					{
+						current: this,
+						module: this,
+						compilation: compilation,
+						options: options
+					},
+					(err, result) => {
+						if (err) {
+							handleParseError(err);
+						} else {
+							handleParseResult(result);
+						}
+					}
+				);
+				if (result !== undefined) {
+					// parse is sync
+					handleParseResult(result);
+				}
+			} catch (e) {
+				handleParseError(e);
+			}
+		});
+	}
+
+	getHashDigest(dependencyTemplates) {
+		// TODO webpack 5 refactor
+		let dtHash = dependencyTemplates.get("hash");
+		return `${this.hash}-${dtHash}`;
+	}
+
+	source(dependencyTemplates, runtimeTemplate, type = "javascript") {
+		const hashDigest = this.getHashDigest(dependencyTemplates);
+		const cacheEntry = this._cachedSources.get(type);
+		if (cacheEntry !== undefined && cacheEntry.hash === hashDigest) {
+			// We can reuse the cached source
+			return cacheEntry.source;
+		}
+
+		const source = this.generator.generate(
+			this,
+			dependencyTemplates,
+			runtimeTemplate,
+			type
+		);
+
+		const cachedSource = new CachedSource(source);
+		this._cachedSources.set(type, {
+			source: cachedSource,
+			hash: hashDigest
+		});
+		return cachedSource;
+	}
+
+	originalSource() {
+		return this._source;
+	}
+
+	needRebuild(fileTimestamps, contextTimestamps) {
+		// always try to rebuild in case of an error
+		if (this.error) return true;
+
+		// always rebuild when module is not cacheable
+		if (!this.buildInfo.cacheable) return true;
+
+		// Check timestamps of all dependencies
+		// Missing timestamp -> need rebuild
+		// Timestamp bigger than buildTimestamp -> need rebuild
+		for (const file of this.buildInfo.fileDependencies) {
+			const timestamp = fileTimestamps.get(file);
+			if (!timestamp) return true;
+			if (timestamp >= this.buildTimestamp) return true;
+		}
+		for (const file of this.buildInfo.contextDependencies) {
+			const timestamp = contextTimestamps.get(file);
+			if (!timestamp) return true;
+			if (timestamp >= this.buildTimestamp) return true;
+		}
+		// elsewise -> no rebuild needed
+		return false;
+	}
+
+	size() {
+		if (this._sourceSize === null) {
+			this._sourceSize = this._source ? this._source.size() : -1;
+		}
+		return this._sourceSize;
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track dependencies
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		hash.update(this._buildHash);
+		super.updateHash(hash);
+	}
+}
+
+module.exports = NormalModule;
diff --git a/node_modules/webpack/lib/NormalModuleFactory.js b/node_modules/webpack/lib/NormalModuleFactory.js
new file mode 100644
index 0000000..e6a4109
--- /dev/null
+++ b/node_modules/webpack/lib/NormalModuleFactory.js
@@ -0,0 +1,528 @@
+/*
+ MIT License http://www.opensource.org/licenses/mit-license.php
+ Author Tobias Koppers @sokra
+ */
+"use strict";
+
+const path = require("path");
+const asyncLib = require("neo-async");
+const {
+	Tapable,
+	AsyncSeriesWaterfallHook,
+	SyncWaterfallHook,
+	SyncBailHook,
+	SyncHook,
+	HookMap
+} = require("tapable");
+const NormalModule = require("./NormalModule");
+const RawModule = require("./RawModule");
+const RuleSet = require("./RuleSet");
+const { cachedCleverMerge } = require("./util/cleverMerge");
+
+const EMPTY_RESOLVE_OPTIONS = {};
+
+const MATCH_RESOURCE_REGEX = /^([^!]+)!=!/;
+
+const loaderToIdent = data => {
+	if (!data.options) {
+		return data.loader;
+	}
+	if (typeof data.options === "string") {
+		return data.loader + "?" + data.options;
+	}
+	if (typeof data.options !== "object") {
+		throw new Error("loader options must be string or object");
+	}
+	if (data.ident) {
+		return data.loader + "??" + data.ident;
+	}
+	return data.loader + "?" + JSON.stringify(data.options);
+};
+
+const identToLoaderRequest = resultString => {
+	const idx = resultString.indexOf("?");
+	if (idx >= 0) {
+		const loader = resultString.substr(0, idx);
+		const options = resultString.substr(idx + 1);
+		return {
+			loader,
+			options
+		};
+	} else {
+		return {
+			loader: resultString,
+			options: undefined
+		};
+	}
+};
+
+const dependencyCache = new WeakMap();
+
+class NormalModuleFactory extends Tapable {
+	constructor(context, resolverFactory, options) {
+		super();
+		this.hooks = {
+			resolver: new SyncWaterfallHook(["resolver"]),
+			factory: new SyncWaterfallHook(["factory"]),
+			beforeResolve: new AsyncSeriesWaterfallHook(["data"]),
+			afterResolve: new AsyncSeriesWaterfallHook(["data"]),
+			createModule: new SyncBailHook(["data"]),
+			module: new SyncWaterfallHook(["module", "data"]),
+			createParser: new HookMap(() => new SyncBailHook(["parserOptions"])),
+			parser: new HookMap(() => new SyncHook(["parser", "parserOptions"])),
+			createGenerator: new HookMap(
+				() => new SyncBailHook(["generatorOptions"])
+			),
+			generator: new HookMap(
+				() => new SyncHook(["generator", "generatorOptions"])
+			)
+		};
+		this._pluginCompat.tap("NormalModuleFactory", options => {
+			switch (options.name) {
+				case "before-resolve":
+				case "after-resolve":
+					options.async = true;
+					break;
+				case "parser":
+					this.hooks.parser
+						.for("javascript/auto")
+						.tap(options.fn.name || "unnamed compat plugin", options.fn);
+					return true;
+			}
+			let match;
+			match = /^parser (.+)$/.exec(options.name);
+			if (match) {
+				this.hooks.parser
+					.for(match[1])
+					.tap(
+						options.fn.name || "unnamed compat plugin",
+						options.fn.bind(this)
+					);
+				return true;
+			}
+			match = /^create-parser (.+)$/.exec(options.name);
+			if (match) {
+				this.hooks.createParser
+					.for(match[1])
+					.tap(
+						options.fn.name || "unnamed compat plugin",
+						options.fn.bind(this)
+					);
+				return true;
+			}
+		});
+		this.resolverFactory = resolverFactory;
+		this.ruleSet = new RuleSet(options.defaultRules.concat(options.rules));
+		this.cachePredicate =
+			typeof options.unsafeCache === "function"
+				? options.unsafeCache
+				: Boolean.bind(null, options.unsafeCache);
+		this.context = context || "";
+		this.parserCache = Object.create(null);
+		this.generatorCache = Object.create(null);
+		this.hooks.factory.tap("NormalModuleFactory", () => (result, callback) => {
+			let resolver = this.hooks.resolver.call(null);
+
+			// Ignored
+			if (!resolver) return callback();
+
+			resolver(result, (err, data) => {
+				if (err) return callback(err);
+
+				// Ignored
+				if (!data) return callback();
+
+				// direct module
+				if (typeof data.source === "function") return callback(null, data);
+
+				this.hooks.afterResolve.callAsync(data, (err, result) => {
+					if (err) return callback(err);
+
+					// Ignored
+					if (!result) return callback();
+
+					let createdModule = this.hooks.createModule.call(result);
+					if (!createdModule) {
+						if (!result.request) {
+							return callback(new Error("Empty dependency (no request)"));
+						}
+
+						createdModule = new NormalModule(result);
+					}
+
+					createdModule = this.hooks.module.call(createdModule, result);
+
+					return callback(null, createdModule);
+				});
+			});
+		});
+		this.hooks.resolver.tap("NormalModuleFactory", () => (data, callback) => {
+			const contextInfo = data.contextInfo;
+			const context = data.context;
+			const request = data.request;
+
+			const loaderResolver = this.getResolver("loader");
+			const normalResolver = this.getResolver("normal", data.resolveOptions);
+
+			let matchResource = undefined;
+			let requestWithoutMatchResource = request;
+			const matchResourceMatch = MATCH_RESOURCE_REGEX.exec(request);
+			if (matchResourceMatch) {
+				matchResource = matchResourceMatch[1];
+				if (/^\.\.?\//.test(matchResource)) {
+					matchResource = path.join(context, matchResource);
+				}
+				requestWithoutMatchResource = request.substr(
+					matchResourceMatch[0].length
+				);
+			}
+
+			const noPreAutoLoaders = requestWithoutMatchResource.startsWith("-!");
+			const noAutoLoaders =
+				noPreAutoLoaders || requestWithoutMatchResource.startsWith("!");
+			const noPrePostAutoLoaders = requestWithoutMatchResource.startsWith("!!");
+			let elements = requestWithoutMatchResource
+				.replace(/^-?!+/, "")
+				.replace(/!!+/g, "!")
+				.split("!");
+			let resource = elements.pop();
+			elements = elements.map(identToLoaderRequest);
+
+			asyncLib.parallel(
+				[
+					callback =>
+						this.resolveRequestArray(
+							contextInfo,
+							context,
+							elements,
+							loaderResolver,
+							callback
+						),
+					callback => {
+						if (resource === "" || resource[0] === "?") {
+							return callback(null, {
+								resource
+							});
+						}
+
+						normalResolver.resolve(
+							contextInfo,
+							context,
+							resource,
+							{},
+							(err, resource, resourceResolveData) => {
+								if (err) return callback(err);
+								callback(null, {
+									resourceResolveData,
+									resource
+								});
+							}
+						);
+					}
+				],
+				(err, results) => {
+					if (err) return callback(err);
+					let loaders = results[0];
+					const resourceResolveData = results[1].resourceResolveData;
+					resource = results[1].resource;
+
+					// translate option idents
+					try {
+						for (const item of loaders) {
+							if (typeof item.options === "string" && item.options[0] === "?") {
+								const ident = item.options.substr(1);
+								item.options = this.ruleSet.findOptionsByIdent(ident);
+								item.ident = ident;
+							}
+						}
+					} catch (e) {
+						return callback(e);
+					}
+
+					if (resource === false) {
+						// ignored
+						return callback(
+							null,
+							new RawModule(
+								"/* (ignored) */",
+								`ignored ${context} ${request}`,
+								`${request} (ignored)`
+							)
+						);
+					}
+
+					const userRequest =
+						(matchResource !== undefined ? `${matchResource}!=!` : "") +
+						loaders
+							.map(loaderToIdent)
+							.concat([resource])
+							.join("!");
+
+					let resourcePath =
+						matchResource !== undefined ? matchResource : resource;
+					let resourceQuery = "";
+					const queryIndex = resourcePath.indexOf("?");
+					if (queryIndex >= 0) {
+						resourceQuery = resourcePath.substr(queryIndex);
+						resourcePath = resourcePath.substr(0, queryIndex);
+					}
+
+					const result = this.ruleSet.exec({
+						resource: resourcePath,
+						realResource:
+							matchResource !== undefined
+								? resource.replace(/\?.*/, "")
+								: resourcePath,
+						resourceQuery,
+						issuer: contextInfo.issuer,
+						compiler: contextInfo.compiler
+					});
+					const settings = {};
+					const useLoadersPost = [];
+					const useLoaders = [];
+					const useLoadersPre = [];
+					for (const r of result) {
+						if (r.type === "use") {
+							if (r.enforce === "post" && !noPrePostAutoLoaders) {
+								useLoadersPost.push(r.value);
+							} else if (
+								r.enforce === "pre" &&
+								!noPreAutoLoaders &&
+								!noPrePostAutoLoaders
+							) {
+								useLoadersPre.push(r.value);
+							} else if (
+								!r.enforce &&
+								!noAutoLoaders &&
+								!noPrePostAutoLoaders
+							) {
+								useLoaders.push(r.value);
+							}
+						} else if (
+							typeof r.value === "object" &&
+							r.value !== null &&
+							typeof settings[r.type] === "object" &&
+							settings[r.type] !== null
+						) {
+							settings[r.type] = cachedCleverMerge(settings[r.type], r.value);
+						} else {
+							settings[r.type] = r.value;
+						}
+					}
+					asyncLib.parallel(
+						[
+							this.resolveRequestArray.bind(
+								this,
+								contextInfo,
+								this.context,
+								useLoadersPost,
+								loaderResolver
+							),
+							this.resolveRequestArray.bind(
+								this,
+								contextInfo,
+								this.context,
+								useLoaders,
+								loaderResolver
+							),
+							this.resolveRequestArray.bind(
+								this,
+								contextInfo,
+								this.context,
+								useLoadersPre,
+								loaderResolver
+							)
+						],
+						(err, results) => {
+							if (err) return callback(err);
+							if (matchResource === undefined) {
+								loaders = results[0].concat(loaders, results[1], results[2]);
+							} else {
+								loaders = results[0].concat(results[1], loaders, results[2]);
+							}
+							process.nextTick(() => {
+								const type = settings.type;
+								const resolveOptions = settings.resolve;
+								callback(null, {
+									context: context,
+									request: loaders
+										.map(loaderToIdent)
+										.concat([resource])
+										.join("!"),
+									dependencies: data.dependencies,
+									userRequest,
+									rawRequest: request,
+									loaders,
+									resource,
+									matchResource,
+									resourceResolveData,
+									settings,
+									type,
+									parser: this.getParser(type, settings.parser),
+									generator: this.getGenerator(type, settings.generator),
+									resolveOptions
+								});
+							});
+						}
+					);
+				}
+			);
+		});
+	}
+
+	create(data, callback) {
+		const dependencies = data.dependencies;
+		const cacheEntry = dependencyCache.get(dependencies[0]);
+		if (cacheEntry) return callback(null, cacheEntry);
+		const context = data.context || this.context;
+		const resolveOptions = data.resolveOptions || EMPTY_RESOLVE_OPTIONS;
+		const request = dependencies[0].request;
+		const contextInfo = data.contextInfo || {};
+		this.hooks.beforeResolve.callAsync(
+			{
+				contextInfo,
+				resolveOptions,
+				context,
+				request,
+				dependencies
+			},
+			(err, result) => {
+				if (err) return callback(err);
+
+				// Ignored
+				if (!result) return callback();
+
+				const factory = this.hooks.factory.call(null);
+
+				// Ignored
+				if (!factory) return callback();
+
+				factory(result, (err, module) => {
+					if (err) return callback(err);
+
+					if (module && this.cachePredicate(module)) {
+						for (const d of dependencies) {
+							dependencyCache.set(d, module);
+						}
+					}
+
+					callback(null, module);
+				});
+			}
+		);
+	}
+
+	resolveRequestArray(contextInfo, context, array, resolver, callback) {
+		if (array.length === 0) return callback(null, []);
+		asyncLib.map(
+			array,
+			(item, callback) => {
+				resolver.resolve(
+					contextInfo,
+					context,
+					item.loader,
+					{},
+					(err, result) => {
+						if (
+							err &&
+							/^[^/]*$/.test(item.loader) &&
+							!/-loader$/.test(item.loader)
+						) {
+							return resolver.resolve(
+								contextInfo,
+								context,
+								item.loader + "-loader",
+								{},
+								err2 => {
+									if (!err2) {
+										err.message =
+											err.message +
+											"\n" +
+											"BREAKING CHANGE: It's no longer allowed to omit the '-loader' suffix when using loaders.\n" +
+											`                 You need to specify '${item.loader}-loader' instead of '${item.loader}',\n` +
+											"                 see https://webpack.js.org/migrate/3/#automatic-loader-module-name-extension-removed";
+									}
+									callback(err);
+								}
+							);
+						}
+						if (err) return callback(err);
+
+						const optionsOnly = item.options
+							? {
+									options: item.options
+							  }
+							: undefined;
+						return callback(
+							null,
+							Object.assign({}, item, identToLoaderRequest(result), optionsOnly)
+						);
+					}
+				);
+			},
+			callback
+		);
+	}
+
+	getParser(type, parserOptions) {
+		let ident = type;
+		if (parserOptions) {
+			if (parserOptions.ident) {
+				ident = `${type}|${parserOptions.ident}`;
+			} else {
+				ident = JSON.stringify([type, parserOptions]);
+			}
+		}
+		if (ident in this.parserCache) {
+			return this.parserCache[ident];
+		}
+		return (this.parserCache[ident] = this.createParser(type, parserOptions));
+	}
+
+	createParser(type, parserOptions = {}) {
+		const parser = this.hooks.createParser.for(type).call(parserOptions);
+		if (!parser) {
+			throw new Error(`No parser registered for ${type}`);
+		}
+		this.hooks.parser.for(type).call(parser, parserOptions);
+		return parser;
+	}
+
+	getGenerator(type, generatorOptions) {
+		let ident = type;
+		if (generatorOptions) {
+			if (generatorOptions.ident) {
+				ident = `${type}|${generatorOptions.ident}`;
+			} else {
+				ident = JSON.stringify([type, generatorOptions]);
+			}
+		}
+		if (ident in this.generatorCache) {
+			return this.generatorCache[ident];
+		}
+		return (this.generatorCache[ident] = this.createGenerator(
+			type,
+			generatorOptions
+		));
+	}
+
+	createGenerator(type, generatorOptions = {}) {
+		const generator = this.hooks.createGenerator
+			.for(type)
+			.call(generatorOptions);
+		if (!generator) {
+			throw new Error(`No generator registered for ${type}`);
+		}
+		this.hooks.generator.for(type).call(generator, generatorOptions);
+		return generator;
+	}
+
+	getResolver(type, resolveOptions) {
+		return this.resolverFactory.get(
+			type,
+			resolveOptions || EMPTY_RESOLVE_OPTIONS
+		);
+	}
+}
+
+module.exports = NormalModuleFactory;
diff --git a/node_modules/webpack/lib/NormalModuleReplacementPlugin.js b/node_modules/webpack/lib/NormalModuleReplacementPlugin.js
new file mode 100644
index 0000000..d4f23a5
--- /dev/null
+++ b/node_modules/webpack/lib/NormalModuleReplacementPlugin.js
@@ -0,0 +1,51 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+
+class NormalModuleReplacementPlugin {
+	constructor(resourceRegExp, newResource) {
+		this.resourceRegExp = resourceRegExp;
+		this.newResource = newResource;
+	}
+
+	apply(compiler) {
+		const resourceRegExp = this.resourceRegExp;
+		const newResource = this.newResource;
+		compiler.hooks.normalModuleFactory.tap(
+			"NormalModuleReplacementPlugin",
+			nmf => {
+				nmf.hooks.beforeResolve.tap("NormalModuleReplacementPlugin", result => {
+					if (!result) return;
+					if (resourceRegExp.test(result.request)) {
+						if (typeof newResource === "function") {
+							newResource(result);
+						} else {
+							result.request = newResource;
+						}
+					}
+					return result;
+				});
+				nmf.hooks.afterResolve.tap("NormalModuleReplacementPlugin", result => {
+					if (!result) return;
+					if (resourceRegExp.test(result.resource)) {
+						if (typeof newResource === "function") {
+							newResource(result);
+						} else {
+							result.resource = path.resolve(
+								path.dirname(result.resource),
+								newResource
+							);
+						}
+					}
+					return result;
+				});
+			}
+		);
+	}
+}
+
+module.exports = NormalModuleReplacementPlugin;
diff --git a/node_modules/webpack/lib/NullFactory.js b/node_modules/webpack/lib/NullFactory.js
new file mode 100644
index 0000000..90ede1f
--- /dev/null
+++ b/node_modules/webpack/lib/NullFactory.js
@@ -0,0 +1,12 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class NullFactory {
+	create(data, callback) {
+		return callback();
+	}
+}
+module.exports = NullFactory;
diff --git a/node_modules/webpack/lib/OptionsApply.js b/node_modules/webpack/lib/OptionsApply.js
new file mode 100644
index 0000000..3b1ec31
--- /dev/null
+++ b/node_modules/webpack/lib/OptionsApply.js
@@ -0,0 +1,10 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class OptionsApply {
+	process(options, compiler) {}
+}
+module.exports = OptionsApply;
diff --git a/node_modules/webpack/lib/OptionsDefaulter.js b/node_modules/webpack/lib/OptionsDefaulter.js
new file mode 100644
index 0000000..90fc895
--- /dev/null
+++ b/node_modules/webpack/lib/OptionsDefaulter.js
@@ -0,0 +1,141 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+/**
+ * Gets the value at path of object
+ * @param {object} obj object to query
+ * @param {string} path query path
+ * @returns {any} - if {@param path} requests element from array, then `undefined` will be returned
+ */
+const getProperty = (obj, path) => {
+	let name = path.split(".");
+	for (let i = 0; i < name.length - 1; i++) {
+		obj = obj[name[i]];
+		if (typeof obj !== "object" || !obj || Array.isArray(obj)) return;
+	}
+	return obj[name.pop()];
+};
+
+/**
+ * Sets the value at path of object. Stops execution, if {@param path} requests element from array to be set
+ * @param {object} obj object to query
+ * @param {string} path query path
+ * @param {any} value value to be set
+ * @returns {void}
+ */
+const setProperty = (obj, path, value) => {
+	let name = path.split(".");
+	for (let i = 0; i < name.length - 1; i++) {
+		if (typeof obj[name[i]] !== "object" && obj[name[i]] !== undefined) return;
+		if (Array.isArray(obj[name[i]])) return;
+		if (!obj[name[i]]) obj[name[i]] = {};
+		obj = obj[name[i]];
+	}
+	obj[name.pop()] = value;
+};
+
+/**
+ * @typedef {'call' | 'make' | 'append'} ConfigType
+ */
+/**
+ * @typedef {(options: object) => any} MakeConfigHandler
+ */
+/**
+ * @typedef {(value: any, options: object) => any} CallConfigHandler
+ */
+/**
+ * @typedef {any[]} AppendConfigValues
+ */
+
+class OptionsDefaulter {
+	constructor() {
+		/**
+		 * Stores default options settings or functions for computing them
+		 */
+		this.defaults = {};
+		/**
+		 * Stores configuration for options
+		 * @type {{[key: string]: ConfigType}}
+		 */
+		this.config = {};
+	}
+
+	/**
+	 * Enhancing {@param options} with default values
+	 * @param {object} options provided options
+	 * @returns {object} - enhanced options
+	 * @throws {Error} - will throw error, if configuration value is other then `undefined` or {@link ConfigType}
+	 */
+	process(options) {
+		options = Object.assign({}, options);
+		for (let name in this.defaults) {
+			switch (this.config[name]) {
+				/**
+				 * If {@link ConfigType} doesn't specified and current value is `undefined`, then default value will be assigned
+				 */
+				case undefined:
+					if (getProperty(options, name) === undefined) {
+						setProperty(options, name, this.defaults[name]);
+					}
+					break;
+				/**
+				 * Assign result of {@link CallConfigHandler}
+				 */
+				case "call":
+					setProperty(
+						options,
+						name,
+						this.defaults[name].call(this, getProperty(options, name), options)
+					);
+					break;
+				/**
+				 * Assign result of {@link MakeConfigHandler}, if current value is `undefined`
+				 */
+				case "make":
+					if (getProperty(options, name) === undefined) {
+						setProperty(options, name, this.defaults[name].call(this, options));
+					}
+					break;
+				/**
+				 * Adding {@link AppendConfigValues} at the end of the current array
+				 */
+				case "append": {
+					let oldValue = getProperty(options, name);
+					if (!Array.isArray(oldValue)) {
+						oldValue = [];
+					}
+					oldValue.push(...this.defaults[name]);
+					setProperty(options, name, oldValue);
+					break;
+				}
+				default:
+					throw new Error(
+						"OptionsDefaulter cannot process " + this.config[name]
+					);
+			}
+		}
+		return options;
+	}
+
+	/**
+	 * Builds up default values
+	 * @param {string} name option path
+	 * @param {ConfigType | any} config if {@param def} is provided, then only {@link ConfigType} is allowed
+	 * @param {MakeConfigHandler | CallConfigHandler | AppendConfigValues} [def] defaults
+	 * @returns {void}
+	 */
+	set(name, config, def) {
+		if (def !== undefined) {
+			this.defaults[name] = def;
+			this.config[name] = config;
+		} else {
+			this.defaults[name] = config;
+			delete this.config[name];
+		}
+	}
+}
+
+module.exports = OptionsDefaulter;
diff --git a/node_modules/webpack/lib/Parser.js b/node_modules/webpack/lib/Parser.js
new file mode 100644
index 0000000..b496845
--- /dev/null
+++ b/node_modules/webpack/lib/Parser.js
@@ -0,0 +1,2454 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+// Syntax: https://developer.mozilla.org/en/SpiderMonkey/Parser_API
+
+const acorn = require("acorn");
+const { Tapable, SyncBailHook, HookMap } = require("tapable");
+const util = require("util");
+const vm = require("vm");
+const BasicEvaluatedExpression = require("./BasicEvaluatedExpression");
+const StackedSetMap = require("./util/StackedSetMap");
+
+const acornParser = acorn.Parser;
+
+const joinRanges = (startRange, endRange) => {
+	if (!endRange) return startRange;
+	if (!startRange) return endRange;
+	return [startRange[0], endRange[1]];
+};
+
+const defaultParserOptions = {
+	ranges: true,
+	locations: true,
+	ecmaVersion: 11,
+	sourceType: "module",
+	onComment: null
+};
+
+// regexp to match at least one "magic comment"
+const webpackCommentRegExp = new RegExp(/(^|\W)webpack[A-Z]{1,}[A-Za-z]{1,}:/);
+
+const EMPTY_COMMENT_OPTIONS = {
+	options: null,
+	errors: null
+};
+
+class Parser extends Tapable {
+	constructor(options, sourceType = "auto") {
+		super();
+		this.hooks = {
+			evaluateTypeof: new HookMap(() => new SyncBailHook(["expression"])),
+			evaluate: new HookMap(() => new SyncBailHook(["expression"])),
+			evaluateIdentifier: new HookMap(() => new SyncBailHook(["expression"])),
+			evaluateDefinedIdentifier: new HookMap(
+				() => new SyncBailHook(["expression"])
+			),
+			evaluateCallExpressionMember: new HookMap(
+				() => new SyncBailHook(["expression", "param"])
+			),
+			statement: new SyncBailHook(["statement"]),
+			statementIf: new SyncBailHook(["statement"]),
+			label: new HookMap(() => new SyncBailHook(["statement"])),
+			import: new SyncBailHook(["statement", "source"]),
+			importSpecifier: new SyncBailHook([
+				"statement",
+				"source",
+				"exportName",
+				"identifierName"
+			]),
+			export: new SyncBailHook(["statement"]),
+			exportImport: new SyncBailHook(["statement", "source"]),
+			exportDeclaration: new SyncBailHook(["statement", "declaration"]),
+			exportExpression: new SyncBailHook(["statement", "declaration"]),
+			exportSpecifier: new SyncBailHook([
+				"statement",
+				"identifierName",
+				"exportName",
+				"index"
+			]),
+			exportImportSpecifier: new SyncBailHook([
+				"statement",
+				"source",
+				"identifierName",
+				"exportName",
+				"index"
+			]),
+			varDeclaration: new HookMap(() => new SyncBailHook(["declaration"])),
+			varDeclarationLet: new HookMap(() => new SyncBailHook(["declaration"])),
+			varDeclarationConst: new HookMap(() => new SyncBailHook(["declaration"])),
+			varDeclarationVar: new HookMap(() => new SyncBailHook(["declaration"])),
+			canRename: new HookMap(() => new SyncBailHook(["initExpression"])),
+			rename: new HookMap(() => new SyncBailHook(["initExpression"])),
+			assigned: new HookMap(() => new SyncBailHook(["expression"])),
+			assign: new HookMap(() => new SyncBailHook(["expression"])),
+			typeof: new HookMap(() => new SyncBailHook(["expression"])),
+			importCall: new SyncBailHook(["expression"]),
+			call: new HookMap(() => new SyncBailHook(["expression"])),
+			callAnyMember: new HookMap(() => new SyncBailHook(["expression"])),
+			new: new HookMap(() => new SyncBailHook(["expression"])),
+			expression: new HookMap(() => new SyncBailHook(["expression"])),
+			expressionAnyMember: new HookMap(() => new SyncBailHook(["expression"])),
+			expressionConditionalOperator: new SyncBailHook(["expression"]),
+			expressionLogicalOperator: new SyncBailHook(["expression"]),
+			program: new SyncBailHook(["ast", "comments"])
+		};
+		const HOOK_MAP_COMPAT_CONFIG = {
+			evaluateTypeof: /^evaluate typeof (.+)$/,
+			evaluateIdentifier: /^evaluate Identifier (.+)$/,
+			evaluateDefinedIdentifier: /^evaluate defined Identifier (.+)$/,
+			evaluateCallExpressionMember: /^evaluate CallExpression .(.+)$/,
+			evaluate: /^evaluate (.+)$/,
+			label: /^label (.+)$/,
+			varDeclarationLet: /^var-let (.+)$/,
+			varDeclarationConst: /^var-const (.+)$/,
+			varDeclarationVar: /^var-var (.+)$/,
+			varDeclaration: /^var (.+)$/,
+			canRename: /^can-rename (.+)$/,
+			rename: /^rename (.+)$/,
+			typeof: /^typeof (.+)$/,
+			assigned: /^assigned (.+)$/,
+			assign: /^assign (.+)$/,
+			callAnyMember: /^call (.+)\.\*$/,
+			call: /^call (.+)$/,
+			new: /^new (.+)$/,
+			expressionConditionalOperator: /^expression \?:$/,
+			expressionAnyMember: /^expression (.+)\.\*$/,
+			expression: /^expression (.+)$/
+		};
+		this._pluginCompat.tap("Parser", options => {
+			for (const name of Object.keys(HOOK_MAP_COMPAT_CONFIG)) {
+				const regexp = HOOK_MAP_COMPAT_CONFIG[name];
+				const match = regexp.exec(options.name);
+				if (match) {
+					if (match[1]) {
+						this.hooks[name].tap(
+							match[1],
+							options.fn.name || "unnamed compat plugin",
+							options.fn.bind(this)
+						);
+					} else {
+						this.hooks[name].tap(
+							options.fn.name || "unnamed compat plugin",
+							options.fn.bind(this)
+						);
+					}
+					return true;
+				}
+			}
+		});
+		this.options = options;
+		this.sourceType = sourceType;
+		this.scope = undefined;
+		this.state = undefined;
+		this.comments = undefined;
+		this.initializeEvaluating();
+	}
+
+	initializeEvaluating() {
+		this.hooks.evaluate.for("Literal").tap("Parser", expr => {
+			switch (typeof expr.value) {
+				case "number":
+					return new BasicEvaluatedExpression()
+						.setNumber(expr.value)
+						.setRange(expr.range);
+				case "string":
+					return new BasicEvaluatedExpression()
+						.setString(expr.value)
+						.setRange(expr.range);
+				case "boolean":
+					return new BasicEvaluatedExpression()
+						.setBoolean(expr.value)
+						.setRange(expr.range);
+			}
+			if (expr.value === null) {
+				return new BasicEvaluatedExpression().setNull().setRange(expr.range);
+			}
+			if (expr.value instanceof RegExp) {
+				return new BasicEvaluatedExpression()
+					.setRegExp(expr.value)
+					.setRange(expr.range);
+			}
+		});
+		this.hooks.evaluate.for("LogicalExpression").tap("Parser", expr => {
+			let left;
+			let leftAsBool;
+			let right;
+			if (expr.operator === "&&") {
+				left = this.evaluateExpression(expr.left);
+				leftAsBool = left && left.asBool();
+				if (leftAsBool === false) return left.setRange(expr.range);
+				if (leftAsBool !== true) return;
+				right = this.evaluateExpression(expr.right);
+				return right.setRange(expr.range);
+			} else if (expr.operator === "||") {
+				left = this.evaluateExpression(expr.left);
+				leftAsBool = left && left.asBool();
+				if (leftAsBool === true) return left.setRange(expr.range);
+				if (leftAsBool !== false) return;
+				right = this.evaluateExpression(expr.right);
+				return right.setRange(expr.range);
+			}
+		});
+		this.hooks.evaluate.for("BinaryExpression").tap("Parser", expr => {
+			let left;
+			let right;
+			let res;
+			if (expr.operator === "+") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				res = new BasicEvaluatedExpression();
+				if (left.isString()) {
+					if (right.isString()) {
+						res.setString(left.string + right.string);
+					} else if (right.isNumber()) {
+						res.setString(left.string + right.number);
+					} else if (
+						right.isWrapped() &&
+						right.prefix &&
+						right.prefix.isString()
+					) {
+						// "left" + ("prefix" + inner + "postfix")
+						// => ("leftprefix" + inner + "postfix")
+						res.setWrapped(
+							new BasicEvaluatedExpression()
+								.setString(left.string + right.prefix.string)
+								.setRange(joinRanges(left.range, right.prefix.range)),
+							right.postfix,
+							right.wrappedInnerExpressions
+						);
+					} else if (right.isWrapped()) {
+						// "left" + ([null] + inner + "postfix")
+						// => ("left" + inner + "postfix")
+						res.setWrapped(left, right.postfix, right.wrappedInnerExpressions);
+					} else {
+						// "left" + expr
+						// => ("left" + expr + "")
+						res.setWrapped(left, null, [right]);
+					}
+				} else if (left.isNumber()) {
+					if (right.isString()) {
+						res.setString(left.number + right.string);
+					} else if (right.isNumber()) {
+						res.setNumber(left.number + right.number);
+					} else {
+						return;
+					}
+				} else if (left.isWrapped()) {
+					if (left.postfix && left.postfix.isString() && right.isString()) {
+						// ("prefix" + inner + "postfix") + "right"
+						// => ("prefix" + inner + "postfixright")
+						res.setWrapped(
+							left.prefix,
+							new BasicEvaluatedExpression()
+								.setString(left.postfix.string + right.string)
+								.setRange(joinRanges(left.postfix.range, right.range)),
+							left.wrappedInnerExpressions
+						);
+					} else if (
+						left.postfix &&
+						left.postfix.isString() &&
+						right.isNumber()
+					) {
+						// ("prefix" + inner + "postfix") + 123
+						// => ("prefix" + inner + "postfix123")
+						res.setWrapped(
+							left.prefix,
+							new BasicEvaluatedExpression()
+								.setString(left.postfix.string + right.number)
+								.setRange(joinRanges(left.postfix.range, right.range)),
+							left.wrappedInnerExpressions
+						);
+					} else if (right.isString()) {
+						// ("prefix" + inner + [null]) + "right"
+						// => ("prefix" + inner + "right")
+						res.setWrapped(left.prefix, right, left.wrappedInnerExpressions);
+					} else if (right.isNumber()) {
+						// ("prefix" + inner + [null]) + 123
+						// => ("prefix" + inner + "123")
+						res.setWrapped(
+							left.prefix,
+							new BasicEvaluatedExpression()
+								.setString(right.number + "")
+								.setRange(right.range),
+							left.wrappedInnerExpressions
+						);
+					} else if (right.isWrapped()) {
+						// ("prefix1" + inner1 + "postfix1") + ("prefix2" + inner2 + "postfix2")
+						// ("prefix1" + inner1 + "postfix1" + "prefix2" + inner2 + "postfix2")
+						res.setWrapped(
+							left.prefix,
+							right.postfix,
+							left.wrappedInnerExpressions &&
+								right.wrappedInnerExpressions &&
+								left.wrappedInnerExpressions
+									.concat(left.postfix ? [left.postfix] : [])
+									.concat(right.prefix ? [right.prefix] : [])
+									.concat(right.wrappedInnerExpressions)
+						);
+					} else {
+						// ("prefix" + inner + postfix) + expr
+						// => ("prefix" + inner + postfix + expr + [null])
+						res.setWrapped(
+							left.prefix,
+							null,
+							left.wrappedInnerExpressions &&
+								left.wrappedInnerExpressions.concat(
+									left.postfix ? [left.postfix, right] : [right]
+								)
+						);
+					}
+				} else {
+					if (right.isString()) {
+						// left + "right"
+						// => ([null] + left + "right")
+						res.setWrapped(null, right, [left]);
+					} else if (right.isWrapped()) {
+						// left + (prefix + inner + "postfix")
+						// => ([null] + left + prefix + inner + "postfix")
+						res.setWrapped(
+							null,
+							right.postfix,
+							right.wrappedInnerExpressions &&
+								(right.prefix ? [left, right.prefix] : [left]).concat(
+									right.wrappedInnerExpressions
+								)
+						);
+					} else {
+						return;
+					}
+				}
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === "-") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number - right.number);
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === "*") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number * right.number);
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === "/") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number / right.number);
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === "**") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(Math.pow(left.number, right.number));
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === "==" || expr.operator === "===") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				res = new BasicEvaluatedExpression();
+				res.setRange(expr.range);
+				if (left.isString() && right.isString()) {
+					return res.setBoolean(left.string === right.string);
+				} else if (left.isNumber() && right.isNumber()) {
+					return res.setBoolean(left.number === right.number);
+				} else if (left.isBoolean() && right.isBoolean()) {
+					return res.setBoolean(left.bool === right.bool);
+				}
+			} else if (expr.operator === "!=" || expr.operator === "!==") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				res = new BasicEvaluatedExpression();
+				res.setRange(expr.range);
+				if (left.isString() && right.isString()) {
+					return res.setBoolean(left.string !== right.string);
+				} else if (left.isNumber() && right.isNumber()) {
+					return res.setBoolean(left.number !== right.number);
+				} else if (left.isBoolean() && right.isBoolean()) {
+					return res.setBoolean(left.bool !== right.bool);
+				}
+			} else if (expr.operator === "&") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number & right.number);
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === "|") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number | right.number);
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === "^") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number ^ right.number);
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === ">>>") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number >>> right.number);
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === ">>") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number >> right.number);
+				res.setRange(expr.range);
+				return res;
+			} else if (expr.operator === "<<") {
+				left = this.evaluateExpression(expr.left);
+				right = this.evaluateExpression(expr.right);
+				if (!left || !right) return;
+				if (!left.isNumber() || !right.isNumber()) return;
+				res = new BasicEvaluatedExpression();
+				res.setNumber(left.number << right.number);
+				res.setRange(expr.range);
+				return res;
+			}
+		});
+		this.hooks.evaluate.for("UnaryExpression").tap("Parser", expr => {
+			if (expr.operator === "typeof") {
+				let res;
+				let name;
+				if (expr.argument.type === "Identifier") {
+					name =
+						this.scope.renames.get(expr.argument.name) || expr.argument.name;
+					if (!this.scope.definitions.has(name)) {
+						const hook = this.hooks.evaluateTypeof.get(name);
+						if (hook !== undefined) {
+							res = hook.call(expr);
+							if (res !== undefined) return res;
+						}
+					}
+				}
+				if (expr.argument.type === "MemberExpression") {
+					const exprName = this.getNameForExpression(expr.argument);
+					if (exprName && exprName.free) {
+						const hook = this.hooks.evaluateTypeof.get(exprName.name);
+						if (hook !== undefined) {
+							res = hook.call(expr);
+							if (res !== undefined) return res;
+						}
+					}
+				}
+				if (expr.argument.type === "FunctionExpression") {
+					return new BasicEvaluatedExpression()
+						.setString("function")
+						.setRange(expr.range);
+				}
+				const arg = this.evaluateExpression(expr.argument);
+				if (arg.isString() || arg.isWrapped()) {
+					return new BasicEvaluatedExpression()
+						.setString("string")
+						.setRange(expr.range);
+				}
+				if (arg.isNumber()) {
+					return new BasicEvaluatedExpression()
+						.setString("number")
+						.setRange(expr.range);
+				}
+				if (arg.isBoolean()) {
+					return new BasicEvaluatedExpression()
+						.setString("boolean")
+						.setRange(expr.range);
+				}
+				if (arg.isArray() || arg.isConstArray() || arg.isRegExp()) {
+					return new BasicEvaluatedExpression()
+						.setString("object")
+						.setRange(expr.range);
+				}
+			} else if (expr.operator === "!") {
+				const argument = this.evaluateExpression(expr.argument);
+				if (!argument) return;
+				if (argument.isBoolean()) {
+					return new BasicEvaluatedExpression()
+						.setBoolean(!argument.bool)
+						.setRange(expr.range);
+				}
+				if (argument.isTruthy()) {
+					return new BasicEvaluatedExpression()
+						.setBoolean(false)
+						.setRange(expr.range);
+				}
+				if (argument.isFalsy()) {
+					return new BasicEvaluatedExpression()
+						.setBoolean(true)
+						.setRange(expr.range);
+				}
+				if (argument.isString()) {
+					return new BasicEvaluatedExpression()
+						.setBoolean(!argument.string)
+						.setRange(expr.range);
+				}
+				if (argument.isNumber()) {
+					return new BasicEvaluatedExpression()
+						.setBoolean(!argument.number)
+						.setRange(expr.range);
+				}
+			} else if (expr.operator === "~") {
+				const argument = this.evaluateExpression(expr.argument);
+				if (!argument) return;
+				if (!argument.isNumber()) return;
+				const res = new BasicEvaluatedExpression();
+				res.setNumber(~argument.number);
+				res.setRange(expr.range);
+				return res;
+			}
+		});
+		this.hooks.evaluateTypeof.for("undefined").tap("Parser", expr => {
+			return new BasicEvaluatedExpression()
+				.setString("undefined")
+				.setRange(expr.range);
+		});
+		this.hooks.evaluate.for("Identifier").tap("Parser", expr => {
+			const name = this.scope.renames.get(expr.name) || expr.name;
+			if (!this.scope.definitions.has(expr.name)) {
+				const hook = this.hooks.evaluateIdentifier.get(name);
+				if (hook !== undefined) {
+					const result = hook.call(expr);
+					if (result) return result;
+				}
+				return new BasicEvaluatedExpression()
+					.setIdentifier(name)
+					.setRange(expr.range);
+			} else {
+				const hook = this.hooks.evaluateDefinedIdentifier.get(name);
+				if (hook !== undefined) {
+					return hook.call(expr);
+				}
+			}
+		});
+		this.hooks.evaluate.for("ThisExpression").tap("Parser", expr => {
+			const name = this.scope.renames.get("this");
+			if (name) {
+				const hook = this.hooks.evaluateIdentifier.get(name);
+				if (hook !== undefined) {
+					const result = hook.call(expr);
+					if (result) return result;
+				}
+				return new BasicEvaluatedExpression()
+					.setIdentifier(name)
+					.setRange(expr.range);
+			}
+		});
+		this.hooks.evaluate.for("MemberExpression").tap("Parser", expression => {
+			let exprName = this.getNameForExpression(expression);
+			if (exprName) {
+				if (exprName.free) {
+					const hook = this.hooks.evaluateIdentifier.get(exprName.name);
+					if (hook !== undefined) {
+						const result = hook.call(expression);
+						if (result) return result;
+					}
+					return new BasicEvaluatedExpression()
+						.setIdentifier(exprName.name)
+						.setRange(expression.range);
+				} else {
+					const hook = this.hooks.evaluateDefinedIdentifier.get(exprName.name);
+					if (hook !== undefined) {
+						return hook.call(expression);
+					}
+				}
+			}
+		});
+		this.hooks.evaluate.for("CallExpression").tap("Parser", expr => {
+			if (expr.callee.type !== "MemberExpression") return;
+			if (
+				expr.callee.property.type !==
+				(expr.callee.computed ? "Literal" : "Identifier")
+			)
+				return;
+			const param = this.evaluateExpression(expr.callee.object);
+			if (!param) return;
+			const property = expr.callee.property.name || expr.callee.property.value;
+			const hook = this.hooks.evaluateCallExpressionMember.get(property);
+			if (hook !== undefined) {
+				return hook.call(expr, param);
+			}
+		});
+		this.hooks.evaluateCallExpressionMember
+			.for("replace")
+			.tap("Parser", (expr, param) => {
+				if (!param.isString()) return;
+				if (expr.arguments.length !== 2) return;
+				let arg1 = this.evaluateExpression(expr.arguments[0]);
+				let arg2 = this.evaluateExpression(expr.arguments[1]);
+				if (!arg1.isString() && !arg1.isRegExp()) return;
+				arg1 = arg1.regExp || arg1.string;
+				if (!arg2.isString()) return;
+				arg2 = arg2.string;
+				return new BasicEvaluatedExpression()
+					.setString(param.string.replace(arg1, arg2))
+					.setRange(expr.range);
+			});
+		["substr", "substring"].forEach(fn => {
+			this.hooks.evaluateCallExpressionMember
+				.for(fn)
+				.tap("Parser", (expr, param) => {
+					if (!param.isString()) return;
+					let arg1;
+					let result,
+						str = param.string;
+					switch (expr.arguments.length) {
+						case 1:
+							arg1 = this.evaluateExpression(expr.arguments[0]);
+							if (!arg1.isNumber()) return;
+							result = str[fn](arg1.number);
+							break;
+						case 2: {
+							arg1 = this.evaluateExpression(expr.arguments[0]);
+							const arg2 = this.evaluateExpression(expr.arguments[1]);
+							if (!arg1.isNumber()) return;
+							if (!arg2.isNumber()) return;
+							result = str[fn](arg1.number, arg2.number);
+							break;
+						}
+						default:
+							return;
+					}
+					return new BasicEvaluatedExpression()
+						.setString(result)
+						.setRange(expr.range);
+				});
+		});
+
+		/**
+		 * @param {string} kind "cooked" | "raw"
+		 * @param {TODO} templateLiteralExpr TemplateLiteral expr
+		 * @returns {{quasis: BasicEvaluatedExpression[], parts: BasicEvaluatedExpression[]}} Simplified template
+		 */
+		const getSimplifiedTemplateResult = (kind, templateLiteralExpr) => {
+			const quasis = [];
+			const parts = [];
+
+			for (let i = 0; i < templateLiteralExpr.quasis.length; i++) {
+				const quasiExpr = templateLiteralExpr.quasis[i];
+				const quasi = quasiExpr.value[kind];
+
+				if (i > 0) {
+					const prevExpr = parts[parts.length - 1];
+					const expr = this.evaluateExpression(
+						templateLiteralExpr.expressions[i - 1]
+					);
+					const exprAsString = expr.asString();
+					if (typeof exprAsString === "string") {
+						// We can merge quasi + expr + quasi when expr
+						// is a const string
+
+						prevExpr.setString(prevExpr.string + exprAsString + quasi);
+						prevExpr.setRange([prevExpr.range[0], quasiExpr.range[1]]);
+						// We unset the expression as it doesn't match to a single expression
+						prevExpr.setExpression(undefined);
+						continue;
+					}
+					parts.push(expr);
+				}
+
+				const part = new BasicEvaluatedExpression()
+					.setString(quasi)
+					.setRange(quasiExpr.range)
+					.setExpression(quasiExpr);
+				quasis.push(part);
+				parts.push(part);
+			}
+			return {
+				quasis,
+				parts
+			};
+		};
+
+		this.hooks.evaluate.for("TemplateLiteral").tap("Parser", node => {
+			const { quasis, parts } = getSimplifiedTemplateResult("cooked", node);
+			if (parts.length === 1) {
+				return parts[0].setRange(node.range);
+			}
+			return new BasicEvaluatedExpression()
+				.setTemplateString(quasis, parts, "cooked")
+				.setRange(node.range);
+		});
+		this.hooks.evaluate.for("TaggedTemplateExpression").tap("Parser", node => {
+			if (this.evaluateExpression(node.tag).identifier !== "String.raw") return;
+			const { quasis, parts } = getSimplifiedTemplateResult("raw", node.quasi);
+			if (parts.length === 1) {
+				return parts[0].setRange(node.range);
+			}
+			return new BasicEvaluatedExpression()
+				.setTemplateString(quasis, parts, "raw")
+				.setRange(node.range);
+		});
+
+		this.hooks.evaluateCallExpressionMember
+			.for("concat")
+			.tap("Parser", (expr, param) => {
+				if (!param.isString() && !param.isWrapped()) return;
+
+				let stringSuffix = null;
+				let hasUnknownParams = false;
+				for (let i = expr.arguments.length - 1; i >= 0; i--) {
+					const argExpr = this.evaluateExpression(expr.arguments[i]);
+					if (!argExpr.isString() && !argExpr.isNumber()) {
+						hasUnknownParams = true;
+						break;
+					}
+
+					const value = argExpr.isString()
+						? argExpr.string
+						: "" + argExpr.number;
+
+					const newString = value + (stringSuffix ? stringSuffix.string : "");
+					const newRange = [
+						argExpr.range[0],
+						(stringSuffix || argExpr).range[1]
+					];
+					stringSuffix = new BasicEvaluatedExpression()
+						.setString(newString)
+						.setRange(newRange);
+				}
+
+				if (hasUnknownParams) {
+					const prefix = param.isString() ? param : param.prefix;
+					return new BasicEvaluatedExpression()
+						.setWrapped(prefix, stringSuffix)
+						.setRange(expr.range);
+				} else if (param.isWrapped()) {
+					const postfix = stringSuffix || param.postfix;
+					return new BasicEvaluatedExpression()
+						.setWrapped(param.prefix, postfix)
+						.setRange(expr.range);
+				} else {
+					const newString =
+						param.string + (stringSuffix ? stringSuffix.string : "");
+					return new BasicEvaluatedExpression()
+						.setString(newString)
+						.setRange(expr.range);
+				}
+			});
+		this.hooks.evaluateCallExpressionMember
+			.for("split")
+			.tap("Parser", (expr, param) => {
+				if (!param.isString()) return;
+				if (expr.arguments.length !== 1) return;
+				let result;
+				const arg = this.evaluateExpression(expr.arguments[0]);
+				if (arg.isString()) {
+					result = param.string.split(arg.string);
+				} else if (arg.isRegExp()) {
+					result = param.string.split(arg.regExp);
+				} else {
+					return;
+				}
+				return new BasicEvaluatedExpression()
+					.setArray(result)
+					.setRange(expr.range);
+			});
+		this.hooks.evaluate.for("ConditionalExpression").tap("Parser", expr => {
+			const condition = this.evaluateExpression(expr.test);
+			const conditionValue = condition.asBool();
+			let res;
+			if (conditionValue === undefined) {
+				const consequent = this.evaluateExpression(expr.consequent);
+				const alternate = this.evaluateExpression(expr.alternate);
+				if (!consequent || !alternate) return;
+				res = new BasicEvaluatedExpression();
+				if (consequent.isConditional()) {
+					res.setOptions(consequent.options);
+				} else {
+					res.setOptions([consequent]);
+				}
+				if (alternate.isConditional()) {
+					res.addOptions(alternate.options);
+				} else {
+					res.addOptions([alternate]);
+				}
+			} else {
+				res = this.evaluateExpression(
+					conditionValue ? expr.consequent : expr.alternate
+				);
+			}
+			res.setRange(expr.range);
+			return res;
+		});
+		this.hooks.evaluate.for("ArrayExpression").tap("Parser", expr => {
+			const items = expr.elements.map(element => {
+				return element !== null && this.evaluateExpression(element);
+			});
+			if (!items.every(Boolean)) return;
+			return new BasicEvaluatedExpression()
+				.setItems(items)
+				.setRange(expr.range);
+		});
+	}
+
+	getRenameIdentifier(expr) {
+		const result = this.evaluateExpression(expr);
+		if (result && result.isIdentifier()) {
+			return result.identifier;
+		}
+	}
+
+	walkClass(classy) {
+		if (classy.superClass) this.walkExpression(classy.superClass);
+		if (classy.body && classy.body.type === "ClassBody") {
+			const wasTopLevel = this.scope.topLevelScope;
+			this.scope.topLevelScope = false;
+			for (const methodDefinition of classy.body.body) {
+				if (methodDefinition.type === "MethodDefinition") {
+					this.walkMethodDefinition(methodDefinition);
+				}
+			}
+			this.scope.topLevelScope = wasTopLevel;
+		}
+	}
+
+	walkMethodDefinition(methodDefinition) {
+		if (methodDefinition.computed && methodDefinition.key) {
+			this.walkExpression(methodDefinition.key);
+		}
+		if (methodDefinition.value) {
+			this.walkExpression(methodDefinition.value);
+		}
+	}
+
+	// Prewalking iterates the scope for variable declarations
+	prewalkStatements(statements) {
+		for (let index = 0, len = statements.length; index < len; index++) {
+			const statement = statements[index];
+			this.prewalkStatement(statement);
+		}
+	}
+
+	// Block-Prewalking iterates the scope for block variable declarations
+	blockPrewalkStatements(statements) {
+		for (let index = 0, len = statements.length; index < len; index++) {
+			const statement = statements[index];
+			this.blockPrewalkStatement(statement);
+		}
+	}
+
+	// Walking iterates the statements and expressions and processes them
+	walkStatements(statements) {
+		for (let index = 0, len = statements.length; index < len; index++) {
+			const statement = statements[index];
+			this.walkStatement(statement);
+		}
+	}
+
+	prewalkStatement(statement) {
+		switch (statement.type) {
+			case "BlockStatement":
+				this.prewalkBlockStatement(statement);
+				break;
+			case "DoWhileStatement":
+				this.prewalkDoWhileStatement(statement);
+				break;
+			case "ExportAllDeclaration":
+				this.prewalkExportAllDeclaration(statement);
+				break;
+			case "ExportDefaultDeclaration":
+				this.prewalkExportDefaultDeclaration(statement);
+				break;
+			case "ExportNamedDeclaration":
+				this.prewalkExportNamedDeclaration(statement);
+				break;
+			case "ForInStatement":
+				this.prewalkForInStatement(statement);
+				break;
+			case "ForOfStatement":
+				this.prewalkForOfStatement(statement);
+				break;
+			case "ForStatement":
+				this.prewalkForStatement(statement);
+				break;
+			case "FunctionDeclaration":
+				this.prewalkFunctionDeclaration(statement);
+				break;
+			case "IfStatement":
+				this.prewalkIfStatement(statement);
+				break;
+			case "ImportDeclaration":
+				this.prewalkImportDeclaration(statement);
+				break;
+			case "LabeledStatement":
+				this.prewalkLabeledStatement(statement);
+				break;
+			case "SwitchStatement":
+				this.prewalkSwitchStatement(statement);
+				break;
+			case "TryStatement":
+				this.prewalkTryStatement(statement);
+				break;
+			case "VariableDeclaration":
+				this.prewalkVariableDeclaration(statement);
+				break;
+			case "WhileStatement":
+				this.prewalkWhileStatement(statement);
+				break;
+			case "WithStatement":
+				this.prewalkWithStatement(statement);
+				break;
+		}
+	}
+
+	blockPrewalkStatement(statement) {
+		switch (statement.type) {
+			case "VariableDeclaration":
+				this.blockPrewalkVariableDeclaration(statement);
+				break;
+			case "ExportDefaultDeclaration":
+				this.blockPrewalkExportDefaultDeclaration(statement);
+				break;
+			case "ExportNamedDeclaration":
+				this.blockPrewalkExportNamedDeclaration(statement);
+				break;
+			case "ClassDeclaration":
+				this.blockPrewalkClassDeclaration(statement);
+				break;
+		}
+	}
+
+	walkStatement(statement) {
+		if (this.hooks.statement.call(statement) !== undefined) return;
+		switch (statement.type) {
+			case "BlockStatement":
+				this.walkBlockStatement(statement);
+				break;
+			case "ClassDeclaration":
+				this.walkClassDeclaration(statement);
+				break;
+			case "DoWhileStatement":
+				this.walkDoWhileStatement(statement);
+				break;
+			case "ExportDefaultDeclaration":
+				this.walkExportDefaultDeclaration(statement);
+				break;
+			case "ExportNamedDeclaration":
+				this.walkExportNamedDeclaration(statement);
+				break;
+			case "ExpressionStatement":
+				this.walkExpressionStatement(statement);
+				break;
+			case "ForInStatement":
+				this.walkForInStatement(statement);
+				break;
+			case "ForOfStatement":
+				this.walkForOfStatement(statement);
+				break;
+			case "ForStatement":
+				this.walkForStatement(statement);
+				break;
+			case "FunctionDeclaration":
+				this.walkFunctionDeclaration(statement);
+				break;
+			case "IfStatement":
+				this.walkIfStatement(statement);
+				break;
+			case "LabeledStatement":
+				this.walkLabeledStatement(statement);
+				break;
+			case "ReturnStatement":
+				this.walkReturnStatement(statement);
+				break;
+			case "SwitchStatement":
+				this.walkSwitchStatement(statement);
+				break;
+			case "ThrowStatement":
+				this.walkThrowStatement(statement);
+				break;
+			case "TryStatement":
+				this.walkTryStatement(statement);
+				break;
+			case "VariableDeclaration":
+				this.walkVariableDeclaration(statement);
+				break;
+			case "WhileStatement":
+				this.walkWhileStatement(statement);
+				break;
+			case "WithStatement":
+				this.walkWithStatement(statement);
+				break;
+		}
+	}
+
+	// Real Statements
+	prewalkBlockStatement(statement) {
+		this.prewalkStatements(statement.body);
+	}
+
+	walkBlockStatement(statement) {
+		this.inBlockScope(() => {
+			const body = statement.body;
+			this.blockPrewalkStatements(body);
+			this.walkStatements(body);
+		});
+	}
+
+	walkExpressionStatement(statement) {
+		this.walkExpression(statement.expression);
+	}
+
+	prewalkIfStatement(statement) {
+		this.prewalkStatement(statement.consequent);
+		if (statement.alternate) {
+			this.prewalkStatement(statement.alternate);
+		}
+	}
+
+	walkIfStatement(statement) {
+		const result = this.hooks.statementIf.call(statement);
+		if (result === undefined) {
+			this.walkExpression(statement.test);
+			this.walkStatement(statement.consequent);
+			if (statement.alternate) {
+				this.walkStatement(statement.alternate);
+			}
+		} else {
+			if (result) {
+				this.walkStatement(statement.consequent);
+			} else if (statement.alternate) {
+				this.walkStatement(statement.alternate);
+			}
+		}
+	}
+
+	prewalkLabeledStatement(statement) {
+		this.prewalkStatement(statement.body);
+	}
+
+	walkLabeledStatement(statement) {
+		const hook = this.hooks.label.get(statement.label.name);
+		if (hook !== undefined) {
+			const result = hook.call(statement);
+			if (result === true) return;
+		}
+		this.walkStatement(statement.body);
+	}
+
+	prewalkWithStatement(statement) {
+		this.prewalkStatement(statement.body);
+	}
+
+	walkWithStatement(statement) {
+		this.walkExpression(statement.object);
+		this.walkStatement(statement.body);
+	}
+
+	prewalkSwitchStatement(statement) {
+		this.prewalkSwitchCases(statement.cases);
+	}
+
+	walkSwitchStatement(statement) {
+		this.walkExpression(statement.discriminant);
+		this.walkSwitchCases(statement.cases);
+	}
+
+	walkTerminatingStatement(statement) {
+		if (statement.argument) this.walkExpression(statement.argument);
+	}
+
+	walkReturnStatement(statement) {
+		this.walkTerminatingStatement(statement);
+	}
+
+	walkThrowStatement(statement) {
+		this.walkTerminatingStatement(statement);
+	}
+
+	prewalkTryStatement(statement) {
+		this.prewalkStatement(statement.block);
+	}
+
+	walkTryStatement(statement) {
+		if (this.scope.inTry) {
+			this.walkStatement(statement.block);
+		} else {
+			this.scope.inTry = true;
+			this.walkStatement(statement.block);
+			this.scope.inTry = false;
+		}
+		if (statement.handler) this.walkCatchClause(statement.handler);
+		if (statement.finalizer) this.walkStatement(statement.finalizer);
+	}
+
+	prewalkWhileStatement(statement) {
+		this.prewalkStatement(statement.body);
+	}
+
+	walkWhileStatement(statement) {
+		this.walkExpression(statement.test);
+		this.walkStatement(statement.body);
+	}
+
+	prewalkDoWhileStatement(statement) {
+		this.prewalkStatement(statement.body);
+	}
+
+	walkDoWhileStatement(statement) {
+		this.walkStatement(statement.body);
+		this.walkExpression(statement.test);
+	}
+
+	prewalkForStatement(statement) {
+		if (statement.init) {
+			if (statement.init.type === "VariableDeclaration") {
+				this.prewalkStatement(statement.init);
+			}
+		}
+		this.prewalkStatement(statement.body);
+	}
+
+	walkForStatement(statement) {
+		this.inBlockScope(() => {
+			if (statement.init) {
+				if (statement.init.type === "VariableDeclaration") {
+					this.blockPrewalkVariableDeclaration(statement.init);
+					this.walkStatement(statement.init);
+				} else {
+					this.walkExpression(statement.init);
+				}
+			}
+			if (statement.test) {
+				this.walkExpression(statement.test);
+			}
+			if (statement.update) {
+				this.walkExpression(statement.update);
+			}
+			const body = statement.body;
+			if (body.type === "BlockStatement") {
+				// no need to add additional scope
+				this.blockPrewalkStatements(body.body);
+				this.walkStatements(body.body);
+			} else {
+				this.walkStatement(body);
+			}
+		});
+	}
+
+	prewalkForInStatement(statement) {
+		if (statement.left.type === "VariableDeclaration") {
+			this.prewalkVariableDeclaration(statement.left);
+		}
+		this.prewalkStatement(statement.body);
+	}
+
+	walkForInStatement(statement) {
+		this.inBlockScope(() => {
+			if (statement.left.type === "VariableDeclaration") {
+				this.blockPrewalkVariableDeclaration(statement.left);
+				this.walkVariableDeclaration(statement.left);
+			} else {
+				this.walkPattern(statement.left);
+			}
+			this.walkExpression(statement.right);
+			const body = statement.body;
+			if (body.type === "BlockStatement") {
+				// no need to add additional scope
+				this.blockPrewalkStatements(body.body);
+				this.walkStatements(body.body);
+			} else {
+				this.walkStatement(body);
+			}
+		});
+	}
+
+	prewalkForOfStatement(statement) {
+		if (statement.left.type === "VariableDeclaration") {
+			this.prewalkVariableDeclaration(statement.left);
+		}
+		this.prewalkStatement(statement.body);
+	}
+
+	walkForOfStatement(statement) {
+		this.inBlockScope(() => {
+			if (statement.left.type === "VariableDeclaration") {
+				this.blockPrewalkVariableDeclaration(statement.left);
+				this.walkVariableDeclaration(statement.left);
+			} else {
+				this.walkPattern(statement.left);
+			}
+			this.walkExpression(statement.right);
+			const body = statement.body;
+			if (body.type === "BlockStatement") {
+				// no need to add additional scope
+				this.blockPrewalkStatements(body.body);
+				this.walkStatements(body.body);
+			} else {
+				this.walkStatement(body);
+			}
+		});
+	}
+
+	// Declarations
+	prewalkFunctionDeclaration(statement) {
+		if (statement.id) {
+			this.scope.renames.set(statement.id.name, null);
+			this.scope.definitions.add(statement.id.name);
+		}
+	}
+
+	walkFunctionDeclaration(statement) {
+		const wasTopLevel = this.scope.topLevelScope;
+		this.scope.topLevelScope = false;
+		this.inFunctionScope(true, statement.params, () => {
+			for (const param of statement.params) {
+				this.walkPattern(param);
+			}
+			if (statement.body.type === "BlockStatement") {
+				this.detectMode(statement.body.body);
+				this.prewalkStatement(statement.body);
+				this.walkStatement(statement.body);
+			} else {
+				this.walkExpression(statement.body);
+			}
+		});
+		this.scope.topLevelScope = wasTopLevel;
+	}
+
+	prewalkImportDeclaration(statement) {
+		const source = statement.source.value;
+		this.hooks.import.call(statement, source);
+		for (const specifier of statement.specifiers) {
+			const name = specifier.local.name;
+			this.scope.renames.set(name, null);
+			this.scope.definitions.add(name);
+			switch (specifier.type) {
+				case "ImportDefaultSpecifier":
+					this.hooks.importSpecifier.call(statement, source, "default", name);
+					break;
+				case "ImportSpecifier":
+					this.hooks.importSpecifier.call(
+						statement,
+						source,
+						specifier.imported.name,
+						name
+					);
+					break;
+				case "ImportNamespaceSpecifier":
+					this.hooks.importSpecifier.call(statement, source, null, name);
+					break;
+			}
+		}
+	}
+
+	enterDeclaration(declaration, onIdent) {
+		switch (declaration.type) {
+			case "VariableDeclaration":
+				for (const declarator of declaration.declarations) {
+					switch (declarator.type) {
+						case "VariableDeclarator": {
+							this.enterPattern(declarator.id, onIdent);
+							break;
+						}
+					}
+				}
+				break;
+			case "FunctionDeclaration":
+				this.enterPattern(declaration.id, onIdent);
+				break;
+			case "ClassDeclaration":
+				this.enterPattern(declaration.id, onIdent);
+				break;
+		}
+	}
+
+	blockPrewalkExportNamedDeclaration(statement) {
+		if (statement.declaration) {
+			this.blockPrewalkStatement(statement.declaration);
+		}
+	}
+
+	prewalkExportNamedDeclaration(statement) {
+		let source;
+		if (statement.source) {
+			source = statement.source.value;
+			this.hooks.exportImport.call(statement, source);
+		} else {
+			this.hooks.export.call(statement);
+		}
+		if (statement.declaration) {
+			if (
+				!this.hooks.exportDeclaration.call(statement, statement.declaration)
+			) {
+				this.prewalkStatement(statement.declaration);
+				let index = 0;
+				this.enterDeclaration(statement.declaration, def => {
+					this.hooks.exportSpecifier.call(statement, def, def, index++);
+				});
+			}
+		}
+		if (statement.specifiers) {
+			for (
+				let specifierIndex = 0;
+				specifierIndex < statement.specifiers.length;
+				specifierIndex++
+			) {
+				const specifier = statement.specifiers[specifierIndex];
+				switch (specifier.type) {
+					case "ExportSpecifier": {
+						const name = specifier.exported.name;
+						if (source) {
+							this.hooks.exportImportSpecifier.call(
+								statement,
+								source,
+								specifier.local.name,
+								name,
+								specifierIndex
+							);
+						} else {
+							this.hooks.exportSpecifier.call(
+								statement,
+								specifier.local.name,
+								name,
+								specifierIndex
+							);
+						}
+						break;
+					}
+				}
+			}
+		}
+	}
+
+	walkExportNamedDeclaration(statement) {
+		if (statement.declaration) {
+			this.walkStatement(statement.declaration);
+		}
+	}
+
+	blockPrewalkExportDefaultDeclaration(statement) {
+		if (statement.declaration.type === "ClassDeclaration") {
+			this.blockPrewalkClassDeclaration(statement.declaration);
+		}
+	}
+
+	prewalkExportDefaultDeclaration(statement) {
+		this.prewalkStatement(statement.declaration);
+		if (
+			statement.declaration.id &&
+			statement.declaration.type !== "FunctionExpression" &&
+			statement.declaration.type !== "ClassExpression"
+		) {
+			this.hooks.exportSpecifier.call(
+				statement,
+				statement.declaration.id.name,
+				"default"
+			);
+		}
+	}
+
+	walkExportDefaultDeclaration(statement) {
+		this.hooks.export.call(statement);
+		if (
+			statement.declaration.id &&
+			statement.declaration.type !== "FunctionExpression" &&
+			statement.declaration.type !== "ClassExpression"
+		) {
+			if (
+				!this.hooks.exportDeclaration.call(statement, statement.declaration)
+			) {
+				this.walkStatement(statement.declaration);
+			}
+		} else {
+			// Acorn parses `export default function() {}` as `FunctionDeclaration` and
+			// `export default class {}` as `ClassDeclaration`, both with `id = null`.
+			// These nodes must be treated as expressions.
+			if (statement.declaration.type === "FunctionDeclaration") {
+				this.walkFunctionDeclaration(statement.declaration);
+			} else if (statement.declaration.type === "ClassDeclaration") {
+				this.walkClassDeclaration(statement.declaration);
+			} else {
+				this.walkExpression(statement.declaration);
+			}
+			if (!this.hooks.exportExpression.call(statement, statement.declaration)) {
+				this.hooks.exportSpecifier.call(
+					statement,
+					statement.declaration,
+					"default"
+				);
+			}
+		}
+	}
+
+	prewalkExportAllDeclaration(statement) {
+		const source = statement.source.value;
+		this.hooks.exportImport.call(statement, source);
+		this.hooks.exportImportSpecifier.call(statement, source, null, null, 0);
+	}
+
+	prewalkVariableDeclaration(statement) {
+		if (statement.kind !== "var") return;
+		this._prewalkVariableDeclaration(statement, this.hooks.varDeclarationVar);
+	}
+
+	blockPrewalkVariableDeclaration(statement) {
+		if (statement.kind === "var") return;
+		const hookMap =
+			statement.kind === "const"
+				? this.hooks.varDeclarationConst
+				: this.hooks.varDeclarationLet;
+		this._prewalkVariableDeclaration(statement, hookMap);
+	}
+
+	_prewalkVariableDeclaration(statement, hookMap) {
+		for (const declarator of statement.declarations) {
+			switch (declarator.type) {
+				case "VariableDeclarator": {
+					this.enterPattern(declarator.id, (name, decl) => {
+						let hook = hookMap.get(name);
+						if (hook === undefined || !hook.call(decl)) {
+							hook = this.hooks.varDeclaration.get(name);
+							if (hook === undefined || !hook.call(decl)) {
+								this.scope.renames.set(name, null);
+								this.scope.definitions.add(name);
+							}
+						}
+					});
+					break;
+				}
+			}
+		}
+	}
+
+	walkVariableDeclaration(statement) {
+		for (const declarator of statement.declarations) {
+			switch (declarator.type) {
+				case "VariableDeclarator": {
+					const renameIdentifier =
+						declarator.init && this.getRenameIdentifier(declarator.init);
+					if (renameIdentifier && declarator.id.type === "Identifier") {
+						const hook = this.hooks.canRename.get(renameIdentifier);
+						if (hook !== undefined && hook.call(declarator.init)) {
+							// renaming with "var a = b;"
+							const hook = this.hooks.rename.get(renameIdentifier);
+							if (hook === undefined || !hook.call(declarator.init)) {
+								this.scope.renames.set(
+									declarator.id.name,
+									this.scope.renames.get(renameIdentifier) || renameIdentifier
+								);
+								this.scope.definitions.delete(declarator.id.name);
+							}
+							break;
+						}
+					}
+					this.walkPattern(declarator.id);
+					if (declarator.init) this.walkExpression(declarator.init);
+					break;
+				}
+			}
+		}
+	}
+
+	blockPrewalkClassDeclaration(statement) {
+		if (statement.id) {
+			this.scope.renames.set(statement.id.name, null);
+			this.scope.definitions.add(statement.id.name);
+		}
+	}
+
+	walkClassDeclaration(statement) {
+		this.walkClass(statement);
+	}
+
+	prewalkSwitchCases(switchCases) {
+		for (let index = 0, len = switchCases.length; index < len; index++) {
+			const switchCase = switchCases[index];
+			this.prewalkStatements(switchCase.consequent);
+		}
+	}
+
+	walkSwitchCases(switchCases) {
+		for (let index = 0, len = switchCases.length; index < len; index++) {
+			const switchCase = switchCases[index];
+
+			if (switchCase.test) {
+				this.walkExpression(switchCase.test);
+			}
+			this.walkStatements(switchCase.consequent);
+		}
+	}
+
+	walkCatchClause(catchClause) {
+		this.inBlockScope(() => {
+			// Error binding is optional in catch clause since ECMAScript 2019
+			if (catchClause.param !== null) {
+				this.enterPattern(catchClause.param, ident => {
+					this.scope.renames.set(ident, null);
+					this.scope.definitions.add(ident);
+				});
+				this.walkPattern(catchClause.param);
+			}
+			this.prewalkStatement(catchClause.body);
+			this.walkStatement(catchClause.body);
+		});
+	}
+
+	walkPattern(pattern) {
+		switch (pattern.type) {
+			case "ArrayPattern":
+				this.walkArrayPattern(pattern);
+				break;
+			case "AssignmentPattern":
+				this.walkAssignmentPattern(pattern);
+				break;
+			case "MemberExpression":
+				this.walkMemberExpression(pattern);
+				break;
+			case "ObjectPattern":
+				this.walkObjectPattern(pattern);
+				break;
+			case "RestElement":
+				this.walkRestElement(pattern);
+				break;
+		}
+	}
+
+	walkAssignmentPattern(pattern) {
+		this.walkExpression(pattern.right);
+		this.walkPattern(pattern.left);
+	}
+
+	walkObjectPattern(pattern) {
+		for (let i = 0, len = pattern.properties.length; i < len; i++) {
+			const prop = pattern.properties[i];
+			if (prop) {
+				if (prop.computed) this.walkExpression(prop.key);
+				if (prop.value) this.walkPattern(prop.value);
+			}
+		}
+	}
+
+	walkArrayPattern(pattern) {
+		for (let i = 0, len = pattern.elements.length; i < len; i++) {
+			const element = pattern.elements[i];
+			if (element) this.walkPattern(element);
+		}
+	}
+
+	walkRestElement(pattern) {
+		this.walkPattern(pattern.argument);
+	}
+
+	walkExpressions(expressions) {
+		for (const expression of expressions) {
+			if (expression) {
+				this.walkExpression(expression);
+			}
+		}
+	}
+
+	walkExpression(expression) {
+		switch (expression.type) {
+			case "ArrayExpression":
+				this.walkArrayExpression(expression);
+				break;
+			case "ArrowFunctionExpression":
+				this.walkArrowFunctionExpression(expression);
+				break;
+			case "AssignmentExpression":
+				this.walkAssignmentExpression(expression);
+				break;
+			case "AwaitExpression":
+				this.walkAwaitExpression(expression);
+				break;
+			case "BinaryExpression":
+				this.walkBinaryExpression(expression);
+				break;
+			case "CallExpression":
+				this.walkCallExpression(expression);
+				break;
+			case "ClassExpression":
+				this.walkClassExpression(expression);
+				break;
+			case "ConditionalExpression":
+				this.walkConditionalExpression(expression);
+				break;
+			case "FunctionExpression":
+				this.walkFunctionExpression(expression);
+				break;
+			case "Identifier":
+				this.walkIdentifier(expression);
+				break;
+			case "LogicalExpression":
+				this.walkLogicalExpression(expression);
+				break;
+			case "MemberExpression":
+				this.walkMemberExpression(expression);
+				break;
+			case "NewExpression":
+				this.walkNewExpression(expression);
+				break;
+			case "ObjectExpression":
+				this.walkObjectExpression(expression);
+				break;
+			case "SequenceExpression":
+				this.walkSequenceExpression(expression);
+				break;
+			case "SpreadElement":
+				this.walkSpreadElement(expression);
+				break;
+			case "TaggedTemplateExpression":
+				this.walkTaggedTemplateExpression(expression);
+				break;
+			case "TemplateLiteral":
+				this.walkTemplateLiteral(expression);
+				break;
+			case "ThisExpression":
+				this.walkThisExpression(expression);
+				break;
+			case "UnaryExpression":
+				this.walkUnaryExpression(expression);
+				break;
+			case "UpdateExpression":
+				this.walkUpdateExpression(expression);
+				break;
+			case "YieldExpression":
+				this.walkYieldExpression(expression);
+				break;
+		}
+	}
+
+	walkAwaitExpression(expression) {
+		this.walkExpression(expression.argument);
+	}
+
+	walkArrayExpression(expression) {
+		if (expression.elements) {
+			this.walkExpressions(expression.elements);
+		}
+	}
+
+	walkSpreadElement(expression) {
+		if (expression.argument) {
+			this.walkExpression(expression.argument);
+		}
+	}
+
+	walkObjectExpression(expression) {
+		for (
+			let propIndex = 0, len = expression.properties.length;
+			propIndex < len;
+			propIndex++
+		) {
+			const prop = expression.properties[propIndex];
+			if (prop.type === "SpreadElement") {
+				this.walkExpression(prop.argument);
+				continue;
+			}
+			if (prop.computed) {
+				this.walkExpression(prop.key);
+			}
+			if (prop.shorthand) {
+				this.scope.inShorthand = true;
+			}
+			this.walkExpression(prop.value);
+			if (prop.shorthand) {
+				this.scope.inShorthand = false;
+			}
+		}
+	}
+
+	walkFunctionExpression(expression) {
+		const wasTopLevel = this.scope.topLevelScope;
+		this.scope.topLevelScope = false;
+		const scopeParams = expression.params;
+
+		// Add function name in scope for recursive calls
+		if (expression.id) {
+			scopeParams.push(expression.id.name);
+		}
+
+		this.inFunctionScope(true, scopeParams, () => {
+			for (const param of expression.params) {
+				this.walkPattern(param);
+			}
+			if (expression.body.type === "BlockStatement") {
+				this.detectMode(expression.body.body);
+				this.prewalkStatement(expression.body);
+				this.walkStatement(expression.body);
+			} else {
+				this.walkExpression(expression.body);
+			}
+		});
+		this.scope.topLevelScope = wasTopLevel;
+	}
+
+	walkArrowFunctionExpression(expression) {
+		this.inFunctionScope(false, expression.params, () => {
+			for (const param of expression.params) {
+				this.walkPattern(param);
+			}
+			if (expression.body.type === "BlockStatement") {
+				this.detectMode(expression.body.body);
+				this.prewalkStatement(expression.body);
+				this.walkStatement(expression.body);
+			} else {
+				this.walkExpression(expression.body);
+			}
+		});
+	}
+
+	walkSequenceExpression(expression) {
+		if (expression.expressions) this.walkExpressions(expression.expressions);
+	}
+
+	walkUpdateExpression(expression) {
+		this.walkExpression(expression.argument);
+	}
+
+	walkUnaryExpression(expression) {
+		if (expression.operator === "typeof") {
+			const exprName = this.getNameForExpression(expression.argument);
+			if (exprName && exprName.free) {
+				const hook = this.hooks.typeof.get(exprName.name);
+				if (hook !== undefined) {
+					const result = hook.call(expression);
+					if (result === true) return;
+				}
+			}
+		}
+		this.walkExpression(expression.argument);
+	}
+
+	walkLeftRightExpression(expression) {
+		this.walkExpression(expression.left);
+		this.walkExpression(expression.right);
+	}
+
+	walkBinaryExpression(expression) {
+		this.walkLeftRightExpression(expression);
+	}
+
+	walkLogicalExpression(expression) {
+		const result = this.hooks.expressionLogicalOperator.call(expression);
+		if (result === undefined) {
+			this.walkLeftRightExpression(expression);
+		} else {
+			if (result) {
+				this.walkExpression(expression.right);
+			}
+		}
+	}
+
+	walkAssignmentExpression(expression) {
+		const renameIdentifier = this.getRenameIdentifier(expression.right);
+		if (expression.left.type === "Identifier" && renameIdentifier) {
+			const hook = this.hooks.canRename.get(renameIdentifier);
+			if (hook !== undefined && hook.call(expression.right)) {
+				// renaming "a = b;"
+				const hook = this.hooks.rename.get(renameIdentifier);
+				if (hook === undefined || !hook.call(expression.right)) {
+					this.scope.renames.set(expression.left.name, renameIdentifier);
+					this.scope.definitions.delete(expression.left.name);
+				}
+				return;
+			}
+		}
+		if (expression.left.type === "Identifier") {
+			const assignedHook = this.hooks.assigned.get(expression.left.name);
+			if (assignedHook === undefined || !assignedHook.call(expression)) {
+				this.walkExpression(expression.right);
+			}
+			this.scope.renames.set(expression.left.name, null);
+			const assignHook = this.hooks.assign.get(expression.left.name);
+			if (assignHook === undefined || !assignHook.call(expression)) {
+				this.walkExpression(expression.left);
+			}
+			return;
+		}
+		this.walkExpression(expression.right);
+		this.walkPattern(expression.left);
+		this.enterPattern(expression.left, (name, decl) => {
+			this.scope.renames.set(name, null);
+		});
+	}
+
+	walkConditionalExpression(expression) {
+		const result = this.hooks.expressionConditionalOperator.call(expression);
+		if (result === undefined) {
+			this.walkExpression(expression.test);
+			this.walkExpression(expression.consequent);
+			if (expression.alternate) {
+				this.walkExpression(expression.alternate);
+			}
+		} else {
+			if (result) {
+				this.walkExpression(expression.consequent);
+			} else if (expression.alternate) {
+				this.walkExpression(expression.alternate);
+			}
+		}
+	}
+
+	walkNewExpression(expression) {
+		const callee = this.evaluateExpression(expression.callee);
+		if (callee.isIdentifier()) {
+			const hook = this.hooks.new.get(callee.identifier);
+			if (hook !== undefined) {
+				const result = hook.call(expression);
+				if (result === true) {
+					return;
+				}
+			}
+		}
+
+		this.walkExpression(expression.callee);
+		if (expression.arguments) {
+			this.walkExpressions(expression.arguments);
+		}
+	}
+
+	walkYieldExpression(expression) {
+		if (expression.argument) {
+			this.walkExpression(expression.argument);
+		}
+	}
+
+	walkTemplateLiteral(expression) {
+		if (expression.expressions) {
+			this.walkExpressions(expression.expressions);
+		}
+	}
+
+	walkTaggedTemplateExpression(expression) {
+		if (expression.tag) {
+			this.walkExpression(expression.tag);
+		}
+		if (expression.quasi && expression.quasi.expressions) {
+			this.walkExpressions(expression.quasi.expressions);
+		}
+	}
+
+	walkClassExpression(expression) {
+		this.walkClass(expression);
+	}
+
+	_walkIIFE(functionExpression, options, currentThis) {
+		const renameArgOrThis = argOrThis => {
+			const renameIdentifier = this.getRenameIdentifier(argOrThis);
+			if (renameIdentifier) {
+				const hook = this.hooks.canRename.get(renameIdentifier);
+				if (hook !== undefined && hook.call(argOrThis)) {
+					const hook = this.hooks.rename.get(renameIdentifier);
+					if (hook === undefined || !hook.call(argOrThis)) {
+						return renameIdentifier;
+					}
+				}
+			}
+			this.walkExpression(argOrThis);
+		};
+		const params = functionExpression.params;
+		const renameThis = currentThis ? renameArgOrThis(currentThis) : null;
+		const args = options.map(renameArgOrThis);
+		const wasTopLevel = this.scope.topLevelScope;
+		this.scope.topLevelScope = false;
+		const scopeParams = params.filter((identifier, idx) => !args[idx]);
+
+		// Add function name in scope for recursive calls
+		if (functionExpression.id) {
+			scopeParams.push(functionExpression.id.name);
+		}
+
+		this.inFunctionScope(true, scopeParams, () => {
+			if (renameThis) {
+				this.scope.renames.set("this", renameThis);
+			}
+			for (let i = 0; i < args.length; i++) {
+				const param = args[i];
+				if (!param) continue;
+				if (!params[i] || params[i].type !== "Identifier") continue;
+				this.scope.renames.set(params[i].name, param);
+			}
+			if (functionExpression.body.type === "BlockStatement") {
+				this.detectMode(functionExpression.body.body);
+				this.prewalkStatement(functionExpression.body);
+				this.walkStatement(functionExpression.body);
+			} else {
+				this.walkExpression(functionExpression.body);
+			}
+		});
+		this.scope.topLevelScope = wasTopLevel;
+	}
+
+	walkCallExpression(expression) {
+		if (
+			expression.callee.type === "MemberExpression" &&
+			expression.callee.object.type === "FunctionExpression" &&
+			!expression.callee.computed &&
+			(expression.callee.property.name === "call" ||
+				expression.callee.property.name === "bind") &&
+			expression.arguments.length > 0
+		) {
+			// (function(…) { }.call/bind(?, …))
+			this._walkIIFE(
+				expression.callee.object,
+				expression.arguments.slice(1),
+				expression.arguments[0]
+			);
+		} else if (expression.callee.type === "FunctionExpression") {
+			// (function(…) { }(…))
+			this._walkIIFE(expression.callee, expression.arguments, null);
+		} else if (expression.callee.type === "Import") {
+			let result = this.hooks.importCall.call(expression);
+			if (result === true) return;
+
+			if (expression.arguments) this.walkExpressions(expression.arguments);
+		} else {
+			const callee = this.evaluateExpression(expression.callee);
+			if (callee.isIdentifier()) {
+				const callHook = this.hooks.call.get(callee.identifier);
+				if (callHook !== undefined) {
+					let result = callHook.call(expression);
+					if (result === true) return;
+				}
+				let identifier = callee.identifier.replace(/\.[^.]+$/, "");
+				if (identifier !== callee.identifier) {
+					const callAnyHook = this.hooks.callAnyMember.get(identifier);
+					if (callAnyHook !== undefined) {
+						let result = callAnyHook.call(expression);
+						if (result === true) return;
+					}
+				}
+			}
+
+			if (expression.callee) this.walkExpression(expression.callee);
+			if (expression.arguments) this.walkExpressions(expression.arguments);
+		}
+	}
+
+	walkMemberExpression(expression) {
+		const exprName = this.getNameForExpression(expression);
+		if (exprName && exprName.free) {
+			const expressionHook = this.hooks.expression.get(exprName.name);
+			if (expressionHook !== undefined) {
+				const result = expressionHook.call(expression);
+				if (result === true) return;
+			}
+			const expressionAnyMemberHook = this.hooks.expressionAnyMember.get(
+				exprName.nameGeneral
+			);
+			if (expressionAnyMemberHook !== undefined) {
+				const result = expressionAnyMemberHook.call(expression);
+				if (result === true) return;
+			}
+		}
+		this.walkExpression(expression.object);
+		if (expression.computed === true) this.walkExpression(expression.property);
+	}
+
+	walkThisExpression(expression) {
+		const expressionHook = this.hooks.expression.get("this");
+		if (expressionHook !== undefined) {
+			expressionHook.call(expression);
+		}
+	}
+
+	walkIdentifier(expression) {
+		if (!this.scope.definitions.has(expression.name)) {
+			const hook = this.hooks.expression.get(
+				this.scope.renames.get(expression.name) || expression.name
+			);
+			if (hook !== undefined) {
+				const result = hook.call(expression);
+				if (result === true) return;
+			}
+		}
+	}
+
+	/**
+	 * @deprecated
+	 * @param {any} params scope params
+	 * @param {function(): void} fn inner function
+	 * @returns {void}
+	 */
+	inScope(params, fn) {
+		const oldScope = this.scope;
+		this.scope = {
+			topLevelScope: oldScope.topLevelScope,
+			inTry: false,
+			inShorthand: false,
+			isStrict: oldScope.isStrict,
+			isAsmJs: oldScope.isAsmJs,
+			definitions: oldScope.definitions.createChild(),
+			renames: oldScope.renames.createChild()
+		};
+
+		this.scope.renames.set("this", null);
+
+		this.enterPatterns(params, ident => {
+			this.scope.renames.set(ident, null);
+			this.scope.definitions.add(ident);
+		});
+
+		fn();
+
+		this.scope = oldScope;
+	}
+
+	inFunctionScope(hasThis, params, fn) {
+		const oldScope = this.scope;
+		this.scope = {
+			topLevelScope: oldScope.topLevelScope,
+			inTry: false,
+			inShorthand: false,
+			isStrict: oldScope.isStrict,
+			isAsmJs: oldScope.isAsmJs,
+			definitions: oldScope.definitions.createChild(),
+			renames: oldScope.renames.createChild()
+		};
+
+		if (hasThis) {
+			this.scope.renames.set("this", null);
+		}
+
+		this.enterPatterns(params, ident => {
+			this.scope.renames.set(ident, null);
+			this.scope.definitions.add(ident);
+		});
+
+		fn();
+
+		this.scope = oldScope;
+	}
+
+	inBlockScope(fn) {
+		const oldScope = this.scope;
+		this.scope = {
+			topLevelScope: oldScope.topLevelScope,
+			inTry: oldScope.inTry,
+			inShorthand: false,
+			isStrict: oldScope.isStrict,
+			isAsmJs: oldScope.isAsmJs,
+			definitions: oldScope.definitions.createChild(),
+			renames: oldScope.renames.createChild()
+		};
+
+		fn();
+
+		this.scope = oldScope;
+	}
+
+	// TODO webpack 5: remove this methods
+	// only for backward-compat
+	detectStrictMode(statements) {
+		this.detectMode(statements);
+	}
+
+	detectMode(statements) {
+		const isLiteral =
+			statements.length >= 1 &&
+			statements[0].type === "ExpressionStatement" &&
+			statements[0].expression.type === "Literal";
+		if (isLiteral && statements[0].expression.value === "use strict") {
+			this.scope.isStrict = true;
+		}
+		if (isLiteral && statements[0].expression.value === "use asm") {
+			this.scope.isAsmJs = true;
+		}
+	}
+
+	enterPatterns(patterns, onIdent) {
+		for (const pattern of patterns) {
+			if (typeof pattern !== "string") {
+				this.enterPattern(pattern, onIdent);
+			} else if (pattern) {
+				onIdent(pattern);
+			}
+		}
+	}
+
+	enterPattern(pattern, onIdent) {
+		if (!pattern) return;
+		switch (pattern.type) {
+			case "ArrayPattern":
+				this.enterArrayPattern(pattern, onIdent);
+				break;
+			case "AssignmentPattern":
+				this.enterAssignmentPattern(pattern, onIdent);
+				break;
+			case "Identifier":
+				this.enterIdentifier(pattern, onIdent);
+				break;
+			case "ObjectPattern":
+				this.enterObjectPattern(pattern, onIdent);
+				break;
+			case "RestElement":
+				this.enterRestElement(pattern, onIdent);
+				break;
+			case "Property":
+				this.enterPattern(pattern.value, onIdent);
+				break;
+		}
+	}
+
+	enterIdentifier(pattern, onIdent) {
+		onIdent(pattern.name, pattern);
+	}
+
+	enterObjectPattern(pattern, onIdent) {
+		for (
+			let propIndex = 0, len = pattern.properties.length;
+			propIndex < len;
+			propIndex++
+		) {
+			const prop = pattern.properties[propIndex];
+			this.enterPattern(prop, onIdent);
+		}
+	}
+
+	enterArrayPattern(pattern, onIdent) {
+		for (
+			let elementIndex = 0, len = pattern.elements.length;
+			elementIndex < len;
+			elementIndex++
+		) {
+			const element = pattern.elements[elementIndex];
+			this.enterPattern(element, onIdent);
+		}
+	}
+
+	enterRestElement(pattern, onIdent) {
+		this.enterPattern(pattern.argument, onIdent);
+	}
+
+	enterAssignmentPattern(pattern, onIdent) {
+		this.enterPattern(pattern.left, onIdent);
+	}
+
+	evaluateExpression(expression) {
+		try {
+			const hook = this.hooks.evaluate.get(expression.type);
+			if (hook !== undefined) {
+				const result = hook.call(expression);
+				if (result !== undefined) {
+					if (result) {
+						result.setExpression(expression);
+					}
+					return result;
+				}
+			}
+		} catch (e) {
+			console.warn(e);
+			// ignore error
+		}
+		return new BasicEvaluatedExpression()
+			.setRange(expression.range)
+			.setExpression(expression);
+	}
+
+	parseString(expression) {
+		switch (expression.type) {
+			case "BinaryExpression":
+				if (expression.operator === "+") {
+					return (
+						this.parseString(expression.left) +
+						this.parseString(expression.right)
+					);
+				}
+				break;
+			case "Literal":
+				return expression.value + "";
+		}
+		throw new Error(
+			expression.type + " is not supported as parameter for require"
+		);
+	}
+
+	parseCalculatedString(expression) {
+		switch (expression.type) {
+			case "BinaryExpression":
+				if (expression.operator === "+") {
+					const left = this.parseCalculatedString(expression.left);
+					const right = this.parseCalculatedString(expression.right);
+					if (left.code) {
+						return {
+							range: left.range,
+							value: left.value,
+							code: true,
+							conditional: false
+						};
+					} else if (right.code) {
+						return {
+							range: [
+								left.range[0],
+								right.range ? right.range[1] : left.range[1]
+							],
+							value: left.value + right.value,
+							code: true,
+							conditional: false
+						};
+					} else {
+						return {
+							range: [left.range[0], right.range[1]],
+							value: left.value + right.value,
+							code: false,
+							conditional: false
+						};
+					}
+				}
+				break;
+			case "ConditionalExpression": {
+				const consequent = this.parseCalculatedString(expression.consequent);
+				const alternate = this.parseCalculatedString(expression.alternate);
+				const items = [];
+				if (consequent.conditional) {
+					items.push(...consequent.conditional);
+				} else if (!consequent.code) {
+					items.push(consequent);
+				} else {
+					break;
+				}
+				if (alternate.conditional) {
+					items.push(...alternate.conditional);
+				} else if (!alternate.code) {
+					items.push(alternate);
+				} else {
+					break;
+				}
+				return {
+					range: undefined,
+					value: "",
+					code: true,
+					conditional: items
+				};
+			}
+			case "Literal":
+				return {
+					range: expression.range,
+					value: expression.value + "",
+					code: false,
+					conditional: false
+				};
+		}
+		return {
+			range: undefined,
+			value: "",
+			code: true,
+			conditional: false
+		};
+	}
+
+	parse(source, initialState) {
+		let ast;
+		let comments;
+		if (typeof source === "object" && source !== null) {
+			ast = source;
+			comments = source.comments;
+		} else {
+			comments = [];
+			ast = Parser.parse(source, {
+				sourceType: this.sourceType,
+				onComment: comments
+			});
+		}
+
+		const oldScope = this.scope;
+		const oldState = this.state;
+		const oldComments = this.comments;
+		this.scope = {
+			topLevelScope: true,
+			inTry: false,
+			inShorthand: false,
+			isStrict: false,
+			isAsmJs: false,
+			definitions: new StackedSetMap(),
+			renames: new StackedSetMap()
+		};
+		const state = (this.state = initialState || {});
+		this.comments = comments;
+		if (this.hooks.program.call(ast, comments) === undefined) {
+			this.detectMode(ast.body);
+			this.prewalkStatements(ast.body);
+			this.blockPrewalkStatements(ast.body);
+			this.walkStatements(ast.body);
+		}
+		this.scope = oldScope;
+		this.state = oldState;
+		this.comments = oldComments;
+		return state;
+	}
+
+	evaluate(source) {
+		const ast = Parser.parse("(" + source + ")", {
+			sourceType: this.sourceType,
+			locations: false
+		});
+		// TODO(https://github.com/acornjs/acorn/issues/741)
+		// @ts-ignore
+		if (ast.body.length !== 1 || ast.body[0].type !== "ExpressionStatement") {
+			throw new Error("evaluate: Source is not a expression");
+		}
+		// TODO(https://github.com/acornjs/acorn/issues/741)
+		// @ts-ignore
+		return this.evaluateExpression(ast.body[0].expression);
+	}
+
+	getComments(range) {
+		return this.comments.filter(
+			comment => comment.range[0] >= range[0] && comment.range[1] <= range[1]
+		);
+	}
+
+	parseCommentOptions(range) {
+		const comments = this.getComments(range);
+		if (comments.length === 0) {
+			return EMPTY_COMMENT_OPTIONS;
+		}
+		let options = {};
+		let errors = [];
+		for (const comment of comments) {
+			const { value } = comment;
+			if (value && webpackCommentRegExp.test(value)) {
+				// try compile only if webpack options comment is present
+				try {
+					const val = vm.runInNewContext(`(function(){return {${value}};})()`);
+					Object.assign(options, val);
+				} catch (e) {
+					e.comment = comment;
+					errors.push(e);
+				}
+			}
+		}
+		return { options, errors };
+	}
+
+	getNameForExpression(expression) {
+		let expr = expression;
+		const exprName = [];
+		while (
+			expr.type === "MemberExpression" &&
+			expr.property.type === (expr.computed ? "Literal" : "Identifier")
+		) {
+			exprName.push(expr.computed ? expr.property.value : expr.property.name);
+			expr = expr.object;
+		}
+		let free;
+		if (expr.type === "Identifier") {
+			free = !this.scope.definitions.has(expr.name);
+			exprName.push(this.scope.renames.get(expr.name) || expr.name);
+		} else if (
+			expr.type === "ThisExpression" &&
+			this.scope.renames.get("this")
+		) {
+			free = true;
+			exprName.push(this.scope.renames.get("this"));
+		} else if (expr.type === "ThisExpression") {
+			free = this.scope.topLevelScope;
+			exprName.push("this");
+		} else {
+			return null;
+		}
+		let prefix = "";
+		for (let i = exprName.length - 1; i >= 2; i--) {
+			prefix += exprName[i] + ".";
+		}
+		if (exprName.length > 1) {
+			prefix += exprName[1];
+		}
+		const name = prefix ? prefix + "." + exprName[0] : exprName[0];
+		const nameGeneral = prefix;
+		return {
+			name,
+			nameGeneral,
+			free
+		};
+	}
+
+	static parse(code, options) {
+		const type = options ? options.sourceType : "module";
+		const parserOptions = Object.assign(
+			Object.create(null),
+			defaultParserOptions,
+			options
+		);
+
+		if (type === "auto") {
+			parserOptions.sourceType = "module";
+		} else if (parserOptions.sourceType === "script") {
+			parserOptions.allowReturnOutsideFunction = true;
+		}
+
+		let ast;
+		let error;
+		let threw = false;
+		try {
+			ast = acornParser.parse(code, parserOptions);
+		} catch (e) {
+			error = e;
+			threw = true;
+		}
+
+		if (threw && type === "auto") {
+			parserOptions.sourceType = "script";
+			parserOptions.allowReturnOutsideFunction = true;
+			if (Array.isArray(parserOptions.onComment)) {
+				parserOptions.onComment.length = 0;
+			}
+			try {
+				ast = acornParser.parse(code, parserOptions);
+				threw = false;
+			} catch (e) {
+				threw = true;
+			}
+		}
+
+		if (threw) {
+			throw error;
+		}
+
+		return ast;
+	}
+}
+
+// TODO remove in webpack 5
+Object.defineProperty(Parser.prototype, "getCommentOptions", {
+	configurable: false,
+	value: util.deprecate(
+		/**
+		 * @deprecated
+		 * @param {TODO} range Range
+		 * @returns {void}
+		 * @this {Parser}
+		 */
+		function(range) {
+			return this.parseCommentOptions(range).options;
+		},
+		"Parser.getCommentOptions: Use Parser.parseCommentOptions(range) instead"
+	)
+});
+
+module.exports = Parser;
diff --git a/node_modules/webpack/lib/ParserHelpers.js b/node_modules/webpack/lib/ParserHelpers.js
new file mode 100644
index 0000000..5248f12
--- /dev/null
+++ b/node_modules/webpack/lib/ParserHelpers.js
@@ -0,0 +1,103 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const path = require("path");
+
+const BasicEvaluatedExpression = require("./BasicEvaluatedExpression");
+const ConstDependency = require("./dependencies/ConstDependency");
+const UnsupportedFeatureWarning = require("./UnsupportedFeatureWarning");
+
+const ParserHelpers = exports;
+
+ParserHelpers.addParsedVariableToModule = (parser, name, expression) => {
+	if (!parser.state.current.addVariable) return false;
+	var deps = [];
+	parser.parse(expression, {
+		current: {
+			addDependency: dep => {
+				dep.userRequest = name;
+				deps.push(dep);
+			}
+		},
+		module: parser.state.module
+	});
+	parser.state.current.addVariable(name, expression, deps);
+	return true;
+};
+
+ParserHelpers.requireFileAsExpression = (context, pathToModule) => {
+	var moduleJsPath = path.relative(context, pathToModule);
+	if (!/^[A-Z]:/i.test(moduleJsPath)) {
+		moduleJsPath = "./" + moduleJsPath.replace(/\\/g, "/");
+	}
+	return "require(" + JSON.stringify(moduleJsPath) + ")";
+};
+
+ParserHelpers.toConstantDependency = (parser, value) => {
+	return function constDependency(expr) {
+		var dep = new ConstDependency(value, expr.range, false);
+		dep.loc = expr.loc;
+		parser.state.current.addDependency(dep);
+		return true;
+	};
+};
+
+ParserHelpers.toConstantDependencyWithWebpackRequire = (parser, value) => {
+	return function constDependencyWithWebpackRequire(expr) {
+		var dep = new ConstDependency(value, expr.range, true);
+		dep.loc = expr.loc;
+		parser.state.current.addDependency(dep);
+		return true;
+	};
+};
+
+ParserHelpers.evaluateToString = value => {
+	return function stringExpression(expr) {
+		return new BasicEvaluatedExpression().setString(value).setRange(expr.range);
+	};
+};
+
+ParserHelpers.evaluateToBoolean = value => {
+	return function booleanExpression(expr) {
+		return new BasicEvaluatedExpression()
+			.setBoolean(value)
+			.setRange(expr.range);
+	};
+};
+
+ParserHelpers.evaluateToIdentifier = (identifier, truthy) => {
+	return function identifierExpression(expr) {
+		let evex = new BasicEvaluatedExpression()
+			.setIdentifier(identifier)
+			.setRange(expr.range);
+		if (truthy === true) {
+			evex = evex.setTruthy();
+		} else if (truthy === false) {
+			evex = evex.setFalsy();
+		}
+		return evex;
+	};
+};
+
+ParserHelpers.expressionIsUnsupported = (parser, message) => {
+	return function unsupportedExpression(expr) {
+		var dep = new ConstDependency("(void 0)", expr.range, false);
+		dep.loc = expr.loc;
+		parser.state.current.addDependency(dep);
+		if (!parser.state.module) return;
+		parser.state.module.warnings.push(
+			new UnsupportedFeatureWarning(parser.state.module, message, expr.loc)
+		);
+		return true;
+	};
+};
+
+ParserHelpers.skipTraversal = function skipTraversal() {
+	return true;
+};
+
+ParserHelpers.approve = function approve() {
+	return true;
+};
diff --git a/node_modules/webpack/lib/PrefetchPlugin.js b/node_modules/webpack/lib/PrefetchPlugin.js
new file mode 100644
index 0000000..cc9d17c
--- /dev/null
+++ b/node_modules/webpack/lib/PrefetchPlugin.js
@@ -0,0 +1,37 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const PrefetchDependency = require("./dependencies/PrefetchDependency");
+
+class PrefetchPlugin {
+	constructor(context, request) {
+		if (!request) {
+			this.request = context;
+		} else {
+			this.context = context;
+			this.request = request;
+		}
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"PrefetchPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					PrefetchDependency,
+					normalModuleFactory
+				);
+			}
+		);
+		compiler.hooks.make.tapAsync("PrefetchPlugin", (compilation, callback) => {
+			compilation.prefetch(
+				this.context || compiler.context,
+				new PrefetchDependency(this.request),
+				callback
+			);
+		});
+	}
+}
+module.exports = PrefetchPlugin;
diff --git a/node_modules/webpack/lib/ProgressPlugin.js b/node_modules/webpack/lib/ProgressPlugin.js
new file mode 100644
index 0000000..93a5830
--- /dev/null
+++ b/node_modules/webpack/lib/ProgressPlugin.js
@@ -0,0 +1,307 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/ProgressPlugin.json");
+
+/** @typedef {import("../declarations/plugins/ProgressPlugin").ProgressPluginArgument} ProgressPluginArgument */
+/** @typedef {import("../declarations/plugins/ProgressPlugin").ProgressPluginOptions} ProgressPluginOptions */
+
+const createDefaultHandler = (profile, logger) => {
+	let lastState;
+	let lastStateTime;
+
+	const defaultHandler = (percentage, msg, ...args) => {
+		logger.status(`${Math.floor(percentage * 100)}%`, msg, ...args);
+		if (profile) {
+			let state = msg;
+			state = state.replace(/^\d+\/\d+\s+/, "");
+			if (percentage === 0) {
+				lastState = null;
+				lastStateTime = Date.now();
+			} else if (state !== lastState || percentage === 1) {
+				const now = Date.now();
+				if (lastState) {
+					const diff = now - lastStateTime;
+					const stateMsg = `${diff}ms ${lastState}`;
+					if (diff > 1000) {
+						logger.warn(stateMsg);
+					} else if (diff > 10) {
+						logger.info(stateMsg);
+					} else if (diff > 0) {
+						logger.log(stateMsg);
+					} else {
+						logger.debug(stateMsg);
+					}
+				}
+				lastState = state;
+				lastStateTime = now;
+			}
+		}
+		if (percentage === 1) logger.status();
+	};
+
+	return defaultHandler;
+};
+
+class ProgressPlugin {
+	/**
+	 * @param {ProgressPluginArgument} options options
+	 */
+	constructor(options) {
+		if (typeof options === "function") {
+			options = {
+				handler: options
+			};
+		}
+
+		options = options || {};
+		validateOptions(schema, options, "Progress Plugin");
+		options = Object.assign({}, ProgressPlugin.defaultOptions, options);
+
+		this.profile = options.profile;
+		this.handler = options.handler;
+		this.modulesCount = options.modulesCount;
+		this.showEntries = options.entries;
+		this.showModules = options.modules;
+		this.showActiveModules = options.activeModules;
+	}
+
+	apply(compiler) {
+		const { modulesCount } = this;
+		const handler =
+			this.handler ||
+			createDefaultHandler(
+				this.profile,
+				compiler.getInfrastructureLogger("webpack.Progress")
+			);
+		const showEntries = this.showEntries;
+		const showModules = this.showModules;
+		const showActiveModules = this.showActiveModules;
+		if (compiler.compilers) {
+			const states = new Array(compiler.compilers.length);
+			compiler.compilers.forEach((compiler, idx) => {
+				new ProgressPlugin((p, msg, ...args) => {
+					states[idx] = [p, msg, ...args];
+					handler(
+						states
+							.map(state => (state && state[0]) || 0)
+							.reduce((a, b) => a + b) / states.length,
+						`[${idx}] ${msg}`,
+						...args
+					);
+				}).apply(compiler);
+			});
+		} else {
+			let lastModulesCount = 0;
+			let lastEntriesCount = 0;
+			let moduleCount = modulesCount;
+			let entriesCount = 1;
+			let doneModules = 0;
+			let doneEntries = 0;
+			const activeModules = new Set();
+			let lastActiveModule = "";
+
+			const update = () => {
+				const percentByModules =
+					doneModules / Math.max(lastModulesCount, moduleCount);
+				const percentByEntries =
+					doneEntries / Math.max(lastEntriesCount, entriesCount);
+
+				const items = [
+					0.1 + Math.max(percentByModules, percentByEntries) * 0.6,
+					"building"
+				];
+				if (showEntries) {
+					items.push(`${doneEntries}/${entriesCount} entries`);
+				}
+				if (showModules) {
+					items.push(`${doneModules}/${moduleCount} modules`);
+				}
+				if (showActiveModules) {
+					items.push(`${activeModules.size} active`);
+					items.push(lastActiveModule);
+				}
+				handler(...items);
+			};
+
+			const moduleAdd = module => {
+				moduleCount++;
+				if (showActiveModules) {
+					const ident = module.identifier();
+					if (ident) {
+						activeModules.add(ident);
+						lastActiveModule = ident;
+					}
+				}
+				update();
+			};
+
+			const entryAdd = (entry, name) => {
+				entriesCount++;
+				update();
+			};
+
+			const moduleDone = module => {
+				doneModules++;
+				if (showActiveModules) {
+					const ident = module.identifier();
+					if (ident) {
+						activeModules.delete(ident);
+						if (lastActiveModule === ident) {
+							lastActiveModule = "";
+							for (const m of activeModules) {
+								lastActiveModule = m;
+							}
+						}
+					}
+				}
+				update();
+			};
+
+			const entryDone = (entry, name) => {
+				doneEntries++;
+				update();
+			};
+
+			compiler.hooks.compilation.tap("ProgressPlugin", compilation => {
+				if (compilation.compiler.isChild()) return;
+				lastModulesCount = moduleCount;
+				lastEntriesCount = entriesCount;
+				moduleCount = entriesCount = 0;
+				doneModules = doneEntries = 0;
+				handler(0, "compiling");
+
+				compilation.hooks.buildModule.tap("ProgressPlugin", moduleAdd);
+				compilation.hooks.failedModule.tap("ProgressPlugin", moduleDone);
+				compilation.hooks.succeedModule.tap("ProgressPlugin", moduleDone);
+
+				compilation.hooks.addEntry.tap("ProgressPlugin", entryAdd);
+				compilation.hooks.failedEntry.tap("ProgressPlugin", entryDone);
+				compilation.hooks.succeedEntry.tap("ProgressPlugin", entryDone);
+
+				const hooks = {
+					finishModules: "finish module graph",
+					seal: "sealing",
+					beforeChunks: "chunk graph",
+					afterChunks: "after chunk graph",
+					optimizeDependenciesBasic: "basic dependencies optimization",
+					optimizeDependencies: "dependencies optimization",
+					optimizeDependenciesAdvanced: "advanced dependencies optimization",
+					afterOptimizeDependencies: "after dependencies optimization",
+					optimize: "optimizing",
+					optimizeModulesBasic: "basic module optimization",
+					optimizeModules: "module optimization",
+					optimizeModulesAdvanced: "advanced module optimization",
+					afterOptimizeModules: "after module optimization",
+					optimizeChunksBasic: "basic chunk optimization",
+					optimizeChunks: "chunk optimization",
+					optimizeChunksAdvanced: "advanced chunk optimization",
+					afterOptimizeChunks: "after chunk optimization",
+					optimizeTree: "module and chunk tree optimization",
+					afterOptimizeTree: "after module and chunk tree optimization",
+					optimizeChunkModulesBasic: "basic chunk modules optimization",
+					optimizeChunkModules: "chunk modules optimization",
+					optimizeChunkModulesAdvanced: "advanced chunk modules optimization",
+					afterOptimizeChunkModules: "after chunk modules optimization",
+					reviveModules: "module reviving",
+					optimizeModuleOrder: "module order optimization",
+					advancedOptimizeModuleOrder: "advanced module order optimization",
+					beforeModuleIds: "before module ids",
+					moduleIds: "module ids",
+					optimizeModuleIds: "module id optimization",
+					afterOptimizeModuleIds: "module id optimization",
+					reviveChunks: "chunk reviving",
+					optimizeChunkOrder: "chunk order optimization",
+					beforeChunkIds: "before chunk ids",
+					optimizeChunkIds: "chunk id optimization",
+					afterOptimizeChunkIds: "after chunk id optimization",
+					recordModules: "record modules",
+					recordChunks: "record chunks",
+					beforeHash: "hashing",
+					afterHash: "after hashing",
+					recordHash: "record hash",
+					beforeModuleAssets: "module assets processing",
+					beforeChunkAssets: "chunk assets processing",
+					additionalChunkAssets: "additional chunk assets processing",
+					record: "recording",
+					additionalAssets: "additional asset processing",
+					optimizeChunkAssets: "chunk asset optimization",
+					afterOptimizeChunkAssets: "after chunk asset optimization",
+					optimizeAssets: "asset optimization",
+					afterOptimizeAssets: "after asset optimization",
+					afterSeal: "after seal"
+				};
+				const numberOfHooks = Object.keys(hooks).length;
+				Object.keys(hooks).forEach((name, idx) => {
+					const title = hooks[name];
+					const percentage = (idx / numberOfHooks) * 0.25 + 0.7;
+					compilation.hooks[name].intercept({
+						name: "ProgressPlugin",
+						context: true,
+						call: () => {
+							handler(percentage, title);
+						},
+						tap: (context, tap) => {
+							if (context) {
+								// p is percentage from 0 to 1
+								// args is any number of messages in a hierarchical matter
+								context.reportProgress = (p, ...args) => {
+									handler(percentage, title, tap.name, ...args);
+								};
+							}
+							handler(percentage, title, tap.name);
+						}
+					});
+				});
+			});
+			compiler.hooks.emit.intercept({
+				name: "ProgressPlugin",
+				context: true,
+				call: () => {
+					handler(0.95, "emitting");
+				},
+				tap: (context, tap) => {
+					if (context) {
+						context.reportProgress = (p, ...args) => {
+							handler(0.95, "emitting", tap.name, ...args);
+						};
+					}
+					handler(0.95, "emitting", tap.name);
+				}
+			});
+			compiler.hooks.afterEmit.intercept({
+				name: "ProgressPlugin",
+				context: true,
+				call: () => {
+					handler(0.98, "after emitting");
+				},
+				tap: (context, tap) => {
+					if (context) {
+						context.reportProgress = (p, ...args) => {
+							handler(0.98, "after emitting", tap.name, ...args);
+						};
+					}
+					handler(0.98, "after emitting", tap.name);
+				}
+			});
+			compiler.hooks.done.tap("ProgressPlugin", () => {
+				handler(1, "");
+			});
+		}
+	}
+}
+
+ProgressPlugin.defaultOptions = {
+	profile: false,
+	modulesCount: 500,
+	modules: true,
+	activeModules: true,
+	// TODO webpack 5 default this to true
+	entries: false
+};
+
+module.exports = ProgressPlugin;
diff --git a/node_modules/webpack/lib/ProvidePlugin.js b/node_modules/webpack/lib/ProvidePlugin.js
new file mode 100644
index 0000000..4e6a69d
--- /dev/null
+++ b/node_modules/webpack/lib/ProvidePlugin.js
@@ -0,0 +1,86 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ParserHelpers = require("./ParserHelpers");
+const ConstDependency = require("./dependencies/ConstDependency");
+
+const NullFactory = require("./NullFactory");
+
+class ProvidePlugin {
+	constructor(definitions) {
+		this.definitions = definitions;
+	}
+
+	apply(compiler) {
+		const definitions = this.definitions;
+		compiler.hooks.compilation.tap(
+			"ProvidePlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+				const handler = (parser, parserOptions) => {
+					Object.keys(definitions).forEach(name => {
+						var request = [].concat(definitions[name]);
+						var splittedName = name.split(".");
+						if (splittedName.length > 0) {
+							splittedName.slice(1).forEach((_, i) => {
+								const name = splittedName.slice(0, i + 1).join(".");
+								parser.hooks.canRename
+									.for(name)
+									.tap("ProvidePlugin", ParserHelpers.approve);
+							});
+						}
+						parser.hooks.expression.for(name).tap("ProvidePlugin", expr => {
+							let nameIdentifier = name;
+							const scopedName = name.includes(".");
+							let expression = `require(${JSON.stringify(request[0])})`;
+							if (scopedName) {
+								nameIdentifier = `__webpack_provided_${name.replace(
+									/\./g,
+									"_dot_"
+								)}`;
+							}
+							if (request.length > 1) {
+								expression += request
+									.slice(1)
+									.map(r => `[${JSON.stringify(r)}]`)
+									.join("");
+							}
+							if (
+								!ParserHelpers.addParsedVariableToModule(
+									parser,
+									nameIdentifier,
+									expression
+								)
+							) {
+								return false;
+							}
+							if (scopedName) {
+								ParserHelpers.toConstantDependency(
+									parser,
+									nameIdentifier
+								)(expr);
+							}
+							return true;
+						});
+					});
+				};
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("ProvidePlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("ProvidePlugin", handler);
+
+				// Disable ProvidePlugin for javascript/esm, see https://github.com/webpack/webpack/issues/7032
+			}
+		);
+	}
+}
+module.exports = ProvidePlugin;
diff --git a/node_modules/webpack/lib/RawModule.js b/node_modules/webpack/lib/RawModule.js
new file mode 100644
index 0000000..ab3fd3a
--- /dev/null
+++ b/node_modules/webpack/lib/RawModule.js
@@ -0,0 +1,56 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Module = require("./Module");
+const { OriginalSource, RawSource } = require("webpack-sources");
+
+module.exports = class RawModule extends Module {
+	constructor(source, identifier, readableIdentifier) {
+		super("javascript/dynamic", null);
+		this.sourceStr = source;
+		this.identifierStr = identifier || this.sourceStr;
+		this.readableIdentifierStr = readableIdentifier || this.identifierStr;
+		this.built = false;
+	}
+
+	identifier() {
+		return this.identifierStr;
+	}
+
+	size() {
+		return this.sourceStr.length;
+	}
+
+	readableIdentifier(requestShortener) {
+		return requestShortener.shorten(this.readableIdentifierStr);
+	}
+
+	needRebuild() {
+		return false;
+	}
+
+	build(options, compilations, resolver, fs, callback) {
+		this.built = true;
+		this.buildMeta = {};
+		this.buildInfo = {
+			cacheable: true
+		};
+		callback();
+	}
+
+	source() {
+		if (this.useSourceMap) {
+			return new OriginalSource(this.sourceStr, this.identifier());
+		} else {
+			return new RawSource(this.sourceStr);
+		}
+	}
+
+	updateHash(hash) {
+		hash.update(this.sourceStr);
+		super.updateHash(hash);
+	}
+};
diff --git a/node_modules/webpack/lib/RecordIdsPlugin.js b/node_modules/webpack/lib/RecordIdsPlugin.js
new file mode 100644
index 0000000..3979f1f
--- /dev/null
+++ b/node_modules/webpack/lib/RecordIdsPlugin.js
@@ -0,0 +1,236 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const identifierUtils = require("./util/identifier");
+
+/** @typedef {import("./Compiler")} Compiler */
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("./Module")} Module */
+
+/**
+ * @typedef {Object} RecordsChunks
+ * @property {Record<string, number>=} byName
+ * @property {Record<string, number>=} bySource
+ * @property {number[]=} usedIds
+ */
+
+/**
+ * @typedef {Object} RecordsModules
+ * @property {Record<string, number>=} byIdentifier
+ * @property {Record<string, number>=} bySource
+ * @property {Record<number, number>=} usedIds
+ */
+
+/**
+ * @typedef {Object} Records
+ * @property {RecordsChunks=} chunks
+ * @property {RecordsModules=} modules
+ */
+
+class RecordIdsPlugin {
+	/**
+	 * @param {Object} options Options object
+	 * @param {boolean=} options.portableIds true, when ids need to be portable
+	 */
+	constructor(options) {
+		this.options = options || {};
+	}
+
+	/**
+	 * @param {Compiler} compiler the Compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		const portableIds = this.options.portableIds;
+		compiler.hooks.compilation.tap("RecordIdsPlugin", compilation => {
+			compilation.hooks.recordModules.tap(
+				"RecordIdsPlugin",
+				/**
+				 * @param {Module[]} modules the modules array
+				 * @param {Records} records the records object
+				 * @returns {void}
+				 */
+				(modules, records) => {
+					if (!records.modules) records.modules = {};
+					if (!records.modules.byIdentifier) records.modules.byIdentifier = {};
+					if (!records.modules.usedIds) records.modules.usedIds = {};
+					for (const module of modules) {
+						if (typeof module.id !== "number") continue;
+						const identifier = portableIds
+							? identifierUtils.makePathsRelative(
+									compiler.context,
+									module.identifier(),
+									compilation.cache
+							  )
+							: module.identifier();
+						records.modules.byIdentifier[identifier] = module.id;
+						records.modules.usedIds[module.id] = module.id;
+					}
+				}
+			);
+			compilation.hooks.reviveModules.tap(
+				"RecordIdsPlugin",
+				/**
+				 * @param {Module[]} modules the modules array
+				 * @param {Records} records the records object
+				 * @returns {void}
+				 */
+				(modules, records) => {
+					if (!records.modules) return;
+					if (records.modules.byIdentifier) {
+						/** @type {Set<number>} */
+						const usedIds = new Set();
+						for (const module of modules) {
+							if (module.id !== null) continue;
+							const identifier = portableIds
+								? identifierUtils.makePathsRelative(
+										compiler.context,
+										module.identifier(),
+										compilation.cache
+								  )
+								: module.identifier();
+							const id = records.modules.byIdentifier[identifier];
+							if (id === undefined) continue;
+							if (usedIds.has(id)) continue;
+							usedIds.add(id);
+							module.id = id;
+						}
+					}
+					if (Array.isArray(records.modules.usedIds)) {
+						compilation.usedModuleIds = new Set(records.modules.usedIds);
+					}
+				}
+			);
+
+			/**
+			 * @param {Module} module the module
+			 * @returns {string} the (portable) identifier
+			 */
+			const getModuleIdentifier = module => {
+				if (portableIds) {
+					return identifierUtils.makePathsRelative(
+						compiler.context,
+						module.identifier(),
+						compilation.cache
+					);
+				}
+				return module.identifier();
+			};
+
+			/**
+			 * @param {Chunk} chunk the chunk
+			 * @returns {string[]} sources of the chunk
+			 */
+			const getChunkSources = chunk => {
+				/** @type {string[]} */
+				const sources = [];
+				for (const chunkGroup of chunk.groupsIterable) {
+					const index = chunkGroup.chunks.indexOf(chunk);
+					if (chunkGroup.name) {
+						sources.push(`${index} ${chunkGroup.name}`);
+					} else {
+						for (const origin of chunkGroup.origins) {
+							if (origin.module) {
+								if (origin.request) {
+									sources.push(
+										`${index} ${getModuleIdentifier(origin.module)} ${
+											origin.request
+										}`
+									);
+								} else if (typeof origin.loc === "string") {
+									sources.push(
+										`${index} ${getModuleIdentifier(origin.module)} ${
+											origin.loc
+										}`
+									);
+								} else if (
+									origin.loc &&
+									typeof origin.loc === "object" &&
+									origin.loc.start
+								) {
+									sources.push(
+										`${index} ${getModuleIdentifier(
+											origin.module
+										)} ${JSON.stringify(origin.loc.start)}`
+									);
+								}
+							}
+						}
+					}
+				}
+				return sources;
+			};
+
+			compilation.hooks.recordChunks.tap(
+				"RecordIdsPlugin",
+				/**
+				 * @param {Chunk[]} chunks the chunks array
+				 * @param {Records} records the records object
+				 * @returns {void}
+				 */
+				(chunks, records) => {
+					if (!records.chunks) records.chunks = {};
+					if (!records.chunks.byName) records.chunks.byName = {};
+					if (!records.chunks.bySource) records.chunks.bySource = {};
+					/** @type {Set<number>} */
+					const usedIds = new Set();
+					for (const chunk of chunks) {
+						if (typeof chunk.id !== "number") continue;
+						const name = chunk.name;
+						if (name) records.chunks.byName[name] = chunk.id;
+						const sources = getChunkSources(chunk);
+						for (const source of sources) {
+							records.chunks.bySource[source] = chunk.id;
+						}
+						usedIds.add(chunk.id);
+					}
+					records.chunks.usedIds = Array.from(usedIds).sort();
+				}
+			);
+			compilation.hooks.reviveChunks.tap(
+				"RecordIdsPlugin",
+				/**
+				 * @param {Chunk[]} chunks the chunks array
+				 * @param {Records} records the records object
+				 * @returns {void}
+				 */
+				(chunks, records) => {
+					if (!records.chunks) return;
+					/** @type {Set<number>} */
+					const usedIds = new Set();
+					if (records.chunks.byName) {
+						for (const chunk of chunks) {
+							if (chunk.id !== null) continue;
+							if (!chunk.name) continue;
+							const id = records.chunks.byName[chunk.name];
+							if (id === undefined) continue;
+							if (usedIds.has(id)) continue;
+							usedIds.add(id);
+							chunk.id = id;
+						}
+					}
+					if (records.chunks.bySource) {
+						for (const chunk of chunks) {
+							const sources = getChunkSources(chunk);
+							for (const source of sources) {
+								const id = records.chunks.bySource[source];
+								if (id === undefined) continue;
+								if (usedIds.has(id)) continue;
+								usedIds.add(id);
+								chunk.id = id;
+								break;
+							}
+						}
+					}
+					if (Array.isArray(records.chunks.usedIds)) {
+						compilation.usedChunkIds = new Set(records.chunks.usedIds);
+					}
+				}
+			);
+		});
+	}
+}
+module.exports = RecordIdsPlugin;
diff --git a/node_modules/webpack/lib/RemovedPluginError.js b/node_modules/webpack/lib/RemovedPluginError.js
new file mode 100644
index 0000000..626c3b4
--- /dev/null
+++ b/node_modules/webpack/lib/RemovedPluginError.js
@@ -0,0 +1,11 @@
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+module.exports = class RemovedPluginError extends WebpackError {
+	constructor(message) {
+		super(message);
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/RequestShortener.js b/node_modules/webpack/lib/RequestShortener.js
new file mode 100644
index 0000000..3d9af00
--- /dev/null
+++ b/node_modules/webpack/lib/RequestShortener.js
@@ -0,0 +1,83 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+const NORMALIZE_SLASH_DIRECTION_REGEXP = /\\/g;
+const PATH_CHARS_REGEXP = /[-[\]{}()*+?.,\\^$|#\s]/g;
+const SEPARATOR_REGEXP = /[/\\]$/;
+const FRONT_OR_BACK_BANG_REGEXP = /^!|!$/g;
+const INDEX_JS_REGEXP = /\/index.js(!|\?|\(query\))/g;
+const MATCH_RESOURCE_REGEXP = /!=!/;
+
+const normalizeBackSlashDirection = request => {
+	return request.replace(NORMALIZE_SLASH_DIRECTION_REGEXP, "/");
+};
+
+const createRegExpForPath = path => {
+	const regexpTypePartial = path.replace(PATH_CHARS_REGEXP, "\\$&");
+	return new RegExp(`(^|!)${regexpTypePartial}`, "g");
+};
+
+class RequestShortener {
+	constructor(directory) {
+		directory = normalizeBackSlashDirection(directory);
+		if (SEPARATOR_REGEXP.test(directory)) {
+			directory = directory.substr(0, directory.length - 1);
+		}
+
+		if (directory) {
+			this.currentDirectoryRegExp = createRegExpForPath(directory);
+		}
+
+		const dirname = path.dirname(directory);
+		const endsWithSeparator = SEPARATOR_REGEXP.test(dirname);
+		const parentDirectory = endsWithSeparator
+			? dirname.substr(0, dirname.length - 1)
+			: dirname;
+		if (parentDirectory && parentDirectory !== directory) {
+			this.parentDirectoryRegExp = createRegExpForPath(`${parentDirectory}/`);
+		}
+
+		if (__dirname.length >= 2) {
+			const buildins = normalizeBackSlashDirection(path.join(__dirname, ".."));
+			const buildinsAsModule =
+				this.currentDirectoryRegExp &&
+				this.currentDirectoryRegExp.test(buildins);
+			this.buildinsAsModule = buildinsAsModule;
+			this.buildinsRegExp = createRegExpForPath(buildins);
+		}
+
+		this.cache = new Map();
+	}
+
+	shorten(request) {
+		if (!request) return request;
+		const cacheEntry = this.cache.get(request);
+		if (cacheEntry !== undefined) {
+			return cacheEntry;
+		}
+		let result = normalizeBackSlashDirection(request);
+		if (this.buildinsAsModule && this.buildinsRegExp) {
+			result = result.replace(this.buildinsRegExp, "!(webpack)");
+		}
+		if (this.currentDirectoryRegExp) {
+			result = result.replace(this.currentDirectoryRegExp, "!.");
+		}
+		if (this.parentDirectoryRegExp) {
+			result = result.replace(this.parentDirectoryRegExp, "!../");
+		}
+		if (!this.buildinsAsModule && this.buildinsRegExp) {
+			result = result.replace(this.buildinsRegExp, "!(webpack)");
+		}
+		result = result.replace(INDEX_JS_REGEXP, "$1");
+		result = result.replace(FRONT_OR_BACK_BANG_REGEXP, "");
+		result = result.replace(MATCH_RESOURCE_REGEXP, " = ");
+		this.cache.set(request, result);
+		return result;
+	}
+}
+
+module.exports = RequestShortener;
diff --git a/node_modules/webpack/lib/RequireJsStuffPlugin.js b/node_modules/webpack/lib/RequireJsStuffPlugin.js
new file mode 100644
index 0000000..632deef
--- /dev/null
+++ b/node_modules/webpack/lib/RequireJsStuffPlugin.js
@@ -0,0 +1,66 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ParserHelpers = require("./ParserHelpers");
+const ConstDependency = require("./dependencies/ConstDependency");
+const NullFactory = require("./NullFactory");
+
+module.exports = class RequireJsStuffPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"RequireJsStuffPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(ConstDependency, new NullFactory());
+				compilation.dependencyTemplates.set(
+					ConstDependency,
+					new ConstDependency.Template()
+				);
+				const handler = (parser, parserOptions) => {
+					if (parserOptions.requireJs !== undefined && !parserOptions.requireJs)
+						return;
+
+					parser.hooks.call
+						.for("require.config")
+						.tap(
+							"RequireJsStuffPlugin",
+							ParserHelpers.toConstantDependency(parser, "undefined")
+						);
+					parser.hooks.call
+						.for("requirejs.config")
+						.tap(
+							"RequireJsStuffPlugin",
+							ParserHelpers.toConstantDependency(parser, "undefined")
+						);
+
+					parser.hooks.expression
+						.for("require.version")
+						.tap(
+							"RequireJsStuffPlugin",
+							ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify("0.0.0")
+							)
+						);
+					parser.hooks.expression
+						.for("requirejs.onError")
+						.tap(
+							"RequireJsStuffPlugin",
+							ParserHelpers.toConstantDependencyWithWebpackRequire(
+								parser,
+								"__webpack_require__.oe"
+							)
+						);
+				};
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("RequireJsStuffPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("RequireJsStuffPlugin", handler);
+			}
+		);
+	}
+};
diff --git a/node_modules/webpack/lib/ResolverFactory.js b/node_modules/webpack/lib/ResolverFactory.js
new file mode 100644
index 0000000..7166257
--- /dev/null
+++ b/node_modules/webpack/lib/ResolverFactory.js
@@ -0,0 +1,74 @@
+/*
+ MIT License http://www.opensource.org/licenses/mit-license.php
+ Author Tobias Koppers @sokra
+ */
+"use strict";
+
+const { Tapable, HookMap, SyncHook, SyncWaterfallHook } = require("tapable");
+const Factory = require("enhanced-resolve").ResolverFactory;
+const { cachedCleverMerge } = require("./util/cleverMerge");
+
+/** @typedef {import("enhanced-resolve").Resolver} Resolver */
+
+const EMTPY_RESOLVE_OPTIONS = {};
+
+module.exports = class ResolverFactory extends Tapable {
+	constructor() {
+		super();
+		this.hooks = {
+			resolveOptions: new HookMap(
+				() => new SyncWaterfallHook(["resolveOptions"])
+			),
+			resolver: new HookMap(() => new SyncHook(["resolver", "resolveOptions"]))
+		};
+		this._pluginCompat.tap("ResolverFactory", options => {
+			let match;
+			match = /^resolve-options (.+)$/.exec(options.name);
+			if (match) {
+				this.hooks.resolveOptions
+					.for(match[1])
+					.tap(options.fn.name || "unnamed compat plugin", options.fn);
+				return true;
+			}
+			match = /^resolver (.+)$/.exec(options.name);
+			if (match) {
+				this.hooks.resolver
+					.for(match[1])
+					.tap(options.fn.name || "unnamed compat plugin", options.fn);
+				return true;
+			}
+		});
+		this.cache2 = new Map();
+	}
+
+	get(type, resolveOptions) {
+		resolveOptions = resolveOptions || EMTPY_RESOLVE_OPTIONS;
+		const ident = `${type}|${JSON.stringify(resolveOptions)}`;
+		const resolver = this.cache2.get(ident);
+		if (resolver) return resolver;
+		const newResolver = this._create(type, resolveOptions);
+		this.cache2.set(ident, newResolver);
+		return newResolver;
+	}
+
+	_create(type, resolveOptions) {
+		const originalResolveOptions = Object.assign({}, resolveOptions);
+		resolveOptions = this.hooks.resolveOptions.for(type).call(resolveOptions);
+		const resolver = Factory.createResolver(resolveOptions);
+		if (!resolver) {
+			throw new Error("No resolver created");
+		}
+		/** @type {Map<Object, Resolver>} */
+		const childCache = new Map();
+		resolver.withOptions = options => {
+			const cacheEntry = childCache.get(options);
+			if (cacheEntry !== undefined) return cacheEntry;
+			const mergedOptions = cachedCleverMerge(originalResolveOptions, options);
+			const resolver = this.get(type, mergedOptions);
+			childCache.set(options, resolver);
+			return resolver;
+		};
+		this.hooks.resolver.for(type).call(resolver, resolveOptions);
+		return resolver;
+	}
+};
diff --git a/node_modules/webpack/lib/RuleSet.js b/node_modules/webpack/lib/RuleSet.js
new file mode 100644
index 0000000..7ed8eba
--- /dev/null
+++ b/node_modules/webpack/lib/RuleSet.js
@@ -0,0 +1,567 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+/*
+<rules>: <rule>
+<rules>: [<rule>]
+<rule>: {
+	resource: {
+		test: <condition>,
+		include: <condition>,
+		exclude: <condition>,
+	},
+	resource: <condition>, -> resource.test
+	test: <condition>, -> resource.test
+	include: <condition>, -> resource.include
+	exclude: <condition>, -> resource.exclude
+	resourceQuery: <condition>,
+	compiler: <condition>,
+	issuer: <condition>,
+	use: "loader", -> use[0].loader
+	loader: <>, -> use[0].loader
+	loaders: <>, -> use
+	options: {}, -> use[0].options,
+	query: {}, -> options
+	parser: {},
+	use: [
+		"loader" -> use[x].loader
+	],
+	use: [
+		{
+			loader: "loader",
+			options: {}
+		}
+	],
+	rules: [
+		<rule>
+	],
+	oneOf: [
+		<rule>
+	]
+}
+
+<condition>: /regExp/
+<condition>: function(arg) {}
+<condition>: "starting"
+<condition>: [<condition>] // or
+<condition>: { and: [<condition>] }
+<condition>: { or: [<condition>] }
+<condition>: { not: [<condition>] }
+<condition>: { test: <condition>, include: <condition>, exclude: <condition> }
+
+
+normalized:
+
+{
+	resource: function(),
+	resourceQuery: function(),
+	compiler: function(),
+	issuer: function(),
+	use: [
+		{
+			loader: string,
+			options: string,
+			<any>: <any>
+		}
+	],
+	rules: [<rule>],
+	oneOf: [<rule>],
+	<any>: <any>,
+}
+
+*/
+
+"use strict";
+
+const notMatcher = matcher => {
+	return str => {
+		return !matcher(str);
+	};
+};
+
+const orMatcher = items => {
+	return str => {
+		for (let i = 0; i < items.length; i++) {
+			if (items[i](str)) return true;
+		}
+		return false;
+	};
+};
+
+const andMatcher = items => {
+	return str => {
+		for (let i = 0; i < items.length; i++) {
+			if (!items[i](str)) return false;
+		}
+		return true;
+	};
+};
+
+module.exports = class RuleSet {
+	constructor(rules) {
+		this.references = Object.create(null);
+		this.rules = RuleSet.normalizeRules(rules, this.references, "ref-");
+	}
+
+	static normalizeRules(rules, refs, ident) {
+		if (Array.isArray(rules)) {
+			return rules.map((rule, idx) => {
+				return RuleSet.normalizeRule(rule, refs, `${ident}-${idx}`);
+			});
+		} else if (rules) {
+			return [RuleSet.normalizeRule(rules, refs, ident)];
+		} else {
+			return [];
+		}
+	}
+
+	static normalizeRule(rule, refs, ident) {
+		if (typeof rule === "string") {
+			return {
+				use: [
+					{
+						loader: rule
+					}
+				]
+			};
+		}
+		if (!rule) {
+			throw new Error("Unexcepted null when object was expected as rule");
+		}
+		if (typeof rule !== "object") {
+			throw new Error(
+				"Unexcepted " +
+					typeof rule +
+					" when object was expected as rule (" +
+					rule +
+					")"
+			);
+		}
+
+		const newRule = {};
+		let useSource;
+		let resourceSource;
+		let condition;
+
+		const checkUseSource = newSource => {
+			if (useSource && useSource !== newSource) {
+				throw new Error(
+					RuleSet.buildErrorMessage(
+						rule,
+						new Error(
+							"Rule can only have one result source (provided " +
+								newSource +
+								" and " +
+								useSource +
+								")"
+						)
+					)
+				);
+			}
+			useSource = newSource;
+		};
+
+		const checkResourceSource = newSource => {
+			if (resourceSource && resourceSource !== newSource) {
+				throw new Error(
+					RuleSet.buildErrorMessage(
+						rule,
+						new Error(
+							"Rule can only have one resource source (provided " +
+								newSource +
+								" and " +
+								resourceSource +
+								")"
+						)
+					)
+				);
+			}
+			resourceSource = newSource;
+		};
+
+		if (rule.test || rule.include || rule.exclude) {
+			checkResourceSource("test + include + exclude");
+			condition = {
+				test: rule.test,
+				include: rule.include,
+				exclude: rule.exclude
+			};
+			try {
+				newRule.resource = RuleSet.normalizeCondition(condition);
+			} catch (error) {
+				throw new Error(RuleSet.buildErrorMessage(condition, error));
+			}
+		}
+
+		if (rule.resource) {
+			checkResourceSource("resource");
+			try {
+				newRule.resource = RuleSet.normalizeCondition(rule.resource);
+			} catch (error) {
+				throw new Error(RuleSet.buildErrorMessage(rule.resource, error));
+			}
+		}
+
+		if (rule.realResource) {
+			try {
+				newRule.realResource = RuleSet.normalizeCondition(rule.realResource);
+			} catch (error) {
+				throw new Error(RuleSet.buildErrorMessage(rule.realResource, error));
+			}
+		}
+
+		if (rule.resourceQuery) {
+			try {
+				newRule.resourceQuery = RuleSet.normalizeCondition(rule.resourceQuery);
+			} catch (error) {
+				throw new Error(RuleSet.buildErrorMessage(rule.resourceQuery, error));
+			}
+		}
+
+		if (rule.compiler) {
+			try {
+				newRule.compiler = RuleSet.normalizeCondition(rule.compiler);
+			} catch (error) {
+				throw new Error(RuleSet.buildErrorMessage(rule.compiler, error));
+			}
+		}
+
+		if (rule.issuer) {
+			try {
+				newRule.issuer = RuleSet.normalizeCondition(rule.issuer);
+			} catch (error) {
+				throw new Error(RuleSet.buildErrorMessage(rule.issuer, error));
+			}
+		}
+
+		if (rule.loader && rule.loaders) {
+			throw new Error(
+				RuleSet.buildErrorMessage(
+					rule,
+					new Error(
+						"Provided loader and loaders for rule (use only one of them)"
+					)
+				)
+			);
+		}
+
+		const loader = rule.loaders || rule.loader;
+		if (typeof loader === "string" && !rule.options && !rule.query) {
+			checkUseSource("loader");
+			newRule.use = RuleSet.normalizeUse(loader.split("!"), ident);
+		} else if (typeof loader === "string" && (rule.options || rule.query)) {
+			checkUseSource("loader + options/query");
+			newRule.use = RuleSet.normalizeUse(
+				{
+					loader: loader,
+					options: rule.options,
+					query: rule.query
+				},
+				ident
+			);
+		} else if (loader && (rule.options || rule.query)) {
+			throw new Error(
+				RuleSet.buildErrorMessage(
+					rule,
+					new Error(
+						"options/query cannot be used with loaders (use options for each array item)"
+					)
+				)
+			);
+		} else if (loader) {
+			checkUseSource("loaders");
+			newRule.use = RuleSet.normalizeUse(loader, ident);
+		} else if (rule.options || rule.query) {
+			throw new Error(
+				RuleSet.buildErrorMessage(
+					rule,
+					new Error(
+						"options/query provided without loader (use loader + options)"
+					)
+				)
+			);
+		}
+
+		if (rule.use) {
+			checkUseSource("use");
+			newRule.use = RuleSet.normalizeUse(rule.use, ident);
+		}
+
+		if (rule.rules) {
+			newRule.rules = RuleSet.normalizeRules(
+				rule.rules,
+				refs,
+				`${ident}-rules`
+			);
+		}
+
+		if (rule.oneOf) {
+			newRule.oneOf = RuleSet.normalizeRules(
+				rule.oneOf,
+				refs,
+				`${ident}-oneOf`
+			);
+		}
+
+		const keys = Object.keys(rule).filter(key => {
+			return ![
+				"resource",
+				"resourceQuery",
+				"compiler",
+				"test",
+				"include",
+				"exclude",
+				"issuer",
+				"loader",
+				"options",
+				"query",
+				"loaders",
+				"use",
+				"rules",
+				"oneOf"
+			].includes(key);
+		});
+		for (const key of keys) {
+			newRule[key] = rule[key];
+		}
+
+		if (Array.isArray(newRule.use)) {
+			for (const item of newRule.use) {
+				if (item.ident) {
+					refs[item.ident] = item.options;
+				}
+			}
+		}
+
+		return newRule;
+	}
+
+	static buildErrorMessage(condition, error) {
+		const conditionAsText = JSON.stringify(
+			condition,
+			(key, value) => {
+				return value === undefined ? "undefined" : value;
+			},
+			2
+		);
+		return error.message + " in " + conditionAsText;
+	}
+
+	static normalizeUse(use, ident) {
+		if (typeof use === "function") {
+			return data => RuleSet.normalizeUse(use(data), ident);
+		}
+		if (Array.isArray(use)) {
+			return use
+				.map((item, idx) => RuleSet.normalizeUse(item, `${ident}-${idx}`))
+				.reduce((arr, items) => arr.concat(items), []);
+		}
+		return [RuleSet.normalizeUseItem(use, ident)];
+	}
+
+	static normalizeUseItemString(useItemString) {
+		const idx = useItemString.indexOf("?");
+		if (idx >= 0) {
+			return {
+				loader: useItemString.substr(0, idx),
+				options: useItemString.substr(idx + 1)
+			};
+		}
+		return {
+			loader: useItemString,
+			options: undefined
+		};
+	}
+
+	static normalizeUseItem(item, ident) {
+		if (typeof item === "string") {
+			return RuleSet.normalizeUseItemString(item);
+		}
+
+		const newItem = {};
+
+		if (item.options && item.query) {
+			throw new Error("Provided options and query in use");
+		}
+
+		if (!item.loader) {
+			throw new Error("No loader specified");
+		}
+
+		newItem.options = item.options || item.query;
+
+		if (typeof newItem.options === "object" && newItem.options) {
+			if (newItem.options.ident) {
+				newItem.ident = newItem.options.ident;
+			} else {
+				newItem.ident = ident;
+			}
+		}
+
+		const keys = Object.keys(item).filter(function(key) {
+			return !["options", "query"].includes(key);
+		});
+
+		for (const key of keys) {
+			newItem[key] = item[key];
+		}
+
+		return newItem;
+	}
+
+	static normalizeCondition(condition) {
+		if (!condition) throw new Error("Expected condition but got falsy value");
+		if (typeof condition === "string") {
+			return str => str.indexOf(condition) === 0;
+		}
+		if (typeof condition === "function") {
+			return condition;
+		}
+		if (condition instanceof RegExp) {
+			return condition.test.bind(condition);
+		}
+		if (Array.isArray(condition)) {
+			const items = condition.map(c => RuleSet.normalizeCondition(c));
+			return orMatcher(items);
+		}
+		if (typeof condition !== "object") {
+			throw Error(
+				"Unexcepted " +
+					typeof condition +
+					" when condition was expected (" +
+					condition +
+					")"
+			);
+		}
+
+		const matchers = [];
+		Object.keys(condition).forEach(key => {
+			const value = condition[key];
+			switch (key) {
+				case "or":
+				case "include":
+				case "test":
+					if (value) matchers.push(RuleSet.normalizeCondition(value));
+					break;
+				case "and":
+					if (value) {
+						const items = value.map(c => RuleSet.normalizeCondition(c));
+						matchers.push(andMatcher(items));
+					}
+					break;
+				case "not":
+				case "exclude":
+					if (value) {
+						const matcher = RuleSet.normalizeCondition(value);
+						matchers.push(notMatcher(matcher));
+					}
+					break;
+				default:
+					throw new Error("Unexcepted property " + key + " in condition");
+			}
+		});
+		if (matchers.length === 0) {
+			throw new Error("Excepted condition but got " + condition);
+		}
+		if (matchers.length === 1) {
+			return matchers[0];
+		}
+		return andMatcher(matchers);
+	}
+
+	exec(data) {
+		const result = [];
+		this._run(
+			data,
+			{
+				rules: this.rules
+			},
+			result
+		);
+		return result;
+	}
+
+	_run(data, rule, result) {
+		// test conditions
+		if (rule.resource && !data.resource) return false;
+		if (rule.realResource && !data.realResource) return false;
+		if (rule.resourceQuery && !data.resourceQuery) return false;
+		if (rule.compiler && !data.compiler) return false;
+		if (rule.issuer && !data.issuer) return false;
+		if (rule.resource && !rule.resource(data.resource)) return false;
+		if (rule.realResource && !rule.realResource(data.realResource))
+			return false;
+		if (data.issuer && rule.issuer && !rule.issuer(data.issuer)) return false;
+		if (
+			data.resourceQuery &&
+			rule.resourceQuery &&
+			!rule.resourceQuery(data.resourceQuery)
+		) {
+			return false;
+		}
+		if (data.compiler && rule.compiler && !rule.compiler(data.compiler)) {
+			return false;
+		}
+
+		// apply
+		const keys = Object.keys(rule).filter(key => {
+			return ![
+				"resource",
+				"realResource",
+				"resourceQuery",
+				"compiler",
+				"issuer",
+				"rules",
+				"oneOf",
+				"use",
+				"enforce"
+			].includes(key);
+		});
+		for (const key of keys) {
+			result.push({
+				type: key,
+				value: rule[key]
+			});
+		}
+
+		if (rule.use) {
+			const process = use => {
+				if (typeof use === "function") {
+					process(use(data));
+				} else if (Array.isArray(use)) {
+					use.forEach(process);
+				} else {
+					result.push({
+						type: "use",
+						value: use,
+						enforce: rule.enforce
+					});
+				}
+			};
+			process(rule.use);
+		}
+
+		if (rule.rules) {
+			for (let i = 0; i < rule.rules.length; i++) {
+				this._run(data, rule.rules[i], result);
+			}
+		}
+
+		if (rule.oneOf) {
+			for (let i = 0; i < rule.oneOf.length; i++) {
+				if (this._run(data, rule.oneOf[i], result)) break;
+			}
+		}
+
+		return true;
+	}
+
+	findOptionsByIdent(ident) {
+		const options = this.references[ident];
+		if (!options) {
+			throw new Error("Can't find options with ident '" + ident + "'");
+		}
+		return options;
+	}
+};
diff --git a/node_modules/webpack/lib/RuntimeTemplate.js b/node_modules/webpack/lib/RuntimeTemplate.js
new file mode 100644
index 0000000..613aed1
--- /dev/null
+++ b/node_modules/webpack/lib/RuntimeTemplate.js
@@ -0,0 +1,336 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Template = require("./Template");
+
+/** @typedef {import("./Module")} Module */
+
+module.exports = class RuntimeTemplate {
+	constructor(outputOptions, requestShortener) {
+		this.outputOptions = outputOptions || {};
+		this.requestShortener = requestShortener;
+	}
+
+	/**
+	 * Add a comment
+	 * @param {object} options Information content of the comment
+	 * @param {string=} options.request request string used originally
+	 * @param {string=} options.chunkName name of the chunk referenced
+	 * @param {string=} options.chunkReason reason information of the chunk
+	 * @param {string=} options.message additional message
+	 * @param {string=} options.exportName name of the export
+	 * @returns {string} comment
+	 */
+	comment({ request, chunkName, chunkReason, message, exportName }) {
+		let content;
+		if (this.outputOptions.pathinfo) {
+			content = [message, request, chunkName, chunkReason]
+				.filter(Boolean)
+				.map(item => this.requestShortener.shorten(item))
+				.join(" | ");
+		} else {
+			content = [message, chunkName, chunkReason]
+				.filter(Boolean)
+				.map(item => this.requestShortener.shorten(item))
+				.join(" | ");
+		}
+		if (!content) return "";
+		if (this.outputOptions.pathinfo) {
+			return Template.toComment(content) + " ";
+		} else {
+			return Template.toNormalComment(content) + " ";
+		}
+	}
+
+	throwMissingModuleErrorFunction({ request }) {
+		const err = `Cannot find module '${request}'`;
+		return `function webpackMissingModule() { var e = new Error(${JSON.stringify(
+			err
+		)}); e.code = 'MODULE_NOT_FOUND'; throw e; }`;
+	}
+
+	missingModule({ request }) {
+		return `!(${this.throwMissingModuleErrorFunction({ request })}())`;
+	}
+
+	missingModuleStatement({ request }) {
+		return `${this.missingModule({ request })};\n`;
+	}
+
+	missingModulePromise({ request }) {
+		return `Promise.resolve().then(${this.throwMissingModuleErrorFunction({
+			request
+		})})`;
+	}
+
+	moduleId({ module, request }) {
+		if (!module) {
+			return this.missingModule({
+				request
+			});
+		}
+		if (module.id === null) {
+			throw new Error(
+				`RuntimeTemplate.moduleId(): Module ${module.identifier()} has no id. This should not happen.`
+			);
+		}
+		return `${this.comment({ request })}${JSON.stringify(module.id)}`;
+	}
+
+	moduleRaw({ module, request }) {
+		if (!module) {
+			return this.missingModule({
+				request
+			});
+		}
+		return `__webpack_require__(${this.moduleId({ module, request })})`;
+	}
+
+	moduleExports({ module, request }) {
+		return this.moduleRaw({
+			module,
+			request
+		});
+	}
+
+	moduleNamespace({ module, request, strict }) {
+		if (!module) {
+			return this.missingModule({
+				request
+			});
+		}
+		const moduleId = this.moduleId({
+			module,
+			request
+		});
+		const exportsType = module.buildMeta && module.buildMeta.exportsType;
+		if (exportsType === "namespace") {
+			const rawModule = this.moduleRaw({
+				module,
+				request
+			});
+			return rawModule;
+		} else if (exportsType === "named") {
+			return `__webpack_require__.t(${moduleId}, 3)`;
+		} else if (strict) {
+			return `__webpack_require__.t(${moduleId}, 1)`;
+		} else {
+			return `__webpack_require__.t(${moduleId}, 7)`;
+		}
+	}
+
+	moduleNamespacePromise({ block, module, request, message, strict, weak }) {
+		if (!module) {
+			return this.missingModulePromise({
+				request
+			});
+		}
+		if (module.id === null) {
+			throw new Error(
+				`RuntimeTemplate.moduleNamespacePromise(): Module ${module.identifier()} has no id. This should not happen.`
+			);
+		}
+		const promise = this.blockPromise({
+			block,
+			message
+		});
+
+		let getModuleFunction;
+		let idExpr = JSON.stringify(module.id);
+		const comment = this.comment({
+			request
+		});
+		let header = "";
+		if (weak) {
+			if (idExpr.length > 8) {
+				// 'var x="nnnnnn";x,"+x+",x' vs '"nnnnnn",nnnnnn,"nnnnnn"'
+				header += `var id = ${idExpr}; `;
+				idExpr = "id";
+			}
+			header += `if(!__webpack_require__.m[${idExpr}]) { var e = new Error("Module '" + ${idExpr} + "' is not available (weak dependency)"); e.code = 'MODULE_NOT_FOUND'; throw e; } `;
+		}
+		const moduleId = this.moduleId({
+			module,
+			request
+		});
+		const exportsType = module.buildMeta && module.buildMeta.exportsType;
+		if (exportsType === "namespace") {
+			if (header) {
+				const rawModule = this.moduleRaw({
+					module,
+					request
+				});
+				getModuleFunction = `function() { ${header}return ${rawModule}; }`;
+			} else {
+				getModuleFunction = `__webpack_require__.bind(null, ${comment}${idExpr})`;
+			}
+		} else if (exportsType === "named") {
+			if (header) {
+				getModuleFunction = `function() { ${header}return __webpack_require__.t(${moduleId}, 3); }`;
+			} else {
+				getModuleFunction = `__webpack_require__.t.bind(null, ${comment}${idExpr}, 3)`;
+			}
+		} else if (strict) {
+			if (header) {
+				getModuleFunction = `function() { ${header}return __webpack_require__.t(${moduleId}, 1); }`;
+			} else {
+				getModuleFunction = `__webpack_require__.t.bind(null, ${comment}${idExpr}, 1)`;
+			}
+		} else {
+			if (header) {
+				getModuleFunction = `function() { ${header}return __webpack_require__.t(${moduleId}, 7); }`;
+			} else {
+				getModuleFunction = `__webpack_require__.t.bind(null, ${comment}${idExpr}, 7)`;
+			}
+		}
+
+		return `${promise || "Promise.resolve()"}.then(${getModuleFunction})`;
+	}
+
+	/**
+	 *
+	 * @param {Object} options options object
+	 * @param {boolean=} options.update whether a new variable should be created or the existing one updated
+	 * @param {Module} options.module the module
+	 * @param {string} options.request the request that should be printed as comment
+	 * @param {string} options.importVar name of the import variable
+	 * @param {Module} options.originModule module in which the statement is emitted
+	 * @returns {string} the import statement
+	 */
+	importStatement({ update, module, request, importVar, originModule }) {
+		if (!module) {
+			return this.missingModuleStatement({
+				request
+			});
+		}
+		const moduleId = this.moduleId({
+			module,
+			request
+		});
+		const optDeclaration = update ? "" : "var ";
+
+		const exportsType = module.buildMeta && module.buildMeta.exportsType;
+		let content = `/* harmony import */ ${optDeclaration}${importVar} = __webpack_require__(${moduleId});\n`;
+
+		if (!exportsType && !originModule.buildMeta.strictHarmonyModule) {
+			content += `/* harmony import */ ${optDeclaration}${importVar}_default = /*#__PURE__*/__webpack_require__.n(${importVar});\n`;
+		}
+		if (exportsType === "named") {
+			if (Array.isArray(module.buildMeta.providedExports)) {
+				content += `${optDeclaration}${importVar}_namespace = /*#__PURE__*/__webpack_require__.t(${moduleId}, 1);\n`;
+			} else {
+				content += `${optDeclaration}${importVar}_namespace = /*#__PURE__*/__webpack_require__.t(${moduleId});\n`;
+			}
+		}
+		return content;
+	}
+
+	exportFromImport({
+		module,
+		request,
+		exportName,
+		originModule,
+		asiSafe,
+		isCall,
+		callContext,
+		importVar
+	}) {
+		if (!module) {
+			return this.missingModule({
+				request
+			});
+		}
+		const exportsType = module.buildMeta && module.buildMeta.exportsType;
+
+		if (!exportsType) {
+			if (exportName === "default") {
+				if (!originModule.buildMeta.strictHarmonyModule) {
+					if (isCall) {
+						return `${importVar}_default()`;
+					} else if (asiSafe) {
+						return `(${importVar}_default())`;
+					} else {
+						return `${importVar}_default.a`;
+					}
+				} else {
+					return importVar;
+				}
+			} else if (originModule.buildMeta.strictHarmonyModule) {
+				if (exportName) {
+					return "/* non-default import from non-esm module */undefined";
+				} else {
+					return `/*#__PURE__*/__webpack_require__.t(${importVar})`;
+				}
+			}
+		}
+
+		if (exportsType === "named") {
+			if (exportName === "default") {
+				return importVar;
+			} else if (!exportName) {
+				return `${importVar}_namespace`;
+			}
+		}
+
+		if (exportName) {
+			const used = module.isUsed(exportName);
+			if (!used) {
+				const comment = Template.toNormalComment(`unused export ${exportName}`);
+				return `${comment} undefined`;
+			}
+			const comment =
+				used !== exportName ? Template.toNormalComment(exportName) + " " : "";
+			const access = `${importVar}[${comment}${JSON.stringify(used)}]`;
+			if (isCall) {
+				if (callContext === false && asiSafe) {
+					return `(0,${access})`;
+				} else if (callContext === false) {
+					return `Object(${access})`;
+				}
+			}
+			return access;
+		} else {
+			return importVar;
+		}
+	}
+
+	blockPromise({ block, message }) {
+		if (!block || !block.chunkGroup || block.chunkGroup.chunks.length === 0) {
+			const comment = this.comment({
+				message
+			});
+			return `Promise.resolve(${comment.trim()})`;
+		}
+		const chunks = block.chunkGroup.chunks.filter(
+			chunk => !chunk.hasRuntime() && chunk.id !== null
+		);
+		const comment = this.comment({
+			message,
+			chunkName: block.chunkName,
+			chunkReason: block.chunkReason
+		});
+		if (chunks.length === 1) {
+			const chunkId = JSON.stringify(chunks[0].id);
+			return `__webpack_require__.e(${comment}${chunkId})`;
+		} else if (chunks.length > 0) {
+			const requireChunkId = chunk =>
+				`__webpack_require__.e(${JSON.stringify(chunk.id)})`;
+			return `Promise.all(${comment.trim()}[${chunks
+				.map(requireChunkId)
+				.join(", ")}])`;
+		} else {
+			return `Promise.resolve(${comment.trim()})`;
+		}
+	}
+
+	onError() {
+		return "__webpack_require__.oe";
+	}
+
+	defineEsModuleFlagStatement({ exportsArgument }) {
+		return `__webpack_require__.r(${exportsArgument});\n`;
+	}
+};
diff --git a/node_modules/webpack/lib/SetVarMainTemplatePlugin.js b/node_modules/webpack/lib/SetVarMainTemplatePlugin.js
new file mode 100644
index 0000000..63db282
--- /dev/null
+++ b/node_modules/webpack/lib/SetVarMainTemplatePlugin.js
@@ -0,0 +1,69 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+
+/** @typedef {import("./Compilation")} Compilation */
+
+class SetVarMainTemplatePlugin {
+	/**
+	 * @param {string} varExpression the accessor where the library is exported
+	 * @param {boolean} copyObject specify copying the exports
+	 */
+	constructor(varExpression, copyObject) {
+		/** @type {string} */
+		this.varExpression = varExpression;
+		/** @type {boolean} */
+		this.copyObject = copyObject;
+	}
+
+	/**
+	 * @param {Compilation} compilation the compilation instance
+	 * @returns {void}
+	 */
+	apply(compilation) {
+		const { mainTemplate, chunkTemplate } = compilation;
+
+		const onRenderWithEntry = (source, chunk, hash) => {
+			const varExpression = mainTemplate.getAssetPath(this.varExpression, {
+				hash,
+				chunk
+			});
+			if (this.copyObject) {
+				return new ConcatSource(
+					`(function(e, a) { for(var i in a) e[i] = a[i]; }(${varExpression}, `,
+					source,
+					"))"
+				);
+			} else {
+				const prefix = `${varExpression} =\n`;
+				return new ConcatSource(prefix, source);
+			}
+		};
+
+		for (const template of [mainTemplate, chunkTemplate]) {
+			template.hooks.renderWithEntry.tap(
+				"SetVarMainTemplatePlugin",
+				onRenderWithEntry
+			);
+		}
+
+		mainTemplate.hooks.globalHashPaths.tap(
+			"SetVarMainTemplatePlugin",
+			paths => {
+				if (this.varExpression) paths.push(this.varExpression);
+				return paths;
+			}
+		);
+		mainTemplate.hooks.hash.tap("SetVarMainTemplatePlugin", hash => {
+			hash.update("set var");
+			hash.update(`${this.varExpression}`);
+			hash.update(`${this.copyObject}`);
+		});
+	}
+}
+
+module.exports = SetVarMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/SingleEntryPlugin.js b/node_modules/webpack/lib/SingleEntryPlugin.js
new file mode 100644
index 0000000..4a1703b
--- /dev/null
+++ b/node_modules/webpack/lib/SingleEntryPlugin.js
@@ -0,0 +1,63 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const SingleEntryDependency = require("./dependencies/SingleEntryDependency");
+
+/** @typedef {import("./Compiler")} Compiler */
+
+class SingleEntryPlugin {
+	/**
+	 * An entry plugin which will handle
+	 * creation of the SingleEntryDependency
+	 *
+	 * @param {string} context context path
+	 * @param {string} entry entry path
+	 * @param {string} name entry key name
+	 */
+	constructor(context, entry, name) {
+		this.context = context;
+		this.entry = entry;
+		this.name = name;
+	}
+
+	/**
+	 * @param {Compiler} compiler the compiler instance
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"SingleEntryPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					SingleEntryDependency,
+					normalModuleFactory
+				);
+			}
+		);
+
+		compiler.hooks.make.tapAsync(
+			"SingleEntryPlugin",
+			(compilation, callback) => {
+				const { entry, name, context } = this;
+
+				const dep = SingleEntryPlugin.createDependency(entry, name);
+				compilation.addEntry(context, dep, name, callback);
+			}
+		);
+	}
+
+	/**
+	 * @param {string} entry entry request
+	 * @param {string} name entry name
+	 * @returns {SingleEntryDependency} the dependency
+	 */
+	static createDependency(entry, name) {
+		const dep = new SingleEntryDependency(entry);
+		dep.loc = { name };
+		return dep;
+	}
+}
+
+module.exports = SingleEntryPlugin;
diff --git a/node_modules/webpack/lib/SizeFormatHelpers.js b/node_modules/webpack/lib/SizeFormatHelpers.js
new file mode 100644
index 0000000..c4677f6
--- /dev/null
+++ b/node_modules/webpack/lib/SizeFormatHelpers.js
@@ -0,0 +1,24 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Sean Larkin @thelarkinn
+*/
+"use strict";
+
+const SizeFormatHelpers = exports;
+
+SizeFormatHelpers.formatSize = size => {
+	if (typeof size !== "number" || Number.isNaN(size) === true) {
+		return "unknown size";
+	}
+
+	if (size <= 0) {
+		return "0 bytes";
+	}
+
+	const abbreviations = ["bytes", "KiB", "MiB", "GiB"];
+	const index = Math.floor(Math.log(size) / Math.log(1024));
+
+	return `${+(size / Math.pow(1024, index)).toPrecision(3)} ${
+		abbreviations[index]
+	}`;
+};
diff --git a/node_modules/webpack/lib/SourceMapDevToolModuleOptionsPlugin.js b/node_modules/webpack/lib/SourceMapDevToolModuleOptionsPlugin.js
new file mode 100644
index 0000000..e593ced
--- /dev/null
+++ b/node_modules/webpack/lib/SourceMapDevToolModuleOptionsPlugin.js
@@ -0,0 +1,49 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ModuleFilenameHelpers = require("./ModuleFilenameHelpers");
+
+class SourceMapDevToolModuleOptionsPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compilation) {
+		const options = this.options;
+		if (options.module !== false) {
+			compilation.hooks.buildModule.tap(
+				"SourceMapDevToolModuleOptionsPlugin",
+				module => {
+					module.useSourceMap = true;
+				}
+			);
+		}
+		if (options.lineToLine === true) {
+			compilation.hooks.buildModule.tap(
+				"SourceMapDevToolModuleOptionsPlugin",
+				module => {
+					module.lineToLine = true;
+				}
+			);
+		} else if (options.lineToLine) {
+			compilation.hooks.buildModule.tap(
+				"SourceMapDevToolModuleOptionsPlugin",
+				module => {
+					if (!module.resource) return;
+					let resourcePath = module.resource;
+					const idx = resourcePath.indexOf("?");
+					if (idx >= 0) resourcePath = resourcePath.substr(0, idx);
+					module.lineToLine = ModuleFilenameHelpers.matchObject(
+						options.lineToLine,
+						resourcePath
+					);
+				}
+			);
+		}
+	}
+}
+
+module.exports = SourceMapDevToolModuleOptionsPlugin;
diff --git a/node_modules/webpack/lib/SourceMapDevToolPlugin.js b/node_modules/webpack/lib/SourceMapDevToolPlugin.js
new file mode 100644
index 0000000..3018eb2
--- /dev/null
+++ b/node_modules/webpack/lib/SourceMapDevToolPlugin.js
@@ -0,0 +1,418 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+const { ConcatSource, RawSource } = require("webpack-sources");
+const ModuleFilenameHelpers = require("./ModuleFilenameHelpers");
+const SourceMapDevToolModuleOptionsPlugin = require("./SourceMapDevToolModuleOptionsPlugin");
+const createHash = require("./util/createHash");
+const { absolutify } = require("./util/identifier");
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/SourceMapDevToolPlugin.json");
+
+/** @typedef {import("../declarations/plugins/SourceMapDevToolPlugin").SourceMapDevToolPluginOptions} SourceMapDevToolPluginOptions */
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("source-map").RawSourceMap} SourceMap */
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./Compilation")} Compilation */
+/** @typedef {import("./Compiler")} Compiler */
+/** @typedef {import("./Compilation")} SourceMapDefinition */
+
+/**
+ * @typedef {object} SourceMapTask
+ * @property {Source} asset
+ * @property {Array<string | Module>} [modules]
+ * @property {string} source
+ * @property {string} file
+ * @property {SourceMap} sourceMap
+ * @property {Chunk} chunk
+ */
+
+/**
+ * @param {string} name file path
+ * @returns {string} file name
+ */
+const basename = name => {
+	if (!name.includes("/")) return name;
+	return name.substr(name.lastIndexOf("/") + 1);
+};
+
+/**
+ * @type {WeakMap<Source, {file: string, assets: {[k: string]: ConcatSource | RawSource}}>}
+ */
+const assetsCache = new WeakMap();
+
+/**
+ * Creating {@link SourceMapTask} for given file
+ * @param {string} file current compiled file
+ * @param {Source} asset the asset
+ * @param {Chunk} chunk related chunk
+ * @param {SourceMapDevToolPluginOptions} options source map options
+ * @param {Compilation} compilation compilation instance
+ * @returns {SourceMapTask | undefined} created task instance or `undefined`
+ */
+const getTaskForFile = (file, asset, chunk, options, compilation) => {
+	let source, sourceMap;
+	/**
+	 * Check if asset can build source map
+	 */
+	if (asset.sourceAndMap) {
+		const sourceAndMap = asset.sourceAndMap(options);
+		sourceMap = sourceAndMap.map;
+		source = sourceAndMap.source;
+	} else {
+		sourceMap = asset.map(options);
+		source = asset.source();
+	}
+	if (!sourceMap || typeof source !== "string") return;
+	const context = compilation.options.context;
+	const modules = sourceMap.sources.map(source => {
+		if (source.startsWith("webpack://")) {
+			source = absolutify(context, source.slice(10));
+		}
+		const module = compilation.findModule(source);
+		return module || source;
+	});
+
+	return {
+		chunk,
+		file,
+		asset,
+		source,
+		sourceMap,
+		modules
+	};
+};
+
+class SourceMapDevToolPlugin {
+	/**
+	 * @param {SourceMapDevToolPluginOptions} [options] options object
+	 * @throws {Error} throws error, if got more than 1 arguments
+	 */
+	constructor(options) {
+		if (arguments.length > 1) {
+			throw new Error(
+				"SourceMapDevToolPlugin only takes one argument (pass an options object)"
+			);
+		}
+
+		if (!options) options = {};
+
+		validateOptions(schema, options, "SourceMap DevTool Plugin");
+
+		/** @type {string | false} */
+		this.sourceMapFilename = options.filename;
+		/** @type {string | false} */
+		this.sourceMappingURLComment =
+			options.append === false
+				? false
+				: options.append || "\n//# sourceMappingURL=[url]";
+		/** @type {string | Function} */
+		this.moduleFilenameTemplate =
+			options.moduleFilenameTemplate || "webpack://[namespace]/[resourcePath]";
+		/** @type {string | Function} */
+		this.fallbackModuleFilenameTemplate =
+			options.fallbackModuleFilenameTemplate ||
+			"webpack://[namespace]/[resourcePath]?[hash]";
+		/** @type {string} */
+		this.namespace = options.namespace || "";
+		/** @type {SourceMapDevToolPluginOptions} */
+		this.options = options;
+	}
+
+	/**
+	 * Apply compiler
+	 * @param {Compiler} compiler compiler instance
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		const sourceMapFilename = this.sourceMapFilename;
+		const sourceMappingURLComment = this.sourceMappingURLComment;
+		const moduleFilenameTemplate = this.moduleFilenameTemplate;
+		const namespace = this.namespace;
+		const fallbackModuleFilenameTemplate = this.fallbackModuleFilenameTemplate;
+		const requestShortener = compiler.requestShortener;
+		const options = this.options;
+		options.test = options.test || /\.(m?js|css)($|\?)/i;
+
+		const matchObject = ModuleFilenameHelpers.matchObject.bind(
+			undefined,
+			options
+		);
+
+		compiler.hooks.compilation.tap("SourceMapDevToolPlugin", compilation => {
+			new SourceMapDevToolModuleOptionsPlugin(options).apply(compilation);
+
+			compilation.hooks.afterOptimizeChunkAssets.tap(
+				/** @type {TODO} */
+				({ name: "SourceMapDevToolPlugin", context: true }),
+				/**
+				 * @param {object} context hook context
+				 * @param {Array<Chunk>} chunks resulted chunks
+				 * @throws {Error} throws error, if `sourceMapFilename === false && sourceMappingURLComment === false`
+				 * @returns {void}
+				 */
+				(context, chunks) => {
+					/** @type {Map<string | Module, string>} */
+					const moduleToSourceNameMapping = new Map();
+					/**
+					 * @type {Function}
+					 * @returns {void}
+					 */
+					const reportProgress =
+						context && context.reportProgress
+							? context.reportProgress
+							: () => {};
+
+					const files = [];
+					for (const chunk of chunks) {
+						for (const file of chunk.files) {
+							if (matchObject(file)) {
+								files.push({
+									file,
+									chunk
+								});
+							}
+						}
+					}
+
+					reportProgress(0.0);
+					const tasks = [];
+					files.forEach(({ file, chunk }, idx) => {
+						const asset = compilation.getAsset(file).source;
+						const cache = assetsCache.get(asset);
+						/**
+						 * If presented in cache, reassigns assets. Cache assets already have source maps.
+						 */
+						if (cache && cache.file === file) {
+							for (const cachedFile in cache.assets) {
+								if (cachedFile === file) {
+									compilation.updateAsset(cachedFile, cache.assets[cachedFile]);
+								} else {
+									compilation.emitAsset(cachedFile, cache.assets[cachedFile], {
+										development: true
+									});
+								}
+								/**
+								 * Add file to chunk, if not presented there
+								 */
+								if (cachedFile !== file) chunk.files.push(cachedFile);
+							}
+							return;
+						}
+
+						reportProgress(
+							(0.5 * idx) / files.length,
+							file,
+							"generate SourceMap"
+						);
+						/** @type {SourceMapTask | undefined} */
+						const task = getTaskForFile(
+							file,
+							asset,
+							chunk,
+							options,
+							compilation
+						);
+
+						if (task) {
+							const modules = task.modules;
+
+							for (let idx = 0; idx < modules.length; idx++) {
+								const module = modules[idx];
+								if (!moduleToSourceNameMapping.get(module)) {
+									moduleToSourceNameMapping.set(
+										module,
+										ModuleFilenameHelpers.createFilename(
+											module,
+											{
+												moduleFilenameTemplate: moduleFilenameTemplate,
+												namespace: namespace
+											},
+											requestShortener
+										)
+									);
+								}
+							}
+
+							tasks.push(task);
+						}
+					});
+
+					reportProgress(0.5, "resolve sources");
+					/** @type {Set<string>} */
+					const usedNamesSet = new Set(moduleToSourceNameMapping.values());
+					/** @type {Set<string>} */
+					const conflictDetectionSet = new Set();
+
+					/**
+					 * all modules in defined order (longest identifier first)
+					 * @type {Array<string | Module>}
+					 */
+					const allModules = Array.from(moduleToSourceNameMapping.keys()).sort(
+						(a, b) => {
+							const ai = typeof a === "string" ? a : a.identifier();
+							const bi = typeof b === "string" ? b : b.identifier();
+							return ai.length - bi.length;
+						}
+					);
+
+					// find modules with conflicting source names
+					for (let idx = 0; idx < allModules.length; idx++) {
+						const module = allModules[idx];
+						let sourceName = moduleToSourceNameMapping.get(module);
+						let hasName = conflictDetectionSet.has(sourceName);
+						if (!hasName) {
+							conflictDetectionSet.add(sourceName);
+							continue;
+						}
+
+						// try the fallback name first
+						sourceName = ModuleFilenameHelpers.createFilename(
+							module,
+							{
+								moduleFilenameTemplate: fallbackModuleFilenameTemplate,
+								namespace: namespace
+							},
+							requestShortener
+						);
+						hasName = usedNamesSet.has(sourceName);
+						if (!hasName) {
+							moduleToSourceNameMapping.set(module, sourceName);
+							usedNamesSet.add(sourceName);
+							continue;
+						}
+
+						// elsewise just append stars until we have a valid name
+						while (hasName) {
+							sourceName += "*";
+							hasName = usedNamesSet.has(sourceName);
+						}
+						moduleToSourceNameMapping.set(module, sourceName);
+						usedNamesSet.add(sourceName);
+					}
+					tasks.forEach((task, index) => {
+						reportProgress(
+							0.5 + (0.5 * index) / tasks.length,
+							task.file,
+							"attach SourceMap"
+						);
+						const assets = Object.create(null);
+						const chunk = task.chunk;
+						const file = task.file;
+						const asset = task.asset;
+						const sourceMap = task.sourceMap;
+						const source = task.source;
+						const modules = task.modules;
+						const moduleFilenames = modules.map(m =>
+							moduleToSourceNameMapping.get(m)
+						);
+						sourceMap.sources = moduleFilenames;
+						if (options.noSources) {
+							sourceMap.sourcesContent = undefined;
+						}
+						sourceMap.sourceRoot = options.sourceRoot || "";
+						sourceMap.file = file;
+						assetsCache.set(asset, { file, assets });
+						/** @type {string | false} */
+						let currentSourceMappingURLComment = sourceMappingURLComment;
+						if (
+							currentSourceMappingURLComment !== false &&
+							/\.css($|\?)/i.test(file)
+						) {
+							currentSourceMappingURLComment = currentSourceMappingURLComment.replace(
+								/^\n\/\/(.*)$/,
+								"\n/*$1*/"
+							);
+						}
+						const sourceMapString = JSON.stringify(sourceMap);
+						if (sourceMapFilename) {
+							let filename = file;
+							let query = "";
+							const idx = filename.indexOf("?");
+							if (idx >= 0) {
+								query = filename.substr(idx);
+								filename = filename.substr(0, idx);
+							}
+							const pathParams = {
+								chunk,
+								filename: options.fileContext
+									? path.relative(options.fileContext, filename)
+									: filename,
+								query,
+								basename: basename(filename),
+								contentHash: createHash("md4")
+									.update(sourceMapString)
+									.digest("hex")
+							};
+							let sourceMapFile = compilation.getPath(
+								sourceMapFilename,
+								pathParams
+							);
+							const sourceMapUrl = options.publicPath
+								? options.publicPath + sourceMapFile.replace(/\\/g, "/")
+								: path
+										.relative(path.dirname(file), sourceMapFile)
+										.replace(/\\/g, "/");
+							/**
+							 * Add source map url to compilation asset, if {@link currentSourceMappingURLComment} presented
+							 */
+							if (currentSourceMappingURLComment !== false) {
+								const asset = new ConcatSource(
+									new RawSource(source),
+									compilation.getPath(
+										currentSourceMappingURLComment,
+										Object.assign({ url: sourceMapUrl }, pathParams)
+									)
+								);
+								assets[file] = asset;
+								compilation.updateAsset(file, asset);
+							}
+							/**
+							 * Add source map file to compilation assets and chunk files
+							 */
+							const asset = new RawSource(sourceMapString);
+							assets[sourceMapFile] = asset;
+							compilation.emitAsset(sourceMapFile, asset, {
+								development: true
+							});
+							chunk.files.push(sourceMapFile);
+						} else {
+							if (currentSourceMappingURLComment === false) {
+								throw new Error(
+									"SourceMapDevToolPlugin: append can't be false when no filename is provided"
+								);
+							}
+							/**
+							 * Add source map as data url to asset
+							 */
+							const asset = new ConcatSource(
+								new RawSource(source),
+								currentSourceMappingURLComment
+									.replace(/\[map\]/g, () => sourceMapString)
+									.replace(
+										/\[url\]/g,
+										() =>
+											`data:application/json;charset=utf-8;base64,${Buffer.from(
+												sourceMapString,
+												"utf-8"
+											).toString("base64")}`
+									)
+							);
+							assets[file] = asset;
+							compilation.updateAsset(file, asset);
+						}
+					});
+					reportProgress(1.0);
+				}
+			);
+		});
+	}
+}
+
+module.exports = SourceMapDevToolPlugin;
diff --git a/node_modules/webpack/lib/Stats.js b/node_modules/webpack/lib/Stats.js
new file mode 100644
index 0000000..6c5c338
--- /dev/null
+++ b/node_modules/webpack/lib/Stats.js
@@ -0,0 +1,1685 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const RequestShortener = require("./RequestShortener");
+const SizeFormatHelpers = require("./SizeFormatHelpers");
+const formatLocation = require("./formatLocation");
+const identifierUtils = require("./util/identifier");
+const compareLocations = require("./compareLocations");
+const { LogType } = require("./logging/Logger");
+
+const optionsOrFallback = (...args) => {
+	let optionValues = [];
+	optionValues.push(...args);
+	return optionValues.find(optionValue => optionValue !== undefined);
+};
+
+const compareId = (a, b) => {
+	if (typeof a !== typeof b) {
+		return typeof a < typeof b ? -1 : 1;
+	}
+	if (a < b) return -1;
+	if (a > b) return 1;
+	return 0;
+};
+
+class Stats {
+	constructor(compilation) {
+		this.compilation = compilation;
+		this.hash = compilation.hash;
+		this.startTime = undefined;
+		this.endTime = undefined;
+	}
+
+	static filterWarnings(warnings, warningsFilter) {
+		// we dont have anything to filter so all warnings can be shown
+		if (!warningsFilter) {
+			return warnings;
+		}
+
+		// create a chain of filters
+		// if they return "true" a warning should be suppressed
+		const normalizedWarningsFilters = [].concat(warningsFilter).map(filter => {
+			if (typeof filter === "string") {
+				return warning => warning.includes(filter);
+			}
+
+			if (filter instanceof RegExp) {
+				return warning => filter.test(warning);
+			}
+
+			if (typeof filter === "function") {
+				return filter;
+			}
+
+			throw new Error(
+				`Can only filter warnings with Strings or RegExps. (Given: ${filter})`
+			);
+		});
+		return warnings.filter(warning => {
+			return !normalizedWarningsFilters.some(check => check(warning));
+		});
+	}
+
+	formatFilePath(filePath) {
+		const OPTIONS_REGEXP = /^(\s|\S)*!/;
+		return filePath.includes("!")
+			? `${filePath.replace(OPTIONS_REGEXP, "")} (${filePath})`
+			: `${filePath}`;
+	}
+
+	hasWarnings() {
+		return (
+			this.compilation.warnings.length > 0 ||
+			this.compilation.children.some(child => child.getStats().hasWarnings())
+		);
+	}
+
+	hasErrors() {
+		return (
+			this.compilation.errors.length > 0 ||
+			this.compilation.children.some(child => child.getStats().hasErrors())
+		);
+	}
+
+	// remove a prefixed "!" that can be specified to reverse sort order
+	normalizeFieldKey(field) {
+		if (field[0] === "!") {
+			return field.substr(1);
+		}
+		return field;
+	}
+
+	// if a field is prefixed by a "!" reverse sort order
+	sortOrderRegular(field) {
+		if (field[0] === "!") {
+			return false;
+		}
+		return true;
+	}
+
+	toJson(options, forToString) {
+		if (typeof options === "boolean" || typeof options === "string") {
+			options = Stats.presetToOptions(options);
+		} else if (!options) {
+			options = {};
+		}
+
+		const optionOrLocalFallback = (v, def) =>
+			v !== undefined ? v : options.all !== undefined ? options.all : def;
+
+		const testAgainstGivenOption = item => {
+			if (typeof item === "string") {
+				const regExp = new RegExp(
+					`[\\\\/]${item.replace(
+						// eslint-disable-next-line no-useless-escape
+						/[-[\]{}()*+?.\\^$|]/g,
+						"\\$&"
+					)}([\\\\/]|$|!|\\?)`
+				);
+				return ident => regExp.test(ident);
+			}
+			if (item && typeof item === "object" && typeof item.test === "function") {
+				return ident => item.test(ident);
+			}
+			if (typeof item === "function") {
+				return item;
+			}
+			if (typeof item === "boolean") {
+				return () => item;
+			}
+		};
+
+		const compilation = this.compilation;
+		const context = optionsOrFallback(
+			options.context,
+			compilation.compiler.context
+		);
+		const requestShortener =
+			compilation.compiler.context === context
+				? compilation.requestShortener
+				: new RequestShortener(context);
+		const showPerformance = optionOrLocalFallback(options.performance, true);
+		const showHash = optionOrLocalFallback(options.hash, true);
+		const showEnv = optionOrLocalFallback(options.env, false);
+		const showVersion = optionOrLocalFallback(options.version, true);
+		const showTimings = optionOrLocalFallback(options.timings, true);
+		const showBuiltAt = optionOrLocalFallback(options.builtAt, true);
+		const showAssets = optionOrLocalFallback(options.assets, true);
+		const showEntrypoints = optionOrLocalFallback(options.entrypoints, true);
+		const showChunkGroups = optionOrLocalFallback(
+			options.chunkGroups,
+			!forToString
+		);
+		const showChunks = optionOrLocalFallback(options.chunks, !forToString);
+		const showChunkModules = optionOrLocalFallback(options.chunkModules, true);
+		const showChunkOrigins = optionOrLocalFallback(
+			options.chunkOrigins,
+			!forToString
+		);
+		const showModules = optionOrLocalFallback(options.modules, true);
+		const showNestedModules = optionOrLocalFallback(
+			options.nestedModules,
+			true
+		);
+		const showModuleAssets = optionOrLocalFallback(
+			options.moduleAssets,
+			!forToString
+		);
+		const showDepth = optionOrLocalFallback(options.depth, !forToString);
+		const showCachedModules = optionOrLocalFallback(options.cached, true);
+		const showCachedAssets = optionOrLocalFallback(options.cachedAssets, true);
+		const showReasons = optionOrLocalFallback(options.reasons, !forToString);
+		const showUsedExports = optionOrLocalFallback(
+			options.usedExports,
+			!forToString
+		);
+		const showProvidedExports = optionOrLocalFallback(
+			options.providedExports,
+			!forToString
+		);
+		const showOptimizationBailout = optionOrLocalFallback(
+			options.optimizationBailout,
+			!forToString
+		);
+		const showChildren = optionOrLocalFallback(options.children, true);
+		const showSource = optionOrLocalFallback(options.source, !forToString);
+		const showModuleTrace = optionOrLocalFallback(options.moduleTrace, true);
+		const showErrors = optionOrLocalFallback(options.errors, true);
+		const showErrorDetails = optionOrLocalFallback(
+			options.errorDetails,
+			!forToString
+		);
+		const showWarnings = optionOrLocalFallback(options.warnings, true);
+		const warningsFilter = optionsOrFallback(options.warningsFilter, null);
+		const showPublicPath = optionOrLocalFallback(
+			options.publicPath,
+			!forToString
+		);
+		const showLogging = optionOrLocalFallback(
+			options.logging,
+			forToString ? "info" : true
+		);
+		const showLoggingTrace = optionOrLocalFallback(
+			options.loggingTrace,
+			!forToString
+		);
+		const loggingDebug = []
+			.concat(optionsOrFallback(options.loggingDebug, []))
+			.map(testAgainstGivenOption);
+
+		const excludeModules = []
+			.concat(optionsOrFallback(options.excludeModules, options.exclude, []))
+			.map(testAgainstGivenOption);
+		const excludeAssets = []
+			.concat(optionsOrFallback(options.excludeAssets, []))
+			.map(testAgainstGivenOption);
+		const maxModules = optionsOrFallback(
+			options.maxModules,
+			forToString ? 15 : Infinity
+		);
+		const sortModules = optionsOrFallback(options.modulesSort, "id");
+		const sortChunks = optionsOrFallback(options.chunksSort, "id");
+		const sortAssets = optionsOrFallback(options.assetsSort, "");
+		const showOutputPath = optionOrLocalFallback(
+			options.outputPath,
+			!forToString
+		);
+
+		if (!showCachedModules) {
+			excludeModules.push((ident, module) => !module.built);
+		}
+
+		const createModuleFilter = () => {
+			let i = 0;
+			return module => {
+				if (excludeModules.length > 0) {
+					const ident = requestShortener.shorten(module.resource);
+					const excluded = excludeModules.some(fn => fn(ident, module));
+					if (excluded) return false;
+				}
+				const result = i < maxModules;
+				i++;
+				return result;
+			};
+		};
+
+		const createAssetFilter = () => {
+			return asset => {
+				if (excludeAssets.length > 0) {
+					const ident = asset.name;
+					const excluded = excludeAssets.some(fn => fn(ident, asset));
+					if (excluded) return false;
+				}
+				return showCachedAssets || asset.emitted;
+			};
+		};
+
+		const sortByFieldAndOrder = (fieldKey, a, b) => {
+			if (a[fieldKey] === null && b[fieldKey] === null) return 0;
+			if (a[fieldKey] === null) return 1;
+			if (b[fieldKey] === null) return -1;
+			if (a[fieldKey] === b[fieldKey]) return 0;
+			if (typeof a[fieldKey] !== typeof b[fieldKey])
+				return typeof a[fieldKey] < typeof b[fieldKey] ? -1 : 1;
+			return a[fieldKey] < b[fieldKey] ? -1 : 1;
+		};
+
+		const sortByField = (field, originalArray) => {
+			const originalMap = originalArray.reduce((map, v, i) => {
+				map.set(v, i);
+				return map;
+			}, new Map());
+			return (a, b) => {
+				if (field) {
+					const fieldKey = this.normalizeFieldKey(field);
+
+					// if a field is prefixed with a "!" the sort is reversed!
+					const sortIsRegular = this.sortOrderRegular(field);
+
+					const cmp = sortByFieldAndOrder(
+						fieldKey,
+						sortIsRegular ? a : b,
+						sortIsRegular ? b : a
+					);
+					if (cmp) return cmp;
+				}
+				return originalMap.get(a) - originalMap.get(b);
+			};
+		};
+
+		const formatError = e => {
+			let text = "";
+			if (typeof e === "string") {
+				e = { message: e };
+			}
+			if (e.chunk) {
+				text += `chunk ${e.chunk.name || e.chunk.id}${
+					e.chunk.hasRuntime()
+						? " [entry]"
+						: e.chunk.canBeInitial()
+						? " [initial]"
+						: ""
+				}\n`;
+			}
+			if (e.file) {
+				text += `${e.file}\n`;
+			}
+			if (
+				e.module &&
+				e.module.readableIdentifier &&
+				typeof e.module.readableIdentifier === "function"
+			) {
+				text += this.formatFilePath(
+					e.module.readableIdentifier(requestShortener)
+				);
+				if (typeof e.loc === "object") {
+					const locInfo = formatLocation(e.loc);
+					if (locInfo) text += ` ${locInfo}`;
+				}
+				text += "\n";
+			}
+			text += e.message;
+			if (showErrorDetails && e.details) {
+				text += `\n${e.details}`;
+			}
+			if (showErrorDetails && e.missing) {
+				text += e.missing.map(item => `\n[${item}]`).join("");
+			}
+			if (showModuleTrace && e.origin) {
+				text += `\n @ ${this.formatFilePath(
+					e.origin.readableIdentifier(requestShortener)
+				)}`;
+				if (typeof e.originLoc === "object") {
+					const locInfo = formatLocation(e.originLoc);
+					if (locInfo) text += ` ${locInfo}`;
+				}
+				if (e.dependencies) {
+					for (const dep of e.dependencies) {
+						if (!dep.loc) continue;
+						if (typeof dep.loc === "string") continue;
+						const locInfo = formatLocation(dep.loc);
+						if (!locInfo) continue;
+						text += ` ${locInfo}`;
+					}
+				}
+				let current = e.origin;
+				while (current.issuer) {
+					current = current.issuer;
+					text += `\n @ ${current.readableIdentifier(requestShortener)}`;
+				}
+			}
+			return text;
+		};
+
+		const obj = {
+			errors: compilation.errors.map(formatError),
+			warnings: Stats.filterWarnings(
+				compilation.warnings.map(formatError),
+				warningsFilter
+			)
+		};
+
+		//We just hint other renderers since actually omitting
+		//errors/warnings from the JSON would be kind of weird.
+		Object.defineProperty(obj, "_showWarnings", {
+			value: showWarnings,
+			enumerable: false
+		});
+		Object.defineProperty(obj, "_showErrors", {
+			value: showErrors,
+			enumerable: false
+		});
+
+		if (showVersion) {
+			obj.version = require("../package.json").version;
+		}
+
+		if (showHash) obj.hash = this.hash;
+		if (showTimings && this.startTime && this.endTime) {
+			obj.time = this.endTime - this.startTime;
+		}
+
+		if (showBuiltAt && this.endTime) {
+			obj.builtAt = this.endTime;
+		}
+
+		if (showEnv && options._env) {
+			obj.env = options._env;
+		}
+
+		if (compilation.needAdditionalPass) {
+			obj.needAdditionalPass = true;
+		}
+		if (showPublicPath) {
+			obj.publicPath = this.compilation.mainTemplate.getPublicPath({
+				hash: this.compilation.hash
+			});
+		}
+		if (showOutputPath) {
+			obj.outputPath = this.compilation.mainTemplate.outputOptions.path;
+		}
+		if (showAssets) {
+			const assetsByFile = {};
+			const compilationAssets = compilation
+				.getAssets()
+				.sort((a, b) => (a.name < b.name ? -1 : 1));
+			obj.assetsByChunkName = {};
+			obj.assets = compilationAssets
+				.map(({ name, source, info }) => {
+					const obj = {
+						name,
+						size: source.size(),
+						chunks: [],
+						chunkNames: [],
+						info,
+						// TODO webpack 5: remove .emitted
+						emitted: source.emitted || compilation.emittedAssets.has(name)
+					};
+
+					if (showPerformance) {
+						obj.isOverSizeLimit = source.isOverSizeLimit;
+					}
+
+					assetsByFile[name] = obj;
+					return obj;
+				})
+				.filter(createAssetFilter());
+			obj.filteredAssets = compilationAssets.length - obj.assets.length;
+
+			for (const chunk of compilation.chunks) {
+				for (const asset of chunk.files) {
+					if (assetsByFile[asset]) {
+						for (const id of chunk.ids) {
+							assetsByFile[asset].chunks.push(id);
+						}
+						if (chunk.name) {
+							assetsByFile[asset].chunkNames.push(chunk.name);
+							if (obj.assetsByChunkName[chunk.name]) {
+								obj.assetsByChunkName[chunk.name] = []
+									.concat(obj.assetsByChunkName[chunk.name])
+									.concat([asset]);
+							} else {
+								obj.assetsByChunkName[chunk.name] = asset;
+							}
+						}
+					}
+				}
+			}
+			obj.assets.sort(sortByField(sortAssets, obj.assets));
+		}
+
+		const fnChunkGroup = groupMap => {
+			const obj = {};
+			for (const keyValuePair of groupMap) {
+				const name = keyValuePair[0];
+				const cg = keyValuePair[1];
+				const children = cg.getChildrenByOrders();
+				obj[name] = {
+					chunks: cg.chunks.map(c => c.id),
+					assets: cg.chunks.reduce(
+						(array, c) => array.concat(c.files || []),
+						[]
+					),
+					children: Object.keys(children).reduce((obj, key) => {
+						const groups = children[key];
+						obj[key] = groups.map(group => ({
+							name: group.name,
+							chunks: group.chunks.map(c => c.id),
+							assets: group.chunks.reduce(
+								(array, c) => array.concat(c.files || []),
+								[]
+							)
+						}));
+						return obj;
+					}, Object.create(null)),
+					childAssets: Object.keys(children).reduce((obj, key) => {
+						const groups = children[key];
+						obj[key] = Array.from(
+							groups.reduce((set, group) => {
+								for (const chunk of group.chunks) {
+									for (const asset of chunk.files) {
+										set.add(asset);
+									}
+								}
+								return set;
+							}, new Set())
+						);
+						return obj;
+					}, Object.create(null))
+				};
+				if (showPerformance) {
+					obj[name].isOverSizeLimit = cg.isOverSizeLimit;
+				}
+			}
+
+			return obj;
+		};
+
+		if (showEntrypoints) {
+			obj.entrypoints = fnChunkGroup(compilation.entrypoints);
+		}
+
+		if (showChunkGroups) {
+			obj.namedChunkGroups = fnChunkGroup(compilation.namedChunkGroups);
+		}
+
+		const fnModule = module => {
+			const path = [];
+			let current = module;
+			while (current.issuer) {
+				path.push((current = current.issuer));
+			}
+			path.reverse();
+			const obj = {
+				id: module.id,
+				identifier: module.identifier(),
+				name: module.readableIdentifier(requestShortener),
+				index: module.index,
+				index2: module.index2,
+				size: module.size(),
+				cacheable: module.buildInfo.cacheable,
+				built: !!module.built,
+				optional: module.optional,
+				prefetched: module.prefetched,
+				chunks: Array.from(module.chunksIterable, chunk => chunk.id),
+				issuer: module.issuer && module.issuer.identifier(),
+				issuerId: module.issuer && module.issuer.id,
+				issuerName:
+					module.issuer && module.issuer.readableIdentifier(requestShortener),
+				issuerPath:
+					module.issuer &&
+					path.map(module => ({
+						id: module.id,
+						identifier: module.identifier(),
+						name: module.readableIdentifier(requestShortener),
+						profile: module.profile
+					})),
+				profile: module.profile,
+				failed: !!module.error,
+				errors: module.errors ? module.errors.length : 0,
+				warnings: module.warnings ? module.warnings.length : 0
+			};
+			if (showModuleAssets) {
+				obj.assets = Object.keys(module.buildInfo.assets || {});
+			}
+			if (showReasons) {
+				obj.reasons = module.reasons
+					.sort((a, b) => {
+						if (a.module && !b.module) return -1;
+						if (!a.module && b.module) return 1;
+						if (a.module && b.module) {
+							const cmp = compareId(a.module.id, b.module.id);
+							if (cmp) return cmp;
+						}
+						if (a.dependency && !b.dependency) return -1;
+						if (!a.dependency && b.dependency) return 1;
+						if (a.dependency && b.dependency) {
+							const cmp = compareLocations(a.dependency.loc, b.dependency.loc);
+							if (cmp) return cmp;
+							if (a.dependency.type < b.dependency.type) return -1;
+							if (a.dependency.type > b.dependency.type) return 1;
+						}
+						return 0;
+					})
+					.map(reason => {
+						const obj = {
+							moduleId: reason.module ? reason.module.id : null,
+							moduleIdentifier: reason.module
+								? reason.module.identifier()
+								: null,
+							module: reason.module
+								? reason.module.readableIdentifier(requestShortener)
+								: null,
+							moduleName: reason.module
+								? reason.module.readableIdentifier(requestShortener)
+								: null,
+							type: reason.dependency ? reason.dependency.type : null,
+							explanation: reason.explanation,
+							userRequest: reason.dependency
+								? reason.dependency.userRequest
+								: null
+						};
+						if (reason.dependency) {
+							const locInfo = formatLocation(reason.dependency.loc);
+							if (locInfo) {
+								obj.loc = locInfo;
+							}
+						}
+						return obj;
+					});
+			}
+			if (showUsedExports) {
+				if (module.used === true) {
+					obj.usedExports = module.usedExports;
+				} else if (module.used === false) {
+					obj.usedExports = false;
+				}
+			}
+			if (showProvidedExports) {
+				obj.providedExports = Array.isArray(module.buildMeta.providedExports)
+					? module.buildMeta.providedExports
+					: null;
+			}
+			if (showOptimizationBailout) {
+				obj.optimizationBailout = module.optimizationBailout.map(item => {
+					if (typeof item === "function") return item(requestShortener);
+					return item;
+				});
+			}
+			if (showDepth) {
+				obj.depth = module.depth;
+			}
+			if (showNestedModules) {
+				if (module.modules) {
+					const modules = module.modules;
+					obj.modules = modules
+						.sort(sortByField("depth", modules))
+						.filter(createModuleFilter())
+						.map(fnModule);
+					obj.filteredModules = modules.length - obj.modules.length;
+					obj.modules.sort(sortByField(sortModules, obj.modules));
+				}
+			}
+			if (showSource && module._source) {
+				obj.source = module._source.source();
+			}
+			return obj;
+		};
+		if (showChunks) {
+			obj.chunks = compilation.chunks.map(chunk => {
+				const parents = new Set();
+				const children = new Set();
+				const siblings = new Set();
+				const childIdByOrder = chunk.getChildIdsByOrders();
+				for (const chunkGroup of chunk.groupsIterable) {
+					for (const parentGroup of chunkGroup.parentsIterable) {
+						for (const chunk of parentGroup.chunks) {
+							parents.add(chunk.id);
+						}
+					}
+					for (const childGroup of chunkGroup.childrenIterable) {
+						for (const chunk of childGroup.chunks) {
+							children.add(chunk.id);
+						}
+					}
+					for (const sibling of chunkGroup.chunks) {
+						if (sibling !== chunk) siblings.add(sibling.id);
+					}
+				}
+				const obj = {
+					id: chunk.id,
+					rendered: chunk.rendered,
+					initial: chunk.canBeInitial(),
+					entry: chunk.hasRuntime(),
+					recorded: chunk.recorded,
+					reason: chunk.chunkReason,
+					size: chunk.modulesSize(),
+					names: chunk.name ? [chunk.name] : [],
+					files: chunk.files.slice(),
+					hash: chunk.renderedHash,
+					siblings: Array.from(siblings).sort(compareId),
+					parents: Array.from(parents).sort(compareId),
+					children: Array.from(children).sort(compareId),
+					childrenByOrder: childIdByOrder
+				};
+				if (showChunkModules) {
+					const modules = chunk.getModules();
+					obj.modules = modules
+						.slice()
+						.sort(sortByField("depth", modules))
+						.filter(createModuleFilter())
+						.map(fnModule);
+					obj.filteredModules = chunk.getNumberOfModules() - obj.modules.length;
+					obj.modules.sort(sortByField(sortModules, obj.modules));
+				}
+				if (showChunkOrigins) {
+					obj.origins = Array.from(chunk.groupsIterable, g => g.origins)
+						.reduce((a, b) => a.concat(b), [])
+						.map(origin => ({
+							moduleId: origin.module ? origin.module.id : undefined,
+							module: origin.module ? origin.module.identifier() : "",
+							moduleIdentifier: origin.module ? origin.module.identifier() : "",
+							moduleName: origin.module
+								? origin.module.readableIdentifier(requestShortener)
+								: "",
+							loc: formatLocation(origin.loc),
+							request: origin.request,
+							reasons: origin.reasons || []
+						}))
+						.sort((a, b) => {
+							const cmp1 = compareId(a.moduleId, b.moduleId);
+							if (cmp1) return cmp1;
+							const cmp2 = compareId(a.loc, b.loc);
+							if (cmp2) return cmp2;
+							const cmp3 = compareId(a.request, b.request);
+							if (cmp3) return cmp3;
+							return 0;
+						});
+				}
+				return obj;
+			});
+			obj.chunks.sort(sortByField(sortChunks, obj.chunks));
+		}
+		if (showModules) {
+			obj.modules = compilation.modules
+				.slice()
+				.sort(sortByField("depth", compilation.modules))
+				.filter(createModuleFilter())
+				.map(fnModule);
+			obj.filteredModules = compilation.modules.length - obj.modules.length;
+			obj.modules.sort(sortByField(sortModules, obj.modules));
+		}
+		if (showLogging) {
+			const util = require("util");
+			obj.logging = {};
+			let acceptedTypes;
+			let collapsedGroups = false;
+			switch (showLogging) {
+				case "none":
+					acceptedTypes = new Set([]);
+					break;
+				case "error":
+					acceptedTypes = new Set([LogType.error]);
+					break;
+				case "warn":
+					acceptedTypes = new Set([LogType.error, LogType.warn]);
+					break;
+				case "info":
+					acceptedTypes = new Set([LogType.error, LogType.warn, LogType.info]);
+					break;
+				case true:
+				case "log":
+					acceptedTypes = new Set([
+						LogType.error,
+						LogType.warn,
+						LogType.info,
+						LogType.log,
+						LogType.group,
+						LogType.groupEnd,
+						LogType.groupCollapsed,
+						LogType.clear
+					]);
+					break;
+				case "verbose":
+					acceptedTypes = new Set([
+						LogType.error,
+						LogType.warn,
+						LogType.info,
+						LogType.log,
+						LogType.group,
+						LogType.groupEnd,
+						LogType.groupCollapsed,
+						LogType.profile,
+						LogType.profileEnd,
+						LogType.time,
+						LogType.status,
+						LogType.clear
+					]);
+					collapsedGroups = true;
+					break;
+			}
+			for (const [origin, logEntries] of compilation.logging) {
+				const debugMode = loggingDebug.some(fn => fn(origin));
+				let collapseCounter = 0;
+				let processedLogEntries = logEntries;
+				if (!debugMode) {
+					processedLogEntries = processedLogEntries.filter(entry => {
+						if (!acceptedTypes.has(entry.type)) return false;
+						if (!collapsedGroups) {
+							switch (entry.type) {
+								case LogType.groupCollapsed:
+									collapseCounter++;
+									return collapseCounter === 1;
+								case LogType.group:
+									if (collapseCounter > 0) collapseCounter++;
+									return collapseCounter === 0;
+								case LogType.groupEnd:
+									if (collapseCounter > 0) {
+										collapseCounter--;
+										return false;
+									}
+									return true;
+								default:
+									return collapseCounter === 0;
+							}
+						}
+						return true;
+					});
+				}
+				processedLogEntries = processedLogEntries.map(entry => {
+					let message = undefined;
+					if (entry.type === LogType.time) {
+						message = `${entry.args[0]}: ${entry.args[1] * 1000 +
+							entry.args[2] / 1000000}ms`;
+					} else if (entry.args && entry.args.length > 0) {
+						message = util.format(entry.args[0], ...entry.args.slice(1));
+					}
+					return {
+						type:
+							(debugMode || collapsedGroups) &&
+							entry.type === LogType.groupCollapsed
+								? LogType.group
+								: entry.type,
+						message,
+						trace: showLoggingTrace && entry.trace ? entry.trace : undefined
+					};
+				});
+				let name = identifierUtils
+					.makePathsRelative(context, origin, compilation.cache)
+					.replace(/\|/g, " ");
+				if (name in obj.logging) {
+					let i = 1;
+					while (`${name}#${i}` in obj.logging) {
+						i++;
+					}
+					name = `${name}#${i}`;
+				}
+				obj.logging[name] = {
+					entries: processedLogEntries,
+					filteredEntries: logEntries.length - processedLogEntries.length,
+					debug: debugMode
+				};
+			}
+		}
+		if (showChildren) {
+			obj.children = compilation.children.map((child, idx) => {
+				const childOptions = Stats.getChildOptions(options, idx);
+				const obj = new Stats(child).toJson(childOptions, forToString);
+				delete obj.hash;
+				delete obj.version;
+				if (child.name) {
+					obj.name = identifierUtils.makePathsRelative(
+						context,
+						child.name,
+						compilation.cache
+					);
+				}
+				return obj;
+			});
+		}
+
+		return obj;
+	}
+
+	toString(options) {
+		if (typeof options === "boolean" || typeof options === "string") {
+			options = Stats.presetToOptions(options);
+		} else if (!options) {
+			options = {};
+		}
+
+		const useColors = optionsOrFallback(options.colors, false);
+
+		const obj = this.toJson(options, true);
+
+		return Stats.jsonToString(obj, useColors);
+	}
+
+	static jsonToString(obj, useColors) {
+		const buf = [];
+
+		const defaultColors = {
+			bold: "\u001b[1m",
+			yellow: "\u001b[1m\u001b[33m",
+			red: "\u001b[1m\u001b[31m",
+			green: "\u001b[1m\u001b[32m",
+			cyan: "\u001b[1m\u001b[36m",
+			magenta: "\u001b[1m\u001b[35m"
+		};
+
+		const colors = Object.keys(defaultColors).reduce(
+			(obj, color) => {
+				obj[color] = str => {
+					if (useColors) {
+						buf.push(
+							useColors === true || useColors[color] === undefined
+								? defaultColors[color]
+								: useColors[color]
+						);
+					}
+					buf.push(str);
+					if (useColors) {
+						buf.push("\u001b[39m\u001b[22m");
+					}
+				};
+				return obj;
+			},
+			{
+				normal: str => buf.push(str)
+			}
+		);
+
+		const coloredTime = time => {
+			let times = [800, 400, 200, 100];
+			if (obj.time) {
+				times = [obj.time / 2, obj.time / 4, obj.time / 8, obj.time / 16];
+			}
+			if (time < times[3]) colors.normal(`${time}ms`);
+			else if (time < times[2]) colors.bold(`${time}ms`);
+			else if (time < times[1]) colors.green(`${time}ms`);
+			else if (time < times[0]) colors.yellow(`${time}ms`);
+			else colors.red(`${time}ms`);
+		};
+
+		const newline = () => buf.push("\n");
+
+		const getText = (arr, row, col) => {
+			return arr[row][col].value;
+		};
+
+		const table = (array, align, splitter) => {
+			const rows = array.length;
+			const cols = array[0].length;
+			const colSizes = new Array(cols);
+			for (let col = 0; col < cols; col++) {
+				colSizes[col] = 0;
+			}
+			for (let row = 0; row < rows; row++) {
+				for (let col = 0; col < cols; col++) {
+					const value = `${getText(array, row, col)}`;
+					if (value.length > colSizes[col]) {
+						colSizes[col] = value.length;
+					}
+				}
+			}
+			for (let row = 0; row < rows; row++) {
+				for (let col = 0; col < cols; col++) {
+					const format = array[row][col].color;
+					const value = `${getText(array, row, col)}`;
+					let l = value.length;
+					if (align[col] === "l") {
+						format(value);
+					}
+					for (; l < colSizes[col] && col !== cols - 1; l++) {
+						colors.normal(" ");
+					}
+					if (align[col] === "r") {
+						format(value);
+					}
+					if (col + 1 < cols && colSizes[col] !== 0) {
+						colors.normal(splitter || "  ");
+					}
+				}
+				newline();
+			}
+		};
+
+		const getAssetColor = (asset, defaultColor) => {
+			if (asset.isOverSizeLimit) {
+				return colors.yellow;
+			}
+
+			return defaultColor;
+		};
+
+		if (obj.hash) {
+			colors.normal("Hash: ");
+			colors.bold(obj.hash);
+			newline();
+		}
+		if (obj.version) {
+			colors.normal("Version: webpack ");
+			colors.bold(obj.version);
+			newline();
+		}
+		if (typeof obj.time === "number") {
+			colors.normal("Time: ");
+			colors.bold(obj.time);
+			colors.normal("ms");
+			newline();
+		}
+		if (typeof obj.builtAt === "number") {
+			const builtAtDate = new Date(obj.builtAt);
+			let timeZone = undefined;
+
+			try {
+				builtAtDate.toLocaleTimeString();
+			} catch (err) {
+				// Force UTC if runtime timezone is unsupported
+				timeZone = "UTC";
+			}
+
+			colors.normal("Built at: ");
+			colors.normal(
+				builtAtDate.toLocaleDateString(undefined, {
+					day: "2-digit",
+					month: "2-digit",
+					year: "numeric",
+					timeZone
+				})
+			);
+			colors.normal(" ");
+			colors.bold(builtAtDate.toLocaleTimeString(undefined, { timeZone }));
+			newline();
+		}
+		if (obj.env) {
+			colors.normal("Environment (--env): ");
+			colors.bold(JSON.stringify(obj.env, null, 2));
+			newline();
+		}
+		if (obj.publicPath) {
+			colors.normal("PublicPath: ");
+			colors.bold(obj.publicPath);
+			newline();
+		}
+
+		if (obj.assets && obj.assets.length > 0) {
+			const t = [
+				[
+					{
+						value: "Asset",
+						color: colors.bold
+					},
+					{
+						value: "Size",
+						color: colors.bold
+					},
+					{
+						value: "Chunks",
+						color: colors.bold
+					},
+					{
+						value: "",
+						color: colors.bold
+					},
+					{
+						value: "",
+						color: colors.bold
+					},
+					{
+						value: "Chunk Names",
+						color: colors.bold
+					}
+				]
+			];
+			for (const asset of obj.assets) {
+				t.push([
+					{
+						value: asset.name,
+						color: getAssetColor(asset, colors.green)
+					},
+					{
+						value: SizeFormatHelpers.formatSize(asset.size),
+						color: getAssetColor(asset, colors.normal)
+					},
+					{
+						value: asset.chunks.join(", "),
+						color: colors.bold
+					},
+					{
+						value: [
+							asset.emitted && "[emitted]",
+							asset.info.immutable && "[immutable]",
+							asset.info.development && "[dev]",
+							asset.info.hotModuleReplacement && "[hmr]"
+						]
+							.filter(Boolean)
+							.join(" "),
+						color: colors.green
+					},
+					{
+						value: asset.isOverSizeLimit ? "[big]" : "",
+						color: getAssetColor(asset, colors.normal)
+					},
+					{
+						value: asset.chunkNames.join(", "),
+						color: colors.normal
+					}
+				]);
+			}
+			table(t, "rrrlll");
+		}
+		if (obj.filteredAssets > 0) {
+			colors.normal(" ");
+			if (obj.assets.length > 0) colors.normal("+ ");
+			colors.normal(obj.filteredAssets);
+			if (obj.assets.length > 0) colors.normal(" hidden");
+			colors.normal(obj.filteredAssets !== 1 ? " assets" : " asset");
+			newline();
+		}
+
+		const processChunkGroups = (namedGroups, prefix) => {
+			for (const name of Object.keys(namedGroups)) {
+				const cg = namedGroups[name];
+				colors.normal(`${prefix} `);
+				colors.bold(name);
+				if (cg.isOverSizeLimit) {
+					colors.normal(" ");
+					colors.yellow("[big]");
+				}
+				colors.normal(" =");
+				for (const asset of cg.assets) {
+					colors.normal(" ");
+					colors.green(asset);
+				}
+				for (const name of Object.keys(cg.childAssets)) {
+					const assets = cg.childAssets[name];
+					if (assets && assets.length > 0) {
+						colors.normal(" ");
+						colors.magenta(`(${name}:`);
+						for (const asset of assets) {
+							colors.normal(" ");
+							colors.green(asset);
+						}
+						colors.magenta(")");
+					}
+				}
+				newline();
+			}
+		};
+
+		if (obj.entrypoints) {
+			processChunkGroups(obj.entrypoints, "Entrypoint");
+		}
+
+		if (obj.namedChunkGroups) {
+			let outputChunkGroups = obj.namedChunkGroups;
+			if (obj.entrypoints) {
+				outputChunkGroups = Object.keys(outputChunkGroups)
+					.filter(name => !obj.entrypoints[name])
+					.reduce((result, name) => {
+						result[name] = obj.namedChunkGroups[name];
+						return result;
+					}, {});
+			}
+			processChunkGroups(outputChunkGroups, "Chunk Group");
+		}
+
+		const modulesByIdentifier = {};
+		if (obj.modules) {
+			for (const module of obj.modules) {
+				modulesByIdentifier[`$${module.identifier}`] = module;
+			}
+		} else if (obj.chunks) {
+			for (const chunk of obj.chunks) {
+				if (chunk.modules) {
+					for (const module of chunk.modules) {
+						modulesByIdentifier[`$${module.identifier}`] = module;
+					}
+				}
+			}
+		}
+
+		const processModuleAttributes = module => {
+			colors.normal(" ");
+			colors.normal(SizeFormatHelpers.formatSize(module.size));
+			if (module.chunks) {
+				for (const chunk of module.chunks) {
+					colors.normal(" {");
+					colors.yellow(chunk);
+					colors.normal("}");
+				}
+			}
+			if (typeof module.depth === "number") {
+				colors.normal(` [depth ${module.depth}]`);
+			}
+			if (module.cacheable === false) {
+				colors.red(" [not cacheable]");
+			}
+			if (module.optional) {
+				colors.yellow(" [optional]");
+			}
+			if (module.built) {
+				colors.green(" [built]");
+			}
+			if (module.assets && module.assets.length) {
+				colors.magenta(
+					` [${module.assets.length} asset${
+						module.assets.length === 1 ? "" : "s"
+					}]`
+				);
+			}
+			if (module.prefetched) {
+				colors.magenta(" [prefetched]");
+			}
+			if (module.failed) colors.red(" [failed]");
+			if (module.warnings) {
+				colors.yellow(
+					` [${module.warnings} warning${module.warnings === 1 ? "" : "s"}]`
+				);
+			}
+			if (module.errors) {
+				colors.red(
+					` [${module.errors} error${module.errors === 1 ? "" : "s"}]`
+				);
+			}
+		};
+
+		const processModuleContent = (module, prefix) => {
+			if (Array.isArray(module.providedExports)) {
+				colors.normal(prefix);
+				if (module.providedExports.length === 0) {
+					colors.cyan("[no exports]");
+				} else {
+					colors.cyan(`[exports: ${module.providedExports.join(", ")}]`);
+				}
+				newline();
+			}
+			if (module.usedExports !== undefined) {
+				if (module.usedExports !== true) {
+					colors.normal(prefix);
+					if (module.usedExports === null) {
+						colors.cyan("[used exports unknown]");
+					} else if (module.usedExports === false) {
+						colors.cyan("[no exports used]");
+					} else if (
+						Array.isArray(module.usedExports) &&
+						module.usedExports.length === 0
+					) {
+						colors.cyan("[no exports used]");
+					} else if (Array.isArray(module.usedExports)) {
+						const providedExportsCount = Array.isArray(module.providedExports)
+							? module.providedExports.length
+							: null;
+						if (
+							providedExportsCount !== null &&
+							providedExportsCount === module.usedExports.length
+						) {
+							colors.cyan("[all exports used]");
+						} else {
+							colors.cyan(
+								`[only some exports used: ${module.usedExports.join(", ")}]`
+							);
+						}
+					}
+					newline();
+				}
+			}
+			if (Array.isArray(module.optimizationBailout)) {
+				for (const item of module.optimizationBailout) {
+					colors.normal(prefix);
+					colors.yellow(item);
+					newline();
+				}
+			}
+			if (module.reasons) {
+				for (const reason of module.reasons) {
+					colors.normal(prefix);
+					if (reason.type) {
+						colors.normal(reason.type);
+						colors.normal(" ");
+					}
+					if (reason.userRequest) {
+						colors.cyan(reason.userRequest);
+						colors.normal(" ");
+					}
+					if (reason.moduleId !== null) {
+						colors.normal("[");
+						colors.normal(reason.moduleId);
+						colors.normal("]");
+					}
+					if (reason.module && reason.module !== reason.moduleId) {
+						colors.normal(" ");
+						colors.magenta(reason.module);
+					}
+					if (reason.loc) {
+						colors.normal(" ");
+						colors.normal(reason.loc);
+					}
+					if (reason.explanation) {
+						colors.normal(" ");
+						colors.cyan(reason.explanation);
+					}
+					newline();
+				}
+			}
+			if (module.profile) {
+				colors.normal(prefix);
+				let sum = 0;
+				if (module.issuerPath) {
+					for (const m of module.issuerPath) {
+						colors.normal("[");
+						colors.normal(m.id);
+						colors.normal("] ");
+						if (m.profile) {
+							const time = (m.profile.factory || 0) + (m.profile.building || 0);
+							coloredTime(time);
+							sum += time;
+							colors.normal(" ");
+						}
+						colors.normal("-> ");
+					}
+				}
+				for (const key of Object.keys(module.profile)) {
+					colors.normal(`${key}:`);
+					const time = module.profile[key];
+					coloredTime(time);
+					colors.normal(" ");
+					sum += time;
+				}
+				colors.normal("= ");
+				coloredTime(sum);
+				newline();
+			}
+			if (module.modules) {
+				processModulesList(module, prefix + "| ");
+			}
+		};
+
+		const processModulesList = (obj, prefix) => {
+			if (obj.modules) {
+				let maxModuleId = 0;
+				for (const module of obj.modules) {
+					if (typeof module.id === "number") {
+						if (maxModuleId < module.id) maxModuleId = module.id;
+					}
+				}
+				let contentPrefix = prefix + "    ";
+				if (maxModuleId >= 10) contentPrefix += " ";
+				if (maxModuleId >= 100) contentPrefix += " ";
+				if (maxModuleId >= 1000) contentPrefix += " ";
+				for (const module of obj.modules) {
+					colors.normal(prefix);
+					const name = module.name || module.identifier;
+					if (typeof module.id === "string" || typeof module.id === "number") {
+						if (typeof module.id === "number") {
+							if (module.id < 1000 && maxModuleId >= 1000) colors.normal(" ");
+							if (module.id < 100 && maxModuleId >= 100) colors.normal(" ");
+							if (module.id < 10 && maxModuleId >= 10) colors.normal(" ");
+						} else {
+							if (maxModuleId >= 1000) colors.normal(" ");
+							if (maxModuleId >= 100) colors.normal(" ");
+							if (maxModuleId >= 10) colors.normal(" ");
+						}
+						if (name !== module.id) {
+							colors.normal("[");
+							colors.normal(module.id);
+							colors.normal("]");
+							colors.normal(" ");
+						} else {
+							colors.normal("[");
+							colors.bold(module.id);
+							colors.normal("]");
+						}
+					}
+					if (name !== module.id) {
+						colors.bold(name);
+					}
+					processModuleAttributes(module);
+					newline();
+					processModuleContent(module, contentPrefix);
+				}
+				if (obj.filteredModules > 0) {
+					colors.normal(prefix);
+					colors.normal("   ");
+					if (obj.modules.length > 0) colors.normal(" + ");
+					colors.normal(obj.filteredModules);
+					if (obj.modules.length > 0) colors.normal(" hidden");
+					colors.normal(obj.filteredModules !== 1 ? " modules" : " module");
+					newline();
+				}
+			}
+		};
+
+		if (obj.chunks) {
+			for (const chunk of obj.chunks) {
+				colors.normal("chunk ");
+				if (chunk.id < 1000) colors.normal(" ");
+				if (chunk.id < 100) colors.normal(" ");
+				if (chunk.id < 10) colors.normal(" ");
+				colors.normal("{");
+				colors.yellow(chunk.id);
+				colors.normal("} ");
+				colors.green(chunk.files.join(", "));
+				if (chunk.names && chunk.names.length > 0) {
+					colors.normal(" (");
+					colors.normal(chunk.names.join(", "));
+					colors.normal(")");
+				}
+				colors.normal(" ");
+				colors.normal(SizeFormatHelpers.formatSize(chunk.size));
+				for (const id of chunk.parents) {
+					colors.normal(" <{");
+					colors.yellow(id);
+					colors.normal("}>");
+				}
+				for (const id of chunk.siblings) {
+					colors.normal(" ={");
+					colors.yellow(id);
+					colors.normal("}=");
+				}
+				for (const id of chunk.children) {
+					colors.normal(" >{");
+					colors.yellow(id);
+					colors.normal("}<");
+				}
+				if (chunk.childrenByOrder) {
+					for (const name of Object.keys(chunk.childrenByOrder)) {
+						const children = chunk.childrenByOrder[name];
+						colors.normal(" ");
+						colors.magenta(`(${name}:`);
+						for (const id of children) {
+							colors.normal(" {");
+							colors.yellow(id);
+							colors.normal("}");
+						}
+						colors.magenta(")");
+					}
+				}
+				if (chunk.entry) {
+					colors.yellow(" [entry]");
+				} else if (chunk.initial) {
+					colors.yellow(" [initial]");
+				}
+				if (chunk.rendered) {
+					colors.green(" [rendered]");
+				}
+				if (chunk.recorded) {
+					colors.green(" [recorded]");
+				}
+				if (chunk.reason) {
+					colors.yellow(` ${chunk.reason}`);
+				}
+				newline();
+				if (chunk.origins) {
+					for (const origin of chunk.origins) {
+						colors.normal("    > ");
+						if (origin.reasons && origin.reasons.length) {
+							colors.yellow(origin.reasons.join(" "));
+							colors.normal(" ");
+						}
+						if (origin.request) {
+							colors.normal(origin.request);
+							colors.normal(" ");
+						}
+						if (origin.module) {
+							colors.normal("[");
+							colors.normal(origin.moduleId);
+							colors.normal("] ");
+							const module = modulesByIdentifier[`$${origin.module}`];
+							if (module) {
+								colors.bold(module.name);
+								colors.normal(" ");
+							}
+						}
+						if (origin.loc) {
+							colors.normal(origin.loc);
+						}
+						newline();
+					}
+				}
+				processModulesList(chunk, " ");
+			}
+		}
+
+		processModulesList(obj, "");
+
+		if (obj.logging) {
+			for (const origin of Object.keys(obj.logging)) {
+				const logData = obj.logging[origin];
+				if (logData.entries.length > 0) {
+					newline();
+					if (logData.debug) {
+						colors.red("DEBUG ");
+					}
+					colors.bold("LOG from " + origin);
+					newline();
+					let indent = "";
+					for (const entry of logData.entries) {
+						let color = colors.normal;
+						let prefix = "    ";
+						switch (entry.type) {
+							case LogType.clear:
+								colors.normal(`${indent}-------`);
+								newline();
+								continue;
+							case LogType.error:
+								color = colors.red;
+								prefix = "<e> ";
+								break;
+							case LogType.warn:
+								color = colors.yellow;
+								prefix = "<w> ";
+								break;
+							case LogType.info:
+								color = colors.green;
+								prefix = "<i> ";
+								break;
+							case LogType.log:
+								color = colors.bold;
+								break;
+							case LogType.trace:
+							case LogType.debug:
+								color = colors.normal;
+								break;
+							case LogType.status:
+								color = colors.magenta;
+								prefix = "<s> ";
+								break;
+							case LogType.profile:
+								color = colors.magenta;
+								prefix = "<p> ";
+								break;
+							case LogType.profileEnd:
+								color = colors.magenta;
+								prefix = "</p> ";
+								break;
+							case LogType.time:
+								color = colors.magenta;
+								prefix = "<t> ";
+								break;
+							case LogType.group:
+								color = colors.cyan;
+								prefix = "<-> ";
+								break;
+							case LogType.groupCollapsed:
+								color = colors.cyan;
+								prefix = "<+> ";
+								break;
+							case LogType.groupEnd:
+								if (indent.length >= 2)
+									indent = indent.slice(0, indent.length - 2);
+								continue;
+						}
+						if (entry.message) {
+							for (const line of entry.message.split("\n")) {
+								colors.normal(`${indent}${prefix}`);
+								color(line);
+								newline();
+							}
+						}
+						if (entry.trace) {
+							for (const line of entry.trace) {
+								colors.normal(`${indent}| ${line}`);
+								newline();
+							}
+						}
+						switch (entry.type) {
+							case LogType.group:
+								indent += "  ";
+								break;
+						}
+					}
+					if (logData.filteredEntries) {
+						colors.normal(`+ ${logData.filteredEntries} hidden lines`);
+						newline();
+					}
+				}
+			}
+		}
+
+		if (obj._showWarnings && obj.warnings) {
+			for (const warning of obj.warnings) {
+				newline();
+				colors.yellow(`WARNING in ${warning}`);
+				newline();
+			}
+		}
+		if (obj._showErrors && obj.errors) {
+			for (const error of obj.errors) {
+				newline();
+				colors.red(`ERROR in ${error}`);
+				newline();
+			}
+		}
+		if (obj.children) {
+			for (const child of obj.children) {
+				const childString = Stats.jsonToString(child, useColors);
+				if (childString) {
+					if (child.name) {
+						colors.normal("Child ");
+						colors.bold(child.name);
+						colors.normal(":");
+					} else {
+						colors.normal("Child");
+					}
+					newline();
+					buf.push("    ");
+					buf.push(childString.replace(/\n/g, "\n    "));
+					newline();
+				}
+			}
+		}
+		if (obj.needAdditionalPass) {
+			colors.yellow(
+				"Compilation needs an additional pass and will compile again."
+			);
+		}
+
+		while (buf[buf.length - 1] === "\n") {
+			buf.pop();
+		}
+		return buf.join("");
+	}
+
+	static presetToOptions(name) {
+		// Accepted values: none, errors-only, minimal, normal, detailed, verbose
+		// Any other falsy value will behave as 'none', truthy values as 'normal'
+		const pn =
+			(typeof name === "string" && name.toLowerCase()) || name || "none";
+		switch (pn) {
+			case "none":
+				return {
+					all: false
+				};
+			case "verbose":
+				return {
+					entrypoints: true,
+					chunkGroups: true,
+					modules: false,
+					chunks: true,
+					chunkModules: true,
+					chunkOrigins: true,
+					depth: true,
+					env: true,
+					reasons: true,
+					usedExports: true,
+					providedExports: true,
+					optimizationBailout: true,
+					errorDetails: true,
+					publicPath: true,
+					logging: "verbose",
+					exclude: false,
+					maxModules: Infinity
+				};
+			case "detailed":
+				return {
+					entrypoints: true,
+					chunkGroups: true,
+					chunks: true,
+					chunkModules: false,
+					chunkOrigins: true,
+					depth: true,
+					usedExports: true,
+					providedExports: true,
+					optimizationBailout: true,
+					errorDetails: true,
+					publicPath: true,
+					logging: true,
+					exclude: false,
+					maxModules: Infinity
+				};
+			case "minimal":
+				return {
+					all: false,
+					modules: true,
+					maxModules: 0,
+					errors: true,
+					warnings: true,
+					logging: "warn"
+				};
+			case "errors-only":
+				return {
+					all: false,
+					errors: true,
+					moduleTrace: true,
+					logging: "error"
+				};
+			case "errors-warnings":
+				return {
+					all: false,
+					errors: true,
+					warnings: true,
+					logging: "warn"
+				};
+			default:
+				return {};
+		}
+	}
+
+	static getChildOptions(options, idx) {
+		let innerOptions;
+		if (Array.isArray(options.children)) {
+			if (idx < options.children.length) {
+				innerOptions = options.children[idx];
+			}
+		} else if (typeof options.children === "object" && options.children) {
+			innerOptions = options.children;
+		}
+		if (typeof innerOptions === "boolean" || typeof innerOptions === "string") {
+			innerOptions = Stats.presetToOptions(innerOptions);
+		}
+		if (!innerOptions) {
+			return options;
+		}
+		const childOptions = Object.assign({}, options);
+		delete childOptions.children; // do not inherit children
+		return Object.assign(childOptions, innerOptions);
+	}
+}
+
+module.exports = Stats;
diff --git a/node_modules/webpack/lib/SystemMainTemplatePlugin.js b/node_modules/webpack/lib/SystemMainTemplatePlugin.js
new file mode 100644
index 0000000..1c3e4c8
--- /dev/null
+++ b/node_modules/webpack/lib/SystemMainTemplatePlugin.js
@@ -0,0 +1,135 @@
+/*
+ MIT License http://www.opensource.org/licenses/mit-license.php
+ Author Joel Denning @joeldenning
+ */
+
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+const Template = require("./Template");
+
+/** @typedef {import("./Compilation")} Compilation */
+
+/**
+ * @typedef {Object} SystemMainTemplatePluginOptions
+ * @param {string=} name the library name
+ */
+
+class SystemMainTemplatePlugin {
+	/**
+	 * @param {SystemMainTemplatePluginOptions} options the plugin options
+	 */
+	constructor(options) {
+		this.name = options.name;
+	}
+
+	/**
+	 * @param {Compilation} compilation the compilation instance
+	 * @returns {void}
+	 */
+	apply(compilation) {
+		const { mainTemplate, chunkTemplate } = compilation;
+
+		const onRenderWithEntry = (source, chunk, hash) => {
+			const externals = chunk.getModules().filter(m => m.external);
+
+			// The name this bundle should be registered as with System
+			const name = this.name
+				? `${JSON.stringify(
+						mainTemplate.getAssetPath(this.name, { hash, chunk })
+				  )}, `
+				: "";
+
+			// The array of dependencies that are external to webpack and will be provided by System
+			const systemDependencies = JSON.stringify(
+				externals.map(m =>
+					typeof m.request === "object" ? m.request.amd : m.request
+				)
+			);
+
+			// The name of the variable provided by System for exporting
+			const dynamicExport = "__WEBPACK_DYNAMIC_EXPORT__";
+
+			// An array of the internal variable names for the webpack externals
+			const externalWebpackNames = externals.map(
+				m => `__WEBPACK_EXTERNAL_MODULE_${Template.toIdentifier(`${m.id}`)}__`
+			);
+
+			// Declaring variables for the internal variable names for the webpack externals
+			const externalVarDeclarations =
+				externalWebpackNames.length > 0
+					? `var ${externalWebpackNames.join(", ")};`
+					: "";
+
+			// The system.register format requires an array of setter functions for externals.
+			const setters =
+				externalWebpackNames.length === 0
+					? ""
+					: Template.asString([
+							"setters: [",
+							Template.indent(
+								externalWebpackNames
+									.map(external =>
+										Template.asString([
+											"function(module) {",
+											Template.indent(`${external} = module;`),
+											"}"
+										])
+									)
+									.join(",\n")
+							),
+							"],"
+					  ]);
+
+			return new ConcatSource(
+				Template.asString([
+					`System.register(${name}${systemDependencies}, function(${dynamicExport}) {`,
+					Template.indent([
+						externalVarDeclarations,
+						"return {",
+						Template.indent([
+							setters,
+							"execute: function() {",
+							Template.indent(`${dynamicExport}(`)
+						])
+					])
+				]) + "\n",
+				source,
+				"\n" +
+					Template.asString([
+						Template.indent([
+							Template.indent([Template.indent([");"]), "}"]),
+							"};"
+						]),
+						"})"
+					])
+			);
+		};
+
+		for (const template of [mainTemplate, chunkTemplate]) {
+			template.hooks.renderWithEntry.tap(
+				"SystemMainTemplatePlugin",
+				onRenderWithEntry
+			);
+		}
+
+		mainTemplate.hooks.globalHashPaths.tap(
+			"SystemMainTemplatePlugin",
+			paths => {
+				if (this.name) {
+					paths.push(this.name);
+				}
+				return paths;
+			}
+		);
+
+		mainTemplate.hooks.hash.tap("SystemMainTemplatePlugin", hash => {
+			hash.update("exports system");
+			if (this.name) {
+				hash.update(this.name);
+			}
+		});
+	}
+}
+
+module.exports = SystemMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/Template.js b/node_modules/webpack/lib/Template.js
new file mode 100644
index 0000000..0543957
--- /dev/null
+++ b/node_modules/webpack/lib/Template.js
@@ -0,0 +1,291 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("./ModuleTemplate")} ModuleTemplate */
+/** @typedef {import("webpack-sources").ConcatSource} ConcatSource */
+
+const { ConcatSource } = require("webpack-sources");
+const HotUpdateChunk = require("./HotUpdateChunk");
+
+const START_LOWERCASE_ALPHABET_CODE = "a".charCodeAt(0);
+const START_UPPERCASE_ALPHABET_CODE = "A".charCodeAt(0);
+const DELTA_A_TO_Z = "z".charCodeAt(0) - START_LOWERCASE_ALPHABET_CODE + 1;
+const FUNCTION_CONTENT_REGEX = /^function\s?\(\)\s?\{\r?\n?|\r?\n?\}$/g;
+const INDENT_MULTILINE_REGEX = /^\t/gm;
+const LINE_SEPARATOR_REGEX = /\r?\n/g;
+const IDENTIFIER_NAME_REPLACE_REGEX = /^([^a-zA-Z$_])/;
+const IDENTIFIER_ALPHA_NUMERIC_NAME_REPLACE_REGEX = /[^a-zA-Z0-9$]+/g;
+const COMMENT_END_REGEX = /\*\//g;
+const PATH_NAME_NORMALIZE_REPLACE_REGEX = /[^a-zA-Z0-9_!§$()=\-^°]+/g;
+const MATCH_PADDED_HYPHENS_REPLACE_REGEX = /^-|-$/g;
+
+/** @typedef {import("webpack-sources").Source} Source */
+
+/**
+ * @typedef {Object} HasId
+ * @property {number | string} id
+ */
+
+/**
+ * @typedef {function(Module, number): boolean} ModuleFilterPredicate
+ */
+
+/**
+ * @param {HasId} a first id object to be sorted
+ * @param {HasId} b second id object to be sorted against
+ * @returns {-1|0|1} the sort value
+ */
+const stringifyIdSortPredicate = (a, b) => {
+	const aId = a.id + "";
+	const bId = b.id + "";
+	if (aId < bId) return -1;
+	if (aId > bId) return 1;
+	return 0;
+};
+
+class Template {
+	/**
+	 *
+	 * @param {Function} fn a runtime function (.runtime.js) "template"
+	 * @returns {string} the updated and normalized function string
+	 */
+	static getFunctionContent(fn) {
+		return fn
+			.toString()
+			.replace(FUNCTION_CONTENT_REGEX, "")
+			.replace(INDENT_MULTILINE_REGEX, "")
+			.replace(LINE_SEPARATOR_REGEX, "\n");
+	}
+
+	/**
+	 * @param {string} str the string converted to identifier
+	 * @returns {string} created identifier
+	 */
+	static toIdentifier(str) {
+		if (typeof str !== "string") return "";
+		return str
+			.replace(IDENTIFIER_NAME_REPLACE_REGEX, "_$1")
+			.replace(IDENTIFIER_ALPHA_NUMERIC_NAME_REPLACE_REGEX, "_");
+	}
+	/**
+	 *
+	 * @param {string} str string to be converted to commented in bundle code
+	 * @returns {string} returns a commented version of string
+	 */
+	static toComment(str) {
+		if (!str) return "";
+		return `/*! ${str.replace(COMMENT_END_REGEX, "* /")} */`;
+	}
+
+	/**
+	 *
+	 * @param {string} str string to be converted to "normal comment"
+	 * @returns {string} returns a commented version of string
+	 */
+	static toNormalComment(str) {
+		if (!str) return "";
+		return `/* ${str.replace(COMMENT_END_REGEX, "* /")} */`;
+	}
+
+	/**
+	 * @param {string} str string path to be normalized
+	 * @returns {string} normalized bundle-safe path
+	 */
+	static toPath(str) {
+		if (typeof str !== "string") return "";
+		return str
+			.replace(PATH_NAME_NORMALIZE_REPLACE_REGEX, "-")
+			.replace(MATCH_PADDED_HYPHENS_REPLACE_REGEX, "");
+	}
+
+	// map number to a single character a-z, A-Z or <_ + number> if number is too big
+	/**
+	 *
+	 * @param {number} n number to convert to ident
+	 * @returns {string} returns single character ident
+	 */
+	static numberToIdentifer(n) {
+		// lower case
+		if (n < DELTA_A_TO_Z) {
+			return String.fromCharCode(START_LOWERCASE_ALPHABET_CODE + n);
+		}
+
+		// upper case
+		if (n < DELTA_A_TO_Z * 2) {
+			return String.fromCharCode(
+				START_UPPERCASE_ALPHABET_CODE + n - DELTA_A_TO_Z
+			);
+		}
+
+		// use multiple letters
+		return (
+			Template.numberToIdentifer(n % (2 * DELTA_A_TO_Z)) +
+			Template.numberToIdentifer(Math.floor(n / (2 * DELTA_A_TO_Z)))
+		);
+	}
+
+	/**
+	 *
+	 * @param {string | string[]} s string to convert to identity
+	 * @returns {string} converted identity
+	 */
+	static indent(s) {
+		if (Array.isArray(s)) {
+			return s.map(Template.indent).join("\n");
+		} else {
+			const str = s.trimRight();
+			if (!str) return "";
+			const ind = str[0] === "\n" ? "" : "\t";
+			return ind + str.replace(/\n([^\n])/g, "\n\t$1");
+		}
+	}
+
+	/**
+	 *
+	 * @param {string|string[]} s string to create prefix for
+	 * @param {string} prefix prefix to compose
+	 * @returns {string} returns new prefix string
+	 */
+	static prefix(s, prefix) {
+		const str = Template.asString(s).trim();
+		if (!str) return "";
+		const ind = str[0] === "\n" ? "" : prefix;
+		return ind + str.replace(/\n([^\n])/g, "\n" + prefix + "$1");
+	}
+
+	/**
+	 *
+	 * @param {string|string[]} str string or string collection
+	 * @returns {string} returns a single string from array
+	 */
+	static asString(str) {
+		if (Array.isArray(str)) {
+			return str.join("\n");
+		}
+		return str;
+	}
+
+	/**
+	 * @typedef {Object} WithId
+	 * @property {string|number} id
+	 */
+
+	/**
+	 * @param {WithId[]} modules a collection of modules to get array bounds for
+	 * @returns {[number, number] | false} returns the upper and lower array bounds
+	 * or false if not every module has a number based id
+	 */
+	static getModulesArrayBounds(modules) {
+		let maxId = -Infinity;
+		let minId = Infinity;
+		for (const module of modules) {
+			if (typeof module.id !== "number") return false;
+			if (maxId < module.id) maxId = /** @type {number} */ (module.id);
+			if (minId > module.id) minId = /** @type {number} */ (module.id);
+		}
+		if (minId < 16 + ("" + minId).length) {
+			// add minId x ',' instead of 'Array(minId).concat(…)'
+			minId = 0;
+		}
+		const objectOverhead = modules
+			.map(module => (module.id + "").length + 2)
+			.reduce((a, b) => a + b, -1);
+		const arrayOverhead =
+			minId === 0 ? maxId : 16 + ("" + minId).length + maxId;
+		return arrayOverhead < objectOverhead ? [minId, maxId] : false;
+	}
+
+	/**
+	 * @param {Chunk} chunk chunk whose modules will be rendered
+	 * @param {ModuleFilterPredicate} filterFn function used to filter modules from chunk to render
+	 * @param {ModuleTemplate} moduleTemplate ModuleTemplate instance used to render modules
+	 * @param {TODO | TODO[]} dependencyTemplates templates needed for each module to render dependencies
+	 * @param {string=} prefix applying prefix strings
+	 * @returns {ConcatSource} rendered chunk modules in a Source object
+	 */
+	static renderChunkModules(
+		chunk,
+		filterFn,
+		moduleTemplate,
+		dependencyTemplates,
+		prefix = ""
+	) {
+		const source = new ConcatSource();
+		const modules = chunk.getModules().filter(filterFn);
+		let removedModules;
+		if (chunk instanceof HotUpdateChunk) {
+			removedModules = chunk.removedModules;
+		}
+		if (
+			modules.length === 0 &&
+			(!removedModules || removedModules.length === 0)
+		) {
+			source.add("[]");
+			return source;
+		}
+		/** @type {{id: string|number, source: Source|string}[]} */
+		const allModules = modules.map(module => {
+			return {
+				id: module.id,
+				source: moduleTemplate.render(module, dependencyTemplates, {
+					chunk
+				})
+			};
+		});
+		if (removedModules && removedModules.length > 0) {
+			for (const id of removedModules) {
+				allModules.push({
+					id,
+					source: "false"
+				});
+			}
+		}
+		const bounds = Template.getModulesArrayBounds(allModules);
+		if (bounds) {
+			// Render a spare array
+			const minId = bounds[0];
+			const maxId = bounds[1];
+			if (minId !== 0) {
+				source.add(`Array(${minId}).concat(`);
+			}
+			source.add("[\n");
+			/** @type {Map<string|number, {id: string|number, source: Source|string}>} */
+			const modules = new Map();
+			for (const module of allModules) {
+				modules.set(module.id, module);
+			}
+			for (let idx = minId; idx <= maxId; idx++) {
+				const module = modules.get(idx);
+				if (idx !== minId) {
+					source.add(",\n");
+				}
+				source.add(`/* ${idx} */`);
+				if (module) {
+					source.add("\n");
+					source.add(module.source);
+				}
+			}
+			source.add("\n" + prefix + "]");
+			if (minId !== 0) {
+				source.add(")");
+			}
+		} else {
+			// Render an object
+			source.add("{\n");
+			allModules.sort(stringifyIdSortPredicate).forEach((module, idx) => {
+				if (idx !== 0) {
+					source.add(",\n");
+				}
+				source.add(`\n/***/ ${JSON.stringify(module.id)}:\n`);
+				source.add(module.source);
+			});
+			source.add(`\n\n${prefix}}`);
+		}
+		return source;
+	}
+}
+
+module.exports = Template;
diff --git a/node_modules/webpack/lib/TemplatedPathPlugin.js b/node_modules/webpack/lib/TemplatedPathPlugin.js
new file mode 100644
index 0000000..d463f51
--- /dev/null
+++ b/node_modules/webpack/lib/TemplatedPathPlugin.js
@@ -0,0 +1,188 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Jason Anderson @diurnalist
+*/
+"use strict";
+
+const REGEXP_HASH = /\[hash(?::(\d+))?\]/gi,
+	REGEXP_CHUNKHASH = /\[chunkhash(?::(\d+))?\]/gi,
+	REGEXP_MODULEHASH = /\[modulehash(?::(\d+))?\]/gi,
+	REGEXP_CONTENTHASH = /\[contenthash(?::(\d+))?\]/gi,
+	REGEXP_NAME = /\[name\]/gi,
+	REGEXP_ID = /\[id\]/gi,
+	REGEXP_MODULEID = /\[moduleid\]/gi,
+	REGEXP_FILE = /\[file\]/gi,
+	REGEXP_QUERY = /\[query\]/gi,
+	REGEXP_FILEBASE = /\[filebase\]/gi,
+	REGEXP_URL = /\[url\]/gi;
+
+// Using global RegExp for .test is dangerous
+// We use a normal RegExp instead of .test
+const REGEXP_HASH_FOR_TEST = new RegExp(REGEXP_HASH.source, "i"),
+	REGEXP_CHUNKHASH_FOR_TEST = new RegExp(REGEXP_CHUNKHASH.source, "i"),
+	REGEXP_CONTENTHASH_FOR_TEST = new RegExp(REGEXP_CONTENTHASH.source, "i"),
+	REGEXP_NAME_FOR_TEST = new RegExp(REGEXP_NAME.source, "i");
+
+const withHashLength = (replacer, handlerFn, assetInfo) => {
+	const fn = (match, hashLength, ...args) => {
+		if (assetInfo) assetInfo.immutable = true;
+		const length = hashLength && parseInt(hashLength, 10);
+		if (length && handlerFn) {
+			return handlerFn(length);
+		}
+		const hash = replacer(match, hashLength, ...args);
+		return length ? hash.slice(0, length) : hash;
+	};
+	return fn;
+};
+
+const getReplacer = (value, allowEmpty) => {
+	const fn = (match, ...args) => {
+		// last argument in replacer is the entire input string
+		const input = args[args.length - 1];
+		if (value === null || value === undefined) {
+			if (!allowEmpty) {
+				throw new Error(
+					`Path variable ${match} not implemented in this context: ${input}`
+				);
+			}
+			return "";
+		} else {
+			return `${escapePathVariables(value)}`;
+		}
+	};
+	return fn;
+};
+
+const escapePathVariables = value => {
+	return typeof value === "string"
+		? value.replace(/\[(\\*[\w:]+\\*)\]/gi, "[\\$1\\]")
+		: value;
+};
+
+const replacePathVariables = (path, data, assetInfo) => {
+	const chunk = data.chunk;
+	const chunkId = chunk && chunk.id;
+	const chunkName = chunk && (chunk.name || chunk.id);
+	const chunkHash = chunk && (chunk.renderedHash || chunk.hash);
+	const chunkHashWithLength = chunk && chunk.hashWithLength;
+	const contentHashType = data.contentHashType;
+	const contentHash =
+		(chunk && chunk.contentHash && chunk.contentHash[contentHashType]) ||
+		data.contentHash;
+	const contentHashWithLength =
+		(chunk &&
+			chunk.contentHashWithLength &&
+			chunk.contentHashWithLength[contentHashType]) ||
+		data.contentHashWithLength;
+	const module = data.module;
+	const moduleId = module && module.id;
+	const moduleHash = module && (module.renderedHash || module.hash);
+	const moduleHashWithLength = module && module.hashWithLength;
+
+	if (typeof path === "function") {
+		path = path(data);
+	}
+
+	if (
+		data.noChunkHash &&
+		(REGEXP_CHUNKHASH_FOR_TEST.test(path) ||
+			REGEXP_CONTENTHASH_FOR_TEST.test(path))
+	) {
+		throw new Error(
+			`Cannot use [chunkhash] or [contenthash] for chunk in '${path}' (use [hash] instead)`
+		);
+	}
+
+	return (
+		path
+			.replace(
+				REGEXP_HASH,
+				withHashLength(getReplacer(data.hash), data.hashWithLength, assetInfo)
+			)
+			.replace(
+				REGEXP_CHUNKHASH,
+				withHashLength(getReplacer(chunkHash), chunkHashWithLength, assetInfo)
+			)
+			.replace(
+				REGEXP_CONTENTHASH,
+				withHashLength(
+					getReplacer(contentHash),
+					contentHashWithLength,
+					assetInfo
+				)
+			)
+			.replace(
+				REGEXP_MODULEHASH,
+				withHashLength(getReplacer(moduleHash), moduleHashWithLength, assetInfo)
+			)
+			.replace(REGEXP_ID, getReplacer(chunkId))
+			.replace(REGEXP_MODULEID, getReplacer(moduleId))
+			.replace(REGEXP_NAME, getReplacer(chunkName))
+			.replace(REGEXP_FILE, getReplacer(data.filename))
+			.replace(REGEXP_FILEBASE, getReplacer(data.basename))
+			// query is optional, it's OK if it's in a path but there's nothing to replace it with
+			.replace(REGEXP_QUERY, getReplacer(data.query, true))
+			// only available in sourceMappingURLComment
+			.replace(REGEXP_URL, getReplacer(data.url))
+			.replace(/\[\\(\\*[\w:]+\\*)\\\]/gi, "[$1]")
+	);
+};
+
+class TemplatedPathPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap("TemplatedPathPlugin", compilation => {
+			const mainTemplate = compilation.mainTemplate;
+
+			mainTemplate.hooks.assetPath.tap(
+				"TemplatedPathPlugin",
+				replacePathVariables
+			);
+
+			mainTemplate.hooks.globalHash.tap(
+				"TemplatedPathPlugin",
+				(chunk, paths) => {
+					const outputOptions = mainTemplate.outputOptions;
+					const publicPath = outputOptions.publicPath || "";
+					const filename = outputOptions.filename || "";
+					const chunkFilename =
+						outputOptions.chunkFilename || outputOptions.filename;
+					if (
+						REGEXP_HASH_FOR_TEST.test(publicPath) ||
+						REGEXP_CHUNKHASH_FOR_TEST.test(publicPath) ||
+						REGEXP_CONTENTHASH_FOR_TEST.test(publicPath) ||
+						REGEXP_NAME_FOR_TEST.test(publicPath)
+					)
+						return true;
+					if (REGEXP_HASH_FOR_TEST.test(filename)) return true;
+					if (REGEXP_HASH_FOR_TEST.test(chunkFilename)) return true;
+					if (REGEXP_HASH_FOR_TEST.test(paths.join("|"))) return true;
+				}
+			);
+
+			mainTemplate.hooks.hashForChunk.tap(
+				"TemplatedPathPlugin",
+				(hash, chunk) => {
+					const outputOptions = mainTemplate.outputOptions;
+					const chunkFilename =
+						outputOptions.chunkFilename || outputOptions.filename;
+					if (REGEXP_CHUNKHASH_FOR_TEST.test(chunkFilename)) {
+						hash.update(JSON.stringify(chunk.getChunkMaps(true).hash));
+					}
+					if (REGEXP_CONTENTHASH_FOR_TEST.test(chunkFilename)) {
+						hash.update(
+							JSON.stringify(
+								chunk.getChunkMaps(true).contentHash.javascript || {}
+							)
+						);
+					}
+					if (REGEXP_NAME_FOR_TEST.test(chunkFilename)) {
+						hash.update(JSON.stringify(chunk.getChunkMaps(true).name));
+					}
+				}
+			);
+		});
+	}
+}
+
+module.exports = TemplatedPathPlugin;
diff --git a/node_modules/webpack/lib/UmdMainTemplatePlugin.js b/node_modules/webpack/lib/UmdMainTemplatePlugin.js
new file mode 100644
index 0000000..7843c78
--- /dev/null
+++ b/node_modules/webpack/lib/UmdMainTemplatePlugin.js
@@ -0,0 +1,305 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource, OriginalSource } = require("webpack-sources");
+const Template = require("./Template");
+
+/** @typedef {import("../declarations/WebpackOptions").LibraryCustomUmdObject} LibraryCustomUmdObject */
+/** @typedef {import("./Compilation")} Compilation */
+
+/**
+ * @param {string[]} accessor the accessor to convert to path
+ * @returns {string} the path
+ */
+const accessorToObjectAccess = accessor => {
+	return accessor.map(a => `[${JSON.stringify(a)}]`).join("");
+};
+
+/**
+ * @param {string=} base the path prefix
+ * @param {string|string[]} accessor the accessor
+ * @param {string=} joinWith the element separator
+ * @returns {string} the path
+ */
+const accessorAccess = (base, accessor, joinWith = ", ") => {
+	const accessors = Array.isArray(accessor) ? accessor : [accessor];
+	return accessors
+		.map((_, idx) => {
+			const a = base
+				? base + accessorToObjectAccess(accessors.slice(0, idx + 1))
+				: accessors[0] + accessorToObjectAccess(accessors.slice(1, idx + 1));
+			if (idx === accessors.length - 1) return a;
+			if (idx === 0 && base === undefined)
+				return `${a} = typeof ${a} === "object" ? ${a} : {}`;
+			return `${a} = ${a} || {}`;
+		})
+		.join(joinWith);
+};
+
+/** @typedef {string | string[] | LibraryCustomUmdObject} UmdMainTemplatePluginName */
+
+/**
+ * @typedef {Object} AuxiliaryCommentObject
+ * @property {string} root
+ * @property {string} commonjs
+ * @property {string} commonjs2
+ * @property {string} amd
+ */
+
+/**
+ * @typedef {Object} UmdMainTemplatePluginOption
+ * @property {boolean=} optionalAmdExternalAsGlobal
+ * @property {boolean} namedDefine
+ * @property {string | AuxiliaryCommentObject} auxiliaryComment
+ */
+
+class UmdMainTemplatePlugin {
+	/**
+	 * @param {UmdMainTemplatePluginName} name the name of the UMD library
+	 * @param {UmdMainTemplatePluginOption} options the plugin option
+	 */
+	constructor(name, options) {
+		if (typeof name === "object" && !Array.isArray(name)) {
+			this.name = name.root || name.amd || name.commonjs;
+			this.names = name;
+		} else {
+			this.name = name;
+			this.names = {
+				commonjs: name,
+				root: name,
+				amd: name
+			};
+		}
+		this.optionalAmdExternalAsGlobal = options.optionalAmdExternalAsGlobal;
+		this.namedDefine = options.namedDefine;
+		this.auxiliaryComment = options.auxiliaryComment;
+	}
+
+	/**
+	 * @param {Compilation} compilation the compilation instance
+	 * @returns {void}
+	 */
+	apply(compilation) {
+		const { mainTemplate, chunkTemplate, runtimeTemplate } = compilation;
+
+		const onRenderWithEntry = (source, chunk, hash) => {
+			let externals = chunk
+				.getModules()
+				.filter(
+					m =>
+						m.external &&
+						(m.externalType === "umd" || m.externalType === "umd2")
+				);
+			const optionalExternals = [];
+			let requiredExternals = [];
+			if (this.optionalAmdExternalAsGlobal) {
+				for (const m of externals) {
+					if (m.optional) {
+						optionalExternals.push(m);
+					} else {
+						requiredExternals.push(m);
+					}
+				}
+				externals = requiredExternals.concat(optionalExternals);
+			} else {
+				requiredExternals = externals;
+			}
+
+			const replaceKeys = str => {
+				return mainTemplate.getAssetPath(str, {
+					hash,
+					chunk
+				});
+			};
+
+			const externalsDepsArray = modules => {
+				return `[${replaceKeys(
+					modules
+						.map(m =>
+							JSON.stringify(
+								typeof m.request === "object" ? m.request.amd : m.request
+							)
+						)
+						.join(", ")
+				)}]`;
+			};
+
+			const externalsRootArray = modules => {
+				return replaceKeys(
+					modules
+						.map(m => {
+							let request = m.request;
+							if (typeof request === "object") request = request.root;
+							return `root${accessorToObjectAccess([].concat(request))}`;
+						})
+						.join(", ")
+				);
+			};
+
+			const externalsRequireArray = type => {
+				return replaceKeys(
+					externals
+						.map(m => {
+							let expr;
+							let request = m.request;
+							if (typeof request === "object") {
+								request = request[type];
+							}
+							if (request === undefined) {
+								throw new Error(
+									"Missing external configuration for type:" + type
+								);
+							}
+							if (Array.isArray(request)) {
+								expr = `require(${JSON.stringify(
+									request[0]
+								)})${accessorToObjectAccess(request.slice(1))}`;
+							} else {
+								expr = `require(${JSON.stringify(request)})`;
+							}
+							if (m.optional) {
+								expr = `(function webpackLoadOptionalExternalModule() { try { return ${expr}; } catch(e) {} }())`;
+							}
+							return expr;
+						})
+						.join(", ")
+				);
+			};
+
+			const externalsArguments = modules => {
+				return modules
+					.map(
+						m =>
+							`__WEBPACK_EXTERNAL_MODULE_${Template.toIdentifier(`${m.id}`)}__`
+					)
+					.join(", ");
+			};
+
+			const libraryName = library => {
+				return JSON.stringify(replaceKeys([].concat(library).pop()));
+			};
+
+			let amdFactory;
+			if (optionalExternals.length > 0) {
+				const wrapperArguments = externalsArguments(requiredExternals);
+				const factoryArguments =
+					requiredExternals.length > 0
+						? externalsArguments(requiredExternals) +
+						  ", " +
+						  externalsRootArray(optionalExternals)
+						: externalsRootArray(optionalExternals);
+				amdFactory =
+					`function webpackLoadOptionalExternalModuleAmd(${wrapperArguments}) {\n` +
+					`			return factory(${factoryArguments});\n` +
+					"		}";
+			} else {
+				amdFactory = "factory";
+			}
+
+			const auxiliaryComment = this.auxiliaryComment;
+
+			const getAuxilaryComment = type => {
+				if (auxiliaryComment) {
+					if (typeof auxiliaryComment === "string")
+						return "\t//" + auxiliaryComment + "\n";
+					if (auxiliaryComment[type])
+						return "\t//" + auxiliaryComment[type] + "\n";
+				}
+				return "";
+			};
+
+			return new ConcatSource(
+				new OriginalSource(
+					"(function webpackUniversalModuleDefinition(root, factory) {\n" +
+						getAuxilaryComment("commonjs2") +
+						"	if(typeof exports === 'object' && typeof module === 'object')\n" +
+						"		module.exports = factory(" +
+						externalsRequireArray("commonjs2") +
+						");\n" +
+						getAuxilaryComment("amd") +
+						"	else if(typeof define === 'function' && define.amd)\n" +
+						(requiredExternals.length > 0
+							? this.names.amd && this.namedDefine === true
+								? "		define(" +
+								  libraryName(this.names.amd) +
+								  ", " +
+								  externalsDepsArray(requiredExternals) +
+								  ", " +
+								  amdFactory +
+								  ");\n"
+								: "		define(" +
+								  externalsDepsArray(requiredExternals) +
+								  ", " +
+								  amdFactory +
+								  ");\n"
+							: this.names.amd && this.namedDefine === true
+							? "		define(" +
+							  libraryName(this.names.amd) +
+							  ", [], " +
+							  amdFactory +
+							  ");\n"
+							: "		define([], " + amdFactory + ");\n") +
+						(this.names.root || this.names.commonjs
+							? getAuxilaryComment("commonjs") +
+							  "	else if(typeof exports === 'object')\n" +
+							  "		exports[" +
+							  libraryName(this.names.commonjs || this.names.root) +
+							  "] = factory(" +
+							  externalsRequireArray("commonjs") +
+							  ");\n" +
+							  getAuxilaryComment("root") +
+							  "	else\n" +
+							  "		" +
+							  replaceKeys(
+									accessorAccess("root", this.names.root || this.names.commonjs)
+							  ) +
+							  " = factory(" +
+							  externalsRootArray(externals) +
+							  ");\n"
+							: "	else {\n" +
+							  (externals.length > 0
+									? "		var a = typeof exports === 'object' ? factory(" +
+									  externalsRequireArray("commonjs") +
+									  ") : factory(" +
+									  externalsRootArray(externals) +
+									  ");\n"
+									: "		var a = factory();\n") +
+							  "		for(var i in a) (typeof exports === 'object' ? exports : root)[i] = a[i];\n" +
+							  "	}\n") +
+						`})(${
+							runtimeTemplate.outputOptions.globalObject
+						}, function(${externalsArguments(externals)}) {\nreturn `,
+					"webpack/universalModuleDefinition"
+				),
+				source,
+				";\n})"
+			);
+		};
+
+		for (const template of [mainTemplate, chunkTemplate]) {
+			template.hooks.renderWithEntry.tap(
+				"UmdMainTemplatePlugin",
+				onRenderWithEntry
+			);
+		}
+
+		mainTemplate.hooks.globalHashPaths.tap("UmdMainTemplatePlugin", paths => {
+			if (this.names.root) paths = paths.concat(this.names.root);
+			if (this.names.amd) paths = paths.concat(this.names.amd);
+			if (this.names.commonjs) paths = paths.concat(this.names.commonjs);
+			return paths;
+		});
+
+		mainTemplate.hooks.hash.tap("UmdMainTemplatePlugin", hash => {
+			hash.update("umd");
+			hash.update(`${this.names.root}`);
+			hash.update(`${this.names.amd}`);
+			hash.update(`${this.names.commonjs}`);
+		});
+	}
+}
+
+module.exports = UmdMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/UnsupportedFeatureWarning.js b/node_modules/webpack/lib/UnsupportedFeatureWarning.js
new file mode 100644
index 0000000..72eef83
--- /dev/null
+++ b/node_modules/webpack/lib/UnsupportedFeatureWarning.js
@@ -0,0 +1,30 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+
+/** @typedef {import("./Module")} Module */
+/** @typedef {import("./Dependency").DependencyLocation} DependencyLocation */
+
+class UnsupportedFeatureWarning extends WebpackError {
+	/**
+	 * @param {Module} module module relevant to warning
+	 * @param {string} message description of warning
+	 * @param {DependencyLocation} loc location start and end positions of the module
+	 */
+	constructor(module, message, loc) {
+		super(message);
+
+		this.name = "UnsupportedFeatureWarning";
+		this.module = module;
+		this.loc = loc;
+		this.hideStack = true;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = UnsupportedFeatureWarning;
diff --git a/node_modules/webpack/lib/UseStrictPlugin.js b/node_modules/webpack/lib/UseStrictPlugin.js
new file mode 100644
index 0000000..425be2e
--- /dev/null
+++ b/node_modules/webpack/lib/UseStrictPlugin.js
@@ -0,0 +1,54 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ConstDependency = require("./dependencies/ConstDependency");
+
+/** @typedef {import("./Compiler")} Compiler */
+
+class UseStrictPlugin {
+	/**
+	 * @param {Compiler} compiler Webpack Compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"UseStrictPlugin",
+			(compilation, { normalModuleFactory }) => {
+				const handler = parser => {
+					parser.hooks.program.tap("UseStrictPlugin", ast => {
+						const firstNode = ast.body[0];
+						if (
+							firstNode &&
+							firstNode.type === "ExpressionStatement" &&
+							firstNode.expression.type === "Literal" &&
+							firstNode.expression.value === "use strict"
+						) {
+							// Remove "use strict" expression. It will be added later by the renderer again.
+							// This is necessary in order to not break the strict mode when webpack prepends code.
+							// @see https://github.com/webpack/webpack/issues/1970
+							const dep = new ConstDependency("", firstNode.range);
+							dep.loc = firstNode.loc;
+							parser.state.current.addDependency(dep);
+							parser.state.module.buildInfo.strict = true;
+						}
+					});
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("UseStrictPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("UseStrictPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/esm")
+					.tap("UseStrictPlugin", handler);
+			}
+		);
+	}
+}
+
+module.exports = UseStrictPlugin;
diff --git a/node_modules/webpack/lib/WarnCaseSensitiveModulesPlugin.js b/node_modules/webpack/lib/WarnCaseSensitiveModulesPlugin.js
new file mode 100644
index 0000000..867a33f
--- /dev/null
+++ b/node_modules/webpack/lib/WarnCaseSensitiveModulesPlugin.js
@@ -0,0 +1,37 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const CaseSensitiveModulesWarning = require("./CaseSensitiveModulesWarning");
+
+class WarnCaseSensitiveModulesPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"WarnCaseSensitiveModulesPlugin",
+			compilation => {
+				compilation.hooks.seal.tap("WarnCaseSensitiveModulesPlugin", () => {
+					const moduleWithoutCase = new Map();
+					for (const module of compilation.modules) {
+						const identifier = module.identifier().toLowerCase();
+						const array = moduleWithoutCase.get(identifier);
+						if (array) {
+							array.push(module);
+						} else {
+							moduleWithoutCase.set(identifier, [module]);
+						}
+					}
+					for (const pair of moduleWithoutCase) {
+						const array = pair[1];
+						if (array.length > 1) {
+							compilation.warnings.push(new CaseSensitiveModulesWarning(array));
+						}
+					}
+				});
+			}
+		);
+	}
+}
+
+module.exports = WarnCaseSensitiveModulesPlugin;
diff --git a/node_modules/webpack/lib/WarnNoModeSetPlugin.js b/node_modules/webpack/lib/WarnNoModeSetPlugin.js
new file mode 100644
index 0000000..4a69a8c
--- /dev/null
+++ b/node_modules/webpack/lib/WarnNoModeSetPlugin.js
@@ -0,0 +1,17 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const NoModeWarning = require("./NoModeWarning");
+
+class WarnNoModeSetPlugin {
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap("WarnNoModeSetPlugin", compilation => {
+			compilation.warnings.push(new NoModeWarning());
+		});
+	}
+}
+
+module.exports = WarnNoModeSetPlugin;
diff --git a/node_modules/webpack/lib/WatchIgnorePlugin.js b/node_modules/webpack/lib/WatchIgnorePlugin.js
new file mode 100644
index 0000000..5ba9cd0
--- /dev/null
+++ b/node_modules/webpack/lib/WatchIgnorePlugin.js
@@ -0,0 +1,106 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const validateOptions = require("schema-utils");
+const schema = require("../schemas/plugins/WatchIgnorePlugin.json");
+
+/** @typedef {import("../declarations/plugins/WatchIgnorePlugin").WatchIgnorePluginOptions} WatchIgnorePluginOptions */
+
+class IgnoringWatchFileSystem {
+	constructor(wfs, paths) {
+		this.wfs = wfs;
+		this.paths = paths;
+	}
+
+	watch(files, dirs, missing, startTime, options, callback, callbackUndelayed) {
+		const ignored = path =>
+			this.paths.some(p =>
+				p instanceof RegExp ? p.test(path) : path.indexOf(p) === 0
+			);
+
+		const notIgnored = path => !ignored(path);
+
+		const ignoredFiles = files.filter(ignored);
+		const ignoredDirs = dirs.filter(ignored);
+
+		const watcher = this.wfs.watch(
+			files.filter(notIgnored),
+			dirs.filter(notIgnored),
+			missing,
+			startTime,
+			options,
+			(
+				err,
+				filesModified,
+				dirsModified,
+				missingModified,
+				fileTimestamps,
+				dirTimestamps,
+				removedFiles
+			) => {
+				if (err) return callback(err);
+				for (const path of ignoredFiles) {
+					fileTimestamps.set(path, 1);
+				}
+
+				for (const path of ignoredDirs) {
+					dirTimestamps.set(path, 1);
+				}
+
+				callback(
+					err,
+					filesModified,
+					dirsModified,
+					missingModified,
+					fileTimestamps,
+					dirTimestamps,
+					removedFiles
+				);
+			},
+			callbackUndelayed
+		);
+
+		return {
+			close: () => watcher.close(),
+			pause: () => watcher.pause(),
+			getContextTimestamps: () => {
+				const dirTimestamps = watcher.getContextTimestamps();
+				for (const path of ignoredDirs) {
+					dirTimestamps.set(path, 1);
+				}
+				return dirTimestamps;
+			},
+			getFileTimestamps: () => {
+				const fileTimestamps = watcher.getFileTimestamps();
+				for (const path of ignoredFiles) {
+					fileTimestamps.set(path, 1);
+				}
+				return fileTimestamps;
+			}
+		};
+	}
+}
+
+class WatchIgnorePlugin {
+	/**
+	 * @param {WatchIgnorePluginOptions} paths list of paths
+	 */
+	constructor(paths) {
+		validateOptions(schema, paths, "Watch Ignore Plugin");
+		this.paths = paths;
+	}
+
+	apply(compiler) {
+		compiler.hooks.afterEnvironment.tap("WatchIgnorePlugin", () => {
+			compiler.watchFileSystem = new IgnoringWatchFileSystem(
+				compiler.watchFileSystem,
+				this.paths
+			);
+		});
+	}
+}
+
+module.exports = WatchIgnorePlugin;
diff --git a/node_modules/webpack/lib/Watching.js b/node_modules/webpack/lib/Watching.js
new file mode 100644
index 0000000..dc66db1
--- /dev/null
+++ b/node_modules/webpack/lib/Watching.js
@@ -0,0 +1,211 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Stats = require("./Stats");
+
+class Watching {
+	constructor(compiler, watchOptions, handler) {
+		this.startTime = null;
+		this.invalid = false;
+		this.handler = handler;
+		this.callbacks = [];
+		this.closed = false;
+		this.suspended = false;
+		if (typeof watchOptions === "number") {
+			this.watchOptions = {
+				aggregateTimeout: watchOptions
+			};
+		} else if (watchOptions && typeof watchOptions === "object") {
+			this.watchOptions = Object.assign({}, watchOptions);
+		} else {
+			this.watchOptions = {};
+		}
+		this.watchOptions.aggregateTimeout =
+			this.watchOptions.aggregateTimeout || 200;
+		this.compiler = compiler;
+		this.running = true;
+		this.compiler.readRecords(err => {
+			if (err) return this._done(err);
+
+			this._go();
+		});
+	}
+
+	_go() {
+		this.startTime = Date.now();
+		this.running = true;
+		this.invalid = false;
+		this.compiler.hooks.watchRun.callAsync(this.compiler, err => {
+			if (err) return this._done(err);
+			const onCompiled = (err, compilation) => {
+				if (err) return this._done(err);
+				if (this.invalid) return this._done();
+
+				if (this.compiler.hooks.shouldEmit.call(compilation) === false) {
+					return this._done(null, compilation);
+				}
+
+				this.compiler.emitAssets(compilation, err => {
+					if (err) return this._done(err);
+					if (this.invalid) return this._done();
+					this.compiler.emitRecords(err => {
+						if (err) return this._done(err);
+
+						if (compilation.hooks.needAdditionalPass.call()) {
+							compilation.needAdditionalPass = true;
+
+							const stats = new Stats(compilation);
+							stats.startTime = this.startTime;
+							stats.endTime = Date.now();
+							this.compiler.hooks.done.callAsync(stats, err => {
+								if (err) return this._done(err);
+
+								this.compiler.hooks.additionalPass.callAsync(err => {
+									if (err) return this._done(err);
+									this.compiler.compile(onCompiled);
+								});
+							});
+							return;
+						}
+						return this._done(null, compilation);
+					});
+				});
+			};
+			this.compiler.compile(onCompiled);
+		});
+	}
+
+	_getStats(compilation) {
+		const stats = new Stats(compilation);
+		stats.startTime = this.startTime;
+		stats.endTime = Date.now();
+		return stats;
+	}
+
+	_done(err, compilation) {
+		this.running = false;
+		if (this.invalid) return this._go();
+
+		const stats = compilation ? this._getStats(compilation) : null;
+		if (err) {
+			this.compiler.hooks.failed.call(err);
+			this.handler(err, stats);
+			return;
+		}
+		this.compiler.hooks.done.callAsync(stats, () => {
+			this.handler(null, stats);
+			if (!this.closed) {
+				this.watch(
+					Array.from(compilation.fileDependencies),
+					Array.from(compilation.contextDependencies),
+					Array.from(compilation.missingDependencies)
+				);
+			}
+			for (const cb of this.callbacks) cb();
+			this.callbacks.length = 0;
+		});
+	}
+
+	watch(files, dirs, missing) {
+		this.pausedWatcher = null;
+		this.watcher = this.compiler.watchFileSystem.watch(
+			files,
+			dirs,
+			missing,
+			this.startTime,
+			this.watchOptions,
+			(
+				err,
+				filesModified,
+				contextModified,
+				missingModified,
+				fileTimestamps,
+				contextTimestamps,
+				removedFiles
+			) => {
+				this.pausedWatcher = this.watcher;
+				this.watcher = null;
+				if (err) {
+					return this.handler(err);
+				}
+				this.compiler.fileTimestamps = fileTimestamps;
+				this.compiler.contextTimestamps = contextTimestamps;
+				this.compiler.removedFiles = removedFiles;
+				if (!this.suspended) {
+					this._invalidate();
+				}
+			},
+			(fileName, changeTime) => {
+				this.compiler.hooks.invalid.call(fileName, changeTime);
+			}
+		);
+	}
+
+	invalidate(callback) {
+		if (callback) {
+			this.callbacks.push(callback);
+		}
+		if (this.watcher) {
+			this.compiler.fileTimestamps = this.watcher.getFileTimestamps();
+			this.compiler.contextTimestamps = this.watcher.getContextTimestamps();
+		}
+		return this._invalidate();
+	}
+
+	_invalidate() {
+		if (this.watcher) {
+			this.pausedWatcher = this.watcher;
+			this.watcher.pause();
+			this.watcher = null;
+		}
+
+		if (this.running) {
+			this.invalid = true;
+			return false;
+		} else {
+			this._go();
+		}
+	}
+
+	suspend() {
+		this.suspended = true;
+		this.invalid = false;
+	}
+
+	resume() {
+		if (this.suspended) {
+			this.suspended = false;
+			this._invalidate();
+		}
+	}
+
+	close(callback) {
+		const finalCallback = () => {
+			this.compiler.hooks.watchClose.call();
+			this.compiler.running = false;
+			this.compiler.watchMode = false;
+			if (callback !== undefined) callback();
+		};
+
+		this.closed = true;
+		if (this.watcher) {
+			this.watcher.close();
+			this.watcher = null;
+		}
+		if (this.pausedWatcher) {
+			this.pausedWatcher.close();
+			this.pausedWatcher = null;
+		}
+		if (this.running) {
+			this.invalid = true;
+			this._done = finalCallback;
+		} else {
+			finalCallback();
+		}
+	}
+}
+
+module.exports = Watching;
diff --git a/node_modules/webpack/lib/WebpackError.js b/node_modules/webpack/lib/WebpackError.js
new file mode 100644
index 0000000..4f16001
--- /dev/null
+++ b/node_modules/webpack/lib/WebpackError.js
@@ -0,0 +1,31 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Jarid Margolin @jaridmargolin
+*/
+"use strict";
+
+const inspect = require("util").inspect.custom;
+
+class WebpackError extends Error {
+	/**
+	 * Creates an instance of WebpackError.
+	 * @param {string=} message error message
+	 */
+	constructor(message) {
+		super(message);
+
+		this.details = undefined;
+		this.missing = undefined;
+		this.origin = undefined;
+		this.dependencies = undefined;
+		this.module = undefined;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+
+	[inspect]() {
+		return this.stack + (this.details ? `\n${this.details}` : "");
+	}
+}
+
+module.exports = WebpackError;
diff --git a/node_modules/webpack/lib/WebpackOptionsApply.js b/node_modules/webpack/lib/WebpackOptionsApply.js
new file mode 100644
index 0000000..a80113e
--- /dev/null
+++ b/node_modules/webpack/lib/WebpackOptionsApply.js
@@ -0,0 +1,546 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const OptionsApply = require("./OptionsApply");
+
+const JavascriptModulesPlugin = require("./JavascriptModulesPlugin");
+const JsonModulesPlugin = require("./JsonModulesPlugin");
+const WebAssemblyModulesPlugin = require("./wasm/WebAssemblyModulesPlugin");
+
+const LoaderTargetPlugin = require("./LoaderTargetPlugin");
+const FunctionModulePlugin = require("./FunctionModulePlugin");
+const EvalDevToolModulePlugin = require("./EvalDevToolModulePlugin");
+const SourceMapDevToolPlugin = require("./SourceMapDevToolPlugin");
+const EvalSourceMapDevToolPlugin = require("./EvalSourceMapDevToolPlugin");
+
+const EntryOptionPlugin = require("./EntryOptionPlugin");
+const RecordIdsPlugin = require("./RecordIdsPlugin");
+
+const APIPlugin = require("./APIPlugin");
+const ConstPlugin = require("./ConstPlugin");
+const CommonJsStuffPlugin = require("./CommonJsStuffPlugin");
+const CompatibilityPlugin = require("./CompatibilityPlugin");
+
+const TemplatedPathPlugin = require("./TemplatedPathPlugin");
+const WarnCaseSensitiveModulesPlugin = require("./WarnCaseSensitiveModulesPlugin");
+const UseStrictPlugin = require("./UseStrictPlugin");
+
+const LoaderPlugin = require("./dependencies/LoaderPlugin");
+const CommonJsPlugin = require("./dependencies/CommonJsPlugin");
+const HarmonyModulesPlugin = require("./dependencies/HarmonyModulesPlugin");
+const SystemPlugin = require("./dependencies/SystemPlugin");
+const ImportPlugin = require("./dependencies/ImportPlugin");
+const RequireContextPlugin = require("./dependencies/RequireContextPlugin");
+const RequireEnsurePlugin = require("./dependencies/RequireEnsurePlugin");
+const RequireIncludePlugin = require("./dependencies/RequireIncludePlugin");
+
+const { cachedCleverMerge } = require("./util/cleverMerge");
+
+/** @typedef {import("../declarations/WebpackOptions").WebpackOptions} WebpackOptions */
+/** @typedef {import("./Compiler")} Compiler */
+
+class WebpackOptionsApply extends OptionsApply {
+	constructor() {
+		super();
+	}
+
+	/**
+	 * @param {WebpackOptions} options options object
+	 * @param {Compiler} compiler compiler object
+	 * @returns {WebpackOptions} options object
+	 */
+	process(options, compiler) {
+		let ExternalsPlugin;
+		compiler.outputPath = options.output.path;
+		compiler.recordsInputPath = options.recordsInputPath || options.recordsPath;
+		compiler.recordsOutputPath =
+			options.recordsOutputPath || options.recordsPath;
+		compiler.name = options.name;
+		// TODO webpack 5 refactor this to MultiCompiler.setDependencies() with a WeakMap
+		// @ts-ignore TODO
+		compiler.dependencies = options.dependencies;
+		if (typeof options.target === "string") {
+			let JsonpTemplatePlugin;
+			let FetchCompileWasmTemplatePlugin;
+			let ReadFileCompileWasmTemplatePlugin;
+			let NodeSourcePlugin;
+			let NodeTargetPlugin;
+			let NodeTemplatePlugin;
+
+			switch (options.target) {
+				case "web":
+					JsonpTemplatePlugin = require("./web/JsonpTemplatePlugin");
+					FetchCompileWasmTemplatePlugin = require("./web/FetchCompileWasmTemplatePlugin");
+					NodeSourcePlugin = require("./node/NodeSourcePlugin");
+					new JsonpTemplatePlugin().apply(compiler);
+					new FetchCompileWasmTemplatePlugin({
+						mangleImports: options.optimization.mangleWasmImports
+					}).apply(compiler);
+					new FunctionModulePlugin().apply(compiler);
+					new NodeSourcePlugin(options.node).apply(compiler);
+					new LoaderTargetPlugin(options.target).apply(compiler);
+					break;
+				case "webworker": {
+					let WebWorkerTemplatePlugin = require("./webworker/WebWorkerTemplatePlugin");
+					FetchCompileWasmTemplatePlugin = require("./web/FetchCompileWasmTemplatePlugin");
+					NodeSourcePlugin = require("./node/NodeSourcePlugin");
+					new WebWorkerTemplatePlugin().apply(compiler);
+					new FetchCompileWasmTemplatePlugin({
+						mangleImports: options.optimization.mangleWasmImports
+					}).apply(compiler);
+					new FunctionModulePlugin().apply(compiler);
+					new NodeSourcePlugin(options.node).apply(compiler);
+					new LoaderTargetPlugin(options.target).apply(compiler);
+					break;
+				}
+				case "node":
+				case "async-node":
+					NodeTemplatePlugin = require("./node/NodeTemplatePlugin");
+					ReadFileCompileWasmTemplatePlugin = require("./node/ReadFileCompileWasmTemplatePlugin");
+					NodeTargetPlugin = require("./node/NodeTargetPlugin");
+					new NodeTemplatePlugin({
+						asyncChunkLoading: options.target === "async-node"
+					}).apply(compiler);
+					new ReadFileCompileWasmTemplatePlugin({
+						mangleImports: options.optimization.mangleWasmImports
+					}).apply(compiler);
+					new FunctionModulePlugin().apply(compiler);
+					new NodeTargetPlugin().apply(compiler);
+					new LoaderTargetPlugin("node").apply(compiler);
+					break;
+				case "node-webkit":
+					JsonpTemplatePlugin = require("./web/JsonpTemplatePlugin");
+					NodeTargetPlugin = require("./node/NodeTargetPlugin");
+					ExternalsPlugin = require("./ExternalsPlugin");
+					new JsonpTemplatePlugin().apply(compiler);
+					new FunctionModulePlugin().apply(compiler);
+					new NodeTargetPlugin().apply(compiler);
+					new ExternalsPlugin("commonjs", "nw.gui").apply(compiler);
+					new LoaderTargetPlugin(options.target).apply(compiler);
+					break;
+				case "electron-main":
+					NodeTemplatePlugin = require("./node/NodeTemplatePlugin");
+					NodeTargetPlugin = require("./node/NodeTargetPlugin");
+					ExternalsPlugin = require("./ExternalsPlugin");
+					new NodeTemplatePlugin({
+						asyncChunkLoading: true
+					}).apply(compiler);
+					new FunctionModulePlugin().apply(compiler);
+					new NodeTargetPlugin().apply(compiler);
+					new ExternalsPlugin("commonjs", [
+						"app",
+						"auto-updater",
+						"browser-window",
+						"clipboard",
+						"content-tracing",
+						"crash-reporter",
+						"dialog",
+						"electron",
+						"global-shortcut",
+						"ipc",
+						"ipc-main",
+						"menu",
+						"menu-item",
+						"native-image",
+						"original-fs",
+						"power-monitor",
+						"power-save-blocker",
+						"protocol",
+						"screen",
+						"session",
+						"shell",
+						"tray",
+						"web-contents"
+					]).apply(compiler);
+					new LoaderTargetPlugin(options.target).apply(compiler);
+					break;
+				case "electron-renderer":
+				case "electron-preload":
+					FetchCompileWasmTemplatePlugin = require("./web/FetchCompileWasmTemplatePlugin");
+					NodeTargetPlugin = require("./node/NodeTargetPlugin");
+					ExternalsPlugin = require("./ExternalsPlugin");
+					if (options.target === "electron-renderer") {
+						JsonpTemplatePlugin = require("./web/JsonpTemplatePlugin");
+						new JsonpTemplatePlugin().apply(compiler);
+					} else if (options.target === "electron-preload") {
+						NodeTemplatePlugin = require("./node/NodeTemplatePlugin");
+						new NodeTemplatePlugin({
+							asyncChunkLoading: true
+						}).apply(compiler);
+					}
+					new FetchCompileWasmTemplatePlugin({
+						mangleImports: options.optimization.mangleWasmImports
+					}).apply(compiler);
+					new FunctionModulePlugin().apply(compiler);
+					new NodeTargetPlugin().apply(compiler);
+					new ExternalsPlugin("commonjs", [
+						"clipboard",
+						"crash-reporter",
+						"desktop-capturer",
+						"electron",
+						"ipc",
+						"ipc-renderer",
+						"native-image",
+						"original-fs",
+						"remote",
+						"screen",
+						"shell",
+						"web-frame"
+					]).apply(compiler);
+					new LoaderTargetPlugin(options.target).apply(compiler);
+					break;
+				default:
+					throw new Error("Unsupported target '" + options.target + "'.");
+			}
+		}
+		// @ts-ignore This is always true, which is good this way
+		else if (options.target !== false) {
+			options.target(compiler);
+		} else {
+			throw new Error("Unsupported target '" + options.target + "'.");
+		}
+
+		if (options.output.library || options.output.libraryTarget !== "var") {
+			const LibraryTemplatePlugin = require("./LibraryTemplatePlugin");
+			new LibraryTemplatePlugin(
+				options.output.library,
+				options.output.libraryTarget,
+				options.output.umdNamedDefine,
+				options.output.auxiliaryComment || "",
+				options.output.libraryExport
+			).apply(compiler);
+		}
+		if (options.externals) {
+			ExternalsPlugin = require("./ExternalsPlugin");
+			new ExternalsPlugin(
+				options.output.libraryTarget,
+				options.externals
+			).apply(compiler);
+		}
+
+		let noSources;
+		let legacy;
+		let modern;
+		let comment;
+		if (
+			options.devtool &&
+			(options.devtool.includes("sourcemap") ||
+				options.devtool.includes("source-map"))
+		) {
+			const hidden = options.devtool.includes("hidden");
+			const inline = options.devtool.includes("inline");
+			const evalWrapped = options.devtool.includes("eval");
+			const cheap = options.devtool.includes("cheap");
+			const moduleMaps = options.devtool.includes("module");
+			noSources = options.devtool.includes("nosources");
+			legacy = options.devtool.includes("@");
+			modern = options.devtool.includes("#");
+			comment =
+				legacy && modern
+					? "\n/*\n//@ source" +
+					  "MappingURL=[url]\n//# source" +
+					  "MappingURL=[url]\n*/"
+					: legacy
+					? "\n/*\n//@ source" + "MappingURL=[url]\n*/"
+					: modern
+					? "\n//# source" + "MappingURL=[url]"
+					: null;
+			const Plugin = evalWrapped
+				? EvalSourceMapDevToolPlugin
+				: SourceMapDevToolPlugin;
+			new Plugin({
+				filename: inline ? null : options.output.sourceMapFilename,
+				moduleFilenameTemplate: options.output.devtoolModuleFilenameTemplate,
+				fallbackModuleFilenameTemplate:
+					options.output.devtoolFallbackModuleFilenameTemplate,
+				append: hidden ? false : comment,
+				module: moduleMaps ? true : cheap ? false : true,
+				columns: cheap ? false : true,
+				lineToLine: options.output.devtoolLineToLine,
+				noSources: noSources,
+				namespace: options.output.devtoolNamespace
+			}).apply(compiler);
+		} else if (options.devtool && options.devtool.includes("eval")) {
+			legacy = options.devtool.includes("@");
+			modern = options.devtool.includes("#");
+			comment =
+				legacy && modern
+					? "\n//@ sourceURL=[url]\n//# sourceURL=[url]"
+					: legacy
+					? "\n//@ sourceURL=[url]"
+					: modern
+					? "\n//# sourceURL=[url]"
+					: null;
+			new EvalDevToolModulePlugin({
+				sourceUrlComment: comment,
+				moduleFilenameTemplate: options.output.devtoolModuleFilenameTemplate,
+				namespace: options.output.devtoolNamespace
+			}).apply(compiler);
+		}
+
+		new JavascriptModulesPlugin().apply(compiler);
+		new JsonModulesPlugin().apply(compiler);
+		new WebAssemblyModulesPlugin({
+			mangleImports: options.optimization.mangleWasmImports
+		}).apply(compiler);
+
+		new EntryOptionPlugin().apply(compiler);
+		compiler.hooks.entryOption.call(options.context, options.entry);
+
+		new CompatibilityPlugin().apply(compiler);
+		new HarmonyModulesPlugin(options.module).apply(compiler);
+		if (options.amd !== false) {
+			const AMDPlugin = require("./dependencies/AMDPlugin");
+			const RequireJsStuffPlugin = require("./RequireJsStuffPlugin");
+			new AMDPlugin(options.module, options.amd || {}).apply(compiler);
+			new RequireJsStuffPlugin().apply(compiler);
+		}
+		new CommonJsPlugin(options.module).apply(compiler);
+		new LoaderPlugin().apply(compiler);
+		if (options.node !== false) {
+			const NodeStuffPlugin = require("./NodeStuffPlugin");
+			new NodeStuffPlugin(options.node).apply(compiler);
+		}
+		new CommonJsStuffPlugin().apply(compiler);
+		new APIPlugin().apply(compiler);
+		new ConstPlugin().apply(compiler);
+		new UseStrictPlugin().apply(compiler);
+		new RequireIncludePlugin().apply(compiler);
+		new RequireEnsurePlugin().apply(compiler);
+		new RequireContextPlugin(
+			options.resolve.modules,
+			options.resolve.extensions,
+			options.resolve.mainFiles
+		).apply(compiler);
+		new ImportPlugin(options.module).apply(compiler);
+		new SystemPlugin(options.module).apply(compiler);
+
+		if (typeof options.mode !== "string") {
+			const WarnNoModeSetPlugin = require("./WarnNoModeSetPlugin");
+			new WarnNoModeSetPlugin().apply(compiler);
+		}
+
+		const EnsureChunkConditionsPlugin = require("./optimize/EnsureChunkConditionsPlugin");
+		new EnsureChunkConditionsPlugin().apply(compiler);
+		if (options.optimization.removeAvailableModules) {
+			const RemoveParentModulesPlugin = require("./optimize/RemoveParentModulesPlugin");
+			new RemoveParentModulesPlugin().apply(compiler);
+		}
+		if (options.optimization.removeEmptyChunks) {
+			const RemoveEmptyChunksPlugin = require("./optimize/RemoveEmptyChunksPlugin");
+			new RemoveEmptyChunksPlugin().apply(compiler);
+		}
+		if (options.optimization.mergeDuplicateChunks) {
+			const MergeDuplicateChunksPlugin = require("./optimize/MergeDuplicateChunksPlugin");
+			new MergeDuplicateChunksPlugin().apply(compiler);
+		}
+		if (options.optimization.flagIncludedChunks) {
+			const FlagIncludedChunksPlugin = require("./optimize/FlagIncludedChunksPlugin");
+			new FlagIncludedChunksPlugin().apply(compiler);
+		}
+		if (options.optimization.sideEffects) {
+			const SideEffectsFlagPlugin = require("./optimize/SideEffectsFlagPlugin");
+			new SideEffectsFlagPlugin().apply(compiler);
+		}
+		if (options.optimization.providedExports) {
+			const FlagDependencyExportsPlugin = require("./FlagDependencyExportsPlugin");
+			new FlagDependencyExportsPlugin().apply(compiler);
+		}
+		if (options.optimization.usedExports) {
+			const FlagDependencyUsagePlugin = require("./FlagDependencyUsagePlugin");
+			new FlagDependencyUsagePlugin().apply(compiler);
+		}
+		if (options.optimization.concatenateModules) {
+			const ModuleConcatenationPlugin = require("./optimize/ModuleConcatenationPlugin");
+			new ModuleConcatenationPlugin().apply(compiler);
+		}
+		if (options.optimization.splitChunks) {
+			const SplitChunksPlugin = require("./optimize/SplitChunksPlugin");
+			new SplitChunksPlugin(options.optimization.splitChunks).apply(compiler);
+		}
+		if (options.optimization.runtimeChunk) {
+			const RuntimeChunkPlugin = require("./optimize/RuntimeChunkPlugin");
+			new RuntimeChunkPlugin(options.optimization.runtimeChunk).apply(compiler);
+		}
+		if (options.optimization.noEmitOnErrors) {
+			const NoEmitOnErrorsPlugin = require("./NoEmitOnErrorsPlugin");
+			new NoEmitOnErrorsPlugin().apply(compiler);
+		}
+		if (options.optimization.checkWasmTypes) {
+			const WasmFinalizeExportsPlugin = require("./wasm/WasmFinalizeExportsPlugin");
+			new WasmFinalizeExportsPlugin().apply(compiler);
+		}
+		let moduleIds = options.optimization.moduleIds;
+		if (moduleIds === undefined) {
+			// TODO webpack 5 remove all these options
+			if (options.optimization.occurrenceOrder) {
+				moduleIds = "size";
+			}
+			if (options.optimization.namedModules) {
+				moduleIds = "named";
+			}
+			if (options.optimization.hashedModuleIds) {
+				moduleIds = "hashed";
+			}
+			if (moduleIds === undefined) {
+				moduleIds = "natural";
+			}
+		}
+		if (moduleIds) {
+			const NamedModulesPlugin = require("./NamedModulesPlugin");
+			const HashedModuleIdsPlugin = require("./HashedModuleIdsPlugin");
+			const OccurrenceModuleOrderPlugin = require("./optimize/OccurrenceModuleOrderPlugin");
+			switch (moduleIds) {
+				case "natural":
+					// TODO webpack 5: see hint in Compilation.sortModules
+					break;
+				case "named":
+					new NamedModulesPlugin().apply(compiler);
+					break;
+				case "hashed":
+					new HashedModuleIdsPlugin().apply(compiler);
+					break;
+				case "size":
+					new OccurrenceModuleOrderPlugin({
+						prioritiseInitial: true
+					}).apply(compiler);
+					break;
+				case "total-size":
+					new OccurrenceModuleOrderPlugin({
+						prioritiseInitial: false
+					}).apply(compiler);
+					break;
+				default:
+					throw new Error(
+						`webpack bug: moduleIds: ${moduleIds} is not implemented`
+					);
+			}
+		}
+		let chunkIds = options.optimization.chunkIds;
+		if (chunkIds === undefined) {
+			// TODO webpack 5 remove all these options
+			if (options.optimization.occurrenceOrder) {
+				// This looks weird but it's for backward-compat
+				// This bug already existed before adding this feature
+				chunkIds = "total-size";
+			}
+			if (options.optimization.namedChunks) {
+				chunkIds = "named";
+			}
+			if (chunkIds === undefined) {
+				chunkIds = "natural";
+			}
+		}
+		if (chunkIds) {
+			const NaturalChunkOrderPlugin = require("./optimize/NaturalChunkOrderPlugin");
+			const NamedChunksPlugin = require("./NamedChunksPlugin");
+			const OccurrenceChunkOrderPlugin = require("./optimize/OccurrenceChunkOrderPlugin");
+			switch (chunkIds) {
+				case "natural":
+					new NaturalChunkOrderPlugin().apply(compiler);
+					break;
+				case "named":
+					// TODO webapck 5: for backward-compat this need to have OccurrenceChunkOrderPlugin too
+					// The NamedChunksPlugin doesn't give every chunk a name
+					// This should be fixed, and the OccurrenceChunkOrderPlugin should be removed here.
+					new OccurrenceChunkOrderPlugin({
+						prioritiseInitial: false
+					}).apply(compiler);
+					new NamedChunksPlugin().apply(compiler);
+					break;
+				case "size":
+					new OccurrenceChunkOrderPlugin({
+						prioritiseInitial: true
+					}).apply(compiler);
+					break;
+				case "total-size":
+					new OccurrenceChunkOrderPlugin({
+						prioritiseInitial: false
+					}).apply(compiler);
+					break;
+				default:
+					throw new Error(
+						`webpack bug: chunkIds: ${chunkIds} is not implemented`
+					);
+			}
+		}
+		if (options.optimization.nodeEnv) {
+			const DefinePlugin = require("./DefinePlugin");
+			new DefinePlugin({
+				"process.env.NODE_ENV": JSON.stringify(options.optimization.nodeEnv)
+			}).apply(compiler);
+		}
+		if (options.optimization.minimize) {
+			for (const minimizer of options.optimization.minimizer) {
+				if (typeof minimizer === "function") {
+					minimizer.call(compiler, compiler);
+				} else {
+					minimizer.apply(compiler);
+				}
+			}
+		}
+
+		if (options.performance) {
+			const SizeLimitsPlugin = require("./performance/SizeLimitsPlugin");
+			new SizeLimitsPlugin(options.performance).apply(compiler);
+		}
+
+		new TemplatedPathPlugin().apply(compiler);
+
+		new RecordIdsPlugin({
+			portableIds: options.optimization.portableRecords
+		}).apply(compiler);
+
+		new WarnCaseSensitiveModulesPlugin().apply(compiler);
+
+		if (options.cache) {
+			const CachePlugin = require("./CachePlugin");
+			new CachePlugin(
+				typeof options.cache === "object" ? options.cache : null
+			).apply(compiler);
+		}
+
+		compiler.hooks.afterPlugins.call(compiler);
+		if (!compiler.inputFileSystem) {
+			throw new Error("No input filesystem provided");
+		}
+		compiler.resolverFactory.hooks.resolveOptions
+			.for("normal")
+			.tap("WebpackOptionsApply", resolveOptions => {
+				return Object.assign(
+					{
+						fileSystem: compiler.inputFileSystem
+					},
+					cachedCleverMerge(options.resolve, resolveOptions)
+				);
+			});
+		compiler.resolverFactory.hooks.resolveOptions
+			.for("context")
+			.tap("WebpackOptionsApply", resolveOptions => {
+				return Object.assign(
+					{
+						fileSystem: compiler.inputFileSystem,
+						resolveToContext: true
+					},
+					cachedCleverMerge(options.resolve, resolveOptions)
+				);
+			});
+		compiler.resolverFactory.hooks.resolveOptions
+			.for("loader")
+			.tap("WebpackOptionsApply", resolveOptions => {
+				return Object.assign(
+					{
+						fileSystem: compiler.inputFileSystem
+					},
+					cachedCleverMerge(options.resolveLoader, resolveOptions)
+				);
+			});
+		compiler.hooks.afterResolvers.call(compiler);
+		return options;
+	}
+}
+
+module.exports = WebpackOptionsApply;
diff --git a/node_modules/webpack/lib/WebpackOptionsDefaulter.js b/node_modules/webpack/lib/WebpackOptionsDefaulter.js
new file mode 100644
index 0000000..cb5541e
--- /dev/null
+++ b/node_modules/webpack/lib/WebpackOptionsDefaulter.js
@@ -0,0 +1,381 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+
+const OptionsDefaulter = require("./OptionsDefaulter");
+const Template = require("./Template");
+
+const isProductionLikeMode = options => {
+	return options.mode === "production" || !options.mode;
+};
+
+const isWebLikeTarget = options => {
+	return options.target === "web" || options.target === "webworker";
+};
+
+const getDevtoolNamespace = library => {
+	// if options.output.library is a string
+	if (Array.isArray(library)) {
+		return library.join(".");
+	} else if (typeof library === "object") {
+		return getDevtoolNamespace(library.root);
+	}
+	return library || "";
+};
+
+class WebpackOptionsDefaulter extends OptionsDefaulter {
+	constructor() {
+		super();
+
+		this.set("entry", "./src");
+
+		this.set("devtool", "make", options =>
+			options.mode === "development" ? "eval" : false
+		);
+		this.set("cache", "make", options => options.mode === "development");
+
+		this.set("context", process.cwd());
+		this.set("target", "web");
+
+		this.set("module", "call", value => Object.assign({}, value));
+		this.set("module.unknownContextRequest", ".");
+		this.set("module.unknownContextRegExp", false);
+		this.set("module.unknownContextRecursive", true);
+		this.set("module.unknownContextCritical", true);
+		this.set("module.exprContextRequest", ".");
+		this.set("module.exprContextRegExp", false);
+		this.set("module.exprContextRecursive", true);
+		this.set("module.exprContextCritical", true);
+		this.set("module.wrappedContextRegExp", /.*/);
+		this.set("module.wrappedContextRecursive", true);
+		this.set("module.wrappedContextCritical", false);
+		this.set("module.strictExportPresence", false);
+		this.set("module.strictThisContextOnImports", false);
+		this.set("module.unsafeCache", "make", options => !!options.cache);
+		this.set("module.rules", []);
+		this.set("module.defaultRules", "make", options => [
+			{
+				type: "javascript/auto",
+				resolve: {}
+			},
+			{
+				test: /\.mjs$/i,
+				type: "javascript/esm",
+				resolve: {
+					mainFields:
+						options.target === "web" ||
+						options.target === "webworker" ||
+						options.target === "electron-renderer"
+							? ["browser", "main"]
+							: ["main"]
+				}
+			},
+			{
+				test: /\.json$/i,
+				type: "json"
+			},
+			{
+				test: /\.wasm$/i,
+				type: "webassembly/experimental"
+			}
+		]);
+
+		this.set("output", "call", (value, options) => {
+			if (typeof value === "string") {
+				return {
+					filename: value
+				};
+			} else if (typeof value !== "object") {
+				return {};
+			} else {
+				return Object.assign({}, value);
+			}
+		});
+
+		this.set("output.filename", "[name].js");
+		this.set("output.chunkFilename", "make", options => {
+			const filename = options.output.filename;
+			if (typeof filename !== "function") {
+				const hasName = filename.includes("[name]");
+				const hasId = filename.includes("[id]");
+				const hasChunkHash = filename.includes("[chunkhash]");
+				// Anything changing depending on chunk is fine
+				if (hasChunkHash || hasName || hasId) return filename;
+				// Elsewise prefix "[id]." in front of the basename to make it changing
+				return filename.replace(/(^|\/)([^/]*(?:\?|$))/, "$1[id].$2");
+			}
+			return "[id].js";
+		});
+		this.set("output.webassemblyModuleFilename", "[modulehash].module.wasm");
+		this.set("output.library", "");
+		this.set("output.hotUpdateFunction", "make", options => {
+			return Template.toIdentifier(
+				"webpackHotUpdate" + Template.toIdentifier(options.output.library)
+			);
+		});
+		this.set("output.jsonpFunction", "make", options => {
+			return Template.toIdentifier(
+				"webpackJsonp" + Template.toIdentifier(options.output.library)
+			);
+		});
+		this.set("output.chunkCallbackName", "make", options => {
+			return Template.toIdentifier(
+				"webpackChunk" + Template.toIdentifier(options.output.library)
+			);
+		});
+		this.set("output.globalObject", "make", options => {
+			switch (options.target) {
+				case "web":
+				case "electron-renderer":
+				case "node-webkit":
+					return "window";
+				case "webworker":
+					return "self";
+				case "node":
+				case "async-node":
+				case "electron-main":
+					return "global";
+				default:
+					return "self";
+			}
+		});
+		this.set("output.devtoolNamespace", "make", options => {
+			return getDevtoolNamespace(options.output.library);
+		});
+		this.set("output.libraryTarget", "var");
+		this.set("output.path", path.join(process.cwd(), "dist"));
+		this.set(
+			"output.pathinfo",
+			"make",
+			options => options.mode === "development"
+		);
+		this.set("output.sourceMapFilename", "[file].map[query]");
+		this.set("output.hotUpdateChunkFilename", "[id].[hash].hot-update.js");
+		this.set("output.hotUpdateMainFilename", "[hash].hot-update.json");
+		this.set("output.crossOriginLoading", false);
+		this.set("output.jsonpScriptType", false);
+		this.set("output.chunkLoadTimeout", 120000);
+		this.set("output.hashFunction", "md4");
+		this.set("output.hashDigest", "hex");
+		this.set("output.hashDigestLength", 20);
+		this.set("output.devtoolLineToLine", false);
+		this.set("output.strictModuleExceptionHandling", false);
+
+		this.set("node", "call", value => {
+			if (typeof value === "boolean") {
+				return value;
+			} else {
+				return Object.assign({}, value);
+			}
+		});
+		this.set("node.console", false);
+		this.set("node.process", true);
+		this.set("node.global", true);
+		this.set("node.Buffer", true);
+		this.set("node.setImmediate", true);
+		this.set("node.__filename", "mock");
+		this.set("node.__dirname", "mock");
+
+		this.set("performance", "call", (value, options) => {
+			if (value === false) return false;
+			if (
+				value === undefined &&
+				(!isProductionLikeMode(options) || !isWebLikeTarget(options))
+			)
+				return false;
+			return Object.assign({}, value);
+		});
+		this.set("performance.maxAssetSize", 250000);
+		this.set("performance.maxEntrypointSize", 250000);
+		this.set("performance.hints", "make", options =>
+			isProductionLikeMode(options) ? "warning" : false
+		);
+
+		this.set("optimization", "call", value => Object.assign({}, value));
+		// TODO webpack 5: Disable by default in a modes
+		this.set(
+			"optimization.removeAvailableModules",
+			"make",
+			options => options.mode !== "development"
+		);
+		this.set("optimization.removeEmptyChunks", true);
+		this.set("optimization.mergeDuplicateChunks", true);
+		this.set("optimization.flagIncludedChunks", "make", options =>
+			isProductionLikeMode(options)
+		);
+		// TODO webpack 5 add `moduleIds: "named"` default for development
+		// TODO webpack 5 add `moduleIds: "size"` default for production
+		// TODO webpack 5 remove optimization.occurrenceOrder
+		this.set("optimization.occurrenceOrder", "make", options =>
+			isProductionLikeMode(options)
+		);
+		this.set("optimization.sideEffects", "make", options =>
+			isProductionLikeMode(options)
+		);
+		this.set("optimization.providedExports", true);
+		this.set("optimization.usedExports", "make", options =>
+			isProductionLikeMode(options)
+		);
+		this.set("optimization.concatenateModules", "make", options =>
+			isProductionLikeMode(options)
+		);
+		this.set("optimization.splitChunks", {});
+		this.set("optimization.splitChunks.hidePathInfo", "make", options => {
+			return isProductionLikeMode(options);
+		});
+		this.set("optimization.splitChunks.chunks", "async");
+		this.set("optimization.splitChunks.minSize", "make", options => {
+			return isProductionLikeMode(options) ? 30000 : 10000;
+		});
+		this.set("optimization.splitChunks.minChunks", 1);
+		this.set("optimization.splitChunks.maxAsyncRequests", "make", options => {
+			return isProductionLikeMode(options) ? 5 : Infinity;
+		});
+		this.set("optimization.splitChunks.automaticNameDelimiter", "~");
+		this.set("optimization.splitChunks.automaticNameMaxLength", 109);
+		this.set("optimization.splitChunks.maxInitialRequests", "make", options => {
+			return isProductionLikeMode(options) ? 3 : Infinity;
+		});
+		this.set("optimization.splitChunks.name", true);
+		this.set("optimization.splitChunks.cacheGroups", {});
+		this.set("optimization.splitChunks.cacheGroups.default", {
+			automaticNamePrefix: "",
+			reuseExistingChunk: true,
+			minChunks: 2,
+			priority: -20
+		});
+		this.set("optimization.splitChunks.cacheGroups.vendors", {
+			automaticNamePrefix: "vendors",
+			test: /[\\/]node_modules[\\/]/,
+			priority: -10
+		});
+		this.set("optimization.runtimeChunk", "call", value => {
+			if (value === "single") {
+				return {
+					name: "runtime"
+				};
+			}
+			if (value === true || value === "multiple") {
+				return {
+					name: entrypoint => `runtime~${entrypoint.name}`
+				};
+			}
+			return value;
+		});
+		this.set("optimization.noEmitOnErrors", "make", options =>
+			isProductionLikeMode(options)
+		);
+		this.set("optimization.checkWasmTypes", "make", options =>
+			isProductionLikeMode(options)
+		);
+		this.set("optimization.mangleWasmImports", false);
+		// TODO webpack 5 remove optimization.namedModules
+		this.set(
+			"optimization.namedModules",
+			"make",
+			options => options.mode === "development"
+		);
+		this.set("optimization.hashedModuleIds", false);
+		// TODO webpack 5 add `chunkIds: "named"` default for development
+		// TODO webpack 5 add `chunkIds: "size"` default for production
+		// TODO webpack 5 remove optimization.namedChunks
+		this.set(
+			"optimization.namedChunks",
+			"make",
+			options => options.mode === "development"
+		);
+		this.set(
+			"optimization.portableRecords",
+			"make",
+			options =>
+				!!(
+					options.recordsInputPath ||
+					options.recordsOutputPath ||
+					options.recordsPath
+				)
+		);
+		this.set("optimization.minimize", "make", options =>
+			isProductionLikeMode(options)
+		);
+		this.set("optimization.minimizer", "make", options => [
+			{
+				apply: compiler => {
+					// Lazy load the Terser plugin
+					const TerserPlugin = require("terser-webpack-plugin");
+					const SourceMapDevToolPlugin = require("./SourceMapDevToolPlugin");
+					new TerserPlugin({
+						cache: true,
+						parallel: true,
+						sourceMap:
+							(options.devtool && /source-?map/.test(options.devtool)) ||
+							(options.plugins &&
+								options.plugins.some(p => p instanceof SourceMapDevToolPlugin))
+					}).apply(compiler);
+				}
+			}
+		]);
+		this.set("optimization.nodeEnv", "make", options => {
+			// TODO: In webpack 5, it should return `false` when mode is `none`
+			return options.mode || "production";
+		});
+
+		this.set("resolve", "call", value => Object.assign({}, value));
+		this.set("resolve.unsafeCache", true);
+		this.set("resolve.modules", ["node_modules"]);
+		this.set("resolve.extensions", [".wasm", ".mjs", ".js", ".json"]);
+		this.set("resolve.mainFiles", ["index"]);
+		this.set("resolve.aliasFields", "make", options => {
+			if (
+				options.target === "web" ||
+				options.target === "webworker" ||
+				options.target === "electron-renderer"
+			) {
+				return ["browser"];
+			} else {
+				return [];
+			}
+		});
+		this.set("resolve.mainFields", "make", options => {
+			if (
+				options.target === "web" ||
+				options.target === "webworker" ||
+				options.target === "electron-renderer"
+			) {
+				return ["browser", "module", "main"];
+			} else {
+				return ["module", "main"];
+			}
+		});
+		this.set("resolve.cacheWithContext", "make", options => {
+			return (
+				Array.isArray(options.resolve.plugins) &&
+				options.resolve.plugins.length > 0
+			);
+		});
+
+		this.set("resolveLoader", "call", value => Object.assign({}, value));
+		this.set("resolveLoader.unsafeCache", true);
+		this.set("resolveLoader.mainFields", ["loader", "main"]);
+		this.set("resolveLoader.extensions", [".js", ".json"]);
+		this.set("resolveLoader.mainFiles", ["index"]);
+		this.set("resolveLoader.roots", "make", options => [options.context]);
+		this.set("resolveLoader.cacheWithContext", "make", options => {
+			return (
+				Array.isArray(options.resolveLoader.plugins) &&
+				options.resolveLoader.plugins.length > 0
+			);
+		});
+
+		this.set("infrastructureLogging", "call", value =>
+			Object.assign({}, value)
+		);
+		this.set("infrastructureLogging.level", "info");
+		this.set("infrastructureLogging.debug", false);
+	}
+}
+
+module.exports = WebpackOptionsDefaulter;
diff --git a/node_modules/webpack/lib/WebpackOptionsValidationError.js b/node_modules/webpack/lib/WebpackOptionsValidationError.js
new file mode 100644
index 0000000..5f5da57
--- /dev/null
+++ b/node_modules/webpack/lib/WebpackOptionsValidationError.js
@@ -0,0 +1,390 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Gajus Kuizinas @gajus
+*/
+"use strict";
+
+const WebpackError = require("./WebpackError");
+const webpackOptionsSchema = require("../schemas/WebpackOptions.json");
+
+const getSchemaPart = (path, parents, additionalPath) => {
+	parents = parents || 0;
+	path = path.split("/");
+	path = path.slice(0, path.length - parents);
+	if (additionalPath) {
+		additionalPath = additionalPath.split("/");
+		path = path.concat(additionalPath);
+	}
+	let schemaPart = webpackOptionsSchema;
+	for (let i = 1; i < path.length; i++) {
+		const inner = schemaPart[path[i]];
+		if (inner) schemaPart = inner;
+	}
+	return schemaPart;
+};
+
+const getSchemaPartText = (schemaPart, additionalPath) => {
+	if (additionalPath) {
+		for (let i = 0; i < additionalPath.length; i++) {
+			const inner = schemaPart[additionalPath[i]];
+			if (inner) schemaPart = inner;
+		}
+	}
+	while (schemaPart.$ref) {
+		schemaPart = getSchemaPart(schemaPart.$ref);
+	}
+	let schemaText = WebpackOptionsValidationError.formatSchema(schemaPart);
+	if (schemaPart.description) {
+		schemaText += `\n-> ${schemaPart.description}`;
+	}
+	return schemaText;
+};
+
+const getSchemaPartDescription = schemaPart => {
+	while (schemaPart.$ref) {
+		schemaPart = getSchemaPart(schemaPart.$ref);
+	}
+	if (schemaPart.description) {
+		return `\n-> ${schemaPart.description}`;
+	}
+	return "";
+};
+
+const SPECIFICITY = {
+	type: 1,
+	oneOf: 1,
+	anyOf: 1,
+	allOf: 1,
+	additionalProperties: 2,
+	enum: 1,
+	instanceof: 1,
+	required: 2,
+	minimum: 2,
+	uniqueItems: 2,
+	minLength: 2,
+	minItems: 2,
+	minProperties: 2,
+	absolutePath: 2
+};
+
+const filterMax = (array, fn) => {
+	const max = array.reduce((max, item) => Math.max(max, fn(item)), 0);
+	return array.filter(item => fn(item) === max);
+};
+
+const filterChildren = children => {
+	children = filterMax(children, err =>
+		err.dataPath ? err.dataPath.length : 0
+	);
+	children = filterMax(children, err => SPECIFICITY[err.keyword] || 2);
+	return children;
+};
+
+const indent = (str, prefix, firstLine) => {
+	if (firstLine) {
+		return prefix + str.replace(/\n(?!$)/g, "\n" + prefix);
+	} else {
+		return str.replace(/\n(?!$)/g, `\n${prefix}`);
+	}
+};
+
+class WebpackOptionsValidationError extends WebpackError {
+	constructor(validationErrors) {
+		super(
+			"Invalid configuration object. " +
+				"Webpack has been initialised using a configuration object that does not match the API schema.\n" +
+				validationErrors
+					.map(
+						err =>
+							" - " +
+							indent(
+								WebpackOptionsValidationError.formatValidationError(err),
+								"   ",
+								false
+							)
+					)
+					.join("\n")
+		);
+
+		this.name = "WebpackOptionsValidationError";
+		this.validationErrors = validationErrors;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+
+	static formatSchema(schema, prevSchemas) {
+		prevSchemas = prevSchemas || [];
+
+		const formatInnerSchema = (innerSchema, addSelf) => {
+			if (!addSelf) {
+				return WebpackOptionsValidationError.formatSchema(
+					innerSchema,
+					prevSchemas
+				);
+			}
+			if (prevSchemas.includes(innerSchema)) {
+				return "(recursive)";
+			}
+			return WebpackOptionsValidationError.formatSchema(
+				innerSchema,
+				prevSchemas.concat(schema)
+			);
+		};
+
+		if (schema.type === "string") {
+			if (schema.minLength === 1) {
+				return "non-empty string";
+			}
+			if (schema.minLength > 1) {
+				return `string (min length ${schema.minLength})`;
+			}
+			return "string";
+		}
+		if (schema.type === "boolean") {
+			return "boolean";
+		}
+		if (schema.type === "number") {
+			return "number";
+		}
+		if (schema.type === "object") {
+			if (schema.properties) {
+				const required = schema.required || [];
+				return `object { ${Object.keys(schema.properties)
+					.map(property => {
+						if (!required.includes(property)) return property + "?";
+						return property;
+					})
+					.concat(schema.additionalProperties ? ["…"] : [])
+					.join(", ")} }`;
+			}
+			if (schema.additionalProperties) {
+				return `object { <key>: ${formatInnerSchema(
+					schema.additionalProperties
+				)} }`;
+			}
+			return "object";
+		}
+		if (schema.type === "array") {
+			return `[${formatInnerSchema(schema.items)}]`;
+		}
+
+		switch (schema.instanceof) {
+			case "Function":
+				return "function";
+			case "RegExp":
+				return "RegExp";
+		}
+
+		if (schema.enum) {
+			return schema.enum.map(item => JSON.stringify(item)).join(" | ");
+		}
+
+		if (schema.$ref) {
+			return formatInnerSchema(getSchemaPart(schema.$ref), true);
+		}
+		if (schema.allOf) {
+			return schema.allOf.map(formatInnerSchema).join(" & ");
+		}
+		if (schema.oneOf) {
+			return schema.oneOf.map(formatInnerSchema).join(" | ");
+		}
+		if (schema.anyOf) {
+			return schema.anyOf.map(formatInnerSchema).join(" | ");
+		}
+		return JSON.stringify(schema, null, 2);
+	}
+
+	static formatValidationError(err) {
+		const dataPath = `configuration${err.dataPath}`;
+		if (err.keyword === "additionalProperties") {
+			const baseMessage = `${dataPath} has an unknown property '${
+				err.params.additionalProperty
+			}'. These properties are valid:\n${getSchemaPartText(err.parentSchema)}`;
+			if (!err.dataPath) {
+				switch (err.params.additionalProperty) {
+					case "debug":
+						return (
+							`${baseMessage}\n` +
+							"The 'debug' property was removed in webpack 2.0.0.\n" +
+							"Loaders should be updated to allow passing this option via loader options in module.rules.\n" +
+							"Until loaders are updated one can use the LoaderOptionsPlugin to switch loaders into debug mode:\n" +
+							"plugins: [\n" +
+							"  new webpack.LoaderOptionsPlugin({\n" +
+							"    debug: true\n" +
+							"  })\n" +
+							"]"
+						);
+				}
+				return (
+					`${baseMessage}\n` +
+					"For typos: please correct them.\n" +
+					"For loader options: webpack >= v2.0.0 no longer allows custom properties in configuration.\n" +
+					"  Loaders should be updated to allow passing options via loader options in module.rules.\n" +
+					"  Until loaders are updated one can use the LoaderOptionsPlugin to pass these options to the loader:\n" +
+					"  plugins: [\n" +
+					"    new webpack.LoaderOptionsPlugin({\n" +
+					"      // test: /\\.xxx$/, // may apply this only for some modules\n" +
+					"      options: {\n" +
+					`        ${err.params.additionalProperty}: …\n` +
+					"      }\n" +
+					"    })\n" +
+					"  ]"
+				);
+			}
+			return baseMessage;
+		} else if (err.keyword === "oneOf" || err.keyword === "anyOf") {
+			if (err.children && err.children.length > 0) {
+				if (err.schema.length === 1) {
+					const lastChild = err.children[err.children.length - 1];
+					const remainingChildren = err.children.slice(
+						0,
+						err.children.length - 1
+					);
+					return WebpackOptionsValidationError.formatValidationError(
+						Object.assign({}, lastChild, {
+							children: remainingChildren,
+							parentSchema: Object.assign(
+								{},
+								err.parentSchema,
+								lastChild.parentSchema
+							)
+						})
+					);
+				}
+				const children = filterChildren(err.children);
+				if (children.length === 1) {
+					return WebpackOptionsValidationError.formatValidationError(
+						children[0]
+					);
+				}
+				return (
+					`${dataPath} should be one of these:\n${getSchemaPartText(
+						err.parentSchema
+					)}\n` +
+					`Details:\n${children
+						.map(
+							err =>
+								" * " +
+								indent(
+									WebpackOptionsValidationError.formatValidationError(err),
+									"   ",
+									false
+								)
+						)
+						.join("\n")}`
+				);
+			}
+			return `${dataPath} should be one of these:\n${getSchemaPartText(
+				err.parentSchema
+			)}`;
+		} else if (err.keyword === "enum") {
+			if (
+				err.parentSchema &&
+				err.parentSchema.enum &&
+				err.parentSchema.enum.length === 1
+			) {
+				return `${dataPath} should be ${getSchemaPartText(err.parentSchema)}`;
+			}
+			return `${dataPath} should be one of these:\n${getSchemaPartText(
+				err.parentSchema
+			)}`;
+		} else if (err.keyword === "allOf") {
+			return `${dataPath} should be:\n${getSchemaPartText(err.parentSchema)}`;
+		} else if (err.keyword === "type") {
+			switch (err.params.type) {
+				case "object":
+					return `${dataPath} should be an object.${getSchemaPartDescription(
+						err.parentSchema
+					)}`;
+				case "string":
+					return `${dataPath} should be a string.${getSchemaPartDescription(
+						err.parentSchema
+					)}`;
+				case "boolean":
+					return `${dataPath} should be a boolean.${getSchemaPartDescription(
+						err.parentSchema
+					)}`;
+				case "number":
+					return `${dataPath} should be a number.${getSchemaPartDescription(
+						err.parentSchema
+					)}`;
+				case "array":
+					return `${dataPath} should be an array:\n${getSchemaPartText(
+						err.parentSchema
+					)}`;
+			}
+			return `${dataPath} should be ${err.params.type}:\n${getSchemaPartText(
+				err.parentSchema
+			)}`;
+		} else if (err.keyword === "instanceof") {
+			return `${dataPath} should be an instance of ${getSchemaPartText(
+				err.parentSchema
+			)}`;
+		} else if (err.keyword === "required") {
+			const missingProperty = err.params.missingProperty.replace(/^\./, "");
+			return `${dataPath} misses the property '${missingProperty}'.\n${getSchemaPartText(
+				err.parentSchema,
+				["properties", missingProperty]
+			)}`;
+		} else if (err.keyword === "minimum") {
+			return `${dataPath} ${err.message}.${getSchemaPartDescription(
+				err.parentSchema
+			)}`;
+		} else if (err.keyword === "uniqueItems") {
+			return `${dataPath} should not contain the item '${
+				err.data[err.params.i]
+			}' twice.${getSchemaPartDescription(err.parentSchema)}`;
+		} else if (
+			err.keyword === "minLength" ||
+			err.keyword === "minItems" ||
+			err.keyword === "minProperties"
+		) {
+			if (err.params.limit === 1) {
+				switch (err.keyword) {
+					case "minLength":
+						return `${dataPath} should be an non-empty string.${getSchemaPartDescription(
+							err.parentSchema
+						)}`;
+					case "minItems":
+						return `${dataPath} should be an non-empty array.${getSchemaPartDescription(
+							err.parentSchema
+						)}`;
+					case "minProperties":
+						return `${dataPath} should be an non-empty object.${getSchemaPartDescription(
+							err.parentSchema
+						)}`;
+				}
+				return `${dataPath} should be not empty.${getSchemaPartDescription(
+					err.parentSchema
+				)}`;
+			} else {
+				return `${dataPath} ${err.message}${getSchemaPartDescription(
+					err.parentSchema
+				)}`;
+			}
+		} else if (err.keyword === "not") {
+			return `${dataPath} should not be ${getSchemaPartText(
+				err.schema
+			)}\n${getSchemaPartText(err.parentSchema)}`;
+		} else if (err.keyword === "absolutePath") {
+			const baseMessage = `${dataPath}: ${
+				err.message
+			}${getSchemaPartDescription(err.parentSchema)}`;
+			if (dataPath === "configuration.output.filename") {
+				return (
+					`${baseMessage}\n` +
+					"Please use output.path to specify absolute path and output.filename for the file name."
+				);
+			}
+			return baseMessage;
+		} else {
+			return `${dataPath} ${err.message} (${JSON.stringify(
+				err,
+				null,
+				2
+			)}).\n${getSchemaPartText(err.parentSchema)}`;
+		}
+	}
+}
+
+module.exports = WebpackOptionsValidationError;
diff --git a/node_modules/webpack/lib/buildChunkGraph.js b/node_modules/webpack/lib/buildChunkGraph.js
new file mode 100644
index 0000000..4198441
--- /dev/null
+++ b/node_modules/webpack/lib/buildChunkGraph.js
@@ -0,0 +1,712 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const AsyncDependencyToInitialChunkError = require("./AsyncDependencyToInitialChunkError");
+const GraphHelpers = require("./GraphHelpers");
+
+/** @typedef {import("./AsyncDependenciesBlock")} AsyncDependenciesBlock */
+/** @typedef {import("./Chunk")} Chunk */
+/** @typedef {import("./ChunkGroup")} ChunkGroup */
+/** @typedef {import("./Compilation")} Compilation */
+/** @typedef {import("./DependenciesBlock")} DependenciesBlock */
+/** @typedef {import("./Dependency")} Dependency */
+/** @typedef {import("./Entrypoint")} Entrypoint */
+/** @typedef {import("./Module")} Module */
+
+/**
+ * @typedef {Object} QueueItem
+ * @property {number} action
+ * @property {DependenciesBlock} block
+ * @property {Module} module
+ * @property {Chunk} chunk
+ * @property {ChunkGroup} chunkGroup
+ */
+
+/**
+ * @typedef {Object} ChunkGroupInfo
+ * @property {ChunkGroup} chunkGroup the chunk group
+ * @property {Set<Module>} minAvailableModules current minimal set of modules available at this point
+ * @property {boolean} minAvailableModulesOwned true, if minAvailableModules is owned and can be modified
+ * @property {Set<Module>[]} availableModulesToBeMerged enqueued updates to the minimal set of available modules
+ * @property {QueueItem[]} skippedItems queue items that were skipped because module is already available in parent chunks (need to reconsider when minAvailableModules is shrinking)
+ * @property {Set<Module>} resultingAvailableModules set of modules available including modules from this chunk group
+ * @property {Set<ChunkGroup>} children set of children chunk groups, that will be revisited when availableModules shrink
+ */
+
+/**
+ * @typedef {Object} BlockChunkGroupConnection
+ * @property {ChunkGroupInfo} originChunkGroupInfo origin chunk group
+ * @property {ChunkGroup} chunkGroup referenced chunk group
+ */
+
+/**
+ * @template T
+ * @param {Set<T>} a first set
+ * @param {Set<T>} b second set
+ * @returns {number} cmp
+ */
+const bySetSize = (a, b) => {
+	return b.size - a.size;
+};
+
+/**
+ * Extracts simplified info from the modules and their dependencies
+ * @param {Compilation} compilation the compilation
+ * @returns {Map<DependenciesBlock, { modules: Iterable<Module>, blocks: AsyncDependenciesBlock[]}>} the mapping block to modules and inner blocks
+ */
+const extraceBlockInfoMap = compilation => {
+	/** @type {Map<DependenciesBlock, { modules: Iterable<Module>, blocks: AsyncDependenciesBlock[]}>} */
+	const blockInfoMap = new Map();
+
+	/**
+	 * @param {Dependency} d dependency to iterate over
+	 * @returns {void}
+	 */
+	const iteratorDependency = d => {
+		// We skip Dependencies without Reference
+		const ref = compilation.getDependencyReference(currentModule, d);
+		if (!ref) {
+			return;
+		}
+		// We skip Dependencies without Module pointer
+		const refModule = ref.module;
+		if (!refModule) {
+			return;
+		}
+		// We skip weak Dependencies
+		if (ref.weak) {
+			return;
+		}
+
+		blockInfoModules.add(refModule);
+	};
+
+	/**
+	 * @param {AsyncDependenciesBlock} b blocks to prepare
+	 * @returns {void}
+	 */
+	const iteratorBlockPrepare = b => {
+		blockInfoBlocks.push(b);
+		blockQueue.push(b);
+	};
+
+	/** @type {Module} */
+	let currentModule;
+	/** @type {DependenciesBlock} */
+	let block;
+	/** @type {DependenciesBlock[]} */
+	let blockQueue;
+	/** @type {Set<Module>} */
+	let blockInfoModules;
+	/** @type {AsyncDependenciesBlock[]} */
+	let blockInfoBlocks;
+
+	for (const module of compilation.modules) {
+		blockQueue = [module];
+		currentModule = module;
+		while (blockQueue.length > 0) {
+			block = blockQueue.pop();
+			blockInfoModules = new Set();
+			blockInfoBlocks = [];
+
+			if (block.variables) {
+				for (const variable of block.variables) {
+					for (const dep of variable.dependencies) iteratorDependency(dep);
+				}
+			}
+
+			if (block.dependencies) {
+				for (const dep of block.dependencies) iteratorDependency(dep);
+			}
+
+			if (block.blocks) {
+				for (const b of block.blocks) iteratorBlockPrepare(b);
+			}
+
+			const blockInfo = {
+				modules: blockInfoModules,
+				blocks: blockInfoBlocks
+			};
+			blockInfoMap.set(block, blockInfo);
+		}
+	}
+
+	return blockInfoMap;
+};
+
+/**
+ *
+ * @param {Compilation} compilation the compilation
+ * @param {Entrypoint[]} inputChunkGroups input groups
+ * @param {Map<ChunkGroup, ChunkGroupInfo>} chunkGroupInfoMap mapping from chunk group to available modules
+ * @param {Map<AsyncDependenciesBlock, BlockChunkGroupConnection[]>} blockConnections connection for blocks
+ * @param {Set<DependenciesBlock>} blocksWithNestedBlocks flag for blocks that have nested blocks
+ * @param {Set<ChunkGroup>} allCreatedChunkGroups filled with all chunk groups that are created here
+ */
+const visitModules = (
+	compilation,
+	inputChunkGroups,
+	chunkGroupInfoMap,
+	blockConnections,
+	blocksWithNestedBlocks,
+	allCreatedChunkGroups
+) => {
+	const logger = compilation.getLogger("webpack.buildChunkGraph.visitModules");
+	const { namedChunkGroups } = compilation;
+
+	logger.time("prepare");
+	const blockInfoMap = extraceBlockInfoMap(compilation);
+
+	/** @type {Map<ChunkGroup, { index: number, index2: number }>} */
+	const chunkGroupCounters = new Map();
+	for (const chunkGroup of inputChunkGroups) {
+		chunkGroupCounters.set(chunkGroup, {
+			index: 0,
+			index2: 0
+		});
+	}
+
+	let nextFreeModuleIndex = 0;
+	let nextFreeModuleIndex2 = 0;
+
+	/** @type {Map<DependenciesBlock, ChunkGroup>} */
+	const blockChunkGroups = new Map();
+
+	const ADD_AND_ENTER_MODULE = 0;
+	const ENTER_MODULE = 1;
+	const PROCESS_BLOCK = 2;
+	const LEAVE_MODULE = 3;
+
+	/**
+	 * @param {QueueItem[]} queue the queue array (will be mutated)
+	 * @param {ChunkGroup} chunkGroup chunk group
+	 * @returns {QueueItem[]} the queue array again
+	 */
+	const reduceChunkGroupToQueueItem = (queue, chunkGroup) => {
+		for (const chunk of chunkGroup.chunks) {
+			const module = chunk.entryModule;
+			queue.push({
+				action: ENTER_MODULE,
+				block: module,
+				module,
+				chunk,
+				chunkGroup
+			});
+		}
+		chunkGroupInfoMap.set(chunkGroup, {
+			chunkGroup,
+			minAvailableModules: new Set(),
+			minAvailableModulesOwned: true,
+			availableModulesToBeMerged: [],
+			skippedItems: [],
+			resultingAvailableModules: undefined,
+			children: undefined
+		});
+		return queue;
+	};
+
+	// Start with the provided modules/chunks
+	/** @type {QueueItem[]} */
+	let queue = inputChunkGroups
+		.reduce(reduceChunkGroupToQueueItem, [])
+		.reverse();
+	/** @type {Map<ChunkGroup, Set<ChunkGroup>>} */
+	const queueConnect = new Map();
+	/** @type {Set<ChunkGroupInfo>} */
+	const outdatedChunkGroupInfo = new Set();
+	/** @type {QueueItem[]} */
+	let queueDelayed = [];
+
+	logger.timeEnd("prepare");
+
+	/** @type {Module} */
+	let module;
+	/** @type {Chunk} */
+	let chunk;
+	/** @type {ChunkGroup} */
+	let chunkGroup;
+	/** @type {ChunkGroupInfo} */
+	let chunkGroupInfo;
+	/** @type {DependenciesBlock} */
+	let block;
+	/** @type {Set<Module>} */
+	let minAvailableModules;
+	/** @type {QueueItem[]} */
+	let skippedItems;
+
+	// For each async Block in graph
+	/**
+	 * @param {AsyncDependenciesBlock} b iterating over each Async DepBlock
+	 * @returns {void}
+	 */
+	const iteratorBlock = b => {
+		// 1. We create a chunk for this Block
+		// but only once (blockChunkGroups map)
+		let c = blockChunkGroups.get(b);
+		if (c === undefined) {
+			c = namedChunkGroups.get(b.chunkName);
+			if (c && c.isInitial()) {
+				compilation.errors.push(
+					new AsyncDependencyToInitialChunkError(b.chunkName, module, b.loc)
+				);
+				c = chunkGroup;
+			} else {
+				c = compilation.addChunkInGroup(
+					b.groupOptions || b.chunkName,
+					module,
+					b.loc,
+					b.request
+				);
+				chunkGroupCounters.set(c, { index: 0, index2: 0 });
+				blockChunkGroups.set(b, c);
+				allCreatedChunkGroups.add(c);
+			}
+			blockConnections.set(b, []);
+		} else {
+			// TODO webpack 5 remove addOptions check
+			if (c.addOptions) c.addOptions(b.groupOptions);
+			c.addOrigin(module, b.loc, b.request);
+		}
+
+		// 2. We store the connection for the block
+		// to connect it later if needed
+		blockConnections.get(b).push({
+			originChunkGroupInfo: chunkGroupInfo,
+			chunkGroup: c
+		});
+
+		// 3. We create/update the chunk group info
+		let connectList = queueConnect.get(chunkGroup);
+		if (connectList === undefined) {
+			connectList = new Set();
+			queueConnect.set(chunkGroup, connectList);
+		}
+		connectList.add(c);
+
+		// 4. We enqueue the DependenciesBlock for traversal
+		queueDelayed.push({
+			action: PROCESS_BLOCK,
+			block: b,
+			module: module,
+			chunk: c.chunks[0],
+			chunkGroup: c
+		});
+	};
+
+	// Iterative traversal of the Module graph
+	// Recursive would be simpler to write but could result in Stack Overflows
+	while (queue.length) {
+		logger.time("visiting");
+		while (queue.length) {
+			const queueItem = queue.pop();
+			module = queueItem.module;
+			block = queueItem.block;
+			chunk = queueItem.chunk;
+			if (chunkGroup !== queueItem.chunkGroup) {
+				chunkGroup = queueItem.chunkGroup;
+				chunkGroupInfo = chunkGroupInfoMap.get(chunkGroup);
+				minAvailableModules = chunkGroupInfo.minAvailableModules;
+				skippedItems = chunkGroupInfo.skippedItems;
+			}
+
+			switch (queueItem.action) {
+				case ADD_AND_ENTER_MODULE: {
+					if (minAvailableModules.has(module)) {
+						// already in parent chunks
+						// skip it for now, but enqueue for rechecking when minAvailableModules shrinks
+						skippedItems.push(queueItem);
+						break;
+					}
+					// We connect Module and Chunk when not already done
+					if (chunk.addModule(module)) {
+						module.addChunk(chunk);
+					} else {
+						// already connected, skip it
+						break;
+					}
+				}
+				// fallthrough
+				case ENTER_MODULE: {
+					if (chunkGroup !== undefined) {
+						const index = chunkGroup.getModuleIndex(module);
+						if (index === undefined) {
+							chunkGroup.setModuleIndex(
+								module,
+								chunkGroupCounters.get(chunkGroup).index++
+							);
+						}
+					}
+
+					if (module.index === null) {
+						module.index = nextFreeModuleIndex++;
+					}
+
+					queue.push({
+						action: LEAVE_MODULE,
+						block,
+						module,
+						chunk,
+						chunkGroup
+					});
+				}
+				// fallthrough
+				case PROCESS_BLOCK: {
+					// get prepared block info
+					const blockInfo = blockInfoMap.get(block);
+
+					// Buffer items because order need to be reverse to get indicies correct
+					const skipBuffer = [];
+					const queueBuffer = [];
+					// Traverse all referenced modules
+					for (const refModule of blockInfo.modules) {
+						if (chunk.containsModule(refModule)) {
+							// skip early if already connected
+							continue;
+						}
+						if (minAvailableModules.has(refModule)) {
+							// already in parent chunks, skip it for now
+							skipBuffer.push({
+								action: ADD_AND_ENTER_MODULE,
+								block: refModule,
+								module: refModule,
+								chunk,
+								chunkGroup
+							});
+							continue;
+						}
+						// enqueue the add and enter to enter in the correct order
+						// this is relevant with circular dependencies
+						queueBuffer.push({
+							action: ADD_AND_ENTER_MODULE,
+							block: refModule,
+							module: refModule,
+							chunk,
+							chunkGroup
+						});
+					}
+					// Add buffered items in reversed order
+					for (let i = skipBuffer.length - 1; i >= 0; i--) {
+						skippedItems.push(skipBuffer[i]);
+					}
+					for (let i = queueBuffer.length - 1; i >= 0; i--) {
+						queue.push(queueBuffer[i]);
+					}
+
+					// Traverse all Blocks
+					for (const block of blockInfo.blocks) iteratorBlock(block);
+
+					if (blockInfo.blocks.length > 0 && module !== block) {
+						blocksWithNestedBlocks.add(block);
+					}
+					break;
+				}
+				case LEAVE_MODULE: {
+					if (chunkGroup !== undefined) {
+						const index = chunkGroup.getModuleIndex2(module);
+						if (index === undefined) {
+							chunkGroup.setModuleIndex2(
+								module,
+								chunkGroupCounters.get(chunkGroup).index2++
+							);
+						}
+					}
+
+					if (module.index2 === null) {
+						module.index2 = nextFreeModuleIndex2++;
+					}
+					break;
+				}
+			}
+		}
+		logger.timeEnd("visiting");
+
+		while (queueConnect.size > 0) {
+			logger.time("calculating available modules");
+
+			// Figure out new parents for chunk groups
+			// to get new available modules for these children
+			for (const [chunkGroup, targets] of queueConnect) {
+				const info = chunkGroupInfoMap.get(chunkGroup);
+				let minAvailableModules = info.minAvailableModules;
+
+				// 1. Create a new Set of available modules at this points
+				const resultingAvailableModules = new Set(minAvailableModules);
+				for (const chunk of chunkGroup.chunks) {
+					for (const m of chunk.modulesIterable) {
+						resultingAvailableModules.add(m);
+					}
+				}
+				info.resultingAvailableModules = resultingAvailableModules;
+				if (info.children === undefined) {
+					info.children = targets;
+				} else {
+					for (const target of targets) {
+						info.children.add(target);
+					}
+				}
+
+				// 2. Update chunk group info
+				for (const target of targets) {
+					let chunkGroupInfo = chunkGroupInfoMap.get(target);
+					if (chunkGroupInfo === undefined) {
+						chunkGroupInfo = {
+							chunkGroup: target,
+							minAvailableModules: undefined,
+							minAvailableModulesOwned: undefined,
+							availableModulesToBeMerged: [],
+							skippedItems: [],
+							resultingAvailableModules: undefined,
+							children: undefined
+						};
+						chunkGroupInfoMap.set(target, chunkGroupInfo);
+					}
+					chunkGroupInfo.availableModulesToBeMerged.push(
+						resultingAvailableModules
+					);
+					outdatedChunkGroupInfo.add(chunkGroupInfo);
+				}
+			}
+			queueConnect.clear();
+			logger.timeEnd("calculating available modules");
+
+			if (outdatedChunkGroupInfo.size > 0) {
+				logger.time("merging available modules");
+				// Execute the merge
+				for (const info of outdatedChunkGroupInfo) {
+					const availableModulesToBeMerged = info.availableModulesToBeMerged;
+					let cachedMinAvailableModules = info.minAvailableModules;
+
+					// 1. Get minimal available modules
+					// It doesn't make sense to traverse a chunk again with more available modules.
+					// This step calculates the minimal available modules and skips traversal when
+					// the list didn't shrink.
+					if (availableModulesToBeMerged.length > 1) {
+						availableModulesToBeMerged.sort(bySetSize);
+					}
+					let changed = false;
+					for (const availableModules of availableModulesToBeMerged) {
+						if (cachedMinAvailableModules === undefined) {
+							cachedMinAvailableModules = availableModules;
+							info.minAvailableModules = cachedMinAvailableModules;
+							info.minAvailableModulesOwned = false;
+							changed = true;
+						} else {
+							if (info.minAvailableModulesOwned) {
+								// We own it and can modify it
+								for (const m of cachedMinAvailableModules) {
+									if (!availableModules.has(m)) {
+										cachedMinAvailableModules.delete(m);
+										changed = true;
+									}
+								}
+							} else {
+								for (const m of cachedMinAvailableModules) {
+									if (!availableModules.has(m)) {
+										// cachedMinAvailableModules need to be modified
+										// but we don't own it
+										// construct a new Set as intersection of cachedMinAvailableModules and availableModules
+										/** @type {Set<Module>} */
+										const newSet = new Set();
+										const iterator = cachedMinAvailableModules[
+											Symbol.iterator
+										]();
+										/** @type {IteratorResult<Module>} */
+										let it;
+										while (!(it = iterator.next()).done) {
+											const module = it.value;
+											if (module === m) break;
+											newSet.add(module);
+										}
+										while (!(it = iterator.next()).done) {
+											const module = it.value;
+											if (availableModules.has(module)) {
+												newSet.add(module);
+											}
+										}
+										cachedMinAvailableModules = newSet;
+										info.minAvailableModulesOwned = true;
+										info.minAvailableModules = newSet;
+
+										// Update the cache from the first queue
+										// if the chunkGroup is currently cached
+										if (chunkGroup === info.chunkGroup) {
+											minAvailableModules = cachedMinAvailableModules;
+										}
+
+										changed = true;
+										break;
+									}
+								}
+							}
+						}
+					}
+					availableModulesToBeMerged.length = 0;
+					if (!changed) continue;
+
+					// 2. Reconsider skipped items
+					for (const queueItem of info.skippedItems) {
+						queue.push(queueItem);
+					}
+					info.skippedItems.length = 0;
+
+					// 3. Reconsider children chunk groups
+					if (info.children !== undefined) {
+						const chunkGroup = info.chunkGroup;
+						for (const c of info.children) {
+							let connectList = queueConnect.get(chunkGroup);
+							if (connectList === undefined) {
+								connectList = new Set();
+								queueConnect.set(chunkGroup, connectList);
+							}
+							connectList.add(c);
+						}
+					}
+				}
+				outdatedChunkGroupInfo.clear();
+				logger.timeEnd("merging available modules");
+			}
+		}
+
+		// Run queueDelayed when all items of the queue are processed
+		// This is important to get the global indicing correct
+		// Async blocks should be processed after all sync blocks are processed
+		if (queue.length === 0) {
+			const tempQueue = queue;
+			queue = queueDelayed.reverse();
+			queueDelayed = tempQueue;
+		}
+	}
+};
+
+/**
+ *
+ * @param {Set<DependenciesBlock>} blocksWithNestedBlocks flag for blocks that have nested blocks
+ * @param {Map<AsyncDependenciesBlock, BlockChunkGroupConnection[]>} blockConnections connection for blocks
+ * @param {Map<ChunkGroup, ChunkGroupInfo>} chunkGroupInfoMap mapping from chunk group to available modules
+ */
+const connectChunkGroups = (
+	blocksWithNestedBlocks,
+	blockConnections,
+	chunkGroupInfoMap
+) => {
+	/**
+	 * Helper function to check if all modules of a chunk are available
+	 *
+	 * @param {ChunkGroup} chunkGroup the chunkGroup to scan
+	 * @param {Set<Module>} availableModules the comparitor set
+	 * @returns {boolean} return true if all modules of a chunk are available
+	 */
+	const areModulesAvailable = (chunkGroup, availableModules) => {
+		for (const chunk of chunkGroup.chunks) {
+			for (const module of chunk.modulesIterable) {
+				if (!availableModules.has(module)) return false;
+			}
+		}
+		return true;
+	};
+
+	// For each edge in the basic chunk graph
+	for (const [block, connections] of blockConnections) {
+		// 1. Check if connection is needed
+		// When none of the dependencies need to be connected
+		// we can skip all of them
+		// It's not possible to filter each item so it doesn't create inconsistent
+		// connections and modules can only create one version
+		// TODO maybe decide this per runtime
+		if (
+			// TODO is this needed?
+			!blocksWithNestedBlocks.has(block) &&
+			connections.every(({ chunkGroup, originChunkGroupInfo }) =>
+				areModulesAvailable(
+					chunkGroup,
+					originChunkGroupInfo.resultingAvailableModules
+				)
+			)
+		) {
+			continue;
+		}
+
+		// 2. Foreach edge
+		for (let i = 0; i < connections.length; i++) {
+			const { chunkGroup, originChunkGroupInfo } = connections[i];
+
+			// 3. Connect block with chunk
+			GraphHelpers.connectDependenciesBlockAndChunkGroup(block, chunkGroup);
+
+			// 4. Connect chunk with parent
+			GraphHelpers.connectChunkGroupParentAndChild(
+				originChunkGroupInfo.chunkGroup,
+				chunkGroup
+			);
+		}
+	}
+};
+
+/**
+ * Remove all unconnected chunk groups
+ * @param {Compilation} compilation the compilation
+ * @param {Iterable<ChunkGroup>} allCreatedChunkGroups all chunk groups that where created before
+ */
+const cleanupUnconnectedGroups = (compilation, allCreatedChunkGroups) => {
+	for (const chunkGroup of allCreatedChunkGroups) {
+		if (chunkGroup.getNumberOfParents() === 0) {
+			for (const chunk of chunkGroup.chunks) {
+				const idx = compilation.chunks.indexOf(chunk);
+				if (idx >= 0) compilation.chunks.splice(idx, 1);
+				chunk.remove("unconnected");
+			}
+			chunkGroup.remove("unconnected");
+		}
+	}
+};
+
+/**
+ * This method creates the Chunk graph from the Module graph
+ * @param {Compilation} compilation the compilation
+ * @param {Entrypoint[]} inputChunkGroups chunk groups which are processed
+ * @returns {void}
+ */
+const buildChunkGraph = (compilation, inputChunkGroups) => {
+	// SHARED STATE
+
+	/** @type {Map<AsyncDependenciesBlock, BlockChunkGroupConnection[]>} */
+	const blockConnections = new Map();
+
+	/** @type {Set<ChunkGroup>} */
+	const allCreatedChunkGroups = new Set();
+
+	/** @type {Map<ChunkGroup, ChunkGroupInfo>} */
+	const chunkGroupInfoMap = new Map();
+
+	/** @type {Set<DependenciesBlock>} */
+	const blocksWithNestedBlocks = new Set();
+
+	// PART ONE
+
+	visitModules(
+		compilation,
+		inputChunkGroups,
+		chunkGroupInfoMap,
+		blockConnections,
+		blocksWithNestedBlocks,
+		allCreatedChunkGroups
+	);
+
+	// PART TWO
+
+	connectChunkGroups(
+		blocksWithNestedBlocks,
+		blockConnections,
+		chunkGroupInfoMap
+	);
+
+	// Cleaup work
+
+	cleanupUnconnectedGroups(compilation, allCreatedChunkGroups);
+};
+
+module.exports = buildChunkGraph;
diff --git a/node_modules/webpack/lib/compareLocations.js b/node_modules/webpack/lib/compareLocations.js
new file mode 100644
index 0000000..3840eb8
--- /dev/null
+++ b/node_modules/webpack/lib/compareLocations.js
@@ -0,0 +1,52 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+/** @typedef {import("./Dependency").DependencyLocation} DependencyLocation */
+
+// TODO webpack 5 remove string type from a and b
+/**
+ * Compare two locations
+ * @param {string|DependencyLocation} a A location node
+ * @param {string|DependencyLocation} b A location node
+ * @returns {-1|0|1} sorting comparator value
+ */
+module.exports = (a, b) => {
+	if (typeof a === "string") {
+		if (typeof b === "string") {
+			if (a < b) return -1;
+			if (a > b) return 1;
+			return 0;
+		} else if (typeof b === "object") {
+			return 1;
+		} else {
+			return 0;
+		}
+	} else if (typeof a === "object") {
+		if (typeof b === "string") {
+			return -1;
+		} else if (typeof b === "object") {
+			if ("start" in a && "start" in b) {
+				const ap = a.start;
+				const bp = b.start;
+				if (ap.line < bp.line) return -1;
+				if (ap.line > bp.line) return 1;
+				if (ap.column < bp.column) return -1;
+				if (ap.column > bp.column) return 1;
+			}
+			if ("name" in a && "name" in b) {
+				if (a.name < b.name) return -1;
+				if (a.name > b.name) return 1;
+			}
+			if ("index" in a && "index" in b) {
+				if (a.index < b.index) return -1;
+				if (a.index > b.index) return 1;
+			}
+			return 0;
+		} else {
+			return 0;
+		}
+	}
+};
diff --git a/node_modules/webpack/lib/debug/ProfilingPlugin.js b/node_modules/webpack/lib/debug/ProfilingPlugin.js
new file mode 100644
index 0000000..0ba10ae
--- /dev/null
+++ b/node_modules/webpack/lib/debug/ProfilingPlugin.js
@@ -0,0 +1,442 @@
+const fs = require("fs");
+const path = require("path");
+const mkdirp = require("mkdirp");
+const { Tracer } = require("chrome-trace-event");
+const validateOptions = require("schema-utils");
+const schema = require("../../schemas/plugins/debug/ProfilingPlugin.json");
+
+/** @typedef {import("../../declarations/plugins/debug/ProfilingPlugin").ProfilingPluginOptions} ProfilingPluginOptions */
+
+let inspector = undefined;
+
+try {
+	// eslint-disable-next-line node/no-unsupported-features/node-builtins
+	inspector = require("inspector");
+} catch (e) {
+	console.log("Unable to CPU profile in < node 8.0");
+}
+
+class Profiler {
+	constructor(inspector) {
+		this.session = undefined;
+		this.inspector = inspector;
+	}
+
+	hasSession() {
+		return this.session !== undefined;
+	}
+
+	startProfiling() {
+		if (this.inspector === undefined) {
+			return Promise.resolve();
+		}
+
+		try {
+			this.session = new inspector.Session();
+			this.session.connect();
+		} catch (_) {
+			this.session = undefined;
+			return Promise.resolve();
+		}
+
+		return Promise.all([
+			this.sendCommand("Profiler.setSamplingInterval", {
+				interval: 100
+			}),
+			this.sendCommand("Profiler.enable"),
+			this.sendCommand("Profiler.start")
+		]);
+	}
+
+	sendCommand(method, params) {
+		if (this.hasSession()) {
+			return new Promise((res, rej) => {
+				return this.session.post(method, params, (err, params) => {
+					if (err !== null) {
+						rej(err);
+					} else {
+						res(params);
+					}
+				});
+			});
+		} else {
+			return Promise.resolve();
+		}
+	}
+
+	destroy() {
+		if (this.hasSession()) {
+			this.session.disconnect();
+		}
+
+		return Promise.resolve();
+	}
+
+	stopProfiling() {
+		return this.sendCommand("Profiler.stop");
+	}
+}
+
+/**
+ * an object that wraps Tracer and Profiler with a counter
+ * @typedef {Object} Trace
+ * @property {Tracer} trace instance of Tracer
+ * @property {number} counter Counter
+ * @property {Profiler} profiler instance of Profiler
+ * @property {Function} end the end function
+ */
+
+/**
+ * @param {string} outputPath The location where to write the log.
+ * @returns {Trace} The trace object
+ */
+const createTrace = outputPath => {
+	const trace = new Tracer({
+		noStream: true
+	});
+	const profiler = new Profiler(inspector);
+	if (/\/|\\/.test(outputPath)) {
+		const dirPath = path.dirname(outputPath);
+		mkdirp.sync(dirPath);
+	}
+	const fsStream = fs.createWriteStream(outputPath);
+
+	let counter = 0;
+
+	trace.pipe(fsStream);
+	// These are critical events that need to be inserted so that tools like
+	// chrome dev tools can load the profile.
+	trace.instantEvent({
+		name: "TracingStartedInPage",
+		id: ++counter,
+		cat: ["disabled-by-default-devtools.timeline"],
+		args: {
+			data: {
+				sessionId: "-1",
+				page: "0xfff",
+				frames: [
+					{
+						frame: "0xfff",
+						url: "webpack",
+						name: ""
+					}
+				]
+			}
+		}
+	});
+
+	trace.instantEvent({
+		name: "TracingStartedInBrowser",
+		id: ++counter,
+		cat: ["disabled-by-default-devtools.timeline"],
+		args: {
+			data: {
+				sessionId: "-1"
+			}
+		}
+	});
+
+	return {
+		trace,
+		counter,
+		profiler,
+		end: callback => {
+			// Wait until the write stream finishes.
+			fsStream.on("finish", () => {
+				callback();
+			});
+			// Tear down the readable trace stream.
+			trace.push(null);
+		}
+	};
+};
+
+const pluginName = "ProfilingPlugin";
+
+class ProfilingPlugin {
+	/**
+	 * @param {ProfilingPluginOptions=} opts options object
+	 */
+	constructor(opts) {
+		validateOptions(schema, opts || {}, "Profiling plugin");
+		opts = opts || {};
+		this.outputPath = opts.outputPath || "events.json";
+	}
+
+	apply(compiler) {
+		const tracer = createTrace(this.outputPath);
+		tracer.profiler.startProfiling();
+
+		// Compiler Hooks
+		Object.keys(compiler.hooks).forEach(hookName => {
+			compiler.hooks[hookName].intercept(
+				makeInterceptorFor("Compiler", tracer)(hookName)
+			);
+		});
+
+		Object.keys(compiler.resolverFactory.hooks).forEach(hookName => {
+			compiler.resolverFactory.hooks[hookName].intercept(
+				makeInterceptorFor("Resolver", tracer)(hookName)
+			);
+		});
+
+		compiler.hooks.compilation.tap(
+			pluginName,
+			(compilation, { normalModuleFactory, contextModuleFactory }) => {
+				interceptAllHooksFor(compilation, tracer, "Compilation");
+				interceptAllHooksFor(
+					normalModuleFactory,
+					tracer,
+					"Normal Module Factory"
+				);
+				interceptAllHooksFor(
+					contextModuleFactory,
+					tracer,
+					"Context Module Factory"
+				);
+				interceptAllParserHooks(normalModuleFactory, tracer);
+				interceptTemplateInstancesFrom(compilation, tracer);
+			}
+		);
+
+		// We need to write out the CPU profile when we are all done.
+		compiler.hooks.done.tapAsync(
+			{
+				name: pluginName,
+				stage: Infinity
+			},
+			(stats, callback) => {
+				tracer.profiler.stopProfiling().then(parsedResults => {
+					if (parsedResults === undefined) {
+						tracer.profiler.destroy();
+						tracer.trace.flush();
+						tracer.end(callback);
+						return;
+					}
+
+					const cpuStartTime = parsedResults.profile.startTime;
+					const cpuEndTime = parsedResults.profile.endTime;
+
+					tracer.trace.completeEvent({
+						name: "TaskQueueManager::ProcessTaskFromWorkQueue",
+						id: ++tracer.counter,
+						cat: ["toplevel"],
+						ts: cpuStartTime,
+						args: {
+							src_file: "../../ipc/ipc_moji_bootstrap.cc",
+							src_func: "Accept"
+						}
+					});
+
+					tracer.trace.completeEvent({
+						name: "EvaluateScript",
+						id: ++tracer.counter,
+						cat: ["devtools.timeline"],
+						ts: cpuStartTime,
+						dur: cpuEndTime - cpuStartTime,
+						args: {
+							data: {
+								url: "webpack",
+								lineNumber: 1,
+								columnNumber: 1,
+								frame: "0xFFF"
+							}
+						}
+					});
+
+					tracer.trace.instantEvent({
+						name: "CpuProfile",
+						id: ++tracer.counter,
+						cat: ["disabled-by-default-devtools.timeline"],
+						ts: cpuEndTime,
+						args: {
+							data: {
+								cpuProfile: parsedResults.profile
+							}
+						}
+					});
+
+					tracer.profiler.destroy();
+					tracer.trace.flush();
+					tracer.end(callback);
+				});
+			}
+		);
+	}
+}
+
+const interceptTemplateInstancesFrom = (compilation, tracer) => {
+	const {
+		mainTemplate,
+		chunkTemplate,
+		hotUpdateChunkTemplate,
+		moduleTemplates
+	} = compilation;
+
+	const { javascript, webassembly } = moduleTemplates;
+
+	[
+		{
+			instance: mainTemplate,
+			name: "MainTemplate"
+		},
+		{
+			instance: chunkTemplate,
+			name: "ChunkTemplate"
+		},
+		{
+			instance: hotUpdateChunkTemplate,
+			name: "HotUpdateChunkTemplate"
+		},
+		{
+			instance: javascript,
+			name: "JavaScriptModuleTemplate"
+		},
+		{
+			instance: webassembly,
+			name: "WebAssemblyModuleTemplate"
+		}
+	].forEach(templateObject => {
+		Object.keys(templateObject.instance.hooks).forEach(hookName => {
+			templateObject.instance.hooks[hookName].intercept(
+				makeInterceptorFor(templateObject.name, tracer)(hookName)
+			);
+		});
+	});
+};
+
+const interceptAllHooksFor = (instance, tracer, logLabel) => {
+	if (Reflect.has(instance, "hooks")) {
+		Object.keys(instance.hooks).forEach(hookName => {
+			instance.hooks[hookName].intercept(
+				makeInterceptorFor(logLabel, tracer)(hookName)
+			);
+		});
+	}
+};
+
+const interceptAllParserHooks = (moduleFactory, tracer) => {
+	const moduleTypes = [
+		"javascript/auto",
+		"javascript/dynamic",
+		"javascript/esm",
+		"json",
+		"webassembly/experimental"
+	];
+
+	moduleTypes.forEach(moduleType => {
+		moduleFactory.hooks.parser
+			.for(moduleType)
+			.tap("ProfilingPlugin", (parser, parserOpts) => {
+				interceptAllHooksFor(parser, tracer, "Parser");
+			});
+	});
+};
+
+const makeInterceptorFor = (instance, tracer) => hookName => ({
+	register: ({ name, type, context, fn }) => {
+		const newFn = makeNewProfiledTapFn(hookName, tracer, {
+			name,
+			type,
+			fn
+		});
+		return {
+			name,
+			type,
+			context,
+			fn: newFn
+		};
+	}
+});
+
+// TODO improve typing
+/** @typedef {(...args: TODO[]) => void | Promise<TODO>} PluginFunction */
+
+/**
+ * @param {string} hookName Name of the hook to profile.
+ * @param {Trace} tracer The trace object.
+ * @param {object} options Options for the profiled fn.
+ * @param {string} options.name Plugin name
+ * @param {string} options.type Plugin type (sync | async | promise)
+ * @param {PluginFunction} options.fn Plugin function
+ * @returns {PluginFunction} Chainable hooked function.
+ */
+const makeNewProfiledTapFn = (hookName, tracer, { name, type, fn }) => {
+	const defaultCategory = ["blink.user_timing"];
+
+	switch (type) {
+		case "promise":
+			return (...args) => {
+				const id = ++tracer.counter;
+				tracer.trace.begin({
+					name,
+					id,
+					cat: defaultCategory
+				});
+				const promise = /** @type {Promise<*>} */ (fn(...args));
+				return promise.then(r => {
+					tracer.trace.end({
+						name,
+						id,
+						cat: defaultCategory
+					});
+					return r;
+				});
+			};
+		case "async":
+			return (...args) => {
+				const id = ++tracer.counter;
+				tracer.trace.begin({
+					name,
+					id,
+					cat: defaultCategory
+				});
+				const callback = args.pop();
+				fn(...args, (...r) => {
+					tracer.trace.end({
+						name,
+						id,
+						cat: defaultCategory
+					});
+					callback(...r);
+				});
+			};
+		case "sync":
+			return (...args) => {
+				const id = ++tracer.counter;
+				// Do not instrument ourself due to the CPU
+				// profile needing to be the last event in the trace.
+				if (name === pluginName) {
+					return fn(...args);
+				}
+
+				tracer.trace.begin({
+					name,
+					id,
+					cat: defaultCategory
+				});
+				let r;
+				try {
+					r = fn(...args);
+				} catch (error) {
+					tracer.trace.end({
+						name,
+						id,
+						cat: defaultCategory
+					});
+					throw error;
+				}
+				tracer.trace.end({
+					name,
+					id,
+					cat: defaultCategory
+				});
+				return r;
+			};
+		default:
+			break;
+	}
+};
+
+module.exports = ProfilingPlugin;
+module.exports.Profiler = Profiler;
diff --git a/node_modules/webpack/lib/dependencies/AMDDefineDependency.js b/node_modules/webpack/lib/dependencies/AMDDefineDependency.js
new file mode 100644
index 0000000..fcec365
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDDefineDependency.js
@@ -0,0 +1,137 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class AMDDefineDependency extends NullDependency {
+	constructor(range, arrayRange, functionRange, objectRange, namedModule) {
+		super();
+		this.range = range;
+		this.arrayRange = arrayRange;
+		this.functionRange = functionRange;
+		this.objectRange = objectRange;
+		this.namedModule = namedModule;
+		this.localModule = null;
+	}
+
+	get type() {
+		return "amd define";
+	}
+}
+
+AMDDefineDependency.Template = class AMDDefineDependencyTemplate {
+	get definitions() {
+		return {
+			f: [
+				"var __WEBPACK_AMD_DEFINE_RESULT__;",
+				`!(__WEBPACK_AMD_DEFINE_RESULT__ = (#).call(exports, __webpack_require__, exports, module),
+				__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__))`
+			],
+			o: ["", "!(module.exports = #)"],
+			of: [
+				"var __WEBPACK_AMD_DEFINE_FACTORY__, __WEBPACK_AMD_DEFINE_RESULT__;",
+				`!(__WEBPACK_AMD_DEFINE_FACTORY__ = (#),
+				__WEBPACK_AMD_DEFINE_RESULT__ = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?
+				(__WEBPACK_AMD_DEFINE_FACTORY__.call(exports, __webpack_require__, exports, module)) :
+				__WEBPACK_AMD_DEFINE_FACTORY__),
+				__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__))`
+			],
+			af: [
+				"var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;",
+				`!(__WEBPACK_AMD_DEFINE_ARRAY__ = #, __WEBPACK_AMD_DEFINE_RESULT__ = (#).apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),
+				__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__))`
+			],
+			ao: ["", "!(#, module.exports = #)"],
+			aof: [
+				"var __WEBPACK_AMD_DEFINE_FACTORY__, __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;",
+				`!(__WEBPACK_AMD_DEFINE_ARRAY__ = #, __WEBPACK_AMD_DEFINE_FACTORY__ = (#),
+				__WEBPACK_AMD_DEFINE_RESULT__ = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?
+				(__WEBPACK_AMD_DEFINE_FACTORY__.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__)) : __WEBPACK_AMD_DEFINE_FACTORY__),
+				__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__))`
+			],
+			lf: [
+				"var XXX, XXXmodule;",
+				"!(XXXmodule = { id: YYY, exports: {}, loaded: false }, XXX = #.call(XXXmodule.exports, __webpack_require__, XXXmodule.exports, XXXmodule), XXXmodule.loaded = true, XXX === undefined && (XXX = XXXmodule.exports))"
+			],
+			lo: ["var XXX;", "!(XXX = #)"],
+			lof: [
+				"var XXX, XXXfactory, XXXmodule;",
+				"!(XXXfactory = (#), (XXXmodule = { id: YYY, exports: {}, loaded: false }), XXX = (typeof XXXfactory === 'function' ? (XXXfactory.call(XXXmodule.exports, __webpack_require__, XXXmodule.exports, XXXmodule)) : XXXfactory), (XXXmodule.loaded = true), XXX === undefined && (XXX = XXXmodule.exports))"
+			],
+			laf: [
+				"var __WEBPACK_AMD_DEFINE_ARRAY__, XXX;",
+				"!(__WEBPACK_AMD_DEFINE_ARRAY__ = #, XXX = ((#).apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__)))"
+			],
+			lao: ["var XXX;", "!(#, XXX = #)"],
+			laof: [
+				"var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_FACTORY__, XXX;",
+				`!(__WEBPACK_AMD_DEFINE_ARRAY__ = #, __WEBPACK_AMD_DEFINE_FACTORY__ = (#),
+				XXX = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?
+				(__WEBPACK_AMD_DEFINE_FACTORY__.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__)) : __WEBPACK_AMD_DEFINE_FACTORY__))`
+			]
+		};
+	}
+
+	apply(dependency, source) {
+		const branch = this.branch(dependency);
+		const defAndText = this.definitions[branch];
+		const definitions = defAndText[0];
+		const text = defAndText[1];
+		this.replace(dependency, source, definitions, text);
+	}
+
+	localModuleVar(dependency) {
+		return (
+			dependency.localModule &&
+			dependency.localModule.used &&
+			dependency.localModule.variableName()
+		);
+	}
+
+	branch(dependency) {
+		const localModuleVar = this.localModuleVar(dependency) ? "l" : "";
+		const arrayRange = dependency.arrayRange ? "a" : "";
+		const objectRange = dependency.objectRange ? "o" : "";
+		const functionRange = dependency.functionRange ? "f" : "";
+		return localModuleVar + arrayRange + objectRange + functionRange;
+	}
+
+	replace(dependency, source, definition, text) {
+		const localModuleVar = this.localModuleVar(dependency);
+		if (localModuleVar) {
+			text = text.replace(/XXX/g, localModuleVar.replace(/\$/g, "$$$$"));
+			definition = definition.replace(
+				/XXX/g,
+				localModuleVar.replace(/\$/g, "$$$$")
+			);
+		}
+
+		if (dependency.namedModule) {
+			text = text.replace(/YYY/g, JSON.stringify(dependency.namedModule));
+		}
+
+		const texts = text.split("#");
+
+		if (definition) source.insert(0, definition);
+
+		let current = dependency.range[0];
+		if (dependency.arrayRange) {
+			source.replace(current, dependency.arrayRange[0] - 1, texts.shift());
+			current = dependency.arrayRange[1];
+		}
+
+		if (dependency.objectRange) {
+			source.replace(current, dependency.objectRange[0] - 1, texts.shift());
+			current = dependency.objectRange[1];
+		} else if (dependency.functionRange) {
+			source.replace(current, dependency.functionRange[0] - 1, texts.shift());
+			current = dependency.functionRange[1];
+		}
+		source.replace(current, dependency.range[1] - 1, texts.shift());
+		if (texts.length > 0) throw new Error("Implementation error");
+	}
+};
+
+module.exports = AMDDefineDependency;
diff --git a/node_modules/webpack/lib/dependencies/AMDDefineDependencyParserPlugin.js b/node_modules/webpack/lib/dependencies/AMDDefineDependencyParserPlugin.js
new file mode 100644
index 0000000..99a1528
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDDefineDependencyParserPlugin.js
@@ -0,0 +1,336 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const AMDRequireItemDependency = require("./AMDRequireItemDependency");
+const AMDRequireContextDependency = require("./AMDRequireContextDependency");
+const ConstDependency = require("./ConstDependency");
+const AMDDefineDependency = require("./AMDDefineDependency");
+const AMDRequireArrayDependency = require("./AMDRequireArrayDependency");
+const LocalModuleDependency = require("./LocalModuleDependency");
+const ContextDependencyHelpers = require("./ContextDependencyHelpers");
+const LocalModulesHelpers = require("./LocalModulesHelpers");
+
+const isBoundFunctionExpression = expr => {
+	if (expr.type !== "CallExpression") return false;
+	if (expr.callee.type !== "MemberExpression") return false;
+	if (expr.callee.computed) return false;
+	if (expr.callee.object.type !== "FunctionExpression") return false;
+	if (expr.callee.property.type !== "Identifier") return false;
+	if (expr.callee.property.name !== "bind") return false;
+	return true;
+};
+
+const isUnboundFunctionExpression = expr => {
+	if (expr.type === "FunctionExpression") return true;
+	if (expr.type === "ArrowFunctionExpression") return true;
+	return false;
+};
+
+const isCallable = expr => {
+	if (isUnboundFunctionExpression(expr)) return true;
+	if (isBoundFunctionExpression(expr)) return true;
+	return false;
+};
+
+class AMDDefineDependencyParserPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(parser) {
+		parser.hooks.call
+			.for("define")
+			.tap(
+				"AMDDefineDependencyParserPlugin",
+				this.processCallDefine.bind(this, parser)
+			);
+	}
+
+	processArray(parser, expr, param, identifiers, namedModule) {
+		if (param.isArray()) {
+			param.items.forEach((param, idx) => {
+				if (
+					param.isString() &&
+					["require", "module", "exports"].includes(param.string)
+				)
+					identifiers[idx] = param.string;
+				const result = this.processItem(parser, expr, param, namedModule);
+				if (result === undefined) {
+					this.processContext(parser, expr, param);
+				}
+			});
+			return true;
+		} else if (param.isConstArray()) {
+			const deps = [];
+			param.array.forEach((request, idx) => {
+				let dep;
+				let localModule;
+				if (request === "require") {
+					identifiers[idx] = request;
+					dep = "__webpack_require__";
+				} else if (["exports", "module"].includes(request)) {
+					identifiers[idx] = request;
+					dep = request;
+				} else if (
+					(localModule = LocalModulesHelpers.getLocalModule(
+						parser.state,
+						request
+					))
+				) {
+					dep = new LocalModuleDependency(localModule, undefined, false);
+					dep.loc = expr.loc;
+					parser.state.current.addDependency(dep);
+				} else {
+					dep = this.newRequireItemDependency(request);
+					dep.loc = expr.loc;
+					dep.optional = !!parser.scope.inTry;
+					parser.state.current.addDependency(dep);
+				}
+				deps.push(dep);
+			});
+			const dep = this.newRequireArrayDependency(deps, param.range);
+			dep.loc = expr.loc;
+			dep.optional = !!parser.scope.inTry;
+			parser.state.current.addDependency(dep);
+			return true;
+		}
+	}
+	processItem(parser, expr, param, namedModule) {
+		if (param.isConditional()) {
+			param.options.forEach(param => {
+				const result = this.processItem(parser, expr, param);
+				if (result === undefined) {
+					this.processContext(parser, expr, param);
+				}
+			});
+			return true;
+		} else if (param.isString()) {
+			let dep, localModule;
+			if (param.string === "require") {
+				dep = new ConstDependency("__webpack_require__", param.range);
+			} else if (["require", "exports", "module"].includes(param.string)) {
+				dep = new ConstDependency(param.string, param.range);
+			} else if (
+				(localModule = LocalModulesHelpers.getLocalModule(
+					parser.state,
+					param.string,
+					namedModule
+				))
+			) {
+				dep = new LocalModuleDependency(localModule, param.range, false);
+			} else {
+				dep = this.newRequireItemDependency(param.string, param.range);
+			}
+			dep.loc = expr.loc;
+			dep.optional = !!parser.scope.inTry;
+			parser.state.current.addDependency(dep);
+			return true;
+		}
+	}
+	processContext(parser, expr, param) {
+		const dep = ContextDependencyHelpers.create(
+			AMDRequireContextDependency,
+			param.range,
+			param,
+			expr,
+			this.options,
+			{},
+			parser
+		);
+		if (!dep) return;
+		dep.loc = expr.loc;
+		dep.optional = !!parser.scope.inTry;
+		parser.state.current.addDependency(dep);
+		return true;
+	}
+
+	processCallDefine(parser, expr) {
+		let array, fn, obj, namedModule;
+		switch (expr.arguments.length) {
+			case 1:
+				if (isCallable(expr.arguments[0])) {
+					// define(f() {…})
+					fn = expr.arguments[0];
+				} else if (expr.arguments[0].type === "ObjectExpression") {
+					// define({…})
+					obj = expr.arguments[0];
+				} else {
+					// define(expr)
+					// unclear if function or object
+					obj = fn = expr.arguments[0];
+				}
+				break;
+			case 2:
+				if (expr.arguments[0].type === "Literal") {
+					namedModule = expr.arguments[0].value;
+					// define("…", …)
+					if (isCallable(expr.arguments[1])) {
+						// define("…", f() {…})
+						fn = expr.arguments[1];
+					} else if (expr.arguments[1].type === "ObjectExpression") {
+						// define("…", {…})
+						obj = expr.arguments[1];
+					} else {
+						// define("…", expr)
+						// unclear if function or object
+						obj = fn = expr.arguments[1];
+					}
+				} else {
+					array = expr.arguments[0];
+					if (isCallable(expr.arguments[1])) {
+						// define([…], f() {})
+						fn = expr.arguments[1];
+					} else if (expr.arguments[1].type === "ObjectExpression") {
+						// define([…], {…})
+						obj = expr.arguments[1];
+					} else {
+						// define([…], expr)
+						// unclear if function or object
+						obj = fn = expr.arguments[1];
+					}
+				}
+				break;
+			case 3:
+				// define("…", […], f() {…})
+				namedModule = expr.arguments[0].value;
+				array = expr.arguments[1];
+				if (isCallable(expr.arguments[2])) {
+					// define("…", […], f() {})
+					fn = expr.arguments[2];
+				} else if (expr.arguments[2].type === "ObjectExpression") {
+					// define("…", […], {…})
+					obj = expr.arguments[2];
+				} else {
+					// define("…", […], expr)
+					// unclear if function or object
+					obj = fn = expr.arguments[2];
+				}
+				break;
+			default:
+				return;
+		}
+		let fnParams = null;
+		let fnParamsOffset = 0;
+		if (fn) {
+			if (isUnboundFunctionExpression(fn)) {
+				fnParams = fn.params;
+			} else if (isBoundFunctionExpression(fn)) {
+				fnParams = fn.callee.object.params;
+				fnParamsOffset = fn.arguments.length - 1;
+				if (fnParamsOffset < 0) {
+					fnParamsOffset = 0;
+				}
+			}
+		}
+		let fnRenames = parser.scope.renames.createChild();
+		if (array) {
+			const identifiers = {};
+			const param = parser.evaluateExpression(array);
+			const result = this.processArray(
+				parser,
+				expr,
+				param,
+				identifiers,
+				namedModule
+			);
+			if (!result) return;
+			if (fnParams) {
+				fnParams = fnParams.slice(fnParamsOffset).filter((param, idx) => {
+					if (identifiers[idx]) {
+						fnRenames.set(param.name, identifiers[idx]);
+						return false;
+					}
+					return true;
+				});
+			}
+		} else {
+			const identifiers = ["require", "exports", "module"];
+			if (fnParams) {
+				fnParams = fnParams.slice(fnParamsOffset).filter((param, idx) => {
+					if (identifiers[idx]) {
+						fnRenames.set(param.name, identifiers[idx]);
+						return false;
+					}
+					return true;
+				});
+			}
+		}
+		let inTry;
+		if (fn && isUnboundFunctionExpression(fn)) {
+			inTry = parser.scope.inTry;
+			parser.inScope(fnParams, () => {
+				parser.scope.renames = fnRenames;
+				parser.scope.inTry = inTry;
+				if (fn.body.type === "BlockStatement") {
+					parser.walkStatement(fn.body);
+				} else {
+					parser.walkExpression(fn.body);
+				}
+			});
+		} else if (fn && isBoundFunctionExpression(fn)) {
+			inTry = parser.scope.inTry;
+			parser.inScope(
+				fn.callee.object.params.filter(
+					i => !["require", "module", "exports"].includes(i.name)
+				),
+				() => {
+					parser.scope.renames = fnRenames;
+					parser.scope.inTry = inTry;
+					if (fn.callee.object.body.type === "BlockStatement") {
+						parser.walkStatement(fn.callee.object.body);
+					} else {
+						parser.walkExpression(fn.callee.object.body);
+					}
+				}
+			);
+			if (fn.arguments) {
+				parser.walkExpressions(fn.arguments);
+			}
+		} else if (fn || obj) {
+			parser.walkExpression(fn || obj);
+		}
+
+		const dep = this.newDefineDependency(
+			expr.range,
+			array ? array.range : null,
+			fn ? fn.range : null,
+			obj ? obj.range : null,
+			namedModule ? namedModule : null
+		);
+		dep.loc = expr.loc;
+		if (namedModule) {
+			dep.localModule = LocalModulesHelpers.addLocalModule(
+				parser.state,
+				namedModule
+			);
+		}
+		parser.state.current.addDependency(dep);
+		return true;
+	}
+
+	newDefineDependency(
+		range,
+		arrayRange,
+		functionRange,
+		objectRange,
+		namedModule
+	) {
+		return new AMDDefineDependency(
+			range,
+			arrayRange,
+			functionRange,
+			objectRange,
+			namedModule
+		);
+	}
+	newRequireArrayDependency(depsArray, range) {
+		return new AMDRequireArrayDependency(depsArray, range);
+	}
+	newRequireItemDependency(request, range) {
+		return new AMDRequireItemDependency(request, range);
+	}
+}
+module.exports = AMDDefineDependencyParserPlugin;
diff --git a/node_modules/webpack/lib/dependencies/AMDPlugin.js b/node_modules/webpack/lib/dependencies/AMDPlugin.js
new file mode 100644
index 0000000..d113491
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDPlugin.js
@@ -0,0 +1,249 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const path = require("path");
+const AMDRequireDependency = require("./AMDRequireDependency");
+const AMDRequireItemDependency = require("./AMDRequireItemDependency");
+const AMDRequireArrayDependency = require("./AMDRequireArrayDependency");
+const AMDRequireContextDependency = require("./AMDRequireContextDependency");
+const AMDDefineDependency = require("./AMDDefineDependency");
+const UnsupportedDependency = require("./UnsupportedDependency");
+const LocalModuleDependency = require("./LocalModuleDependency");
+
+const NullFactory = require("../NullFactory");
+
+const AMDRequireDependenciesBlockParserPlugin = require("./AMDRequireDependenciesBlockParserPlugin");
+const AMDDefineDependencyParserPlugin = require("./AMDDefineDependencyParserPlugin");
+
+const AliasPlugin = require("enhanced-resolve/lib/AliasPlugin");
+
+const ParserHelpers = require("../ParserHelpers");
+
+class AMDPlugin {
+	constructor(options, amdOptions) {
+		this.amdOptions = amdOptions;
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		const amdOptions = this.amdOptions;
+		compiler.hooks.compilation.tap(
+			"AMDPlugin",
+			(compilation, { contextModuleFactory, normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					AMDRequireDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					AMDRequireDependency,
+					new AMDRequireDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					AMDRequireItemDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					AMDRequireItemDependency,
+					new AMDRequireItemDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					AMDRequireArrayDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					AMDRequireArrayDependency,
+					new AMDRequireArrayDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					AMDRequireContextDependency,
+					contextModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					AMDRequireContextDependency,
+					new AMDRequireContextDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					AMDDefineDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					AMDDefineDependency,
+					new AMDDefineDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					UnsupportedDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					UnsupportedDependency,
+					new UnsupportedDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					LocalModuleDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					LocalModuleDependency,
+					new LocalModuleDependency.Template()
+				);
+
+				const handler = (parser, parserOptions) => {
+					if (parserOptions.amd !== undefined && !parserOptions.amd) return;
+
+					const setExpressionToModule = (outerExpr, module) => {
+						parser.hooks.expression.for(outerExpr).tap("AMDPlugin", expr => {
+							const dep = new AMDRequireItemDependency(module, expr.range);
+							dep.userRequest = outerExpr;
+							dep.loc = expr.loc;
+							parser.state.current.addDependency(dep);
+							return true;
+						});
+					};
+
+					new AMDRequireDependenciesBlockParserPlugin(options).apply(parser);
+					new AMDDefineDependencyParserPlugin(options).apply(parser);
+
+					setExpressionToModule("require.amd", "!!webpack amd options");
+					setExpressionToModule("define.amd", "!!webpack amd options");
+					setExpressionToModule("define", "!!webpack amd define");
+
+					parser.hooks.expression
+						.for("__webpack_amd_options__")
+						.tap("AMDPlugin", () =>
+							parser.state.current.addVariable(
+								"__webpack_amd_options__",
+								JSON.stringify(amdOptions)
+							)
+						);
+					parser.hooks.evaluateTypeof
+						.for("define.amd")
+						.tap(
+							"AMDPlugin",
+							ParserHelpers.evaluateToString(typeof amdOptions)
+						);
+					parser.hooks.evaluateTypeof
+						.for("require.amd")
+						.tap(
+							"AMDPlugin",
+							ParserHelpers.evaluateToString(typeof amdOptions)
+						);
+					parser.hooks.evaluateIdentifier
+						.for("define.amd")
+						.tap(
+							"AMDPlugin",
+							ParserHelpers.evaluateToIdentifier("define.amd", true)
+						);
+					parser.hooks.evaluateIdentifier
+						.for("require.amd")
+						.tap(
+							"AMDPlugin",
+							ParserHelpers.evaluateToIdentifier("require.amd", true)
+						);
+					parser.hooks.typeof
+						.for("define")
+						.tap(
+							"AMDPlugin",
+							ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify("function")
+							)
+						);
+					parser.hooks.evaluateTypeof
+						.for("define")
+						.tap("AMDPlugin", ParserHelpers.evaluateToString("function"));
+					parser.hooks.canRename
+						.for("define")
+						.tap("AMDPlugin", ParserHelpers.approve);
+					parser.hooks.rename.for("define").tap("AMDPlugin", expr => {
+						const dep = new AMDRequireItemDependency(
+							"!!webpack amd define",
+							expr.range
+						);
+						dep.userRequest = "define";
+						dep.loc = expr.loc;
+						parser.state.current.addDependency(dep);
+						return false;
+					});
+					parser.hooks.typeof
+						.for("require")
+						.tap(
+							"AMDPlugin",
+							ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify("function")
+							)
+						);
+					parser.hooks.evaluateTypeof
+						.for("require")
+						.tap("AMDPlugin", ParserHelpers.evaluateToString("function"));
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("AMDPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("AMDPlugin", handler);
+			}
+		);
+		compiler.hooks.afterResolvers.tap("AMDPlugin", () => {
+			compiler.resolverFactory.hooks.resolver
+				.for("normal")
+				.tap("AMDPlugin", resolver => {
+					new AliasPlugin(
+						"described-resolve",
+						{
+							name: "amdefine",
+							alias: path.join(
+								__dirname,
+								"..",
+								"..",
+								"buildin",
+								"amd-define.js"
+							)
+						},
+						"resolve"
+					).apply(resolver);
+					new AliasPlugin(
+						"described-resolve",
+						{
+							name: "webpack amd options",
+							alias: path.join(
+								__dirname,
+								"..",
+								"..",
+								"buildin",
+								"amd-options.js"
+							)
+						},
+						"resolve"
+					).apply(resolver);
+					new AliasPlugin(
+						"described-resolve",
+						{
+							name: "webpack amd define",
+							alias: path.join(
+								__dirname,
+								"..",
+								"..",
+								"buildin",
+								"amd-define.js"
+							)
+						},
+						"resolve"
+					).apply(resolver);
+				});
+		});
+	}
+}
+module.exports = AMDPlugin;
diff --git a/node_modules/webpack/lib/dependencies/AMDRequireArrayDependency.js b/node_modules/webpack/lib/dependencies/AMDRequireArrayDependency.js
new file mode 100644
index 0000000..ddb9c29
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDRequireArrayDependency.js
@@ -0,0 +1,49 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const Dependency = require("../Dependency");
+
+class AMDRequireArrayDependency extends Dependency {
+	constructor(depsArray, range) {
+		super();
+		this.depsArray = depsArray;
+		this.range = range;
+	}
+
+	get type() {
+		return "amd require array";
+	}
+}
+
+AMDRequireArrayDependency.Template = class AMDRequireArrayDependencyTemplate {
+	apply(dep, source, runtime) {
+		const content = this.getContent(dep, runtime);
+		source.replace(dep.range[0], dep.range[1] - 1, content);
+	}
+
+	getContent(dep, runtime) {
+		const requires = dep.depsArray.map(dependency => {
+			return this.contentForDependency(dependency, runtime);
+		});
+		return `[${requires.join(", ")}]`;
+	}
+
+	contentForDependency(dep, runtime) {
+		if (typeof dep === "string") {
+			return dep;
+		}
+
+		if (dep.localModule) {
+			return dep.localModule.variableName();
+		} else {
+			return runtime.moduleExports({
+				module: dep.module,
+				request: dep.request
+			});
+		}
+	}
+};
+
+module.exports = AMDRequireArrayDependency;
diff --git a/node_modules/webpack/lib/dependencies/AMDRequireContextDependency.js b/node_modules/webpack/lib/dependencies/AMDRequireContextDependency.js
new file mode 100644
index 0000000..b2e60b5
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDRequireContextDependency.js
@@ -0,0 +1,20 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ContextDependency = require("./ContextDependency");
+class AMDRequireContextDependency extends ContextDependency {
+	constructor(options, range, valueRange) {
+		super(options);
+		this.range = range;
+		this.valueRange = valueRange;
+	}
+
+	get type() {
+		return "amd require context";
+	}
+}
+AMDRequireContextDependency.Template = require("./ContextDependencyTemplateAsRequireCall");
+module.exports = AMDRequireContextDependency;
diff --git a/node_modules/webpack/lib/dependencies/AMDRequireDependenciesBlock.js b/node_modules/webpack/lib/dependencies/AMDRequireDependenciesBlock.js
new file mode 100644
index 0000000..bd7e7b8
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDRequireDependenciesBlock.js
@@ -0,0 +1,47 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const AsyncDependenciesBlock = require("../AsyncDependenciesBlock");
+const AMDRequireDependency = require("./AMDRequireDependency");
+
+module.exports = class AMDRequireDependenciesBlock extends AsyncDependenciesBlock {
+	constructor(
+		expr,
+		arrayRange,
+		functionRange,
+		errorCallbackRange,
+		module,
+		loc,
+		request
+	) {
+		super(null, module, loc, request);
+		this.expr = expr;
+		this.outerRange = expr.range;
+		this.arrayRange = arrayRange;
+		this.functionBindThis = false;
+		this.functionRange = functionRange;
+		this.errorCallbackBindThis = false;
+		this.errorCallbackRange = errorCallbackRange;
+		this.bindThis = true;
+		if (arrayRange && functionRange && errorCallbackRange) {
+			this.range = [arrayRange[0], errorCallbackRange[1]];
+		} else if (arrayRange && functionRange) {
+			this.range = [arrayRange[0], functionRange[1]];
+		} else if (arrayRange) {
+			this.range = arrayRange;
+		} else if (functionRange) {
+			this.range = functionRange;
+		} else {
+			this.range = expr.range;
+		}
+		const dep = this.newRequireDependency();
+		dep.loc = loc;
+		this.addDependency(dep);
+	}
+
+	newRequireDependency() {
+		return new AMDRequireDependency(this);
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/AMDRequireDependenciesBlockParserPlugin.js b/node_modules/webpack/lib/dependencies/AMDRequireDependenciesBlockParserPlugin.js
new file mode 100644
index 0000000..ea52d81
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDRequireDependenciesBlockParserPlugin.js
@@ -0,0 +1,274 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const AMDRequireItemDependency = require("./AMDRequireItemDependency");
+const AMDRequireArrayDependency = require("./AMDRequireArrayDependency");
+const AMDRequireContextDependency = require("./AMDRequireContextDependency");
+const AMDRequireDependenciesBlock = require("./AMDRequireDependenciesBlock");
+const UnsupportedDependency = require("./UnsupportedDependency");
+const LocalModuleDependency = require("./LocalModuleDependency");
+const ContextDependencyHelpers = require("./ContextDependencyHelpers");
+const LocalModulesHelpers = require("./LocalModulesHelpers");
+const ConstDependency = require("./ConstDependency");
+const getFunctionExpression = require("./getFunctionExpression");
+const UnsupportedFeatureWarning = require("../UnsupportedFeatureWarning");
+
+class AMDRequireDependenciesBlockParserPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	processFunctionArgument(parser, expression) {
+		let bindThis = true;
+		const fnData = getFunctionExpression(expression);
+		if (fnData) {
+			parser.inScope(
+				fnData.fn.params.filter(i => {
+					return !["require", "module", "exports"].includes(i.name);
+				}),
+				() => {
+					if (fnData.fn.body.type === "BlockStatement") {
+						parser.walkStatement(fnData.fn.body);
+					} else {
+						parser.walkExpression(fnData.fn.body);
+					}
+				}
+			);
+			parser.walkExpressions(fnData.expressions);
+			if (fnData.needThis === false) {
+				bindThis = false;
+			}
+		} else {
+			parser.walkExpression(expression);
+		}
+		return bindThis;
+	}
+
+	apply(parser) {
+		parser.hooks.call
+			.for("require")
+			.tap(
+				"AMDRequireDependenciesBlockParserPlugin",
+				this.processCallRequire.bind(this, parser)
+			);
+	}
+
+	processArray(parser, expr, param) {
+		if (param.isArray()) {
+			for (const p of param.items) {
+				const result = this.processItem(parser, expr, p);
+				if (result === undefined) {
+					this.processContext(parser, expr, p);
+				}
+			}
+			return true;
+		} else if (param.isConstArray()) {
+			const deps = [];
+			for (const request of param.array) {
+				let dep, localModule;
+				if (request === "require") {
+					dep = "__webpack_require__";
+				} else if (["exports", "module"].includes(request)) {
+					dep = request;
+				} else if (
+					(localModule = LocalModulesHelpers.getLocalModule(
+						parser.state,
+						request
+					))
+				) {
+					dep = new LocalModuleDependency(localModule, undefined, false);
+					dep.loc = expr.loc;
+					parser.state.current.addDependency(dep);
+				} else {
+					dep = this.newRequireItemDependency(request);
+					dep.loc = expr.loc;
+					dep.optional = !!parser.scope.inTry;
+					parser.state.current.addDependency(dep);
+				}
+				deps.push(dep);
+			}
+			const dep = this.newRequireArrayDependency(deps, param.range);
+			dep.loc = expr.loc;
+			dep.optional = !!parser.scope.inTry;
+			parser.state.current.addDependency(dep);
+			return true;
+		}
+	}
+	processItem(parser, expr, param) {
+		if (param.isConditional()) {
+			for (const p of param.options) {
+				const result = this.processItem(parser, expr, p);
+				if (result === undefined) {
+					this.processContext(parser, expr, p);
+				}
+			}
+			return true;
+		} else if (param.isString()) {
+			let dep, localModule;
+			if (param.string === "require") {
+				dep = new ConstDependency("__webpack_require__", param.string);
+			} else if (param.string === "module") {
+				dep = new ConstDependency(
+					parser.state.module.buildInfo.moduleArgument,
+					param.range
+				);
+			} else if (param.string === "exports") {
+				dep = new ConstDependency(
+					parser.state.module.buildInfo.exportsArgument,
+					param.range
+				);
+			} else if (
+				(localModule = LocalModulesHelpers.getLocalModule(
+					parser.state,
+					param.string
+				))
+			) {
+				dep = new LocalModuleDependency(localModule, param.range, false);
+			} else {
+				dep = this.newRequireItemDependency(param.string, param.range);
+			}
+			dep.loc = expr.loc;
+			dep.optional = !!parser.scope.inTry;
+			parser.state.current.addDependency(dep);
+			return true;
+		}
+	}
+	processContext(parser, expr, param) {
+		const dep = ContextDependencyHelpers.create(
+			AMDRequireContextDependency,
+			param.range,
+			param,
+			expr,
+			this.options,
+			{},
+			parser
+		);
+		if (!dep) return;
+		dep.loc = expr.loc;
+		dep.optional = !!parser.scope.inTry;
+		parser.state.current.addDependency(dep);
+		return true;
+	}
+
+	processArrayForRequestString(param) {
+		if (param.isArray()) {
+			const result = param.items.map(item =>
+				this.processItemForRequestString(item)
+			);
+			if (result.every(Boolean)) return result.join(" ");
+		} else if (param.isConstArray()) {
+			return param.array.join(" ");
+		}
+	}
+
+	processItemForRequestString(param) {
+		if (param.isConditional()) {
+			const result = param.options.map(item =>
+				this.processItemForRequestString(item)
+			);
+			if (result.every(Boolean)) return result.join("|");
+		} else if (param.isString()) {
+			return param.string;
+		}
+	}
+
+	processCallRequire(parser, expr) {
+		let param;
+		let dep;
+		let result;
+
+		const old = parser.state.current;
+
+		if (expr.arguments.length >= 1) {
+			param = parser.evaluateExpression(expr.arguments[0]);
+			dep = this.newRequireDependenciesBlock(
+				expr,
+				param.range,
+				expr.arguments.length > 1 ? expr.arguments[1].range : null,
+				expr.arguments.length > 2 ? expr.arguments[2].range : null,
+				parser.state.module,
+				expr.loc,
+				this.processArrayForRequestString(param)
+			);
+			parser.state.current = dep;
+		}
+
+		if (expr.arguments.length === 1) {
+			parser.inScope([], () => {
+				result = this.processArray(parser, expr, param);
+			});
+			parser.state.current = old;
+			if (!result) return;
+			parser.state.current.addBlock(dep);
+			return true;
+		}
+
+		if (expr.arguments.length === 2 || expr.arguments.length === 3) {
+			try {
+				parser.inScope([], () => {
+					result = this.processArray(parser, expr, param);
+				});
+				if (!result) {
+					dep = new UnsupportedDependency("unsupported", expr.range);
+					old.addDependency(dep);
+					if (parser.state.module) {
+						parser.state.module.errors.push(
+							new UnsupportedFeatureWarning(
+								parser.state.module,
+								"Cannot statically analyse 'require(…, …)' in line " +
+									expr.loc.start.line,
+								expr.loc
+							)
+						);
+					}
+					dep = null;
+					return true;
+				}
+				dep.functionBindThis = this.processFunctionArgument(
+					parser,
+					expr.arguments[1]
+				);
+				if (expr.arguments.length === 3) {
+					dep.errorCallbackBindThis = this.processFunctionArgument(
+						parser,
+						expr.arguments[2]
+					);
+				}
+			} finally {
+				parser.state.current = old;
+				if (dep) parser.state.current.addBlock(dep);
+			}
+			return true;
+		}
+	}
+
+	newRequireDependenciesBlock(
+		expr,
+		arrayRange,
+		functionRange,
+		errorCallbackRange,
+		module,
+		loc,
+		request
+	) {
+		return new AMDRequireDependenciesBlock(
+			expr,
+			arrayRange,
+			functionRange,
+			errorCallbackRange,
+			module,
+			loc,
+			request
+		);
+	}
+	newRequireItemDependency(request, range) {
+		return new AMDRequireItemDependency(request, range);
+	}
+	newRequireArrayDependency(depsArray, range) {
+		return new AMDRequireArrayDependency(depsArray, range);
+	}
+}
+module.exports = AMDRequireDependenciesBlockParserPlugin;
diff --git a/node_modules/webpack/lib/dependencies/AMDRequireDependency.js b/node_modules/webpack/lib/dependencies/AMDRequireDependency.js
new file mode 100644
index 0000000..fd514e2
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDRequireDependency.js
@@ -0,0 +1,135 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class AMDRequireDependency extends NullDependency {
+	constructor(block) {
+		super();
+		this.block = block;
+	}
+}
+
+AMDRequireDependency.Template = class AMDRequireDependencyTemplate {
+	apply(dep, source, runtime) {
+		const depBlock = dep.block;
+		const promise = runtime.blockPromise({
+			block: depBlock,
+			message: "AMD require"
+		});
+
+		// has array range but no function range
+		if (depBlock.arrayRange && !depBlock.functionRange) {
+			const startBlock = `${promise}.then(function() {`;
+			const endBlock = `;}).catch(${runtime.onError()})`;
+			source.replace(
+				depBlock.outerRange[0],
+				depBlock.arrayRange[0] - 1,
+				startBlock
+			);
+			source.replace(
+				depBlock.arrayRange[1],
+				depBlock.outerRange[1] - 1,
+				endBlock
+			);
+			return;
+		}
+
+		// has function range but no array range
+		if (depBlock.functionRange && !depBlock.arrayRange) {
+			const startBlock = `${promise}.then((`;
+			const endBlock = `).bind(exports, __webpack_require__, exports, module)).catch(${runtime.onError()})`;
+			source.replace(
+				depBlock.outerRange[0],
+				depBlock.functionRange[0] - 1,
+				startBlock
+			);
+			source.replace(
+				depBlock.functionRange[1],
+				depBlock.outerRange[1] - 1,
+				endBlock
+			);
+			return;
+		}
+
+		// has array range, function range, and errorCallbackRange
+		if (
+			depBlock.arrayRange &&
+			depBlock.functionRange &&
+			depBlock.errorCallbackRange
+		) {
+			const startBlock = `${promise}.then(function() { `;
+			const errorRangeBlock = `}${
+				depBlock.functionBindThis ? ".bind(this)" : ""
+			}).catch(`;
+			const endBlock = `${
+				depBlock.errorCallbackBindThis ? ".bind(this)" : ""
+			})`;
+
+			source.replace(
+				depBlock.outerRange[0],
+				depBlock.arrayRange[0] - 1,
+				startBlock
+			);
+			source.insert(
+				depBlock.arrayRange[0] + 0.9,
+				"var __WEBPACK_AMD_REQUIRE_ARRAY__ = "
+			);
+			source.replace(
+				depBlock.arrayRange[1],
+				depBlock.functionRange[0] - 1,
+				"; ("
+			);
+			source.insert(
+				depBlock.functionRange[1],
+				").apply(null, __WEBPACK_AMD_REQUIRE_ARRAY__);"
+			);
+			source.replace(
+				depBlock.functionRange[1],
+				depBlock.errorCallbackRange[0] - 1,
+				errorRangeBlock
+			);
+			source.replace(
+				depBlock.errorCallbackRange[1],
+				depBlock.outerRange[1] - 1,
+				endBlock
+			);
+			return;
+		}
+
+		// has array range, function range, but no errorCallbackRange
+		if (depBlock.arrayRange && depBlock.functionRange) {
+			const startBlock = `${promise}.then(function() { `;
+			const endBlock = `}${
+				depBlock.functionBindThis ? ".bind(this)" : ""
+			}).catch(${runtime.onError()})`;
+			source.replace(
+				depBlock.outerRange[0],
+				depBlock.arrayRange[0] - 1,
+				startBlock
+			);
+			source.insert(
+				depBlock.arrayRange[0] + 0.9,
+				"var __WEBPACK_AMD_REQUIRE_ARRAY__ = "
+			);
+			source.replace(
+				depBlock.arrayRange[1],
+				depBlock.functionRange[0] - 1,
+				"; ("
+			);
+			source.insert(
+				depBlock.functionRange[1],
+				").apply(null, __WEBPACK_AMD_REQUIRE_ARRAY__);"
+			);
+			source.replace(
+				depBlock.functionRange[1],
+				depBlock.outerRange[1] - 1,
+				endBlock
+			);
+		}
+	}
+};
+
+module.exports = AMDRequireDependency;
diff --git a/node_modules/webpack/lib/dependencies/AMDRequireItemDependency.js b/node_modules/webpack/lib/dependencies/AMDRequireItemDependency.js
new file mode 100644
index 0000000..d033a90
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/AMDRequireItemDependency.js
@@ -0,0 +1,22 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+const ModuleDependencyTemplateAsRequireId = require("./ModuleDependencyTemplateAsRequireId");
+
+class AMDRequireItemDependency extends ModuleDependency {
+	constructor(request, range) {
+		super(request);
+		this.range = range;
+	}
+
+	get type() {
+		return "amd require";
+	}
+}
+
+AMDRequireItemDependency.Template = ModuleDependencyTemplateAsRequireId;
+
+module.exports = AMDRequireItemDependency;
diff --git a/node_modules/webpack/lib/dependencies/CommonJsPlugin.js b/node_modules/webpack/lib/dependencies/CommonJsPlugin.js
new file mode 100644
index 0000000..6d441a8
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/CommonJsPlugin.js
@@ -0,0 +1,158 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ConstDependency = require("./ConstDependency");
+const CommonJsRequireDependency = require("./CommonJsRequireDependency");
+const CommonJsRequireContextDependency = require("./CommonJsRequireContextDependency");
+const RequireResolveDependency = require("./RequireResolveDependency");
+const RequireResolveContextDependency = require("./RequireResolveContextDependency");
+const RequireResolveHeaderDependency = require("./RequireResolveHeaderDependency");
+const RequireHeaderDependency = require("./RequireHeaderDependency");
+
+const NullFactory = require("../NullFactory");
+
+const RequireResolveDependencyParserPlugin = require("./RequireResolveDependencyParserPlugin");
+const CommonJsRequireDependencyParserPlugin = require("./CommonJsRequireDependencyParserPlugin");
+
+const ParserHelpers = require("../ParserHelpers");
+
+class CommonJsPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		compiler.hooks.compilation.tap(
+			"CommonJsPlugin",
+			(compilation, { contextModuleFactory, normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					CommonJsRequireDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					CommonJsRequireDependency,
+					new CommonJsRequireDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					CommonJsRequireContextDependency,
+					contextModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					CommonJsRequireContextDependency,
+					new CommonJsRequireContextDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					RequireResolveDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					RequireResolveDependency,
+					new RequireResolveDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					RequireResolveContextDependency,
+					contextModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					RequireResolveContextDependency,
+					new RequireResolveContextDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					RequireResolveHeaderDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					RequireResolveHeaderDependency,
+					new RequireResolveHeaderDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					RequireHeaderDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					RequireHeaderDependency,
+					new RequireHeaderDependency.Template()
+				);
+
+				const handler = (parser, parserOptions) => {
+					if (parserOptions.commonjs !== undefined && !parserOptions.commonjs)
+						return;
+
+					const requireExpressions = [
+						"require",
+						"require.resolve",
+						"require.resolveWeak"
+					];
+					for (let expression of requireExpressions) {
+						parser.hooks.typeof
+							.for(expression)
+							.tap(
+								"CommonJsPlugin",
+								ParserHelpers.toConstantDependency(
+									parser,
+									JSON.stringify("function")
+								)
+							);
+						parser.hooks.evaluateTypeof
+							.for(expression)
+							.tap(
+								"CommonJsPlugin",
+								ParserHelpers.evaluateToString("function")
+							);
+						parser.hooks.evaluateIdentifier
+							.for(expression)
+							.tap(
+								"CommonJsPlugin",
+								ParserHelpers.evaluateToIdentifier(expression, true)
+							);
+					}
+
+					parser.hooks.evaluateTypeof
+						.for("module")
+						.tap("CommonJsPlugin", ParserHelpers.evaluateToString("object"));
+					parser.hooks.assign.for("require").tap("CommonJsPlugin", expr => {
+						// to not leak to global "require", we need to define a local require here.
+						const dep = new ConstDependency("var require;", 0);
+						dep.loc = expr.loc;
+						parser.state.current.addDependency(dep);
+						parser.scope.definitions.add("require");
+						return true;
+					});
+					parser.hooks.canRename
+						.for("require")
+						.tap("CommonJsPlugin", () => true);
+					parser.hooks.rename.for("require").tap("CommonJsPlugin", expr => {
+						// define the require variable. It's still undefined, but not "not defined".
+						const dep = new ConstDependency("var require;", 0);
+						dep.loc = expr.loc;
+						parser.state.current.addDependency(dep);
+						return false;
+					});
+					parser.hooks.typeof.for("module").tap("CommonJsPlugin", () => true);
+					parser.hooks.evaluateTypeof
+						.for("exports")
+						.tap("CommonJsPlugin", ParserHelpers.evaluateToString("object"));
+
+					new CommonJsRequireDependencyParserPlugin(options).apply(parser);
+					new RequireResolveDependencyParserPlugin(options).apply(parser);
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("CommonJsPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("CommonJsPlugin", handler);
+			}
+		);
+	}
+}
+module.exports = CommonJsPlugin;
diff --git a/node_modules/webpack/lib/dependencies/CommonJsRequireContextDependency.js b/node_modules/webpack/lib/dependencies/CommonJsRequireContextDependency.js
new file mode 100644
index 0000000..723a849
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/CommonJsRequireContextDependency.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ContextDependency = require("./ContextDependency");
+const ContextDependencyTemplateAsRequireCall = require("./ContextDependencyTemplateAsRequireCall");
+
+class CommonJsRequireContextDependency extends ContextDependency {
+	constructor(options, range, valueRange) {
+		super(options);
+		this.range = range;
+		this.valueRange = valueRange;
+	}
+
+	get type() {
+		return "cjs require context";
+	}
+}
+
+CommonJsRequireContextDependency.Template = ContextDependencyTemplateAsRequireCall;
+
+module.exports = CommonJsRequireContextDependency;
diff --git a/node_modules/webpack/lib/dependencies/CommonJsRequireDependency.js b/node_modules/webpack/lib/dependencies/CommonJsRequireDependency.js
new file mode 100644
index 0000000..29a30f3
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/CommonJsRequireDependency.js
@@ -0,0 +1,22 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+const ModuleDependencyTemplateAsId = require("./ModuleDependencyTemplateAsId");
+
+class CommonJsRequireDependency extends ModuleDependency {
+	constructor(request, range) {
+		super(request);
+		this.range = range;
+	}
+
+	get type() {
+		return "cjs require";
+	}
+}
+
+CommonJsRequireDependency.Template = ModuleDependencyTemplateAsId;
+
+module.exports = CommonJsRequireDependency;
diff --git a/node_modules/webpack/lib/dependencies/CommonJsRequireDependencyParserPlugin.js b/node_modules/webpack/lib/dependencies/CommonJsRequireDependencyParserPlugin.js
new file mode 100644
index 0000000..b0faa1a
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/CommonJsRequireDependencyParserPlugin.js
@@ -0,0 +1,138 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const CommonJsRequireDependency = require("./CommonJsRequireDependency");
+const CommonJsRequireContextDependency = require("./CommonJsRequireContextDependency");
+const RequireHeaderDependency = require("./RequireHeaderDependency");
+const LocalModuleDependency = require("./LocalModuleDependency");
+const ContextDependencyHelpers = require("./ContextDependencyHelpers");
+const LocalModulesHelpers = require("./LocalModulesHelpers");
+const ParserHelpers = require("../ParserHelpers");
+
+class CommonJsRequireDependencyParserPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(parser) {
+		const options = this.options;
+
+		const processItem = (expr, param) => {
+			if (param.isString()) {
+				const dep = new CommonJsRequireDependency(param.string, param.range);
+				dep.loc = expr.loc;
+				dep.optional = !!parser.scope.inTry;
+				parser.state.current.addDependency(dep);
+				return true;
+			}
+		};
+		const processContext = (expr, param) => {
+			const dep = ContextDependencyHelpers.create(
+				CommonJsRequireContextDependency,
+				expr.range,
+				param,
+				expr,
+				options,
+				{},
+				parser
+			);
+			if (!dep) return;
+			dep.loc = expr.loc;
+			dep.optional = !!parser.scope.inTry;
+			parser.state.current.addDependency(dep);
+			return true;
+		};
+
+		parser.hooks.expression
+			.for("require.cache")
+			.tap(
+				"CommonJsRequireDependencyParserPlugin",
+				ParserHelpers.toConstantDependencyWithWebpackRequire(
+					parser,
+					"__webpack_require__.c"
+				)
+			);
+		parser.hooks.expression
+			.for("require")
+			.tap("CommonJsRequireDependencyParserPlugin", expr => {
+				const dep = new CommonJsRequireContextDependency(
+					{
+						request: options.unknownContextRequest,
+						recursive: options.unknownContextRecursive,
+						regExp: options.unknownContextRegExp,
+						mode: "sync"
+					},
+					expr.range
+				);
+				dep.critical =
+					options.unknownContextCritical &&
+					"require function is used in a way in which dependencies cannot be statically extracted";
+				dep.loc = expr.loc;
+				dep.optional = !!parser.scope.inTry;
+				parser.state.current.addDependency(dep);
+				return true;
+			});
+
+		const createHandler = callNew => expr => {
+			if (expr.arguments.length !== 1) return;
+			let localModule;
+			const param = parser.evaluateExpression(expr.arguments[0]);
+			if (param.isConditional()) {
+				let isExpression = false;
+				const prevLength = parser.state.current.dependencies.length;
+				const dep = new RequireHeaderDependency(expr.callee.range);
+				dep.loc = expr.loc;
+				parser.state.current.addDependency(dep);
+				for (const p of param.options) {
+					const result = processItem(expr, p);
+					if (result === undefined) {
+						isExpression = true;
+					}
+				}
+				if (isExpression) {
+					parser.state.current.dependencies.length = prevLength;
+				} else {
+					return true;
+				}
+			}
+			if (
+				param.isString() &&
+				(localModule = LocalModulesHelpers.getLocalModule(
+					parser.state,
+					param.string
+				))
+			) {
+				const dep = new LocalModuleDependency(localModule, expr.range, callNew);
+				dep.loc = expr.loc;
+				parser.state.current.addDependency(dep);
+				return true;
+			} else {
+				const result = processItem(expr, param);
+				if (result === undefined) {
+					processContext(expr, param);
+				} else {
+					const dep = new RequireHeaderDependency(expr.callee.range);
+					dep.loc = expr.loc;
+					parser.state.current.addDependency(dep);
+				}
+				return true;
+			}
+		};
+		parser.hooks.call
+			.for("require")
+			.tap("CommonJsRequireDependencyParserPlugin", createHandler(false));
+		parser.hooks.new
+			.for("require")
+			.tap("CommonJsRequireDependencyParserPlugin", createHandler(true));
+		parser.hooks.call
+			.for("module.require")
+			.tap("CommonJsRequireDependencyParserPlugin", createHandler(false));
+		parser.hooks.new
+			.for("module.require")
+			.tap("CommonJsRequireDependencyParserPlugin", createHandler(true));
+	}
+}
+module.exports = CommonJsRequireDependencyParserPlugin;
diff --git a/node_modules/webpack/lib/dependencies/ConstDependency.js b/node_modules/webpack/lib/dependencies/ConstDependency.js
new file mode 100644
index 0000000..22edb8e
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ConstDependency.js
@@ -0,0 +1,33 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class ConstDependency extends NullDependency {
+	constructor(expression, range, requireWebpackRequire) {
+		super();
+		this.expression = expression;
+		this.range = range;
+		this.requireWebpackRequire = requireWebpackRequire;
+	}
+
+	updateHash(hash) {
+		hash.update(this.range + "");
+		hash.update(this.expression + "");
+	}
+}
+
+ConstDependency.Template = class ConstDependencyTemplate {
+	apply(dep, source) {
+		if (typeof dep.range === "number") {
+			source.insert(dep.range, dep.expression);
+			return;
+		}
+
+		source.replace(dep.range[0], dep.range[1] - 1, dep.expression);
+	}
+};
+
+module.exports = ConstDependency;
diff --git a/node_modules/webpack/lib/dependencies/ContextDependency.js b/node_modules/webpack/lib/dependencies/ContextDependency.js
new file mode 100644
index 0000000..10c2fea
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ContextDependency.js
@@ -0,0 +1,68 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const Dependency = require("../Dependency");
+const CriticalDependencyWarning = require("./CriticalDependencyWarning");
+
+const regExpToString = r => (r ? r + "" : "");
+
+class ContextDependency extends Dependency {
+	// options: { request, recursive, regExp, include, exclude, mode, chunkName, groupOptions }
+	constructor(options) {
+		super();
+		this.options = options;
+		this.userRequest = this.options.request;
+		/** @type {false | string} */
+		this.critical = false;
+		this.hadGlobalOrStickyRegExp = false;
+		if (this.options.regExp.global || this.options.regExp.sticky) {
+			this.options.regExp = null;
+			this.hadGlobalOrStickyRegExp = true;
+		}
+	}
+
+	getResourceIdentifier() {
+		return (
+			`context${this.options.request} ${this.options.recursive} ` +
+			`${regExpToString(this.options.regExp)} ${regExpToString(
+				this.options.include
+			)} ${regExpToString(this.options.exclude)} ` +
+			`${this.options.mode} ${this.options.chunkName} ` +
+			`${JSON.stringify(this.options.groupOptions)}`
+		);
+	}
+
+	getWarnings() {
+		let warnings = super.getWarnings() || [];
+		if (this.critical) {
+			warnings.push(new CriticalDependencyWarning(this.critical));
+		}
+		if (this.hadGlobalOrStickyRegExp) {
+			warnings.push(
+				new CriticalDependencyWarning(
+					"Contexts can't use RegExps with the 'g' or 'y' flags."
+				)
+			);
+		}
+		return warnings;
+	}
+}
+
+// TODO remove in webpack 5
+Object.defineProperty(ContextDependency.prototype, "async", {
+	configurable: false,
+	get() {
+		throw new Error(
+			"ContextDependency.async was removed. Use ContextDependency.options.mode instead."
+		);
+	},
+	set() {
+		throw new Error(
+			"ContextDependency.async was removed. Pass options.mode to constructor instead"
+		);
+	}
+});
+
+module.exports = ContextDependency;
diff --git a/node_modules/webpack/lib/dependencies/ContextDependencyHelpers.js b/node_modules/webpack/lib/dependencies/ContextDependencyHelpers.js
new file mode 100644
index 0000000..377425b
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ContextDependencyHelpers.js
@@ -0,0 +1,232 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ContextDependencyHelpers = exports;
+
+/**
+ * Escapes regular expression metacharacters
+ * @param {string} str String to quote
+ * @returns {string} Escaped string
+ */
+const quotemeta = str => {
+	return str.replace(/[-[\]\\/{}()*+?.^$|]/g, "\\$&");
+};
+
+const splitContextFromPrefix = prefix => {
+	const idx = prefix.lastIndexOf("/");
+	let context = ".";
+	if (idx >= 0) {
+		context = prefix.substr(0, idx);
+		prefix = `.${prefix.substr(idx)}`;
+	}
+	return {
+		context,
+		prefix
+	};
+};
+
+const splitQueryFromPostfix = postfix => {
+	const idx = postfix.indexOf("?");
+	let query = "";
+	if (idx >= 0) {
+		query = postfix.substr(idx);
+		postfix = postfix.substr(0, idx);
+	}
+	return {
+		postfix,
+		query
+	};
+};
+
+ContextDependencyHelpers.create = (
+	Dep,
+	range,
+	param,
+	expr,
+	options,
+	contextOptions,
+	// when parser is not passed in, expressions won't be walked
+	parser = null
+) => {
+	if (param.isTemplateString()) {
+		let prefixRaw = param.quasis[0].string;
+		let postfixRaw =
+			param.quasis.length > 1
+				? param.quasis[param.quasis.length - 1].string
+				: "";
+
+		const valueRange = param.range;
+		const { context, prefix } = splitContextFromPrefix(prefixRaw);
+		const { postfix, query } = splitQueryFromPostfix(postfixRaw);
+
+		// When there are more than two quasis, the generated RegExp can be more precise
+		// We join the quasis with the expression regexp
+		const innerQuasis = param.quasis.slice(1, param.quasis.length - 1);
+		const innerRegExp =
+			options.wrappedContextRegExp.source +
+			innerQuasis
+				.map(q => quotemeta(q.string) + options.wrappedContextRegExp.source)
+				.join("");
+
+		// Example: `./context/pre${e}inner${e}inner2${e}post?query`
+		// context: "./context"
+		// prefix: "./pre"
+		// innerQuasis: [BEE("inner"), BEE("inner2")]
+		// (BEE = BasicEvaluatedExpression)
+		// postfix: "post"
+		// query: "?query"
+		// regExp: /^\.\/pre.*inner.*inner2.*post$/
+		const regExp = new RegExp(
+			`^${quotemeta(prefix)}${innerRegExp}${quotemeta(postfix)}$`
+		);
+		const dep = new Dep(
+			Object.assign(
+				{
+					request: context + query,
+					recursive: options.wrappedContextRecursive,
+					regExp,
+					mode: "sync"
+				},
+				contextOptions
+			),
+			range,
+			valueRange
+		);
+		dep.loc = expr.loc;
+		const replaces = [];
+
+		param.parts.forEach((part, i) => {
+			if (i % 2 === 0) {
+				// Quasis or merged quasi
+				let range = part.range;
+				let value = part.string;
+				if (param.templateStringKind === "cooked") {
+					value = JSON.stringify(value);
+					value = value.slice(1, value.length - 1);
+				}
+				if (i === 0) {
+					// prefix
+					value = prefix;
+					range = [param.range[0], part.range[1]];
+					value =
+						(param.templateStringKind === "cooked" ? "`" : "String.raw`") +
+						value;
+				} else if (i === param.parts.length - 1) {
+					// postfix
+					value = postfix;
+					range = [part.range[0], param.range[1]];
+					value = value + "`";
+				} else if (
+					part.expression &&
+					part.expression.type === "TemplateElement" &&
+					part.expression.value.raw === value
+				) {
+					// Shortcut when it's a single quasi and doesn't need to be replaced
+					return;
+				}
+				replaces.push({
+					range,
+					value
+				});
+			} else {
+				// Expression
+				if (parser) {
+					parser.walkExpression(part.expression);
+				}
+			}
+		});
+
+		dep.replaces = replaces;
+		dep.critical =
+			options.wrappedContextCritical &&
+			"a part of the request of a dependency is an expression";
+		return dep;
+	} else if (
+		param.isWrapped() &&
+		((param.prefix && param.prefix.isString()) ||
+			(param.postfix && param.postfix.isString()))
+	) {
+		let prefixRaw =
+			param.prefix && param.prefix.isString() ? param.prefix.string : "";
+		let postfixRaw =
+			param.postfix && param.postfix.isString() ? param.postfix.string : "";
+		const prefixRange =
+			param.prefix && param.prefix.isString() ? param.prefix.range : null;
+		const postfixRange =
+			param.postfix && param.postfix.isString() ? param.postfix.range : null;
+		const valueRange = param.range;
+		const { context, prefix } = splitContextFromPrefix(prefixRaw);
+		const { postfix, query } = splitQueryFromPostfix(postfixRaw);
+		const regExp = new RegExp(
+			`^${quotemeta(prefix)}${options.wrappedContextRegExp.source}${quotemeta(
+				postfix
+			)}$`
+		);
+		const dep = new Dep(
+			Object.assign(
+				{
+					request: context + query,
+					recursive: options.wrappedContextRecursive,
+					regExp,
+					mode: "sync"
+				},
+				contextOptions
+			),
+			range,
+			valueRange
+		);
+		dep.loc = expr.loc;
+		const replaces = [];
+		if (prefixRange) {
+			replaces.push({
+				range: prefixRange,
+				value: JSON.stringify(prefix)
+			});
+		}
+		if (postfixRange) {
+			replaces.push({
+				range: postfixRange,
+				value: JSON.stringify(postfix)
+			});
+		}
+		dep.replaces = replaces;
+		dep.critical =
+			options.wrappedContextCritical &&
+			"a part of the request of a dependency is an expression";
+
+		if (parser && param.wrappedInnerExpressions) {
+			for (const part of param.wrappedInnerExpressions) {
+				if (part.expression) parser.walkExpression(part.expression);
+			}
+		}
+
+		return dep;
+	} else {
+		const dep = new Dep(
+			Object.assign(
+				{
+					request: options.exprContextRequest,
+					recursive: options.exprContextRecursive,
+					regExp: options.exprContextRegExp,
+					mode: "sync"
+				},
+				contextOptions
+			),
+			range,
+			param.range
+		);
+		dep.loc = expr.loc;
+		dep.critical =
+			options.exprContextCritical &&
+			"the request of a dependency is an expression";
+
+		if (parser) {
+			parser.walkExpression(param.expression);
+		}
+
+		return dep;
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/ContextDependencyTemplateAsId.js b/node_modules/webpack/lib/dependencies/ContextDependencyTemplateAsId.js
new file mode 100644
index 0000000..1ee83ff
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ContextDependencyTemplateAsId.js
@@ -0,0 +1,43 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class ContextDependencyTemplateAsId {
+	apply(dep, source, runtime) {
+		const moduleExports = runtime.moduleExports({
+			module: dep.module,
+			request: dep.request
+		});
+
+		if (dep.module) {
+			if (dep.valueRange) {
+				if (Array.isArray(dep.replaces)) {
+					for (let i = 0; i < dep.replaces.length; i++) {
+						const rep = dep.replaces[i];
+						source.replace(rep.range[0], rep.range[1] - 1, rep.value);
+					}
+				}
+				source.replace(dep.valueRange[1], dep.range[1] - 1, ")");
+				// TODO webpack 5 remove `prepend` it's no longer used
+				source.replace(
+					dep.range[0],
+					dep.valueRange[0] - 1,
+					`${moduleExports}.resolve(${
+						typeof dep.prepend === "string" ? JSON.stringify(dep.prepend) : ""
+					}`
+				);
+			} else {
+				source.replace(
+					dep.range[0],
+					dep.range[1] - 1,
+					`${moduleExports}.resolve`
+				);
+			}
+		} else {
+			source.replace(dep.range[0], dep.range[1] - 1, moduleExports);
+		}
+	}
+}
+module.exports = ContextDependencyTemplateAsId;
diff --git a/node_modules/webpack/lib/dependencies/ContextDependencyTemplateAsRequireCall.js b/node_modules/webpack/lib/dependencies/ContextDependencyTemplateAsRequireCall.js
new file mode 100644
index 0000000..6d833ac
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ContextDependencyTemplateAsRequireCall.js
@@ -0,0 +1,39 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class ContextDependencyTemplateAsRequireCall {
+	apply(dep, source, runtime) {
+		const moduleExports = runtime.moduleExports({
+			module: dep.module,
+			request: dep.request
+		});
+
+		if (dep.module) {
+			if (dep.valueRange) {
+				if (Array.isArray(dep.replaces)) {
+					for (let i = 0; i < dep.replaces.length; i++) {
+						const rep = dep.replaces[i];
+						source.replace(rep.range[0], rep.range[1] - 1, rep.value);
+					}
+				}
+				source.replace(dep.valueRange[1], dep.range[1] - 1, ")");
+				// TODO webpack 5 remove `prepend` it's no longer used
+				source.replace(
+					dep.range[0],
+					dep.valueRange[0] - 1,
+					`${moduleExports}(${
+						typeof dep.prepend === "string" ? JSON.stringify(dep.prepend) : ""
+					}`
+				);
+			} else {
+				source.replace(dep.range[0], dep.range[1] - 1, moduleExports);
+			}
+		} else {
+			source.replace(dep.range[0], dep.range[1] - 1, moduleExports);
+		}
+	}
+}
+module.exports = ContextDependencyTemplateAsRequireCall;
diff --git a/node_modules/webpack/lib/dependencies/ContextElementDependency.js b/node_modules/webpack/lib/dependencies/ContextElementDependency.js
new file mode 100644
index 0000000..2587704
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ContextElementDependency.js
@@ -0,0 +1,21 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+
+class ContextElementDependency extends ModuleDependency {
+	constructor(request, userRequest) {
+		super(request);
+		if (userRequest) {
+			this.userRequest = userRequest;
+		}
+	}
+
+	get type() {
+		return "context element";
+	}
+}
+
+module.exports = ContextElementDependency;
diff --git a/node_modules/webpack/lib/dependencies/CriticalDependencyWarning.js b/node_modules/webpack/lib/dependencies/CriticalDependencyWarning.js
new file mode 100644
index 0000000..43bd568
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/CriticalDependencyWarning.js
@@ -0,0 +1,20 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("../WebpackError");
+
+class CriticalDependencyWarning extends WebpackError {
+	constructor(message) {
+		super();
+
+		this.name = "CriticalDependencyWarning";
+		this.message = "Critical dependency: " + message;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = CriticalDependencyWarning;
diff --git a/node_modules/webpack/lib/dependencies/DelegatedExportsDependency.js b/node_modules/webpack/lib/dependencies/DelegatedExportsDependency.js
new file mode 100644
index 0000000..fcacedb
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/DelegatedExportsDependency.js
@@ -0,0 +1,33 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DependencyReference = require("./DependencyReference");
+const NullDependency = require("./NullDependency");
+
+class DelegatedExportsDependency extends NullDependency {
+	constructor(originModule, exports) {
+		super();
+		this.originModule = originModule;
+		this.exports = exports;
+	}
+
+	get type() {
+		return "delegated exports";
+	}
+
+	getReference() {
+		return new DependencyReference(this.originModule, true, false);
+	}
+
+	getExports() {
+		return {
+			exports: this.exports,
+			dependencies: undefined
+		};
+	}
+}
+
+module.exports = DelegatedExportsDependency;
diff --git a/node_modules/webpack/lib/dependencies/DelegatedSourceDependency.js b/node_modules/webpack/lib/dependencies/DelegatedSourceDependency.js
new file mode 100644
index 0000000..7b0b9de
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/DelegatedSourceDependency.js
@@ -0,0 +1,18 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+
+class DelegatedSourceDependency extends ModuleDependency {
+	constructor(request) {
+		super(request);
+	}
+
+	get type() {
+		return "delegated source";
+	}
+}
+
+module.exports = DelegatedSourceDependency;
diff --git a/node_modules/webpack/lib/dependencies/DependencyReference.js b/node_modules/webpack/lib/dependencies/DependencyReference.js
new file mode 100644
index 0000000..a8f6afa
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/DependencyReference.js
@@ -0,0 +1,64 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Florent Cailhol @ooflorent
+*/
+"use strict";
+
+/** @typedef {import("../Module")} Module */
+
+class DependencyReference {
+	// TODO webpack 5: module must be dynamic, you must pass a function returning a module
+	// This is needed to remove the hack in ConcatenatedModule
+	// The problem is that the `module` in Dependency could be replaced i. e. because of Scope Hoisting
+	/**
+	 *
+	 * @param {Module} module the referenced module
+	 * @param {string[] | boolean} importedNames imported named from the module
+	 * @param {boolean=} weak if this is a weak reference
+	 * @param {number} order the order information or NaN if don't care
+	 */
+	constructor(module, importedNames, weak = false, order = NaN) {
+		// TODO webpack 5: make it a getter
+		this.module = module;
+		// true: full object
+		// false: only sideeffects/no export
+		// array of strings: the exports with this names
+		this.importedNames = importedNames;
+		this.weak = !!weak;
+		this.order = order;
+	}
+
+	/**
+	 * @param {DependencyReference[]} array an array (will be modified)
+	 * @returns {DependencyReference[]} the array again
+	 */
+	static sort(array) {
+		/** @type {WeakMap<DependencyReference, number>} */
+		const originalOrder = new WeakMap();
+		let i = 0;
+		for (const ref of array) {
+			originalOrder.set(ref, i++);
+		}
+		return array.sort((a, b) => {
+			const aOrder = a.order;
+			const bOrder = b.order;
+			if (isNaN(aOrder)) {
+				if (!isNaN(bOrder)) {
+					return 1;
+				}
+			} else {
+				if (isNaN(bOrder)) {
+					return -1;
+				}
+				if (aOrder !== bOrder) {
+					return aOrder - bOrder;
+				}
+			}
+			const aOrg = originalOrder.get(a);
+			const bOrg = originalOrder.get(b);
+			return aOrg - bOrg;
+		});
+	}
+}
+
+module.exports = DependencyReference;
diff --git a/node_modules/webpack/lib/dependencies/DllEntryDependency.js b/node_modules/webpack/lib/dependencies/DllEntryDependency.js
new file mode 100644
index 0000000..47c6acc
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/DllEntryDependency.js
@@ -0,0 +1,20 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const Dependency = require("../Dependency");
+
+class DllEntryDependency extends Dependency {
+	constructor(dependencies, name) {
+		super();
+		this.dependencies = dependencies;
+		this.name = name;
+	}
+
+	get type() {
+		return "dll entry";
+	}
+}
+
+module.exports = DllEntryDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyAcceptDependency.js b/node_modules/webpack/lib/dependencies/HarmonyAcceptDependency.js
new file mode 100644
index 0000000..edb7b01
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyAcceptDependency.js
@@ -0,0 +1,48 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const NullDependency = require("./NullDependency");
+const HarmonyImportDependency = require("./HarmonyImportDependency");
+
+class HarmonyAcceptDependency extends NullDependency {
+	constructor(range, dependencies, hasCallback) {
+		super();
+		this.range = range;
+		this.dependencies = dependencies;
+		this.hasCallback = hasCallback;
+	}
+
+	get type() {
+		return "accepted harmony modules";
+	}
+}
+
+HarmonyAcceptDependency.Template = class HarmonyAcceptDependencyTemplate {
+	apply(dep, source, runtime) {
+		const content = dep.dependencies
+			.filter(dependency =>
+				HarmonyImportDependency.Template.isImportEmitted(dependency, source)
+			)
+			.map(dependency => dependency.getImportStatement(true, runtime))
+			.join("");
+
+		if (dep.hasCallback) {
+			source.insert(
+				dep.range[0],
+				`function(__WEBPACK_OUTDATED_DEPENDENCIES__) { ${content}(`
+			);
+			source.insert(
+				dep.range[1],
+				")(__WEBPACK_OUTDATED_DEPENDENCIES__); }.bind(this)"
+			);
+			return;
+		}
+
+		source.insert(dep.range[1] - 0.5, `, function() { ${content} }`);
+	}
+};
+
+module.exports = HarmonyAcceptDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyAcceptImportDependency.js b/node_modules/webpack/lib/dependencies/HarmonyAcceptImportDependency.js
new file mode 100644
index 0000000..62bd00c
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyAcceptImportDependency.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const HarmonyImportDependency = require("./HarmonyImportDependency");
+
+class HarmonyAcceptImportDependency extends HarmonyImportDependency {
+	constructor(request, originModule, parserScope) {
+		super(request, originModule, NaN, parserScope);
+		this.weak = true;
+	}
+
+	get type() {
+		return "harmony accept";
+	}
+}
+
+HarmonyAcceptImportDependency.Template = class HarmonyAcceptImportDependencyTemplate extends HarmonyImportDependency.Template {
+	apply(dep, source, runtime) {}
+};
+
+module.exports = HarmonyAcceptImportDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyCompatibilityDependency.js b/node_modules/webpack/lib/dependencies/HarmonyCompatibilityDependency.js
new file mode 100644
index 0000000..d6febb5
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyCompatibilityDependency.js
@@ -0,0 +1,31 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class HarmonyCompatibilityDependency extends NullDependency {
+	constructor(originModule) {
+		super();
+		this.originModule = originModule;
+	}
+
+	get type() {
+		return "harmony export header";
+	}
+}
+
+HarmonyCompatibilityDependency.Template = class HarmonyExportDependencyTemplate {
+	apply(dep, source, runtime) {
+		const usedExports = dep.originModule.usedExports;
+		if (usedExports !== false && !Array.isArray(usedExports)) {
+			const content = runtime.defineEsModuleFlagStatement({
+				exportsArgument: dep.originModule.exportsArgument
+			});
+			source.insert(-10, content);
+		}
+	}
+};
+
+module.exports = HarmonyCompatibilityDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyDetectionParserPlugin.js b/node_modules/webpack/lib/dependencies/HarmonyDetectionParserPlugin.js
new file mode 100644
index 0000000..1a0872f
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyDetectionParserPlugin.js
@@ -0,0 +1,96 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const HarmonyCompatibilityDependency = require("./HarmonyCompatibilityDependency");
+const HarmonyInitDependency = require("./HarmonyInitDependency");
+
+module.exports = class HarmonyDetectionParserPlugin {
+	apply(parser) {
+		parser.hooks.program.tap("HarmonyDetectionParserPlugin", ast => {
+			const isStrictHarmony = parser.state.module.type === "javascript/esm";
+			const isHarmony =
+				isStrictHarmony ||
+				ast.body.some(
+					statement =>
+						statement.type === "ImportDeclaration" ||
+						statement.type === "ExportDefaultDeclaration" ||
+						statement.type === "ExportNamedDeclaration" ||
+						statement.type === "ExportAllDeclaration"
+				);
+			if (isHarmony) {
+				const module = parser.state.module;
+				const compatDep = new HarmonyCompatibilityDependency(module);
+				compatDep.loc = {
+					start: {
+						line: -1,
+						column: 0
+					},
+					end: {
+						line: -1,
+						column: 0
+					},
+					index: -3
+				};
+				module.addDependency(compatDep);
+				const initDep = new HarmonyInitDependency(module);
+				initDep.loc = {
+					start: {
+						line: -1,
+						column: 0
+					},
+					end: {
+						line: -1,
+						column: 0
+					},
+					index: -2
+				};
+				module.addDependency(initDep);
+				parser.state.harmonyParserScope = parser.state.harmonyParserScope || {};
+				parser.scope.isStrict = true;
+				module.buildMeta.exportsType = "namespace";
+				module.buildInfo.strict = true;
+				module.buildInfo.exportsArgument = "__webpack_exports__";
+				if (isStrictHarmony) {
+					module.buildMeta.strictHarmonyModule = true;
+					module.buildInfo.moduleArgument = "__webpack_module__";
+				}
+			}
+		});
+
+		const skipInHarmony = () => {
+			const module = parser.state.module;
+			if (module && module.buildMeta && module.buildMeta.exportsType) {
+				return true;
+			}
+		};
+
+		const nullInHarmony = () => {
+			const module = parser.state.module;
+			if (module && module.buildMeta && module.buildMeta.exportsType) {
+				return null;
+			}
+		};
+
+		const nonHarmonyIdentifiers = ["define", "exports"];
+		for (const identifer of nonHarmonyIdentifiers) {
+			parser.hooks.evaluateTypeof
+				.for(identifer)
+				.tap("HarmonyDetectionParserPlugin", nullInHarmony);
+			parser.hooks.typeof
+				.for(identifer)
+				.tap("HarmonyDetectionParserPlugin", skipInHarmony);
+			parser.hooks.evaluate
+				.for(identifer)
+				.tap("HarmonyDetectionParserPlugin", nullInHarmony);
+			parser.hooks.expression
+				.for(identifer)
+				.tap("HarmonyDetectionParserPlugin", skipInHarmony);
+			parser.hooks.call
+				.for(identifer)
+				.tap("HarmonyDetectionParserPlugin", skipInHarmony);
+		}
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/HarmonyExportDependencyParserPlugin.js b/node_modules/webpack/lib/dependencies/HarmonyExportDependencyParserPlugin.js
new file mode 100644
index 0000000..6ab0c0f
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyExportDependencyParserPlugin.js
@@ -0,0 +1,154 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const HarmonyExportExpressionDependency = require("./HarmonyExportExpressionDependency");
+const HarmonyImportSideEffectDependency = require("./HarmonyImportSideEffectDependency");
+const HarmonyExportHeaderDependency = require("./HarmonyExportHeaderDependency");
+const HarmonyExportSpecifierDependency = require("./HarmonyExportSpecifierDependency");
+const HarmonyExportImportedSpecifierDependency = require("./HarmonyExportImportedSpecifierDependency");
+const ConstDependency = require("./ConstDependency");
+
+module.exports = class HarmonyExportDependencyParserPlugin {
+	constructor(moduleOptions) {
+		this.strictExportPresence = moduleOptions.strictExportPresence;
+	}
+
+	apply(parser) {
+		parser.hooks.export.tap(
+			"HarmonyExportDependencyParserPlugin",
+			statement => {
+				const dep = new HarmonyExportHeaderDependency(
+					statement.declaration && statement.declaration.range,
+					statement.range
+				);
+				dep.loc = Object.create(statement.loc);
+				dep.loc.index = -1;
+				parser.state.current.addDependency(dep);
+				return true;
+			}
+		);
+		parser.hooks.exportImport.tap(
+			"HarmonyExportDependencyParserPlugin",
+			(statement, source) => {
+				parser.state.lastHarmonyImportOrder =
+					(parser.state.lastHarmonyImportOrder || 0) + 1;
+				const clearDep = new ConstDependency("", statement.range);
+				clearDep.loc = Object.create(statement.loc);
+				clearDep.loc.index = -1;
+				parser.state.current.addDependency(clearDep);
+				const sideEffectDep = new HarmonyImportSideEffectDependency(
+					source,
+					parser.state.module,
+					parser.state.lastHarmonyImportOrder,
+					parser.state.harmonyParserScope
+				);
+				sideEffectDep.loc = Object.create(statement.loc);
+				sideEffectDep.loc.index = -1;
+				parser.state.current.addDependency(sideEffectDep);
+				return true;
+			}
+		);
+		parser.hooks.exportExpression.tap(
+			"HarmonyExportDependencyParserPlugin",
+			(statement, expr) => {
+				const comments = parser.getComments([
+					statement.range[0],
+					expr.range[0]
+				]);
+				const dep = new HarmonyExportExpressionDependency(
+					parser.state.module,
+					expr.range,
+					statement.range,
+					comments
+						.map(c => {
+							switch (c.type) {
+								case "Block":
+									return `/*${c.value}*/`;
+								case "Line":
+									return `//${c.value}\n`;
+							}
+							return "";
+						})
+						.join("")
+				);
+				dep.loc = Object.create(statement.loc);
+				dep.loc.index = -1;
+				parser.state.current.addDependency(dep);
+				return true;
+			}
+		);
+		parser.hooks.exportDeclaration.tap(
+			"HarmonyExportDependencyParserPlugin",
+			statement => {}
+		);
+		parser.hooks.exportSpecifier.tap(
+			"HarmonyExportDependencyParserPlugin",
+			(statement, id, name, idx) => {
+				const rename = parser.scope.renames.get(id);
+				let dep;
+				const harmonyNamedExports = (parser.state.harmonyNamedExports =
+					parser.state.harmonyNamedExports || new Set());
+				harmonyNamedExports.add(name);
+				if (rename === "imported var") {
+					const settings = parser.state.harmonySpecifier.get(id);
+					dep = new HarmonyExportImportedSpecifierDependency(
+						settings.source,
+						parser.state.module,
+						settings.sourceOrder,
+						parser.state.harmonyParserScope,
+						settings.id,
+						name,
+						harmonyNamedExports,
+						null,
+						this.strictExportPresence
+					);
+				} else {
+					dep = new HarmonyExportSpecifierDependency(
+						parser.state.module,
+						id,
+						name
+					);
+				}
+				dep.loc = Object.create(statement.loc);
+				dep.loc.index = idx;
+				parser.state.current.addDependency(dep);
+				return true;
+			}
+		);
+		parser.hooks.exportImportSpecifier.tap(
+			"HarmonyExportDependencyParserPlugin",
+			(statement, source, id, name, idx) => {
+				const harmonyNamedExports = (parser.state.harmonyNamedExports =
+					parser.state.harmonyNamedExports || new Set());
+				let harmonyStarExports = null;
+				if (name) {
+					harmonyNamedExports.add(name);
+				} else {
+					harmonyStarExports = parser.state.harmonyStarExports =
+						parser.state.harmonyStarExports || [];
+				}
+				const dep = new HarmonyExportImportedSpecifierDependency(
+					source,
+					parser.state.module,
+					parser.state.lastHarmonyImportOrder,
+					parser.state.harmonyParserScope,
+					id,
+					name,
+					harmonyNamedExports,
+					harmonyStarExports && harmonyStarExports.slice(),
+					this.strictExportPresence
+				);
+				if (harmonyStarExports) {
+					harmonyStarExports.push(dep);
+				}
+				dep.loc = Object.create(statement.loc);
+				dep.loc.index = idx;
+				parser.state.current.addDependency(dep);
+				return true;
+			}
+		);
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/HarmonyExportExpressionDependency.js b/node_modules/webpack/lib/dependencies/HarmonyExportExpressionDependency.js
new file mode 100644
index 0000000..dfb499a
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyExportExpressionDependency.js
@@ -0,0 +1,58 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class HarmonyExportExpressionDependency extends NullDependency {
+	constructor(originModule, range, rangeStatement, prefix) {
+		super();
+		this.originModule = originModule;
+		this.range = range;
+		this.rangeStatement = rangeStatement;
+		this.prefix = prefix;
+	}
+
+	get type() {
+		return "harmony export expression";
+	}
+
+	getExports() {
+		return {
+			exports: ["default"],
+			dependencies: undefined
+		};
+	}
+}
+
+HarmonyExportExpressionDependency.Template = class HarmonyExportDependencyTemplate {
+	apply(dep, source) {
+		const used = dep.originModule.isUsed("default");
+		const content = this.getContent(dep.originModule, used);
+
+		if (dep.range) {
+			source.replace(
+				dep.rangeStatement[0],
+				dep.range[0] - 1,
+				content + "(" + dep.prefix
+			);
+			source.replace(dep.range[1], dep.rangeStatement[1] - 1, ");");
+			return;
+		}
+
+		source.replace(dep.rangeStatement[0], dep.rangeStatement[1] - 1, content);
+	}
+
+	getContent(module, used) {
+		const exportsName = module.exportsArgument;
+		if (used) {
+			return `/* harmony default export */ ${exportsName}[${JSON.stringify(
+				used
+			)}] = `;
+		}
+		return "/* unused harmony default export */ var _unused_webpack_default_export = ";
+	}
+};
+
+module.exports = HarmonyExportExpressionDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyExportHeaderDependency.js b/node_modules/webpack/lib/dependencies/HarmonyExportHeaderDependency.js
new file mode 100644
index 0000000..a0e9918
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyExportHeaderDependency.js
@@ -0,0 +1,30 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class HarmonyExportHeaderDependency extends NullDependency {
+	constructor(range, rangeStatement) {
+		super();
+		this.range = range;
+		this.rangeStatement = rangeStatement;
+	}
+
+	get type() {
+		return "harmony export header";
+	}
+}
+
+HarmonyExportHeaderDependency.Template = class HarmonyExportDependencyTemplate {
+	apply(dep, source) {
+		const content = "";
+		const replaceUntil = dep.range
+			? dep.range[0] - 1
+			: dep.rangeStatement[1] - 1;
+		source.replace(dep.rangeStatement[0], replaceUntil, content);
+	}
+};
+
+module.exports = HarmonyExportHeaderDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyExportImportedSpecifierDependency.js b/node_modules/webpack/lib/dependencies/HarmonyExportImportedSpecifierDependency.js
new file mode 100644
index 0000000..bca61a0
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyExportImportedSpecifierDependency.js
@@ -0,0 +1,659 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DependencyReference = require("./DependencyReference");
+const HarmonyImportDependency = require("./HarmonyImportDependency");
+const Template = require("../Template");
+const HarmonyLinkingError = require("../HarmonyLinkingError");
+
+/** @typedef {import("../Module")} Module */
+
+/** @typedef {"missing"|"unused"|"empty-star"|"reexport-non-harmony-default"|"reexport-named-default"|"reexport-namespace-object"|"reexport-non-harmony-default-strict"|"reexport-fake-namespace-object"|"rexport-non-harmony-undefined"|"safe-reexport"|"checked-reexport"|"dynamic-reexport"} ExportModeType */
+
+/** @type {Map<string, string>} */
+const EMPTY_MAP = new Map();
+
+class ExportMode {
+	/**
+	 * @param {ExportModeType} type type of the mode
+	 */
+	constructor(type) {
+		/** @type {ExportModeType} */
+		this.type = type;
+		/** @type {string|null} */
+		this.name = null;
+		/** @type {Map<string, string>} */
+		this.map = EMPTY_MAP;
+		/** @type {Set<string>|null} */
+		this.ignored = null;
+		/** @type {Module|null} */
+		this.module = null;
+		/** @type {string|null} */
+		this.userRequest = null;
+	}
+}
+
+const EMPTY_STAR_MODE = new ExportMode("empty-star");
+
+class HarmonyExportImportedSpecifierDependency extends HarmonyImportDependency {
+	constructor(
+		request,
+		originModule,
+		sourceOrder,
+		parserScope,
+		id,
+		name,
+		activeExports,
+		otherStarExports,
+		strictExportPresence
+	) {
+		super(request, originModule, sourceOrder, parserScope);
+		this.id = id;
+		this.redirectedId = undefined;
+		this.name = name;
+		this.activeExports = activeExports;
+		this.otherStarExports = otherStarExports;
+		this.strictExportPresence = strictExportPresence;
+	}
+
+	get type() {
+		return "harmony export imported specifier";
+	}
+
+	get _id() {
+		return this.redirectedId || this.id;
+	}
+
+	getMode(ignoreUnused) {
+		const name = this.name;
+		const id = this._id;
+		const used = this.originModule.isUsed(name);
+		const importedModule = this._module;
+
+		if (!importedModule) {
+			const mode = new ExportMode("missing");
+			mode.userRequest = this.userRequest;
+			return mode;
+		}
+
+		if (
+			!ignoreUnused &&
+			(name ? !used : this.originModule.usedExports === false)
+		) {
+			const mode = new ExportMode("unused");
+			mode.name = name || "*";
+			return mode;
+		}
+
+		const strictHarmonyModule = this.originModule.buildMeta.strictHarmonyModule;
+		if (name && id === "default" && importedModule.buildMeta) {
+			if (!importedModule.buildMeta.exportsType) {
+				const mode = new ExportMode(
+					strictHarmonyModule
+						? "reexport-non-harmony-default-strict"
+						: "reexport-non-harmony-default"
+				);
+				mode.name = name;
+				mode.module = importedModule;
+				return mode;
+			} else if (importedModule.buildMeta.exportsType === "named") {
+				const mode = new ExportMode("reexport-named-default");
+				mode.name = name;
+				mode.module = importedModule;
+				return mode;
+			}
+		}
+
+		const isNotAHarmonyModule =
+			importedModule.buildMeta && !importedModule.buildMeta.exportsType;
+		if (name) {
+			let mode;
+			if (id) {
+				// export { name as name }
+				if (isNotAHarmonyModule && strictHarmonyModule) {
+					mode = new ExportMode("rexport-non-harmony-undefined");
+					mode.name = name;
+				} else {
+					mode = new ExportMode("safe-reexport");
+					mode.map = new Map([[name, id]]);
+				}
+			} else {
+				// export { * as name }
+				if (isNotAHarmonyModule && strictHarmonyModule) {
+					mode = new ExportMode("reexport-fake-namespace-object");
+					mode.name = name;
+				} else {
+					mode = new ExportMode("reexport-namespace-object");
+					mode.name = name;
+				}
+			}
+			mode.module = importedModule;
+			return mode;
+		}
+
+		const hasUsedExports = Array.isArray(this.originModule.usedExports);
+		const hasProvidedExports = Array.isArray(
+			importedModule.buildMeta.providedExports
+		);
+		const activeFromOtherStarExports = this._discoverActiveExportsFromOtherStartExports();
+
+		// export *
+		if (hasUsedExports) {
+			// reexport * with known used exports
+			if (hasProvidedExports) {
+				const map = new Map(
+					this.originModule.usedExports
+						.filter(id => {
+							if (id === "default") return false;
+							if (this.activeExports.has(id)) return false;
+							if (activeFromOtherStarExports.has(id)) return false;
+							if (!importedModule.buildMeta.providedExports.includes(id))
+								return false;
+							return true;
+						})
+						.map(item => [item, item])
+				);
+
+				if (map.size === 0) {
+					return EMPTY_STAR_MODE;
+				}
+
+				const mode = new ExportMode("safe-reexport");
+				mode.module = importedModule;
+				mode.map = map;
+				return mode;
+			}
+
+			const map = new Map(
+				this.originModule.usedExports
+					.filter(id => {
+						if (id === "default") return false;
+						if (this.activeExports.has(id)) return false;
+						if (activeFromOtherStarExports.has(id)) return false;
+
+						return true;
+					})
+					.map(item => [item, item])
+			);
+
+			if (map.size === 0) {
+				return EMPTY_STAR_MODE;
+			}
+
+			const mode = new ExportMode("checked-reexport");
+			mode.module = importedModule;
+			mode.map = map;
+			return mode;
+		}
+
+		if (hasProvidedExports) {
+			const map = new Map(
+				importedModule.buildMeta.providedExports
+					.filter(id => {
+						if (id === "default") return false;
+						if (this.activeExports.has(id)) return false;
+						if (activeFromOtherStarExports.has(id)) return false;
+
+						return true;
+					})
+					.map(item => [item, item])
+			);
+
+			if (map.size === 0) {
+				return EMPTY_STAR_MODE;
+			}
+
+			const mode = new ExportMode("safe-reexport");
+			mode.module = importedModule;
+			mode.map = map;
+			return mode;
+		}
+
+		const mode = new ExportMode("dynamic-reexport");
+		mode.module = importedModule;
+		mode.ignored = new Set([
+			"default",
+			...this.activeExports,
+			...activeFromOtherStarExports
+		]);
+		return mode;
+	}
+
+	getReference() {
+		const mode = this.getMode(false);
+
+		switch (mode.type) {
+			case "missing":
+			case "unused":
+			case "empty-star":
+				return null;
+
+			case "reexport-non-harmony-default":
+			case "reexport-named-default":
+				return new DependencyReference(
+					mode.module,
+					["default"],
+					false,
+					this.sourceOrder
+				);
+
+			case "reexport-namespace-object":
+			case "reexport-non-harmony-default-strict":
+			case "reexport-fake-namespace-object":
+			case "rexport-non-harmony-undefined":
+				return new DependencyReference(
+					mode.module,
+					true,
+					false,
+					this.sourceOrder
+				);
+
+			case "safe-reexport":
+			case "checked-reexport":
+				return new DependencyReference(
+					mode.module,
+					Array.from(mode.map.values()),
+					false,
+					this.sourceOrder
+				);
+
+			case "dynamic-reexport":
+				return new DependencyReference(
+					mode.module,
+					true,
+					false,
+					this.sourceOrder
+				);
+
+			default:
+				throw new Error(`Unknown mode ${mode.type}`);
+		}
+	}
+
+	_discoverActiveExportsFromOtherStartExports() {
+		if (!this.otherStarExports) return new Set();
+		const result = new Set();
+		// try to learn impossible exports from other star exports with provided exports
+		for (const otherStarExport of this.otherStarExports) {
+			const otherImportedModule = otherStarExport._module;
+			if (
+				otherImportedModule &&
+				Array.isArray(otherImportedModule.buildMeta.providedExports)
+			) {
+				for (const exportName of otherImportedModule.buildMeta
+					.providedExports) {
+					result.add(exportName);
+				}
+			}
+		}
+		return result;
+	}
+
+	getExports() {
+		if (this.name) {
+			return {
+				exports: [this.name],
+				dependencies: undefined
+			};
+		}
+
+		const importedModule = this._module;
+
+		if (!importedModule) {
+			// no imported module available
+			return {
+				exports: null,
+				dependencies: undefined
+			};
+		}
+
+		if (Array.isArray(importedModule.buildMeta.providedExports)) {
+			const activeFromOtherStarExports = this._discoverActiveExportsFromOtherStartExports();
+			return {
+				exports: importedModule.buildMeta.providedExports.filter(
+					id =>
+						id !== "default" &&
+						!activeFromOtherStarExports.has(id) &&
+						!this.activeExports.has(id)
+				),
+				dependencies: [importedModule]
+			};
+		}
+
+		if (importedModule.buildMeta.providedExports) {
+			return {
+				exports: true,
+				dependencies: undefined
+			};
+		}
+
+		return {
+			exports: null,
+			dependencies: [importedModule]
+		};
+	}
+
+	getWarnings() {
+		if (
+			this.strictExportPresence ||
+			this.originModule.buildMeta.strictHarmonyModule
+		) {
+			return [];
+		}
+		return this._getErrors();
+	}
+
+	getErrors() {
+		if (
+			this.strictExportPresence ||
+			this.originModule.buildMeta.strictHarmonyModule
+		) {
+			return this._getErrors();
+		}
+		return [];
+	}
+
+	_getErrors() {
+		const importedModule = this._module;
+		if (!importedModule) {
+			return;
+		}
+
+		if (!importedModule.buildMeta || !importedModule.buildMeta.exportsType) {
+			// It's not an harmony module
+			if (
+				this.originModule.buildMeta.strictHarmonyModule &&
+				this._id &&
+				this._id !== "default"
+			) {
+				// In strict harmony modules we only support the default export
+				return [
+					new HarmonyLinkingError(
+						`Can't reexport the named export '${this._id}' from non EcmaScript module (only default export is available)`
+					)
+				];
+			}
+			return;
+		}
+
+		if (!this._id) {
+			return;
+		}
+
+		if (importedModule.isProvided(this._id) !== false) {
+			// It's provided or we are not sure
+			return;
+		}
+
+		// We are sure that it's not provided
+		const idIsNotNameMessage =
+			this._id !== this.name ? ` (reexported as '${this.name}')` : "";
+		const errorMessage = `"export '${this._id}'${idIsNotNameMessage} was not found in '${this.userRequest}'`;
+		return [new HarmonyLinkingError(errorMessage)];
+	}
+
+	updateHash(hash) {
+		super.updateHash(hash);
+		const hashValue = this.getHashValue(this._module);
+		hash.update(hashValue);
+	}
+
+	getHashValue(importedModule) {
+		if (!importedModule) {
+			return "";
+		}
+
+		const stringifiedUsedExport = JSON.stringify(importedModule.usedExports);
+		const stringifiedProvidedExport = JSON.stringify(
+			importedModule.buildMeta.providedExports
+		);
+		return (
+			importedModule.used + stringifiedUsedExport + stringifiedProvidedExport
+		);
+	}
+
+	disconnect() {
+		super.disconnect();
+		this.redirectedId = undefined;
+	}
+}
+
+module.exports = HarmonyExportImportedSpecifierDependency;
+
+HarmonyExportImportedSpecifierDependency.Template = class HarmonyExportImportedSpecifierDependencyTemplate extends HarmonyImportDependency.Template {
+	harmonyInit(dep, source, runtime, dependencyTemplates) {
+		super.harmonyInit(dep, source, runtime, dependencyTemplates);
+		const content = this.getContent(dep);
+		source.insert(-1, content);
+	}
+
+	getHarmonyInitOrder(dep) {
+		if (dep.name) {
+			const used = dep.originModule.isUsed(dep.name);
+			if (!used) return NaN;
+		} else {
+			const importedModule = dep._module;
+
+			const activeFromOtherStarExports = dep._discoverActiveExportsFromOtherStartExports();
+
+			if (Array.isArray(dep.originModule.usedExports)) {
+				// we know which exports are used
+
+				const unused = dep.originModule.usedExports.every(id => {
+					if (id === "default") return true;
+					if (dep.activeExports.has(id)) return true;
+					if (importedModule.isProvided(id) === false) return true;
+					if (activeFromOtherStarExports.has(id)) return true;
+					return false;
+				});
+				if (unused) return NaN;
+			} else if (
+				dep.originModule.usedExports &&
+				importedModule &&
+				Array.isArray(importedModule.buildMeta.providedExports)
+			) {
+				// not sure which exports are used, but we know which are provided
+
+				const unused = importedModule.buildMeta.providedExports.every(id => {
+					if (id === "default") return true;
+					if (dep.activeExports.has(id)) return true;
+					if (activeFromOtherStarExports.has(id)) return true;
+					return false;
+				});
+				if (unused) return NaN;
+			}
+		}
+		return super.getHarmonyInitOrder(dep);
+	}
+
+	getContent(dep) {
+		const mode = dep.getMode(false);
+		const module = dep.originModule;
+		const importedModule = dep._module;
+		const importVar = dep.getImportVar();
+
+		switch (mode.type) {
+			case "missing":
+				return `throw new Error(${JSON.stringify(
+					`Cannot find module '${mode.userRequest}'`
+				)});\n`;
+
+			case "unused":
+				return `${Template.toNormalComment(
+					`unused harmony reexport ${mode.name}`
+				)}\n`;
+
+			case "reexport-non-harmony-default":
+				return (
+					"/* harmony reexport (default from non-harmony) */ " +
+					this.getReexportStatement(
+						module,
+						module.isUsed(mode.name),
+						importVar,
+						null
+					)
+				);
+
+			case "reexport-named-default":
+				return (
+					"/* harmony reexport (default from named exports) */ " +
+					this.getReexportStatement(
+						module,
+						module.isUsed(mode.name),
+						importVar,
+						""
+					)
+				);
+
+			case "reexport-fake-namespace-object":
+				return (
+					"/* harmony reexport (fake namespace object from non-harmony) */ " +
+					this.getReexportFakeNamespaceObjectStatement(
+						module,
+						module.isUsed(mode.name),
+						importVar
+					)
+				);
+
+			case "rexport-non-harmony-undefined":
+				return (
+					"/* harmony reexport (non default export from non-harmony) */ " +
+					this.getReexportStatement(
+						module,
+						module.isUsed(mode.name),
+						"undefined",
+						""
+					)
+				);
+
+			case "reexport-non-harmony-default-strict":
+				return (
+					"/* harmony reexport (default from non-harmony) */ " +
+					this.getReexportStatement(
+						module,
+						module.isUsed(mode.name),
+						importVar,
+						""
+					)
+				);
+
+			case "reexport-namespace-object":
+				return (
+					"/* harmony reexport (module object) */ " +
+					this.getReexportStatement(
+						module,
+						module.isUsed(mode.name),
+						importVar,
+						""
+					)
+				);
+
+			case "empty-star":
+				return "/* empty/unused harmony star reexport */";
+
+			case "safe-reexport":
+				return Array.from(mode.map.entries())
+					.map(item => {
+						return (
+							"/* harmony reexport (safe) */ " +
+							this.getReexportStatement(
+								module,
+								module.isUsed(item[0]),
+								importVar,
+								importedModule.isUsed(item[1])
+							) +
+							"\n"
+						);
+					})
+					.join("");
+
+			case "checked-reexport":
+				return Array.from(mode.map.entries())
+					.map(item => {
+						return (
+							"/* harmony reexport (checked) */ " +
+							this.getConditionalReexportStatement(
+								module,
+								item[0],
+								importVar,
+								item[1]
+							) +
+							"\n"
+						);
+					})
+					.join("");
+
+			case "dynamic-reexport": {
+				const ignoredExports = mode.ignored;
+				let content =
+					"/* harmony reexport (unknown) */ for(var __WEBPACK_IMPORT_KEY__ in " +
+					importVar +
+					") ";
+
+				// Filter out exports which are defined by other exports
+				// and filter out default export because it cannot be reexported with *
+				if (ignoredExports.size > 0) {
+					content +=
+						"if(" +
+						JSON.stringify(Array.from(ignoredExports)) +
+						".indexOf(__WEBPACK_IMPORT_KEY__) < 0) ";
+				} else {
+					content += "if(__WEBPACK_IMPORT_KEY__ !== 'default') ";
+				}
+				const exportsName = dep.originModule.exportsArgument;
+				return (
+					content +
+					`(function(key) { __webpack_require__.d(${exportsName}, key, function() { return ${importVar}[key]; }) }(__WEBPACK_IMPORT_KEY__));\n`
+				);
+			}
+
+			default:
+				throw new Error(`Unknown mode ${mode.type}`);
+		}
+	}
+
+	getReexportStatement(module, key, name, valueKey) {
+		const exportsName = module.exportsArgument;
+		const returnValue = this.getReturnValue(name, valueKey);
+		return `__webpack_require__.d(${exportsName}, ${JSON.stringify(
+			key
+		)}, function() { return ${returnValue}; });\n`;
+	}
+
+	getReexportFakeNamespaceObjectStatement(module, key, name) {
+		const exportsName = module.exportsArgument;
+		return `__webpack_require__.d(${exportsName}, ${JSON.stringify(
+			key
+		)}, function() { return __webpack_require__.t(${name}); });\n`;
+	}
+
+	getConditionalReexportStatement(module, key, name, valueKey) {
+		if (valueKey === false) {
+			return "/* unused export */\n";
+		}
+		const exportsName = module.exportsArgument;
+		const returnValue = this.getReturnValue(name, valueKey);
+		return `if(__webpack_require__.o(${name}, ${JSON.stringify(
+			valueKey
+		)})) __webpack_require__.d(${exportsName}, ${JSON.stringify(
+			key
+		)}, function() { return ${returnValue}; });\n`;
+	}
+
+	getReturnValue(name, valueKey) {
+		if (valueKey === null) {
+			return `${name}_default.a`;
+		}
+		if (valueKey === "") {
+			return name;
+		}
+		if (valueKey === false) {
+			return "/* unused export */ undefined";
+		}
+
+		return `${name}[${JSON.stringify(valueKey)}]`;
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/HarmonyExportSpecifierDependency.js b/node_modules/webpack/lib/dependencies/HarmonyExportSpecifierDependency.js
new file mode 100644
index 0000000..1bf6a3f
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyExportSpecifierDependency.js
@@ -0,0 +1,54 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class HarmonyExportSpecifierDependency extends NullDependency {
+	constructor(originModule, id, name) {
+		super();
+		this.originModule = originModule;
+		this.id = id;
+		this.name = name;
+	}
+
+	get type() {
+		return "harmony export specifier";
+	}
+
+	getExports() {
+		return {
+			exports: [this.name],
+			dependencies: undefined
+		};
+	}
+}
+
+HarmonyExportSpecifierDependency.Template = class HarmonyExportSpecifierDependencyTemplate {
+	apply(dep, source) {}
+
+	getHarmonyInitOrder(dep) {
+		return 0;
+	}
+
+	harmonyInit(dep, source, runtime) {
+		const content = this.getContent(dep);
+		source.insert(-1, content);
+	}
+
+	getContent(dep) {
+		const used = dep.originModule.isUsed(dep.name);
+		if (!used) {
+			return `/* unused harmony export ${dep.name || "namespace"} */\n`;
+		}
+
+		const exportsName = dep.originModule.exportsArgument;
+
+		return `/* harmony export (binding) */ __webpack_require__.d(${exportsName}, ${JSON.stringify(
+			used
+		)}, function() { return ${dep.id}; });\n`;
+	}
+};
+
+module.exports = HarmonyExportSpecifierDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyImportDependency.js b/node_modules/webpack/lib/dependencies/HarmonyImportDependency.js
new file mode 100644
index 0000000..97fd9bf
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyImportDependency.js
@@ -0,0 +1,109 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DependencyReference = require("./DependencyReference");
+const ModuleDependency = require("./ModuleDependency");
+const Template = require("../Template");
+
+class HarmonyImportDependency extends ModuleDependency {
+	constructor(request, originModule, sourceOrder, parserScope) {
+		super(request);
+		this.redirectedModule = undefined;
+		this.originModule = originModule;
+		this.sourceOrder = sourceOrder;
+		this.parserScope = parserScope;
+	}
+
+	get _module() {
+		return this.redirectedModule || this.module;
+	}
+
+	getReference() {
+		if (!this._module) return null;
+		return new DependencyReference(
+			this._module,
+			false,
+			this.weak,
+			this.sourceOrder
+		);
+	}
+
+	getImportVar() {
+		let importVarMap = this.parserScope.importVarMap;
+		if (!importVarMap) this.parserScope.importVarMap = importVarMap = new Map();
+		let importVar = importVarMap.get(this._module);
+		if (importVar) return importVar;
+		importVar = `${Template.toIdentifier(
+			`${this.userRequest}`
+		)}__WEBPACK_IMPORTED_MODULE_${importVarMap.size}__`;
+		importVarMap.set(this._module, importVar);
+		return importVar;
+	}
+
+	getImportStatement(update, runtime) {
+		return runtime.importStatement({
+			update,
+			module: this._module,
+			importVar: this.getImportVar(),
+			request: this.request,
+			originModule: this.originModule
+		});
+	}
+
+	updateHash(hash) {
+		super.updateHash(hash);
+		const importedModule = this._module;
+		hash.update(
+			(importedModule &&
+				(!importedModule.buildMeta || importedModule.buildMeta.exportsType)) +
+				""
+		);
+		hash.update((importedModule && importedModule.id) + "");
+	}
+
+	disconnect() {
+		super.disconnect();
+		this.redirectedModule = undefined;
+	}
+}
+
+module.exports = HarmonyImportDependency;
+
+const importEmittedMap = new WeakMap();
+
+HarmonyImportDependency.Template = class HarmonyImportDependencyTemplate {
+	apply(dep, source, runtime) {
+		// no-op
+	}
+
+	getHarmonyInitOrder(dep) {
+		return dep.sourceOrder;
+	}
+
+	static isImportEmitted(dep, source) {
+		let sourceInfo = importEmittedMap.get(source);
+		if (!sourceInfo) return false;
+		const key = dep._module || dep.request;
+		return key && sourceInfo.emittedImports.get(key);
+	}
+
+	harmonyInit(dep, source, runtime, dependencyTemplates) {
+		let sourceInfo = importEmittedMap.get(source);
+		if (!sourceInfo) {
+			importEmittedMap.set(
+				source,
+				(sourceInfo = {
+					emittedImports: new Map()
+				})
+			);
+		}
+		const key = dep._module || dep.request;
+		if (key && sourceInfo.emittedImports.get(key)) return;
+		sourceInfo.emittedImports.set(key, true);
+		const content = dep.getImportStatement(false, runtime);
+		source.insert(-1, content);
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/HarmonyImportDependencyParserPlugin.js b/node_modules/webpack/lib/dependencies/HarmonyImportDependencyParserPlugin.js
new file mode 100644
index 0000000..7f9fcde
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyImportDependencyParserPlugin.js
@@ -0,0 +1,222 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { SyncBailHook } = require("tapable");
+const HarmonyImportSideEffectDependency = require("./HarmonyImportSideEffectDependency");
+const HarmonyImportSpecifierDependency = require("./HarmonyImportSpecifierDependency");
+const HarmonyAcceptImportDependency = require("./HarmonyAcceptImportDependency");
+const HarmonyAcceptDependency = require("./HarmonyAcceptDependency");
+const ConstDependency = require("./ConstDependency");
+
+module.exports = class HarmonyImportDependencyParserPlugin {
+	constructor(moduleOptions) {
+		this.strictExportPresence = moduleOptions.strictExportPresence;
+		this.strictThisContextOnImports = moduleOptions.strictThisContextOnImports;
+	}
+
+	apply(parser) {
+		parser.hooks.import.tap(
+			"HarmonyImportDependencyParserPlugin",
+			(statement, source) => {
+				parser.state.lastHarmonyImportOrder =
+					(parser.state.lastHarmonyImportOrder || 0) + 1;
+				const clearDep = new ConstDependency("", statement.range);
+				clearDep.loc = statement.loc;
+				parser.state.module.addDependency(clearDep);
+				const sideEffectDep = new HarmonyImportSideEffectDependency(
+					source,
+					parser.state.module,
+					parser.state.lastHarmonyImportOrder,
+					parser.state.harmonyParserScope
+				);
+				sideEffectDep.loc = statement.loc;
+				parser.state.module.addDependency(sideEffectDep);
+				return true;
+			}
+		);
+		parser.hooks.importSpecifier.tap(
+			"HarmonyImportDependencyParserPlugin",
+			(statement, source, id, name) => {
+				parser.scope.definitions.delete(name);
+				parser.scope.renames.set(name, "imported var");
+				if (!parser.state.harmonySpecifier) {
+					parser.state.harmonySpecifier = new Map();
+				}
+				parser.state.harmonySpecifier.set(name, {
+					source,
+					id,
+					sourceOrder: parser.state.lastHarmonyImportOrder
+				});
+				return true;
+			}
+		);
+		parser.hooks.expression
+			.for("imported var")
+			.tap("HarmonyImportDependencyParserPlugin", expr => {
+				const name = expr.name;
+				const settings = parser.state.harmonySpecifier.get(name);
+				const dep = new HarmonyImportSpecifierDependency(
+					settings.source,
+					parser.state.module,
+					settings.sourceOrder,
+					parser.state.harmonyParserScope,
+					settings.id,
+					name,
+					expr.range,
+					this.strictExportPresence
+				);
+				dep.shorthand = parser.scope.inShorthand;
+				dep.directImport = true;
+				dep.loc = expr.loc;
+				parser.state.module.addDependency(dep);
+				return true;
+			});
+		parser.hooks.expressionAnyMember
+			.for("imported var")
+			.tap("HarmonyImportDependencyParserPlugin", expr => {
+				const name = expr.object.name;
+				const settings = parser.state.harmonySpecifier.get(name);
+				if (settings.id !== null) return false;
+				const dep = new HarmonyImportSpecifierDependency(
+					settings.source,
+					parser.state.module,
+					settings.sourceOrder,
+					parser.state.harmonyParserScope,
+					expr.property.name || expr.property.value,
+					name,
+					expr.range,
+					this.strictExportPresence
+				);
+				dep.shorthand = parser.scope.inShorthand;
+				dep.directImport = false;
+				dep.loc = expr.loc;
+				parser.state.module.addDependency(dep);
+				return true;
+			});
+		if (this.strictThisContextOnImports) {
+			// only in case when we strictly follow the spec we need a special case here
+			parser.hooks.callAnyMember
+				.for("imported var")
+				.tap("HarmonyImportDependencyParserPlugin", expr => {
+					if (expr.callee.type !== "MemberExpression") return;
+					if (expr.callee.object.type !== "Identifier") return;
+					const name = expr.callee.object.name;
+					const settings = parser.state.harmonySpecifier.get(name);
+					if (settings.id !== null) return false;
+					const dep = new HarmonyImportSpecifierDependency(
+						settings.source,
+						parser.state.module,
+						settings.sourceOrder,
+						parser.state.harmonyParserScope,
+						expr.callee.property.name || expr.callee.property.value,
+						name,
+						expr.callee.range,
+						this.strictExportPresence
+					);
+					dep.shorthand = parser.scope.inShorthand;
+					dep.directImport = false;
+					dep.namespaceObjectAsContext = true;
+					dep.loc = expr.callee.loc;
+					parser.state.module.addDependency(dep);
+					if (expr.arguments) parser.walkExpressions(expr.arguments);
+					return true;
+				});
+		}
+		parser.hooks.call
+			.for("imported var")
+			.tap("HarmonyImportDependencyParserPlugin", expr => {
+				const args = expr.arguments;
+				const fullExpr = expr;
+				expr = expr.callee;
+				if (expr.type !== "Identifier") return;
+				const name = expr.name;
+				const settings = parser.state.harmonySpecifier.get(name);
+				const dep = new HarmonyImportSpecifierDependency(
+					settings.source,
+					parser.state.module,
+					settings.sourceOrder,
+					parser.state.harmonyParserScope,
+					settings.id,
+					name,
+					expr.range,
+					this.strictExportPresence
+				);
+				dep.directImport = true;
+				dep.callArgs = args;
+				dep.call = fullExpr;
+				dep.loc = expr.loc;
+				parser.state.module.addDependency(dep);
+				if (args) parser.walkExpressions(args);
+				return true;
+			});
+		// TODO webpack 5: refactor this, no custom hooks
+		if (!parser.hooks.hotAcceptCallback) {
+			parser.hooks.hotAcceptCallback = new SyncBailHook([
+				"expression",
+				"requests"
+			]);
+		}
+		if (!parser.hooks.hotAcceptWithoutCallback) {
+			parser.hooks.hotAcceptWithoutCallback = new SyncBailHook([
+				"expression",
+				"requests"
+			]);
+		}
+		parser.hooks.hotAcceptCallback.tap(
+			"HarmonyImportDependencyParserPlugin",
+			(expr, requests) => {
+				const harmonyParserScope = parser.state.harmonyParserScope;
+				if (!harmonyParserScope) {
+					// This is not a harmony module, skip it
+					return;
+				}
+				const dependencies = requests.map(request => {
+					const dep = new HarmonyAcceptImportDependency(
+						request,
+						parser.state.module,
+						harmonyParserScope
+					);
+					dep.loc = expr.loc;
+					parser.state.module.addDependency(dep);
+					return dep;
+				});
+				if (dependencies.length > 0) {
+					const dep = new HarmonyAcceptDependency(
+						expr.range,
+						dependencies,
+						true
+					);
+					dep.loc = expr.loc;
+					parser.state.module.addDependency(dep);
+				}
+			}
+		);
+		parser.hooks.hotAcceptWithoutCallback.tap(
+			"HarmonyImportDependencyParserPlugin",
+			(expr, requests) => {
+				const dependencies = requests.map(request => {
+					const dep = new HarmonyAcceptImportDependency(
+						request,
+						parser.state.module,
+						parser.state.harmonyParserScope
+					);
+					dep.loc = expr.loc;
+					parser.state.module.addDependency(dep);
+					return dep;
+				});
+				if (dependencies.length > 0) {
+					const dep = new HarmonyAcceptDependency(
+						expr.range,
+						dependencies,
+						false
+					);
+					dep.loc = expr.loc;
+					parser.state.module.addDependency(dep);
+				}
+			}
+		);
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/HarmonyImportSideEffectDependency.js b/node_modules/webpack/lib/dependencies/HarmonyImportSideEffectDependency.js
new file mode 100644
index 0000000..a41c1b9
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyImportSideEffectDependency.js
@@ -0,0 +1,31 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const HarmonyImportDependency = require("./HarmonyImportDependency");
+
+class HarmonyImportSideEffectDependency extends HarmonyImportDependency {
+	constructor(request, originModule, sourceOrder, parserScope) {
+		super(request, originModule, sourceOrder, parserScope);
+	}
+
+	getReference() {
+		if (this._module && this._module.factoryMeta.sideEffectFree) return null;
+
+		return super.getReference();
+	}
+
+	get type() {
+		return "harmony side effect evaluation";
+	}
+}
+
+HarmonyImportSideEffectDependency.Template = class HarmonyImportSideEffectDependencyTemplate extends HarmonyImportDependency.Template {
+	getHarmonyInitOrder(dep) {
+		if (dep._module && dep._module.factoryMeta.sideEffectFree) return NaN;
+		return super.getHarmonyInitOrder(dep);
+	}
+};
+
+module.exports = HarmonyImportSideEffectDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyImportSpecifierDependency.js b/node_modules/webpack/lib/dependencies/HarmonyImportSpecifierDependency.js
new file mode 100644
index 0000000..d07fbf1
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyImportSpecifierDependency.js
@@ -0,0 +1,163 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DependencyReference = require("./DependencyReference");
+const HarmonyImportDependency = require("./HarmonyImportDependency");
+const HarmonyLinkingError = require("../HarmonyLinkingError");
+
+class HarmonyImportSpecifierDependency extends HarmonyImportDependency {
+	constructor(
+		request,
+		originModule,
+		sourceOrder,
+		parserScope,
+		id,
+		name,
+		range,
+		strictExportPresence
+	) {
+		super(request, originModule, sourceOrder, parserScope);
+		this.id = id === null ? null : `${id}`;
+		this.redirectedId = undefined;
+		this.name = name;
+		this.range = range;
+		this.strictExportPresence = strictExportPresence;
+		this.namespaceObjectAsContext = false;
+		this.callArgs = undefined;
+		this.call = undefined;
+		this.directImport = undefined;
+		this.shorthand = undefined;
+	}
+
+	get type() {
+		return "harmony import specifier";
+	}
+
+	get _id() {
+		return this.redirectedId || this.id;
+	}
+
+	getReference() {
+		if (!this._module) return null;
+		return new DependencyReference(
+			this._module,
+			this._id && !this.namespaceObjectAsContext ? [this._id] : true,
+			false,
+			this.sourceOrder
+		);
+	}
+
+	getWarnings() {
+		if (
+			this.strictExportPresence ||
+			this.originModule.buildMeta.strictHarmonyModule
+		) {
+			return [];
+		}
+		return this._getErrors();
+	}
+
+	getErrors() {
+		if (
+			this.strictExportPresence ||
+			this.originModule.buildMeta.strictHarmonyModule
+		) {
+			return this._getErrors();
+		}
+		return [];
+	}
+
+	_getErrors() {
+		const importedModule = this._module;
+		if (!importedModule) {
+			return;
+		}
+
+		if (!importedModule.buildMeta || !importedModule.buildMeta.exportsType) {
+			// It's not an harmony module
+			if (
+				this.originModule.buildMeta.strictHarmonyModule &&
+				this._id &&
+				this._id !== "default"
+			) {
+				// In strict harmony modules we only support the default export
+				return [
+					new HarmonyLinkingError(
+						`Can't import the named export '${this._id}' from non EcmaScript module (only default export is available)`
+					)
+				];
+			}
+			return;
+		}
+
+		if (!this._id) {
+			return;
+		}
+
+		if (importedModule.isProvided(this._id) !== false) {
+			// It's provided or we are not sure
+			return;
+		}
+
+		// We are sure that it's not provided
+		const idIsNotNameMessage =
+			this._id !== this.name ? ` (imported as '${this.name}')` : "";
+		const errorMessage = `"export '${this._id}'${idIsNotNameMessage} was not found in '${this.userRequest}'`;
+		return [new HarmonyLinkingError(errorMessage)];
+	}
+
+	// implement this method to allow the occurrence order plugin to count correctly
+	getNumberOfIdOccurrences() {
+		return 0;
+	}
+
+	updateHash(hash) {
+		super.updateHash(hash);
+		const importedModule = this._module;
+		hash.update((importedModule && this._id) + "");
+		hash.update(
+			(importedModule && this._id && importedModule.isUsed(this._id)) + ""
+		);
+		hash.update(
+			(importedModule &&
+				(!importedModule.buildMeta || importedModule.buildMeta.exportsType)) +
+				""
+		);
+		hash.update(
+			(importedModule &&
+				importedModule.used + JSON.stringify(importedModule.usedExports)) + ""
+		);
+	}
+
+	disconnect() {
+		super.disconnect();
+		this.redirectedId = undefined;
+	}
+}
+
+HarmonyImportSpecifierDependency.Template = class HarmonyImportSpecifierDependencyTemplate extends HarmonyImportDependency.Template {
+	apply(dep, source, runtime) {
+		super.apply(dep, source, runtime);
+		const content = this.getContent(dep, runtime);
+		source.replace(dep.range[0], dep.range[1] - 1, content);
+	}
+
+	getContent(dep, runtime) {
+		const exportExpr = runtime.exportFromImport({
+			module: dep._module,
+			request: dep.request,
+			exportName: dep._id,
+			originModule: dep.originModule,
+			asiSafe: dep.shorthand,
+			isCall: dep.call,
+			callContext: !dep.directImport,
+			importVar: dep.getImportVar()
+		});
+		return dep.shorthand ? `${dep.name}: ${exportExpr}` : exportExpr;
+	}
+};
+
+module.exports = HarmonyImportSpecifierDependency;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyInitDependency.js b/node_modules/webpack/lib/dependencies/HarmonyInitDependency.js
new file mode 100644
index 0000000..73239c8
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyInitDependency.js
@@ -0,0 +1,60 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const NullDependency = require("./NullDependency");
+
+class HarmonyInitDependency extends NullDependency {
+	constructor(originModule) {
+		super();
+		this.originModule = originModule;
+	}
+
+	get type() {
+		return "harmony init";
+	}
+}
+
+module.exports = HarmonyInitDependency;
+
+HarmonyInitDependency.Template = class HarmonyInitDependencyTemplate {
+	apply(dep, source, runtime, dependencyTemplates) {
+		const module = dep.originModule;
+		const list = [];
+		for (const dependency of module.dependencies) {
+			const template = dependencyTemplates.get(dependency.constructor);
+			if (
+				template &&
+				typeof template.harmonyInit === "function" &&
+				typeof template.getHarmonyInitOrder === "function"
+			) {
+				const order = template.getHarmonyInitOrder(dependency);
+				if (!isNaN(order)) {
+					list.push({
+						order,
+						listOrder: list.length,
+						dependency,
+						template
+					});
+				}
+			}
+		}
+
+		list.sort((a, b) => {
+			const x = a.order - b.order;
+			if (x) return x;
+			return a.listOrder - b.listOrder;
+		});
+
+		for (const item of list) {
+			item.template.harmonyInit(
+				item.dependency,
+				source,
+				runtime,
+				dependencyTemplates
+			);
+		}
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/HarmonyModulesPlugin.js b/node_modules/webpack/lib/dependencies/HarmonyModulesPlugin.js
new file mode 100644
index 0000000..43a8d4c
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyModulesPlugin.js
@@ -0,0 +1,143 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const HarmonyCompatibilityDependency = require("./HarmonyCompatibilityDependency");
+const HarmonyInitDependency = require("./HarmonyInitDependency");
+const HarmonyImportSpecifierDependency = require("./HarmonyImportSpecifierDependency");
+const HarmonyImportSideEffectDependency = require("./HarmonyImportSideEffectDependency");
+const HarmonyExportHeaderDependency = require("./HarmonyExportHeaderDependency");
+const HarmonyExportExpressionDependency = require("./HarmonyExportExpressionDependency");
+const HarmonyExportSpecifierDependency = require("./HarmonyExportSpecifierDependency");
+const HarmonyExportImportedSpecifierDependency = require("./HarmonyExportImportedSpecifierDependency");
+const HarmonyAcceptDependency = require("./HarmonyAcceptDependency");
+const HarmonyAcceptImportDependency = require("./HarmonyAcceptImportDependency");
+
+const NullFactory = require("../NullFactory");
+
+const HarmonyDetectionParserPlugin = require("./HarmonyDetectionParserPlugin");
+const HarmonyImportDependencyParserPlugin = require("./HarmonyImportDependencyParserPlugin");
+const HarmonyExportDependencyParserPlugin = require("./HarmonyExportDependencyParserPlugin");
+const HarmonyTopLevelThisParserPlugin = require("./HarmonyTopLevelThisParserPlugin");
+
+class HarmonyModulesPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"HarmonyModulesPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					HarmonyCompatibilityDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyCompatibilityDependency,
+					new HarmonyCompatibilityDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyInitDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyInitDependency,
+					new HarmonyInitDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyImportSideEffectDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyImportSideEffectDependency,
+					new HarmonyImportSideEffectDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyImportSpecifierDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyImportSpecifierDependency,
+					new HarmonyImportSpecifierDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyExportHeaderDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyExportHeaderDependency,
+					new HarmonyExportHeaderDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyExportExpressionDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyExportExpressionDependency,
+					new HarmonyExportExpressionDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyExportSpecifierDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyExportSpecifierDependency,
+					new HarmonyExportSpecifierDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyExportImportedSpecifierDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyExportImportedSpecifierDependency,
+					new HarmonyExportImportedSpecifierDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyAcceptDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyAcceptDependency,
+					new HarmonyAcceptDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					HarmonyAcceptImportDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					HarmonyAcceptImportDependency,
+					new HarmonyAcceptImportDependency.Template()
+				);
+
+				const handler = (parser, parserOptions) => {
+					if (parserOptions.harmony !== undefined && !parserOptions.harmony)
+						return;
+
+					new HarmonyDetectionParserPlugin().apply(parser);
+					new HarmonyImportDependencyParserPlugin(this.options).apply(parser);
+					new HarmonyExportDependencyParserPlugin(this.options).apply(parser);
+					new HarmonyTopLevelThisParserPlugin().apply(parser);
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("HarmonyModulesPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/esm")
+					.tap("HarmonyModulesPlugin", handler);
+			}
+		);
+	}
+}
+module.exports = HarmonyModulesPlugin;
diff --git a/node_modules/webpack/lib/dependencies/HarmonyTopLevelThisParserPlugin.js b/node_modules/webpack/lib/dependencies/HarmonyTopLevelThisParserPlugin.js
new file mode 100644
index 0000000..f036009
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/HarmonyTopLevelThisParserPlugin.js
@@ -0,0 +1,26 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Florent Cailhol @ooflorent
+*/
+"use strict";
+
+const ConstDependency = require("./ConstDependency");
+
+class HarmonyTopLevelThisParserPlugin {
+	apply(parser) {
+		parser.hooks.expression
+			.for("this")
+			.tap("HarmonyTopLevelThisParserPlugin", node => {
+				if (!parser.scope.topLevelScope) return;
+				const module = parser.state.module;
+				const isHarmony = !!(module.buildMeta && module.buildMeta.exportsType);
+				if (isHarmony) {
+					const dep = new ConstDependency("undefined", node.range, false);
+					dep.loc = node.loc;
+					parser.state.current.addDependency(dep);
+				}
+			});
+	}
+}
+
+module.exports = HarmonyTopLevelThisParserPlugin;
diff --git a/node_modules/webpack/lib/dependencies/ImportContextDependency.js b/node_modules/webpack/lib/dependencies/ImportContextDependency.js
new file mode 100644
index 0000000..f25a28a
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ImportContextDependency.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ContextDependency = require("./ContextDependency");
+const ContextDependencyTemplateAsRequireCall = require("./ContextDependencyTemplateAsRequireCall");
+
+class ImportContextDependency extends ContextDependency {
+	constructor(options, range, valueRange) {
+		super(options);
+		this.range = range;
+		this.valueRange = valueRange;
+	}
+
+	get type() {
+		return `import() context ${this.options.mode}`;
+	}
+}
+
+ImportContextDependency.Template = ContextDependencyTemplateAsRequireCall;
+
+module.exports = ImportContextDependency;
diff --git a/node_modules/webpack/lib/dependencies/ImportDependenciesBlock.js b/node_modules/webpack/lib/dependencies/ImportDependenciesBlock.js
new file mode 100644
index 0000000..61e6bb2
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ImportDependenciesBlock.js
@@ -0,0 +1,18 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const AsyncDependenciesBlock = require("../AsyncDependenciesBlock");
+const ImportDependency = require("./ImportDependency");
+
+module.exports = class ImportDependenciesBlock extends AsyncDependenciesBlock {
+	// TODO webpack 5 reorganize arguments
+	constructor(request, range, groupOptions, module, loc, originModule) {
+		super(groupOptions, module, loc, request);
+		this.range = range;
+		const dep = new ImportDependency(request, originModule, this);
+		dep.loc = loc;
+		this.addDependency(dep);
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/ImportDependency.js b/node_modules/webpack/lib/dependencies/ImportDependency.js
new file mode 100644
index 0000000..520bed2
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ImportDependency.js
@@ -0,0 +1,34 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+
+class ImportDependency extends ModuleDependency {
+	constructor(request, originModule, block) {
+		super(request);
+		this.originModule = originModule;
+		this.block = block;
+	}
+
+	get type() {
+		return "import()";
+	}
+}
+
+ImportDependency.Template = class ImportDependencyTemplate {
+	apply(dep, source, runtime) {
+		const content = runtime.moduleNamespacePromise({
+			block: dep.block,
+			module: dep.module,
+			request: dep.request,
+			strict: dep.originModule.buildMeta.strictHarmonyModule,
+			message: "import()"
+		});
+
+		source.replace(dep.block.range[0], dep.block.range[1] - 1, content);
+	}
+};
+
+module.exports = ImportDependency;
diff --git a/node_modules/webpack/lib/dependencies/ImportEagerDependency.js b/node_modules/webpack/lib/dependencies/ImportEagerDependency.js
new file mode 100644
index 0000000..0671d5d
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ImportEagerDependency.js
@@ -0,0 +1,32 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+
+class ImportEagerDependency extends ModuleDependency {
+	constructor(request, originModule, range) {
+		super(request);
+		this.originModule = originModule;
+		this.range = range;
+	}
+
+	get type() {
+		return "import() eager";
+	}
+}
+
+ImportEagerDependency.Template = class ImportEagerDependencyTemplate {
+	apply(dep, source, runtime) {
+		const content = runtime.moduleNamespacePromise({
+			module: dep.module,
+			request: dep.request,
+			strict: dep.originModule.buildMeta.strictHarmonyModule,
+			message: "import() eager"
+		});
+		source.replace(dep.range[0], dep.range[1] - 1, content);
+	}
+};
+
+module.exports = ImportEagerDependency;
diff --git a/node_modules/webpack/lib/dependencies/ImportParserPlugin.js b/node_modules/webpack/lib/dependencies/ImportParserPlugin.js
new file mode 100644
index 0000000..cb751a8
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ImportParserPlugin.js
@@ -0,0 +1,248 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ImportContextDependency = require("./ImportContextDependency");
+const ImportWeakDependency = require("./ImportWeakDependency");
+const ImportDependenciesBlock = require("./ImportDependenciesBlock");
+const ImportEagerDependency = require("./ImportEagerDependency");
+const ContextDependencyHelpers = require("./ContextDependencyHelpers");
+const UnsupportedFeatureWarning = require("../UnsupportedFeatureWarning");
+const CommentCompilationWarning = require("../CommentCompilationWarning");
+
+class ImportParserPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(parser) {
+		parser.hooks.importCall.tap("ImportParserPlugin", expr => {
+			if (expr.arguments.length !== 1) {
+				throw new Error(
+					"Incorrect number of arguments provided to 'import(module: string) -> Promise'."
+				);
+			}
+
+			const param = parser.evaluateExpression(expr.arguments[0]);
+
+			let chunkName = null;
+			let mode = "lazy";
+			let include = null;
+			let exclude = null;
+			const groupOptions = {};
+
+			const {
+				options: importOptions,
+				errors: commentErrors
+			} = parser.parseCommentOptions(expr.range);
+
+			if (commentErrors) {
+				for (const e of commentErrors) {
+					const { comment } = e;
+					parser.state.module.warnings.push(
+						new CommentCompilationWarning(
+							`Compilation error while processing magic comment(-s): /*${comment.value}*/: ${e.message}`,
+							parser.state.module,
+							comment.loc
+						)
+					);
+				}
+			}
+
+			if (importOptions) {
+				if (importOptions.webpackIgnore !== undefined) {
+					if (typeof importOptions.webpackIgnore !== "boolean") {
+						parser.state.module.warnings.push(
+							new UnsupportedFeatureWarning(
+								parser.state.module,
+								`\`webpackIgnore\` expected a boolean, but received: ${importOptions.webpackIgnore}.`,
+								expr.loc
+							)
+						);
+					} else {
+						// Do not instrument `import()` if `webpackIgnore` is `true`
+						if (importOptions.webpackIgnore) {
+							return false;
+						}
+					}
+				}
+				if (importOptions.webpackChunkName !== undefined) {
+					if (typeof importOptions.webpackChunkName !== "string") {
+						parser.state.module.warnings.push(
+							new UnsupportedFeatureWarning(
+								parser.state.module,
+								`\`webpackChunkName\` expected a string, but received: ${importOptions.webpackChunkName}.`,
+								expr.loc
+							)
+						);
+					} else {
+						chunkName = importOptions.webpackChunkName;
+					}
+				}
+				if (importOptions.webpackMode !== undefined) {
+					if (typeof importOptions.webpackMode !== "string") {
+						parser.state.module.warnings.push(
+							new UnsupportedFeatureWarning(
+								parser.state.module,
+								`\`webpackMode\` expected a string, but received: ${importOptions.webpackMode}.`,
+								expr.loc
+							)
+						);
+					} else {
+						mode = importOptions.webpackMode;
+					}
+				}
+				if (importOptions.webpackPrefetch !== undefined) {
+					if (importOptions.webpackPrefetch === true) {
+						groupOptions.prefetchOrder = 0;
+					} else if (typeof importOptions.webpackPrefetch === "number") {
+						groupOptions.prefetchOrder = importOptions.webpackPrefetch;
+					} else {
+						parser.state.module.warnings.push(
+							new UnsupportedFeatureWarning(
+								parser.state.module,
+								`\`webpackPrefetch\` expected true or a number, but received: ${importOptions.webpackPrefetch}.`,
+								expr.loc
+							)
+						);
+					}
+				}
+				if (importOptions.webpackPreload !== undefined) {
+					if (importOptions.webpackPreload === true) {
+						groupOptions.preloadOrder = 0;
+					} else if (typeof importOptions.webpackPreload === "number") {
+						groupOptions.preloadOrder = importOptions.webpackPreload;
+					} else {
+						parser.state.module.warnings.push(
+							new UnsupportedFeatureWarning(
+								parser.state.module,
+								`\`webpackPreload\` expected true or a number, but received: ${importOptions.webpackPreload}.`,
+								expr.loc
+							)
+						);
+					}
+				}
+				if (importOptions.webpackInclude !== undefined) {
+					if (
+						!importOptions.webpackInclude ||
+						importOptions.webpackInclude.constructor.name !== "RegExp"
+					) {
+						parser.state.module.warnings.push(
+							new UnsupportedFeatureWarning(
+								parser.state.module,
+								`\`webpackInclude\` expected a regular expression, but received: ${importOptions.webpackInclude}.`,
+								expr.loc
+							)
+						);
+					} else {
+						include = new RegExp(importOptions.webpackInclude);
+					}
+				}
+				if (importOptions.webpackExclude !== undefined) {
+					if (
+						!importOptions.webpackExclude ||
+						importOptions.webpackExclude.constructor.name !== "RegExp"
+					) {
+						parser.state.module.warnings.push(
+							new UnsupportedFeatureWarning(
+								parser.state.module,
+								`\`webpackExclude\` expected a regular expression, but received: ${importOptions.webpackExclude}.`,
+								expr.loc
+							)
+						);
+					} else {
+						exclude = new RegExp(importOptions.webpackExclude);
+					}
+				}
+			}
+
+			if (param.isString()) {
+				if (mode !== "lazy" && mode !== "eager" && mode !== "weak") {
+					parser.state.module.warnings.push(
+						new UnsupportedFeatureWarning(
+							parser.state.module,
+							`\`webpackMode\` expected 'lazy', 'eager' or 'weak', but received: ${mode}.`,
+							expr.loc
+						)
+					);
+				}
+
+				if (mode === "eager") {
+					const dep = new ImportEagerDependency(
+						param.string,
+						parser.state.module,
+						expr.range
+					);
+					parser.state.current.addDependency(dep);
+				} else if (mode === "weak") {
+					const dep = new ImportWeakDependency(
+						param.string,
+						parser.state.module,
+						expr.range
+					);
+					parser.state.current.addDependency(dep);
+				} else {
+					const depBlock = new ImportDependenciesBlock(
+						param.string,
+						expr.range,
+						Object.assign(groupOptions, {
+							name: chunkName
+						}),
+						parser.state.module,
+						expr.loc,
+						parser.state.module
+					);
+					parser.state.current.addBlock(depBlock);
+				}
+				return true;
+			} else {
+				if (
+					mode !== "lazy" &&
+					mode !== "lazy-once" &&
+					mode !== "eager" &&
+					mode !== "weak"
+				) {
+					parser.state.module.warnings.push(
+						new UnsupportedFeatureWarning(
+							parser.state.module,
+							`\`webpackMode\` expected 'lazy', 'lazy-once', 'eager' or 'weak', but received: ${mode}.`,
+							expr.loc
+						)
+					);
+					mode = "lazy";
+				}
+
+				if (mode === "weak") {
+					mode = "async-weak";
+				}
+				const dep = ContextDependencyHelpers.create(
+					ImportContextDependency,
+					expr.range,
+					param,
+					expr,
+					this.options,
+					{
+						chunkName,
+						groupOptions,
+						include,
+						exclude,
+						mode,
+						namespaceObject: parser.state.module.buildMeta.strictHarmonyModule
+							? "strict"
+							: true
+					},
+					parser
+				);
+				if (!dep) return;
+				dep.loc = expr.loc;
+				dep.optional = !!parser.scope.inTry;
+				parser.state.current.addDependency(dep);
+				return true;
+			}
+		});
+	}
+}
+
+module.exports = ImportParserPlugin;
diff --git a/node_modules/webpack/lib/dependencies/ImportPlugin.js b/node_modules/webpack/lib/dependencies/ImportPlugin.js
new file mode 100644
index 0000000..1647192
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ImportPlugin.js
@@ -0,0 +1,79 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ImportDependency = require("./ImportDependency");
+const ImportEagerDependency = require("./ImportEagerDependency");
+const ImportWeakDependency = require("./ImportWeakDependency");
+const ImportContextDependency = require("./ImportContextDependency");
+const ImportParserPlugin = require("./ImportParserPlugin");
+
+class ImportPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		compiler.hooks.compilation.tap(
+			"ImportPlugin",
+			(compilation, { contextModuleFactory, normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					ImportDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					ImportDependency,
+					new ImportDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					ImportEagerDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					ImportEagerDependency,
+					new ImportEagerDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					ImportWeakDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					ImportWeakDependency,
+					new ImportWeakDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					ImportContextDependency,
+					contextModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					ImportContextDependency,
+					new ImportContextDependency.Template()
+				);
+
+				const handler = (parser, parserOptions) => {
+					if (parserOptions.import !== undefined && !parserOptions.import)
+						return;
+
+					new ImportParserPlugin(options).apply(parser);
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("ImportPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("ImportPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/esm")
+					.tap("ImportPlugin", handler);
+			}
+		);
+	}
+}
+module.exports = ImportPlugin;
diff --git a/node_modules/webpack/lib/dependencies/ImportWeakDependency.js b/node_modules/webpack/lib/dependencies/ImportWeakDependency.js
new file mode 100644
index 0000000..d484000
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ImportWeakDependency.js
@@ -0,0 +1,34 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+
+class ImportWeakDependency extends ModuleDependency {
+	constructor(request, originModule, range) {
+		super(request);
+		this.originModule = originModule;
+		this.range = range;
+		this.weak = true;
+	}
+
+	get type() {
+		return "import() weak";
+	}
+}
+
+ImportWeakDependency.Template = class ImportDependencyTemplate {
+	apply(dep, source, runtime) {
+		const content = runtime.moduleNamespacePromise({
+			module: dep.module,
+			request: dep.request,
+			strict: dep.originModule.buildMeta.strictHarmonyModule,
+			message: "import() weak",
+			weak: true
+		});
+		source.replace(dep.range[0], dep.range[1] - 1, content);
+	}
+};
+
+module.exports = ImportWeakDependency;
diff --git a/node_modules/webpack/lib/dependencies/JsonExportsDependency.js b/node_modules/webpack/lib/dependencies/JsonExportsDependency.js
new file mode 100644
index 0000000..9e17bfb
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/JsonExportsDependency.js
@@ -0,0 +1,26 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class JsonExportsDependency extends NullDependency {
+	constructor(exports) {
+		super();
+		this.exports = exports;
+	}
+
+	get type() {
+		return "json exports";
+	}
+
+	getExports() {
+		return {
+			exports: this.exports,
+			dependencies: undefined
+		};
+	}
+}
+
+module.exports = JsonExportsDependency;
diff --git a/node_modules/webpack/lib/dependencies/LoaderDependency.js b/node_modules/webpack/lib/dependencies/LoaderDependency.js
new file mode 100644
index 0000000..9d0876b
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/LoaderDependency.js
@@ -0,0 +1,21 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+
+class LoaderDependency extends ModuleDependency {
+	/**
+	 * @param {string} request request string
+	 */
+	constructor(request) {
+		super(request);
+	}
+
+	get type() {
+		return "loader";
+	}
+}
+
+module.exports = LoaderDependency;
diff --git a/node_modules/webpack/lib/dependencies/LoaderPlugin.js b/node_modules/webpack/lib/dependencies/LoaderPlugin.js
new file mode 100644
index 0000000..e46f593
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/LoaderPlugin.js
@@ -0,0 +1,115 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const LoaderDependency = require("./LoaderDependency");
+const NormalModule = require("../NormalModule");
+
+/** @typedef {import("../Module")} Module */
+
+/**
+ * @callback LoadModuleCallback
+ * @param {Error=} err error object
+ * @param {string=} source source code
+ * @param {object=} map source map
+ * @param {Module=} module loaded module if successful
+ */
+
+class LoaderPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"LoaderPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					LoaderDependency,
+					normalModuleFactory
+				);
+			}
+		);
+
+		compiler.hooks.compilation.tap("LoaderPlugin", compilation => {
+			compilation.hooks.normalModuleLoader.tap(
+				"LoaderPlugin",
+				(loaderContext, module) => {
+					/**
+					 * @param {string} request the request string to load the module from
+					 * @param {LoadModuleCallback} callback callback returning the loaded module or error
+					 * @returns {void}
+					 */
+					loaderContext.loadModule = (request, callback) => {
+						const dep = new LoaderDependency(request);
+						dep.loc = {
+							name: request
+						};
+						const factory = compilation.dependencyFactories.get(
+							dep.constructor
+						);
+						if (factory === undefined) {
+							return callback(
+								new Error(
+									`No module factory available for dependency type: ${dep.constructor.name}`
+								)
+							);
+						}
+						compilation.semaphore.release();
+						compilation.addModuleDependencies(
+							module,
+							[
+								{
+									factory,
+									dependencies: [dep]
+								}
+							],
+							true,
+							"lm",
+							true,
+							err => {
+								compilation.semaphore.acquire(() => {
+									if (err) {
+										return callback(err);
+									}
+									if (!dep.module) {
+										return callback(new Error("Cannot load the module"));
+									}
+									// TODO consider removing this in webpack 5
+									if (dep.module instanceof NormalModule && dep.module.error) {
+										return callback(dep.module.error);
+									}
+									if (!dep.module._source) {
+										throw new Error(
+											"The module created for a LoaderDependency must have a property _source"
+										);
+									}
+									let source, map;
+									const moduleSource = dep.module._source;
+									if (moduleSource.sourceAndMap) {
+										const sourceAndMap = moduleSource.sourceAndMap();
+										map = sourceAndMap.map;
+										source = sourceAndMap.source;
+									} else {
+										map = moduleSource.map();
+										source = moduleSource.source();
+									}
+									if (dep.module.buildInfo.fileDependencies) {
+										for (const d of dep.module.buildInfo.fileDependencies) {
+											loaderContext.addDependency(d);
+										}
+									}
+									if (dep.module.buildInfo.contextDependencies) {
+										for (const d of dep.module.buildInfo.contextDependencies) {
+											loaderContext.addContextDependency(d);
+										}
+									}
+									return callback(null, source, map, dep.module);
+								});
+							}
+						);
+					};
+				}
+			);
+		});
+	}
+}
+module.exports = LoaderPlugin;
diff --git a/node_modules/webpack/lib/dependencies/LocalModule.js b/node_modules/webpack/lib/dependencies/LocalModule.js
new file mode 100644
index 0000000..06e5385
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/LocalModule.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class LocalModule {
+	constructor(module, name, idx) {
+		this.module = module;
+		this.name = name;
+		this.idx = idx;
+		this.used = false;
+	}
+
+	flagUsed() {
+		this.used = true;
+	}
+
+	variableName() {
+		return "__WEBPACK_LOCAL_MODULE_" + this.idx + "__";
+	}
+}
+module.exports = LocalModule;
diff --git a/node_modules/webpack/lib/dependencies/LocalModuleDependency.js b/node_modules/webpack/lib/dependencies/LocalModuleDependency.js
new file mode 100644
index 0000000..5d1e56b
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/LocalModuleDependency.js
@@ -0,0 +1,28 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class LocalModuleDependency extends NullDependency {
+	constructor(localModule, range, callNew) {
+		super();
+		localModule.flagUsed();
+		this.localModule = localModule;
+		this.range = range;
+		this.callNew = callNew;
+	}
+}
+
+LocalModuleDependency.Template = class LocalModuleDependencyTemplate {
+	apply(dep, source) {
+		if (!dep.range) return;
+		const moduleInstance = dep.callNew
+			? `new (function () { return ${dep.localModule.variableName()}; })()`
+			: dep.localModule.variableName();
+		source.replace(dep.range[0], dep.range[1] - 1, moduleInstance);
+	}
+};
+
+module.exports = LocalModuleDependency;
diff --git a/node_modules/webpack/lib/dependencies/LocalModulesHelpers.js b/node_modules/webpack/lib/dependencies/LocalModulesHelpers.js
new file mode 100644
index 0000000..0566227
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/LocalModulesHelpers.js
@@ -0,0 +1,52 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const LocalModule = require("./LocalModule");
+const LocalModulesHelpers = exports;
+
+const lookup = (parent, mod) => {
+	if (mod.charAt(0) !== ".") return mod;
+
+	var path = parent.split("/");
+	var segs = mod.split("/");
+	path.pop();
+
+	for (let i = 0; i < segs.length; i++) {
+		const seg = segs[i];
+		if (seg === "..") {
+			path.pop();
+		} else if (seg !== ".") {
+			path.push(seg);
+		}
+	}
+
+	return path.join("/");
+};
+
+LocalModulesHelpers.addLocalModule = (state, name) => {
+	if (!state.localModules) {
+		state.localModules = [];
+	}
+	const m = new LocalModule(state.module, name, state.localModules.length);
+	state.localModules.push(m);
+	return m;
+};
+
+LocalModulesHelpers.getLocalModule = (state, name, namedModule) => {
+	if (!state.localModules) return null;
+	if (namedModule) {
+		// resolve dependency name relative to the defining named module
+		name = lookup(namedModule, name);
+	}
+	for (let i = 0; i < state.localModules.length; i++) {
+		if (state.localModules[i].name === name) {
+			return state.localModules[i];
+		}
+	}
+	return null;
+};
+
+module.exports = LocalModulesHelpers;
diff --git a/node_modules/webpack/lib/dependencies/ModuleDependency.js b/node_modules/webpack/lib/dependencies/ModuleDependency.js
new file mode 100644
index 0000000..f325e7a
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ModuleDependency.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const Dependency = require("../Dependency");
+
+class ModuleDependency extends Dependency {
+	/**
+	 * @param {string} request request path which needs resolving
+	 */
+	constructor(request) {
+		super();
+		this.request = request;
+		this.userRequest = request;
+	}
+
+	getResourceIdentifier() {
+		return `module${this.request}`;
+	}
+}
+
+module.exports = ModuleDependency;
diff --git a/node_modules/webpack/lib/dependencies/ModuleDependencyTemplateAsId.js b/node_modules/webpack/lib/dependencies/ModuleDependencyTemplateAsId.js
new file mode 100644
index 0000000..82bc6b5
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ModuleDependencyTemplateAsId.js
@@ -0,0 +1,17 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class ModuleDependencyTemplateAsId {
+	apply(dep, source, runtime) {
+		if (!dep.range) return;
+		const content = runtime.moduleId({
+			module: dep.module,
+			request: dep.request
+		});
+		source.replace(dep.range[0], dep.range[1] - 1, content);
+	}
+}
+module.exports = ModuleDependencyTemplateAsId;
diff --git a/node_modules/webpack/lib/dependencies/ModuleDependencyTemplateAsRequireId.js b/node_modules/webpack/lib/dependencies/ModuleDependencyTemplateAsRequireId.js
new file mode 100644
index 0000000..db74b89
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ModuleDependencyTemplateAsRequireId.js
@@ -0,0 +1,17 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class ModuleDependencyTemplateAsRequireId {
+	apply(dep, source, runtime) {
+		if (!dep.range) return;
+		const content = runtime.moduleExports({
+			module: dep.module,
+			request: dep.request
+		});
+		source.replace(dep.range[0], dep.range[1] - 1, content);
+	}
+}
+module.exports = ModuleDependencyTemplateAsRequireId;
diff --git a/node_modules/webpack/lib/dependencies/ModuleHotAcceptDependency.js b/node_modules/webpack/lib/dependencies/ModuleHotAcceptDependency.js
new file mode 100644
index 0000000..403f7f1
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ModuleHotAcceptDependency.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+const ModuleDependencyTemplateAsId = require("./ModuleDependencyTemplateAsId");
+
+class ModuleHotAcceptDependency extends ModuleDependency {
+	constructor(request, range) {
+		super(request);
+		this.range = range;
+		this.weak = true;
+	}
+
+	get type() {
+		return "module.hot.accept";
+	}
+}
+
+ModuleHotAcceptDependency.Template = ModuleDependencyTemplateAsId;
+
+module.exports = ModuleHotAcceptDependency;
diff --git a/node_modules/webpack/lib/dependencies/ModuleHotDeclineDependency.js b/node_modules/webpack/lib/dependencies/ModuleHotDeclineDependency.js
new file mode 100644
index 0000000..49bf0af
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/ModuleHotDeclineDependency.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+const ModuleDependencyTemplateAsId = require("./ModuleDependencyTemplateAsId");
+
+class ModuleHotDeclineDependency extends ModuleDependency {
+	constructor(request, range) {
+		super(request);
+		this.range = range;
+		this.weak = true;
+	}
+
+	get type() {
+		return "module.hot.decline";
+	}
+}
+
+ModuleHotDeclineDependency.Template = ModuleDependencyTemplateAsId;
+
+module.exports = ModuleHotDeclineDependency;
diff --git a/node_modules/webpack/lib/dependencies/MultiEntryDependency.js b/node_modules/webpack/lib/dependencies/MultiEntryDependency.js
new file mode 100644
index 0000000..712d3ff
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/MultiEntryDependency.js
@@ -0,0 +1,25 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+/** @typedef {import("./SingleEntryDependency")} SingleEntryDependency */
+const Dependency = require("../Dependency");
+
+class MultiEntryDependency extends Dependency {
+	/**
+	 * @param {SingleEntryDependency[]} dependencies an array of SingleEntryDependencies
+	 * @param {string} name entry name
+	 */
+	constructor(dependencies, name) {
+		super();
+		this.dependencies = dependencies;
+		this.name = name;
+	}
+
+	get type() {
+		return "multi entry";
+	}
+}
+
+module.exports = MultiEntryDependency;
diff --git a/node_modules/webpack/lib/dependencies/NullDependency.js b/node_modules/webpack/lib/dependencies/NullDependency.js
new file mode 100644
index 0000000..585f5fc
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/NullDependency.js
@@ -0,0 +1,20 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const Dependency = require("../Dependency");
+
+class NullDependency extends Dependency {
+	get type() {
+		return "null";
+	}
+
+	updateHash() {}
+}
+
+NullDependency.Template = class NullDependencyTemplate {
+	apply() {}
+};
+
+module.exports = NullDependency;
diff --git a/node_modules/webpack/lib/dependencies/PrefetchDependency.js b/node_modules/webpack/lib/dependencies/PrefetchDependency.js
new file mode 100644
index 0000000..7107d83
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/PrefetchDependency.js
@@ -0,0 +1,18 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+
+class PrefetchDependency extends ModuleDependency {
+	constructor(request) {
+		super(request);
+	}
+
+	get type() {
+		return "prefetch";
+	}
+}
+
+module.exports = PrefetchDependency;
diff --git a/node_modules/webpack/lib/dependencies/RequireContextDependency.js b/node_modules/webpack/lib/dependencies/RequireContextDependency.js
new file mode 100644
index 0000000..fd2e728
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireContextDependency.js
@@ -0,0 +1,22 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ContextDependency = require("./ContextDependency");
+const ModuleDependencyTemplateAsRequireId = require("./ModuleDependencyTemplateAsRequireId");
+
+class RequireContextDependency extends ContextDependency {
+	constructor(options, range) {
+		super(options);
+		this.range = range;
+	}
+
+	get type() {
+		return "require.context";
+	}
+}
+
+RequireContextDependency.Template = ModuleDependencyTemplateAsRequireId;
+
+module.exports = RequireContextDependency;
diff --git a/node_modules/webpack/lib/dependencies/RequireContextDependencyParserPlugin.js b/node_modules/webpack/lib/dependencies/RequireContextDependencyParserPlugin.js
new file mode 100644
index 0000000..1071fc0
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireContextDependencyParserPlugin.js
@@ -0,0 +1,56 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const RequireContextDependency = require("./RequireContextDependency");
+
+module.exports = class RequireContextDependencyParserPlugin {
+	apply(parser) {
+		parser.hooks.call
+			.for("require.context")
+			.tap("RequireContextDependencyParserPlugin", expr => {
+				let regExp = /^\.\/.*$/;
+				let recursive = true;
+				let mode = "sync";
+				switch (expr.arguments.length) {
+					case 4: {
+						const modeExpr = parser.evaluateExpression(expr.arguments[3]);
+						if (!modeExpr.isString()) return;
+						mode = modeExpr.string;
+					}
+					// falls through
+					case 3: {
+						const regExpExpr = parser.evaluateExpression(expr.arguments[2]);
+						if (!regExpExpr.isRegExp()) return;
+						regExp = regExpExpr.regExp;
+					}
+					// falls through
+					case 2: {
+						const recursiveExpr = parser.evaluateExpression(expr.arguments[1]);
+						if (!recursiveExpr.isBoolean()) return;
+						recursive = recursiveExpr.bool;
+					}
+					// falls through
+					case 1: {
+						const requestExpr = parser.evaluateExpression(expr.arguments[0]);
+						if (!requestExpr.isString()) return;
+						const dep = new RequireContextDependency(
+							{
+								request: requestExpr.string,
+								recursive,
+								regExp,
+								mode
+							},
+							expr.range
+						);
+						dep.loc = expr.loc;
+						dep.optional = parser.scope.inTry;
+						parser.state.current.addDependency(dep);
+						return true;
+					}
+				}
+			});
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/RequireContextPlugin.js b/node_modules/webpack/lib/dependencies/RequireContextPlugin.js
new file mode 100644
index 0000000..4e44e87
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireContextPlugin.js
@@ -0,0 +1,143 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const RequireContextDependency = require("./RequireContextDependency");
+const ContextElementDependency = require("./ContextElementDependency");
+
+const RequireContextDependencyParserPlugin = require("./RequireContextDependencyParserPlugin");
+
+class RequireContextPlugin {
+	constructor(modulesDirectories, extensions, mainFiles) {
+		if (!Array.isArray(modulesDirectories)) {
+			throw new Error("modulesDirectories must be an array");
+		}
+		if (!Array.isArray(extensions)) {
+			throw new Error("extensions must be an array");
+		}
+		this.modulesDirectories = modulesDirectories;
+		this.extensions = extensions;
+		this.mainFiles = mainFiles;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"RequireContextPlugin",
+			(compilation, { contextModuleFactory, normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					RequireContextDependency,
+					contextModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					RequireContextDependency,
+					new RequireContextDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					ContextElementDependency,
+					normalModuleFactory
+				);
+
+				const handler = (parser, parserOptions) => {
+					if (
+						parserOptions.requireContext !== undefined &&
+						!parserOptions.requireContext
+					)
+						return;
+
+					new RequireContextDependencyParserPlugin().apply(parser);
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("RequireContextPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("RequireContextPlugin", handler);
+
+				contextModuleFactory.hooks.alternatives.tap(
+					"RequireContextPlugin",
+					items => {
+						if (items.length === 0) return items;
+						return items
+							.map(obj => {
+								return this.extensions
+									.filter(ext => {
+										const l = obj.request.length;
+										return (
+											l > ext.length &&
+											obj.request.substr(l - ext.length, l) === ext
+										);
+									})
+									.map(ext => {
+										const l = obj.request.length;
+										return {
+											context: obj.context,
+											request: obj.request.substr(0, l - ext.length)
+										};
+									})
+									.concat(obj);
+							})
+							.reduce((a, b) => a.concat(b), []);
+					}
+				);
+
+				contextModuleFactory.hooks.alternatives.tap(
+					"RequireContextPlugin",
+					items => {
+						if (items.length === 0) return items;
+						return items
+							.map(obj => {
+								return this.mainFiles
+									.filter(mainFile => {
+										const l = obj.request.length;
+										return (
+											l > mainFile.length + 1 &&
+											obj.request.substr(l - mainFile.length - 1, l) ===
+												"/" + mainFile
+										);
+									})
+									.map(mainFile => {
+										const l = obj.request.length;
+										return [
+											{
+												context: obj.context,
+												request: obj.request.substr(0, l - mainFile.length)
+											},
+											{
+												context: obj.context,
+												request: obj.request.substr(0, l - mainFile.length - 1)
+											}
+										];
+									})
+									.reduce((a, b) => a.concat(b), [])
+									.concat(obj);
+							})
+							.reduce((a, b) => a.concat(b), []);
+					}
+				);
+
+				contextModuleFactory.hooks.alternatives.tap(
+					"RequireContextPlugin",
+					items => {
+						if (items.length === 0) return items;
+						return items.map(obj => {
+							for (let i = 0; i < this.modulesDirectories.length; i++) {
+								const dir = this.modulesDirectories[i];
+								const idx = obj.request.indexOf("./" + dir + "/");
+								if (idx === 0) {
+									obj.request = obj.request.slice(dir.length + 3);
+									break;
+								}
+							}
+							return obj;
+						});
+					}
+				);
+			}
+		);
+	}
+}
+module.exports = RequireContextPlugin;
diff --git a/node_modules/webpack/lib/dependencies/RequireEnsureDependenciesBlock.js b/node_modules/webpack/lib/dependencies/RequireEnsureDependenciesBlock.js
new file mode 100644
index 0000000..2a5dde7
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireEnsureDependenciesBlock.js
@@ -0,0 +1,33 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const AsyncDependenciesBlock = require("../AsyncDependenciesBlock");
+const RequireEnsureDependency = require("./RequireEnsureDependency");
+
+module.exports = class RequireEnsureDependenciesBlock extends AsyncDependenciesBlock {
+	constructor(
+		expr,
+		successExpression,
+		errorExpression,
+		chunkName,
+		chunkNameRange,
+		module,
+		loc
+	) {
+		super(chunkName, module, loc, null);
+		this.expr = expr;
+		const successBodyRange =
+			successExpression &&
+			successExpression.body &&
+			successExpression.body.range;
+		if (successBodyRange) {
+			this.range = [successBodyRange[0] + 1, successBodyRange[1] - 1];
+		}
+		this.chunkNameRange = chunkNameRange;
+		const dep = new RequireEnsureDependency(this);
+		dep.loc = loc;
+		this.addDependency(dep);
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/RequireEnsureDependenciesBlockParserPlugin.js b/node_modules/webpack/lib/dependencies/RequireEnsureDependenciesBlockParserPlugin.js
new file mode 100644
index 0000000..213eaac
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireEnsureDependenciesBlockParserPlugin.js
@@ -0,0 +1,116 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const RequireEnsureDependenciesBlock = require("./RequireEnsureDependenciesBlock");
+const RequireEnsureItemDependency = require("./RequireEnsureItemDependency");
+const getFunctionExpression = require("./getFunctionExpression");
+
+module.exports = class RequireEnsureDependenciesBlockParserPlugin {
+	apply(parser) {
+		parser.hooks.call
+			.for("require.ensure")
+			.tap("RequireEnsureDependenciesBlockParserPlugin", expr => {
+				let chunkName = null;
+				let chunkNameRange = null;
+				let errorExpressionArg = null;
+				let errorExpression = null;
+				switch (expr.arguments.length) {
+					case 4: {
+						const chunkNameExpr = parser.evaluateExpression(expr.arguments[3]);
+						if (!chunkNameExpr.isString()) return;
+						chunkNameRange = chunkNameExpr.range;
+						chunkName = chunkNameExpr.string;
+					}
+					// falls through
+					case 3: {
+						errorExpressionArg = expr.arguments[2];
+						errorExpression = getFunctionExpression(errorExpressionArg);
+
+						if (!errorExpression && !chunkName) {
+							const chunkNameExpr = parser.evaluateExpression(
+								expr.arguments[2]
+							);
+							if (!chunkNameExpr.isString()) return;
+							chunkNameRange = chunkNameExpr.range;
+							chunkName = chunkNameExpr.string;
+						}
+					}
+					// falls through
+					case 2: {
+						const dependenciesExpr = parser.evaluateExpression(
+							expr.arguments[0]
+						);
+						const dependenciesItems = dependenciesExpr.isArray()
+							? dependenciesExpr.items
+							: [dependenciesExpr];
+						const successExpressionArg = expr.arguments[1];
+						const successExpression = getFunctionExpression(
+							successExpressionArg
+						);
+
+						if (successExpression) {
+							parser.walkExpressions(successExpression.expressions);
+						}
+						if (errorExpression) {
+							parser.walkExpressions(errorExpression.expressions);
+						}
+
+						const dep = new RequireEnsureDependenciesBlock(
+							expr,
+							successExpression ? successExpression.fn : successExpressionArg,
+							errorExpression ? errorExpression.fn : errorExpressionArg,
+							chunkName,
+							chunkNameRange,
+							parser.state.module,
+							expr.loc
+						);
+						const old = parser.state.current;
+						parser.state.current = dep;
+						try {
+							let failed = false;
+							parser.inScope([], () => {
+								for (const ee of dependenciesItems) {
+									if (ee.isString()) {
+										const edep = new RequireEnsureItemDependency(ee.string);
+										edep.loc = dep.loc;
+										dep.addDependency(edep);
+									} else {
+										failed = true;
+									}
+								}
+							});
+							if (failed) {
+								return;
+							}
+							if (successExpression) {
+								if (successExpression.fn.body.type === "BlockStatement") {
+									parser.walkStatement(successExpression.fn.body);
+								} else {
+									parser.walkExpression(successExpression.fn.body);
+								}
+							}
+							old.addBlock(dep);
+						} finally {
+							parser.state.current = old;
+						}
+						if (!successExpression) {
+							parser.walkExpression(successExpressionArg);
+						}
+						if (errorExpression) {
+							if (errorExpression.fn.body.type === "BlockStatement") {
+								parser.walkStatement(errorExpression.fn.body);
+							} else {
+								parser.walkExpression(errorExpression.fn.body);
+							}
+						} else if (errorExpressionArg) {
+							parser.walkExpression(errorExpressionArg);
+						}
+						return true;
+					}
+				}
+			});
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/RequireEnsureDependency.js b/node_modules/webpack/lib/dependencies/RequireEnsureDependency.js
new file mode 100644
index 0000000..8401305
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireEnsureDependency.js
@@ -0,0 +1,58 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class RequireEnsureDependency extends NullDependency {
+	constructor(block) {
+		super();
+		this.block = block;
+	}
+
+	get type() {
+		return "require.ensure";
+	}
+}
+
+RequireEnsureDependency.Template = class RequireEnsureDependencyTemplate {
+	apply(dep, source, runtime) {
+		const depBlock = dep.block;
+		const promise = runtime.blockPromise({
+			block: depBlock,
+			message: "require.ensure"
+		});
+		const errorCallbackExists =
+			depBlock.expr.arguments.length === 4 ||
+			(!depBlock.chunkName && depBlock.expr.arguments.length === 3);
+		const startBlock = `${promise}.then((`;
+		const middleBlock = ").bind(null, __webpack_require__)).catch(";
+		const endBlock = `).bind(null, __webpack_require__)).catch(${runtime.onError()})`;
+		source.replace(
+			depBlock.expr.range[0],
+			depBlock.expr.arguments[1].range[0] - 1,
+			startBlock
+		);
+		if (errorCallbackExists) {
+			source.replace(
+				depBlock.expr.arguments[1].range[1],
+				depBlock.expr.arguments[2].range[0] - 1,
+				middleBlock
+			);
+			source.replace(
+				depBlock.expr.arguments[2].range[1],
+				depBlock.expr.range[1] - 1,
+				")"
+			);
+		} else {
+			source.replace(
+				depBlock.expr.arguments[1].range[1],
+				depBlock.expr.range[1] - 1,
+				endBlock
+			);
+		}
+	}
+};
+
+module.exports = RequireEnsureDependency;
diff --git a/node_modules/webpack/lib/dependencies/RequireEnsureItemDependency.js b/node_modules/webpack/lib/dependencies/RequireEnsureItemDependency.js
new file mode 100644
index 0000000..b4b620b
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireEnsureItemDependency.js
@@ -0,0 +1,21 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+const NullDependency = require("./NullDependency");
+
+class RequireEnsureItemDependency extends ModuleDependency {
+	constructor(request) {
+		super(request);
+	}
+
+	get type() {
+		return "require.ensure item";
+	}
+}
+
+RequireEnsureItemDependency.Template = NullDependency.Template;
+
+module.exports = RequireEnsureItemDependency;
diff --git a/node_modules/webpack/lib/dependencies/RequireEnsurePlugin.js b/node_modules/webpack/lib/dependencies/RequireEnsurePlugin.js
new file mode 100644
index 0000000..c818e91
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireEnsurePlugin.js
@@ -0,0 +1,74 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const RequireEnsureItemDependency = require("./RequireEnsureItemDependency");
+const RequireEnsureDependency = require("./RequireEnsureDependency");
+
+const NullFactory = require("../NullFactory");
+
+const RequireEnsureDependenciesBlockParserPlugin = require("./RequireEnsureDependenciesBlockParserPlugin");
+
+const ParserHelpers = require("../ParserHelpers");
+
+class RequireEnsurePlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"RequireEnsurePlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					RequireEnsureItemDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					RequireEnsureItemDependency,
+					new RequireEnsureItemDependency.Template()
+				);
+
+				compilation.dependencyFactories.set(
+					RequireEnsureDependency,
+					new NullFactory()
+				);
+				compilation.dependencyTemplates.set(
+					RequireEnsureDependency,
+					new RequireEnsureDependency.Template()
+				);
+
+				const handler = (parser, parserOptions) => {
+					if (
+						parserOptions.requireEnsure !== undefined &&
+						!parserOptions.requireEnsure
+					)
+						return;
+
+					new RequireEnsureDependenciesBlockParserPlugin().apply(parser);
+					parser.hooks.evaluateTypeof
+						.for("require.ensure")
+						.tap(
+							"RequireEnsurePlugin",
+							ParserHelpers.evaluateToString("function")
+						);
+					parser.hooks.typeof
+						.for("require.ensure")
+						.tap(
+							"RequireEnsurePlugin",
+							ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify("function")
+							)
+						);
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("RequireEnsurePlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("RequireEnsurePlugin", handler);
+			}
+		);
+	}
+}
+module.exports = RequireEnsurePlugin;
diff --git a/node_modules/webpack/lib/dependencies/RequireHeaderDependency.js b/node_modules/webpack/lib/dependencies/RequireHeaderDependency.js
new file mode 100644
index 0000000..6dddd06
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireHeaderDependency.js
@@ -0,0 +1,26 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class RequireHeaderDependency extends NullDependency {
+	constructor(range) {
+		super();
+		if (!Array.isArray(range)) throw new Error("range must be valid");
+		this.range = range;
+	}
+}
+
+RequireHeaderDependency.Template = class RequireHeaderDependencyTemplate {
+	apply(dep, source) {
+		source.replace(dep.range[0], dep.range[1] - 1, "__webpack_require__");
+	}
+
+	applyAsTemplateArgument(name, dep, source) {
+		source.replace(dep.range[0], dep.range[1] - 1, "require");
+	}
+};
+
+module.exports = RequireHeaderDependency;
diff --git a/node_modules/webpack/lib/dependencies/RequireIncludeDependency.js b/node_modules/webpack/lib/dependencies/RequireIncludeDependency.js
new file mode 100644
index 0000000..9eca576
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireIncludeDependency.js
@@ -0,0 +1,39 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DependencyReference = require("./DependencyReference");
+const ModuleDependency = require("./ModuleDependency");
+const Template = require("../Template");
+
+class RequireIncludeDependency extends ModuleDependency {
+	constructor(request, range) {
+		super(request);
+		this.range = range;
+	}
+
+	getReference() {
+		if (!this.module) return null;
+		// This doesn't use any export
+		return new DependencyReference(this.module, [], false);
+	}
+
+	get type() {
+		return "require.include";
+	}
+}
+
+RequireIncludeDependency.Template = class RequireIncludeDependencyTemplate {
+	apply(dep, source, runtime) {
+		const comment = runtime.outputOptions.pathinfo
+			? Template.toComment(
+					`require.include ${runtime.requestShortener.shorten(dep.request)}`
+			  )
+			: "";
+		source.replace(dep.range[0], dep.range[1] - 1, `undefined${comment}`);
+	}
+};
+
+module.exports = RequireIncludeDependency;
diff --git a/node_modules/webpack/lib/dependencies/RequireIncludeDependencyParserPlugin.js b/node_modules/webpack/lib/dependencies/RequireIncludeDependencyParserPlugin.js
new file mode 100644
index 0000000..117e204
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireIncludeDependencyParserPlugin.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const RequireIncludeDependency = require("./RequireIncludeDependency");
+
+module.exports = class RequireIncludeDependencyParserPlugin {
+	apply(parser) {
+		parser.hooks.call
+			.for("require.include")
+			.tap("RequireIncludeDependencyParserPlugin", expr => {
+				if (expr.arguments.length !== 1) return;
+				const param = parser.evaluateExpression(expr.arguments[0]);
+				if (!param.isString()) return;
+				const dep = new RequireIncludeDependency(param.string, expr.range);
+				dep.loc = expr.loc;
+				parser.state.current.addDependency(dep);
+				return true;
+			});
+	}
+};
diff --git a/node_modules/webpack/lib/dependencies/RequireIncludePlugin.js b/node_modules/webpack/lib/dependencies/RequireIncludePlugin.js
new file mode 100644
index 0000000..e7d535b
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireIncludePlugin.js
@@ -0,0 +1,61 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const RequireIncludeDependency = require("./RequireIncludeDependency");
+const RequireIncludeDependencyParserPlugin = require("./RequireIncludeDependencyParserPlugin");
+
+const ParserHelpers = require("../ParserHelpers");
+
+class RequireIncludePlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"RequireIncludePlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					RequireIncludeDependency,
+					normalModuleFactory
+				);
+				compilation.dependencyTemplates.set(
+					RequireIncludeDependency,
+					new RequireIncludeDependency.Template()
+				);
+
+				const handler = (parser, parserOptions) => {
+					if (
+						parserOptions.requireInclude !== undefined &&
+						!parserOptions.requireInclude
+					)
+						return;
+
+					new RequireIncludeDependencyParserPlugin().apply(parser);
+					parser.hooks.evaluateTypeof
+						.for("require.include")
+						.tap(
+							"RequireIncludePlugin",
+							ParserHelpers.evaluateToString("function")
+						);
+					parser.hooks.typeof
+						.for("require.include")
+						.tap(
+							"RequireIncludePlugin",
+							ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify("function")
+							)
+						);
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("RequireIncludePlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("RequireIncludePlugin", handler);
+			}
+		);
+	}
+}
+module.exports = RequireIncludePlugin;
diff --git a/node_modules/webpack/lib/dependencies/RequireResolveContextDependency.js b/node_modules/webpack/lib/dependencies/RequireResolveContextDependency.js
new file mode 100644
index 0000000..cc40451
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireResolveContextDependency.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ContextDependency = require("./ContextDependency");
+const ContextDependencyTemplateAsId = require("./ContextDependencyTemplateAsId");
+
+class RequireResolveContextDependency extends ContextDependency {
+	constructor(options, range, valueRange) {
+		super(options);
+		this.range = range;
+		this.valueRange = valueRange;
+	}
+
+	get type() {
+		return "amd require context";
+	}
+}
+
+RequireResolveContextDependency.Template = ContextDependencyTemplateAsId;
+
+module.exports = RequireResolveContextDependency;
diff --git a/node_modules/webpack/lib/dependencies/RequireResolveDependency.js b/node_modules/webpack/lib/dependencies/RequireResolveDependency.js
new file mode 100644
index 0000000..3933baa
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireResolveDependency.js
@@ -0,0 +1,22 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+const ModuleDependencyAsId = require("./ModuleDependencyTemplateAsId");
+
+class RequireResolveDependency extends ModuleDependency {
+	constructor(request, range) {
+		super(request);
+		this.range = range;
+	}
+
+	get type() {
+		return "require.resolve";
+	}
+}
+
+RequireResolveDependency.Template = ModuleDependencyAsId;
+
+module.exports = RequireResolveDependency;
diff --git a/node_modules/webpack/lib/dependencies/RequireResolveDependencyParserPlugin.js b/node_modules/webpack/lib/dependencies/RequireResolveDependencyParserPlugin.js
new file mode 100644
index 0000000..0d356cf
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireResolveDependencyParserPlugin.js
@@ -0,0 +1,86 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const RequireResolveDependency = require("./RequireResolveDependency");
+const RequireResolveContextDependency = require("./RequireResolveContextDependency");
+const RequireResolveHeaderDependency = require("./RequireResolveHeaderDependency");
+const ContextDependencyHelpers = require("./ContextDependencyHelpers");
+
+class RequireResolveDependencyParserPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(parser) {
+		const options = this.options;
+
+		const process = (expr, weak) => {
+			if (expr.arguments.length !== 1) return;
+			const param = parser.evaluateExpression(expr.arguments[0]);
+			if (param.isConditional()) {
+				for (const option of param.options) {
+					const result = processItem(expr, option, weak);
+					if (result === undefined) {
+						processContext(expr, option, weak);
+					}
+				}
+				const dep = new RequireResolveHeaderDependency(expr.callee.range);
+				dep.loc = expr.loc;
+				parser.state.current.addDependency(dep);
+				return true;
+			} else {
+				const result = processItem(expr, param, weak);
+				if (result === undefined) {
+					processContext(expr, param, weak);
+				}
+				const dep = new RequireResolveHeaderDependency(expr.callee.range);
+				dep.loc = expr.loc;
+				parser.state.current.addDependency(dep);
+				return true;
+			}
+		};
+		const processItem = (expr, param, weak) => {
+			if (param.isString()) {
+				const dep = new RequireResolveDependency(param.string, param.range);
+				dep.loc = expr.loc;
+				dep.optional = !!parser.scope.inTry;
+				dep.weak = weak;
+				parser.state.current.addDependency(dep);
+				return true;
+			}
+		};
+		const processContext = (expr, param, weak) => {
+			const dep = ContextDependencyHelpers.create(
+				RequireResolveContextDependency,
+				param.range,
+				param,
+				expr,
+				options,
+				{
+					mode: weak ? "weak" : "sync"
+				},
+				parser
+			);
+			if (!dep) return;
+			dep.loc = expr.loc;
+			dep.optional = !!parser.scope.inTry;
+			parser.state.current.addDependency(dep);
+			return true;
+		};
+
+		parser.hooks.call
+			.for("require.resolve")
+			.tap("RequireResolveDependencyParserPlugin", expr => {
+				return process(expr, false);
+			});
+		parser.hooks.call
+			.for("require.resolveWeak")
+			.tap("RequireResolveDependencyParserPlugin", expr => {
+				return process(expr, true);
+			});
+	}
+}
+module.exports = RequireResolveDependencyParserPlugin;
diff --git a/node_modules/webpack/lib/dependencies/RequireResolveHeaderDependency.js b/node_modules/webpack/lib/dependencies/RequireResolveHeaderDependency.js
new file mode 100644
index 0000000..05fe86d
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/RequireResolveHeaderDependency.js
@@ -0,0 +1,26 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+
+class RequireResolveHeaderDependency extends NullDependency {
+	constructor(range) {
+		super();
+		if (!Array.isArray(range)) throw new Error("range must be valid");
+		this.range = range;
+	}
+}
+
+RequireResolveHeaderDependency.Template = class RequireResolveHeaderDependencyTemplate {
+	apply(dep, source) {
+		source.replace(dep.range[0], dep.range[1] - 1, "/*require.resolve*/");
+	}
+
+	applyAsTemplateArgument(name, dep, source) {
+		source.replace(dep.range[0], dep.range[1] - 1, "/*require.resolve*/");
+	}
+};
+
+module.exports = RequireResolveHeaderDependency;
diff --git a/node_modules/webpack/lib/dependencies/SingleEntryDependency.js b/node_modules/webpack/lib/dependencies/SingleEntryDependency.js
new file mode 100644
index 0000000..75a8c08
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/SingleEntryDependency.js
@@ -0,0 +1,21 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const ModuleDependency = require("./ModuleDependency");
+
+class SingleEntryDependency extends ModuleDependency {
+	/**
+	 * @param {string} request request path for entry
+	 */
+	constructor(request) {
+		super(request);
+	}
+
+	get type() {
+		return "single entry";
+	}
+}
+
+module.exports = SingleEntryDependency;
diff --git a/node_modules/webpack/lib/dependencies/SystemPlugin.js b/node_modules/webpack/lib/dependencies/SystemPlugin.js
new file mode 100644
index 0000000..0e3419b
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/SystemPlugin.js
@@ -0,0 +1,122 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ParserHelpers = require("../ParserHelpers");
+const WebpackError = require("../WebpackError");
+
+class SystemPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"SystemPlugin",
+			(compilation, { normalModuleFactory }) => {
+				const handler = (parser, parserOptions) => {
+					if (parserOptions.system !== undefined && !parserOptions.system)
+						return;
+
+					const shouldWarn = parserOptions.system === undefined;
+
+					const setNotSupported = name => {
+						parser.hooks.evaluateTypeof
+							.for(name)
+							.tap("SystemPlugin", ParserHelpers.evaluateToString("undefined"));
+						parser.hooks.expression
+							.for(name)
+							.tap(
+								"SystemPlugin",
+								ParserHelpers.expressionIsUnsupported(
+									parser,
+									name + " is not supported by webpack."
+								)
+							);
+					};
+
+					parser.hooks.typeof
+						.for("System.import")
+						.tap(
+							"SystemPlugin",
+							ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify("function")
+							)
+						);
+					parser.hooks.evaluateTypeof
+						.for("System.import")
+						.tap("SystemPlugin", ParserHelpers.evaluateToString("function"));
+					parser.hooks.typeof
+						.for("System")
+						.tap(
+							"SystemPlugin",
+							ParserHelpers.toConstantDependency(
+								parser,
+								JSON.stringify("object")
+							)
+						);
+					parser.hooks.evaluateTypeof
+						.for("System")
+						.tap("SystemPlugin", ParserHelpers.evaluateToString("object"));
+
+					setNotSupported("System.set");
+					setNotSupported("System.get");
+					setNotSupported("System.register");
+
+					parser.hooks.expression.for("System").tap("SystemPlugin", () => {
+						const systemPolyfillRequire = ParserHelpers.requireFileAsExpression(
+							parser.state.module.context,
+							require.resolve("../../buildin/system")
+						);
+						return ParserHelpers.addParsedVariableToModule(
+							parser,
+							"System",
+							systemPolyfillRequire
+						);
+					});
+
+					parser.hooks.call.for("System.import").tap("SystemPlugin", expr => {
+						if (shouldWarn) {
+							parser.state.module.warnings.push(
+								new SystemImportDeprecationWarning(
+									parser.state.module,
+									expr.loc
+								)
+							);
+						}
+
+						return parser.hooks.importCall.call(expr);
+					});
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("SystemPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("SystemPlugin", handler);
+			}
+		);
+	}
+}
+
+class SystemImportDeprecationWarning extends WebpackError {
+	constructor(module, loc) {
+		super(
+			"System.import() is deprecated and will be removed soon. Use import() instead.\n" +
+				"For more info visit https://webpack.js.org/guides/code-splitting/"
+		);
+
+		this.name = "SystemImportDeprecationWarning";
+
+		this.module = module;
+		this.loc = loc;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+}
+
+module.exports = SystemPlugin;
diff --git a/node_modules/webpack/lib/dependencies/UnsupportedDependency.js b/node_modules/webpack/lib/dependencies/UnsupportedDependency.js
new file mode 100644
index 0000000..614af78
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/UnsupportedDependency.js
@@ -0,0 +1,27 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const NullDependency = require("./NullDependency");
+const webpackMissingModule = require("./WebpackMissingModule").module;
+
+class UnsupportedDependency extends NullDependency {
+	constructor(request, range) {
+		super();
+		this.request = request;
+		this.range = range;
+	}
+}
+
+UnsupportedDependency.Template = class UnsupportedDependencyTemplate {
+	apply(dep, source, runtime) {
+		source.replace(
+			dep.range[0],
+			dep.range[1],
+			webpackMissingModule(dep.request)
+		);
+	}
+};
+
+module.exports = UnsupportedDependency;
diff --git a/node_modules/webpack/lib/dependencies/WebAssemblyExportImportedDependency.js b/node_modules/webpack/lib/dependencies/WebAssemblyExportImportedDependency.js
new file mode 100644
index 0000000..9fa55f2
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/WebAssemblyExportImportedDependency.js
@@ -0,0 +1,31 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DependencyReference = require("./DependencyReference");
+const ModuleDependency = require("./ModuleDependency");
+
+class WebAssemblyExportImportedDependency extends ModuleDependency {
+	constructor(exportName, request, name, valueType) {
+		super(request);
+		/** @type {string} */
+		this.exportName = exportName;
+		/** @type {string} */
+		this.name = name;
+		/** @type {string} */
+		this.valueType = valueType;
+	}
+
+	getReference() {
+		if (!this.module) return null;
+		return new DependencyReference(this.module, [this.name], false);
+	}
+
+	get type() {
+		return "wasm export import";
+	}
+}
+
+module.exports = WebAssemblyExportImportedDependency;
diff --git a/node_modules/webpack/lib/dependencies/WebAssemblyImportDependency.js b/node_modules/webpack/lib/dependencies/WebAssemblyImportDependency.js
new file mode 100644
index 0000000..4b36faa
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/WebAssemblyImportDependency.js
@@ -0,0 +1,54 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const DependencyReference = require("./DependencyReference");
+const ModuleDependency = require("./ModuleDependency");
+const UnsupportedWebAssemblyFeatureError = require("../wasm/UnsupportedWebAssemblyFeatureError");
+
+/** @typedef {import("@webassemblyjs/ast").ModuleImportDescription} ModuleImportDescription */
+
+class WebAssemblyImportDependency extends ModuleDependency {
+	/**
+	 * @param {string} request the request
+	 * @param {string} name the imported name
+	 * @param {ModuleImportDescription} description the WASM ast node
+	 * @param {false | string} onlyDirectImport if only direct imports are allowed
+	 */
+	constructor(request, name, description, onlyDirectImport) {
+		super(request);
+		/** @type {string} */
+		this.name = name;
+		/** @type {ModuleImportDescription} */
+		this.description = description;
+		/** @type {false | string} */
+		this.onlyDirectImport = onlyDirectImport;
+	}
+
+	getReference() {
+		if (!this.module) return null;
+		return new DependencyReference(this.module, [this.name], false);
+	}
+
+	getErrors() {
+		if (
+			this.onlyDirectImport &&
+			this.module &&
+			!this.module.type.startsWith("webassembly")
+		) {
+			return [
+				new UnsupportedWebAssemblyFeatureError(
+					`Import "${this.name}" from "${this.request}" with ${this.onlyDirectImport} can only be used for direct wasm to wasm dependencies`
+				)
+			];
+		}
+	}
+
+	get type() {
+		return "wasm import";
+	}
+}
+
+module.exports = WebAssemblyImportDependency;
diff --git a/node_modules/webpack/lib/dependencies/WebpackMissingModule.js b/node_modules/webpack/lib/dependencies/WebpackMissingModule.js
new file mode 100644
index 0000000..a55c9ec
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/WebpackMissingModule.js
@@ -0,0 +1,20 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const toErrorCode = err =>
+	`var e = new Error(${JSON.stringify(err)}); e.code = 'MODULE_NOT_FOUND';`;
+
+exports.module = request =>
+	`!(function webpackMissingModule() { ${exports.moduleCode(request)} }())`;
+
+exports.promise = request => {
+	const errorCode = toErrorCode(`Cannot find module '${request}'`);
+	return `Promise.reject(function webpackMissingModule() { ${errorCode} return e; }())`;
+};
+
+exports.moduleCode = request => {
+	const errorCode = toErrorCode(`Cannot find module '${request}'`);
+	return `${errorCode} throw e;`;
+};
diff --git a/node_modules/webpack/lib/dependencies/getFunctionExpression.js b/node_modules/webpack/lib/dependencies/getFunctionExpression.js
new file mode 100644
index 0000000..0e73840
--- /dev/null
+++ b/node_modules/webpack/lib/dependencies/getFunctionExpression.js
@@ -0,0 +1,52 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+module.exports = expr => {
+	// <FunctionExpression>
+	if (
+		expr.type === "FunctionExpression" ||
+		expr.type === "ArrowFunctionExpression"
+	) {
+		return {
+			fn: expr,
+			expressions: [],
+			needThis: false
+		};
+	}
+
+	// <FunctionExpression>.bind(<Expression>)
+	if (
+		expr.type === "CallExpression" &&
+		expr.callee.type === "MemberExpression" &&
+		expr.callee.object.type === "FunctionExpression" &&
+		expr.callee.property.type === "Identifier" &&
+		expr.callee.property.name === "bind" &&
+		expr.arguments.length === 1
+	) {
+		return {
+			fn: expr.callee.object,
+			expressions: [expr.arguments[0]],
+			needThis: undefined
+		};
+	}
+	// (function(_this) {return <FunctionExpression>})(this) (Coffeescript)
+	if (
+		expr.type === "CallExpression" &&
+		expr.callee.type === "FunctionExpression" &&
+		expr.callee.body.type === "BlockStatement" &&
+		expr.arguments.length === 1 &&
+		expr.arguments[0].type === "ThisExpression" &&
+		expr.callee.body.body &&
+		expr.callee.body.body.length === 1 &&
+		expr.callee.body.body[0].type === "ReturnStatement" &&
+		expr.callee.body.body[0].argument &&
+		expr.callee.body.body[0].argument.type === "FunctionExpression"
+	) {
+		return {
+			fn: expr.callee.body.body[0].argument,
+			expressions: [],
+			needThis: true
+		};
+	}
+};
diff --git a/node_modules/webpack/lib/formatLocation.js b/node_modules/webpack/lib/formatLocation.js
new file mode 100644
index 0000000..f608cd4
--- /dev/null
+++ b/node_modules/webpack/lib/formatLocation.js
@@ -0,0 +1,75 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+/** @typedef {import("./Dependency").DependencyLocation} DependencyLocation */
+/** @typedef {import("./Dependency").SourcePosition} SourcePosition */
+
+// TODO webpack 5: pos must be SourcePosition
+/**
+ * @param {SourcePosition|DependencyLocation|string} pos position
+ * @returns {string} formatted position
+ */
+const formatPosition = pos => {
+	if (pos === null) return "";
+	// TODO webpack 5: Simplify this
+	if (typeof pos === "string") return pos;
+	if (typeof pos === "number") return `${pos}`;
+	if (typeof pos === "object") {
+		if ("line" in pos && "column" in pos) {
+			return `${pos.line}:${pos.column}`;
+		} else if ("line" in pos) {
+			return `${pos.line}:?`;
+		} else if ("index" in pos) {
+			// TODO webpack 5 remove this case
+			return `+${pos.index}`;
+		} else {
+			return "";
+		}
+	}
+	return "";
+};
+
+// TODO webpack 5: loc must be DependencyLocation
+/**
+ * @param {DependencyLocation|SourcePosition|string} loc location
+ * @returns {string} formatted location
+ */
+const formatLocation = loc => {
+	if (loc === null) return "";
+	// TODO webpack 5: Simplify this
+	if (typeof loc === "string") return loc;
+	if (typeof loc === "number") return `${loc}`;
+	if (typeof loc === "object") {
+		if ("start" in loc && loc.start && "end" in loc && loc.end) {
+			if (
+				typeof loc.start === "object" &&
+				typeof loc.start.line === "number" &&
+				typeof loc.end === "object" &&
+				typeof loc.end.line === "number" &&
+				typeof loc.end.column === "number" &&
+				loc.start.line === loc.end.line
+			) {
+				return `${formatPosition(loc.start)}-${loc.end.column}`;
+			} else {
+				return `${formatPosition(loc.start)}-${formatPosition(loc.end)}`;
+			}
+		}
+		if ("start" in loc && loc.start) {
+			return formatPosition(loc.start);
+		}
+		if ("name" in loc && "index" in loc) {
+			return `${loc.name}[${loc.index}]`;
+		}
+		if ("name" in loc) {
+			return loc.name;
+		}
+		return formatPosition(loc);
+	}
+	return "";
+};
+
+module.exports = formatLocation;
diff --git a/node_modules/webpack/lib/logging/Logger.js b/node_modules/webpack/lib/logging/Logger.js
new file mode 100644
index 0000000..835683e
--- /dev/null
+++ b/node_modules/webpack/lib/logging/Logger.js
@@ -0,0 +1,128 @@
+/*
+ MIT License http://www.opensource.org/licenses/mit-license.php
+ Author Tobias Koppers @sokra
+ */
+
+"use strict";
+
+const LogType = Object.freeze({
+	error: /** @type {"error"} */ ("error"), // message, c style arguments
+	warn: /** @type {"warn"} */ ("warn"), // message, c style arguments
+	info: /** @type {"info"} */ ("info"), // message, c style arguments
+	log: /** @type {"log"} */ ("log"), // message, c style arguments
+	debug: /** @type {"debug"} */ ("debug"), // message, c style arguments
+
+	trace: /** @type {"trace"} */ ("trace"), // no arguments
+
+	group: /** @type {"group"} */ ("group"), // [label]
+	groupCollapsed: /** @type {"groupCollapsed"} */ ("groupCollapsed"), // [label]
+	groupEnd: /** @type {"groupEnd"} */ ("groupEnd"), // [label]
+
+	profile: /** @type {"profile"} */ ("profile"), // [profileName]
+	profileEnd: /** @type {"profileEnd"} */ ("profileEnd"), // [profileName]
+
+	time: /** @type {"time"} */ ("time"), // name, time as [seconds, nanoseconds]
+
+	clear: /** @type {"clear"} */ ("clear"), // no arguments
+	status: /** @type {"status"} */ ("status") // message, arguments
+});
+
+exports.LogType = LogType;
+
+/** @typedef {typeof LogType[keyof typeof LogType]} LogTypeEnum */
+
+const LOG_SYMBOL = Symbol("webpack logger raw log method");
+const TIMERS_SYMBOL = Symbol("webpack logger times");
+
+class WebpackLogger {
+	/**
+	 * @param {function(LogTypeEnum, any[]=): void} log log function
+	 */
+	constructor(log) {
+		this[LOG_SYMBOL] = log;
+	}
+
+	error(...args) {
+		this[LOG_SYMBOL](LogType.error, args);
+	}
+
+	warn(...args) {
+		this[LOG_SYMBOL](LogType.warn, args);
+	}
+
+	info(...args) {
+		this[LOG_SYMBOL](LogType.info, args);
+	}
+
+	log(...args) {
+		this[LOG_SYMBOL](LogType.log, args);
+	}
+
+	debug(...args) {
+		this[LOG_SYMBOL](LogType.debug, args);
+	}
+
+	assert(assertion, ...args) {
+		if (!assertion) {
+			this[LOG_SYMBOL](LogType.error, args);
+		}
+	}
+
+	trace() {
+		this[LOG_SYMBOL](LogType.trace, ["Trace"]);
+	}
+
+	clear() {
+		this[LOG_SYMBOL](LogType.clear);
+	}
+
+	status(...args) {
+		this[LOG_SYMBOL](LogType.status, args);
+	}
+
+	group(...args) {
+		this[LOG_SYMBOL](LogType.group, args);
+	}
+
+	groupCollapsed(...args) {
+		this[LOG_SYMBOL](LogType.groupCollapsed, args);
+	}
+
+	groupEnd(...args) {
+		this[LOG_SYMBOL](LogType.groupEnd, args);
+	}
+
+	profile(label) {
+		this[LOG_SYMBOL](LogType.profile, [label]);
+	}
+
+	profileEnd(label) {
+		this[LOG_SYMBOL](LogType.profileEnd, [label]);
+	}
+
+	time(label) {
+		this[TIMERS_SYMBOL] = this[TIMERS_SYMBOL] || new Map();
+		this[TIMERS_SYMBOL].set(label, process.hrtime());
+	}
+
+	timeLog(label) {
+		const prev = this[TIMERS_SYMBOL] && this[TIMERS_SYMBOL].get(label);
+		if (!prev) {
+			throw new Error(`No such label '${label}' for WebpackLogger.timeLog()`);
+		}
+		const time = process.hrtime(prev);
+		this[LOG_SYMBOL](LogType.time, [label, ...time]);
+	}
+
+	timeEnd(label) {
+		const prev = this[TIMERS_SYMBOL] && this[TIMERS_SYMBOL].get(label);
+		if (!prev) {
+			throw new Error(`No such label '${label}' for WebpackLogger.timeEnd()`);
+		}
+		const time = process.hrtime(prev);
+		this[TIMERS_SYMBOL].delete(label);
+		this[LOG_SYMBOL](LogType.time, [label, ...time]);
+	}
+}
+
+exports.Logger = WebpackLogger;
diff --git a/node_modules/webpack/lib/logging/createConsoleLogger.js b/node_modules/webpack/lib/logging/createConsoleLogger.js
new file mode 100644
index 0000000..504f660
--- /dev/null
+++ b/node_modules/webpack/lib/logging/createConsoleLogger.js
@@ -0,0 +1,210 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const { LogType } = require("./Logger");
+
+/** @typedef {import("./Logger").LogTypeEnum} LogTypeEnum */
+/** @typedef {import("../../declarations/WebpackOptions").FilterTypes} FilterTypes */
+/** @typedef {import("../../declarations/WebpackOptions").FilterItemTypes} FilterItemTypes */
+
+/** @typedef {function(string): boolean} FilterFunction */
+
+/**
+ * @typedef {Object} LoggerOptions
+ * @property {false|true|"none"|"error"|"warn"|"info"|"log"|"verbose"} level loglevel
+ * @property {FilterTypes|boolean} debug filter for debug logging
+ * @property {Console & { status?: Function, logTime?: Function }} console the console to log to
+ */
+
+/**
+ * @param {FilterItemTypes} item an input item
+ * @returns {FilterFunction} filter funtion
+ */
+const filterToFunction = item => {
+	if (typeof item === "string") {
+		const regExp = new RegExp(
+			`[\\\\/]${item.replace(
+				// eslint-disable-next-line no-useless-escape
+				/[-[\]{}()*+?.\\^$|]/g,
+				"\\$&"
+			)}([\\\\/]|$|!|\\?)`
+		);
+		return ident => regExp.test(ident);
+	}
+	if (item && typeof item === "object" && typeof item.test === "function") {
+		return ident => item.test(ident);
+	}
+	if (typeof item === "function") {
+		return item;
+	}
+	if (typeof item === "boolean") {
+		return () => item;
+	}
+};
+
+/**
+ * @enum {number}
+ */
+const LogLevel = {
+	none: 6,
+	false: 6,
+	error: 5,
+	warn: 4,
+	info: 3,
+	log: 2,
+	true: 2,
+	verbose: 1
+};
+
+/**
+ * @param {LoggerOptions} options options object
+ * @returns {function(string, LogTypeEnum, any[]): void} logging function
+ */
+module.exports = ({ level = "info", debug = false, console }) => {
+	const debugFilters =
+		typeof debug === "boolean"
+			? [() => debug]
+			: /** @type {FilterItemTypes[]} */ ([])
+					.concat(debug)
+					.map(filterToFunction);
+	/** @type {number} */
+	const loglevel = LogLevel[`${level}`] || 0;
+
+	/**
+	 * @param {string} name name of the logger
+	 * @param {LogTypeEnum} type type of the log entry
+	 * @param {any[]} args arguments of the log entry
+	 * @returns {void}
+	 */
+	const logger = (name, type, args) => {
+		const labeledArgs = () => {
+			if (Array.isArray(args)) {
+				if (args.length > 0 && typeof args[0] === "string") {
+					return [`[${name}] ${args[0]}`, ...args.slice(1)];
+				} else {
+					return [`[${name}]`, ...args];
+				}
+			} else {
+				return [];
+			}
+		};
+		const debug = debugFilters.some(f => f(name));
+		switch (type) {
+			case LogType.debug:
+				if (!debug) return;
+				// eslint-disable-next-line node/no-unsupported-features/node-builtins
+				if (typeof console.debug === "function") {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					console.debug(...labeledArgs());
+				} else {
+					console.log(...labeledArgs());
+				}
+				break;
+			case LogType.log:
+				if (!debug && loglevel > LogLevel.log) return;
+				console.log(...labeledArgs());
+				break;
+			case LogType.info:
+				if (!debug && loglevel > LogLevel.info) return;
+				console.info(...labeledArgs());
+				break;
+			case LogType.warn:
+				if (!debug && loglevel > LogLevel.warn) return;
+				console.warn(...labeledArgs());
+				break;
+			case LogType.error:
+				if (!debug && loglevel > LogLevel.error) return;
+				console.error(...labeledArgs());
+				break;
+			case LogType.trace:
+				if (!debug) return;
+				console.trace();
+				break;
+			case LogType.groupCollapsed:
+				if (!debug && loglevel > LogLevel.log) return;
+				if (!debug && loglevel > LogLevel.verbose) {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					if (typeof console.groupCollapsed === "function") {
+						// eslint-disable-next-line node/no-unsupported-features/node-builtins
+						console.groupCollapsed(...labeledArgs());
+					} else {
+						console.log(...labeledArgs());
+					}
+					break;
+				}
+			// falls through
+			case LogType.group:
+				if (!debug && loglevel > LogLevel.log) return;
+				// eslint-disable-next-line node/no-unsupported-features/node-builtins
+				if (typeof console.group === "function") {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					console.group(...labeledArgs());
+				} else {
+					console.log(...labeledArgs());
+				}
+				break;
+			case LogType.groupEnd:
+				if (!debug && loglevel > LogLevel.log) return;
+				// eslint-disable-next-line node/no-unsupported-features/node-builtins
+				if (typeof console.groupEnd === "function") {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					console.groupEnd();
+				}
+				break;
+			case LogType.time: {
+				if (!debug && loglevel > LogLevel.log) return;
+				const ms = args[1] * 1000 + args[2] / 1000000;
+				const msg = `[${name}] ${args[0]}: ${ms}ms`;
+				if (typeof console.logTime === "function") {
+					console.logTime(msg);
+				} else {
+					console.log(msg);
+				}
+				break;
+			}
+			case LogType.profile:
+				// eslint-disable-next-line node/no-unsupported-features/node-builtins
+				if (typeof console.profile === "function") {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					console.profile(...labeledArgs());
+				}
+				break;
+			case LogType.profileEnd:
+				// eslint-disable-next-line node/no-unsupported-features/node-builtins
+				if (typeof console.profileEnd === "function") {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					console.profileEnd(...labeledArgs());
+				}
+				break;
+			case LogType.clear:
+				if (!debug && loglevel > LogLevel.log) return;
+				// eslint-disable-next-line node/no-unsupported-features/node-builtins
+				if (typeof console.clear === "function") {
+					// eslint-disable-next-line node/no-unsupported-features/node-builtins
+					console.clear();
+				}
+				break;
+			case LogType.status:
+				if (!debug && loglevel > LogLevel.info) return;
+				if (typeof console.status === "function") {
+					if (args.length === 0) {
+						console.status();
+					} else {
+						console.status(...labeledArgs());
+					}
+				} else {
+					if (args.length !== 0) {
+						console.info(...labeledArgs());
+					}
+				}
+				break;
+			default:
+				throw new Error(`Unexpected LogType ${type}`);
+		}
+	};
+	return logger;
+};
diff --git a/node_modules/webpack/lib/logging/runtime.js b/node_modules/webpack/lib/logging/runtime.js
new file mode 100644
index 0000000..18e2148
--- /dev/null
+++ b/node_modules/webpack/lib/logging/runtime.js
@@ -0,0 +1,36 @@
+const SyncBailHook = require("tapable/lib/SyncBailHook");
+const { Logger } = require("./Logger");
+const createConsoleLogger = require("./createConsoleLogger");
+
+/** @type {createConsoleLogger.LoggerOptions} */
+let currentDefaultLoggerOptions = {
+	level: "info",
+	debug: false,
+	console
+};
+let currentDefaultLogger = createConsoleLogger(currentDefaultLoggerOptions);
+
+/**
+ * @param {string} name name of the logger
+ * @returns {Logger} a logger
+ */
+exports.getLogger = name => {
+	return new Logger((type, args) => {
+		if (exports.hooks.log.call(name, type, args) === undefined) {
+			currentDefaultLogger(name, type, args);
+		}
+	});
+};
+
+/**
+ * @param {createConsoleLogger.LoggerOptions} options new options, merge with old options
+ * @returns {void}
+ */
+exports.configureDefaultLogger = options => {
+	Object.assign(currentDefaultLoggerOptions, options);
+	currentDefaultLogger = createConsoleLogger(currentDefaultLoggerOptions);
+};
+
+exports.hooks = {
+	log: new SyncBailHook(["origin", "type", "args"])
+};
diff --git a/node_modules/webpack/lib/logging/truncateArgs.js b/node_modules/webpack/lib/logging/truncateArgs.js
new file mode 100644
index 0000000..8522586
--- /dev/null
+++ b/node_modules/webpack/lib/logging/truncateArgs.js
@@ -0,0 +1,76 @@
+/*
+ MIT License http://www.opensource.org/licenses/mit-license.php
+ Author Tobias Koppers @sokra
+ */
+
+"use strict";
+
+/**
+ * @param {any[]} args items to be truncated
+ * @param {number} maxLength maximum length of args including spaces between
+ * @returns {string[]} truncated args
+ */
+const truncateArgs = (args, maxLength) => {
+	const lengths = args.map(a => `${a}`.length);
+	const availableLength = maxLength - lengths.length + 1;
+
+	if (availableLength > 0 && args.length === 1) {
+		if (availableLength >= args[0].length) {
+			return args;
+		} else if (availableLength > 3) {
+			return ["..." + args[0].slice(-availableLength + 3)];
+		} else {
+			return [args[0].slice(-availableLength)];
+		}
+	}
+
+	// Check if there is space for at least 4 chars per arg
+	if (availableLength < lengths.reduce((s, i) => s + Math.min(i, 6), 0)) {
+		// remove args
+		if (args.length > 1)
+			return truncateArgs(args.slice(0, args.length - 1), maxLength);
+		return [];
+	}
+
+	let currentLength = lengths.reduce((a, b) => a + b, 0);
+
+	// Check if all fits into maxLength
+	if (currentLength <= availableLength) return args;
+
+	// Try to remove chars from the longest items until it fits
+	while (currentLength > availableLength) {
+		const maxLength = Math.max(...lengths);
+		const shorterItems = lengths.filter(l => l !== maxLength);
+		const nextToMaxLength =
+			shorterItems.length > 0 ? Math.max(...shorterItems) : 0;
+		const maxReduce = maxLength - nextToMaxLength;
+		let maxItems = lengths.length - shorterItems.length;
+		let overrun = currentLength - availableLength;
+		for (let i = 0; i < lengths.length; i++) {
+			if (lengths[i] === maxLength) {
+				const reduce = Math.min(Math.floor(overrun / maxItems), maxReduce);
+				lengths[i] -= reduce;
+				currentLength -= reduce;
+				overrun -= reduce;
+				maxItems--;
+			}
+		}
+	}
+
+	// Return args reduced to length in lengths
+	return args.map((a, i) => {
+		const str = `${a}`;
+		const length = lengths[i];
+		if (str.length === length) {
+			return str;
+		} else if (length > 5) {
+			return "..." + str.slice(-length + 3);
+		} else if (length > 0) {
+			return str.slice(-length);
+		} else {
+			return "";
+		}
+	});
+};
+
+module.exports = truncateArgs;
diff --git a/node_modules/webpack/lib/node/NodeChunkTemplatePlugin.js b/node_modules/webpack/lib/node/NodeChunkTemplatePlugin.js
new file mode 100644
index 0000000..292182a
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeChunkTemplatePlugin.js
@@ -0,0 +1,31 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+
+class NodeChunkTemplatePlugin {
+	apply(chunkTemplate) {
+		chunkTemplate.hooks.render.tap(
+			"NodeChunkTemplatePlugin",
+			(modules, chunk) => {
+				const source = new ConcatSource();
+				source.add(
+					`exports.ids = ${JSON.stringify(chunk.ids)};\nexports.modules = `
+				);
+				source.add(modules);
+				source.add(";");
+				return source;
+			}
+		);
+		chunkTemplate.hooks.hash.tap("NodeChunkTemplatePlugin", hash => {
+			hash.update("node");
+			hash.update("3");
+		});
+	}
+}
+
+module.exports = NodeChunkTemplatePlugin;
diff --git a/node_modules/webpack/lib/node/NodeEnvironmentPlugin.js b/node_modules/webpack/lib/node/NodeEnvironmentPlugin.js
new file mode 100644
index 0000000..98c7985
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeEnvironmentPlugin.js
@@ -0,0 +1,44 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const NodeWatchFileSystem = require("./NodeWatchFileSystem");
+const NodeOutputFileSystem = require("./NodeOutputFileSystem");
+const NodeJsInputFileSystem = require("enhanced-resolve/lib/NodeJsInputFileSystem");
+const CachedInputFileSystem = require("enhanced-resolve/lib/CachedInputFileSystem");
+const createConsoleLogger = require("../logging/createConsoleLogger");
+const nodeConsole = require("./nodeConsole");
+
+class NodeEnvironmentPlugin {
+	constructor(options) {
+		this.options = options || {};
+	}
+
+	apply(compiler) {
+		compiler.infrastructureLogger = createConsoleLogger(
+			Object.assign(
+				{
+					level: "info",
+					debug: false,
+					console: nodeConsole
+				},
+				this.options.infrastructureLogging
+			)
+		);
+		compiler.inputFileSystem = new CachedInputFileSystem(
+			new NodeJsInputFileSystem(),
+			60000
+		);
+		const inputFileSystem = compiler.inputFileSystem;
+		compiler.outputFileSystem = new NodeOutputFileSystem();
+		compiler.watchFileSystem = new NodeWatchFileSystem(
+			compiler.inputFileSystem
+		);
+		compiler.hooks.beforeRun.tap("NodeEnvironmentPlugin", compiler => {
+			if (compiler.inputFileSystem === inputFileSystem) inputFileSystem.purge();
+		});
+	}
+}
+module.exports = NodeEnvironmentPlugin;
diff --git a/node_modules/webpack/lib/node/NodeHotUpdateChunkTemplatePlugin.js b/node_modules/webpack/lib/node/NodeHotUpdateChunkTemplatePlugin.js
new file mode 100644
index 0000000..bbd2e12
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeHotUpdateChunkTemplatePlugin.js
@@ -0,0 +1,36 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+
+class NodeHotUpdateChunkTemplatePlugin {
+	apply(hotUpdateChunkTemplate) {
+		hotUpdateChunkTemplate.hooks.render.tap(
+			"NodeHotUpdateChunkTemplatePlugin",
+			(modulesSource, modules, removedModules, hash, id) => {
+				const source = new ConcatSource();
+				source.add(
+					"exports.id = " + JSON.stringify(id) + ";\nexports.modules = "
+				);
+				source.add(modulesSource);
+				source.add(";");
+				return source;
+			}
+		);
+		hotUpdateChunkTemplate.hooks.hash.tap(
+			"NodeHotUpdateChunkTemplatePlugin",
+			hash => {
+				hash.update("NodeHotUpdateChunkTemplatePlugin");
+				hash.update("3");
+				hash.update(
+					hotUpdateChunkTemplate.outputOptions.hotUpdateFunction + ""
+				);
+				hash.update(hotUpdateChunkTemplate.outputOptions.library + "");
+			}
+		);
+	}
+}
+module.exports = NodeHotUpdateChunkTemplatePlugin;
diff --git a/node_modules/webpack/lib/node/NodeMainTemplate.runtime.js b/node_modules/webpack/lib/node/NodeMainTemplate.runtime.js
new file mode 100644
index 0000000..0880124
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeMainTemplate.runtime.js
@@ -0,0 +1,32 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+// eslint-disable-next-line no-unused-vars
+var $hotChunkFilename$ = undefined;
+var hotAddUpdateChunk = undefined;
+var installedChunks = undefined;
+var $hotMainFilename$ = undefined;
+
+module.exports = function() {
+	// eslint-disable-next-line no-unused-vars
+	function hotDownloadUpdateChunk(chunkId) {
+		var chunk = require("./" + $hotChunkFilename$);
+		hotAddUpdateChunk(chunk.id, chunk.modules);
+	}
+
+	// eslint-disable-next-line no-unused-vars
+	function hotDownloadManifest() {
+		try {
+			var update = require("./" + $hotMainFilename$);
+		} catch (e) {
+			return Promise.resolve();
+		}
+		return Promise.resolve(update);
+	}
+
+	//eslint-disable-next-line no-unused-vars
+	function hotDisposeChunk(chunkId) {
+		delete installedChunks[chunkId];
+	}
+};
diff --git a/node_modules/webpack/lib/node/NodeMainTemplateAsync.runtime.js b/node_modules/webpack/lib/node/NodeMainTemplateAsync.runtime.js
new file mode 100644
index 0000000..a021f5a
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeMainTemplateAsync.runtime.js
@@ -0,0 +1,50 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+// eslint-disable-next-line no-unused-vars
+var $hotChunkFilename$ = undefined;
+var $require$ = undefined;
+var hotAddUpdateChunk = undefined;
+var $hotMainFilename$ = undefined;
+var installedChunks = undefined;
+
+module.exports = function() {
+	// eslint-disable-next-line no-unused-vars
+	function hotDownloadUpdateChunk(chunkId) {
+		var filename = require("path").join(__dirname, $hotChunkFilename$);
+		require("fs").readFile(filename, "utf-8", function(err, content) {
+			if (err) {
+				if ($require$.onError) return $require$.oe(err);
+				throw err;
+			}
+			var chunk = {};
+			require("vm").runInThisContext(
+				"(function(exports) {" + content + "\n})",
+				{ filename: filename }
+			)(chunk);
+			hotAddUpdateChunk(chunk.id, chunk.modules);
+		});
+	}
+
+	// eslint-disable-next-line no-unused-vars
+	function hotDownloadManifest() {
+		var filename = require("path").join(__dirname, $hotMainFilename$);
+		return new Promise(function(resolve, reject) {
+			require("fs").readFile(filename, "utf-8", function(err, content) {
+				if (err) return resolve();
+				try {
+					var update = JSON.parse(content);
+				} catch (e) {
+					return reject(e);
+				}
+				resolve(update);
+			});
+		});
+	}
+
+	// eslint-disable-next-line no-unused-vars
+	function hotDisposeChunk(chunkId) {
+		delete installedChunks[chunkId];
+	}
+};
diff --git a/node_modules/webpack/lib/node/NodeMainTemplatePlugin.js b/node_modules/webpack/lib/node/NodeMainTemplatePlugin.js
new file mode 100644
index 0000000..a270296
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeMainTemplatePlugin.js
@@ -0,0 +1,321 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Template = require("../Template");
+
+module.exports = class NodeMainTemplatePlugin {
+	constructor(asyncChunkLoading) {
+		this.asyncChunkLoading = asyncChunkLoading;
+	}
+
+	apply(mainTemplate) {
+		const needChunkOnDemandLoadingCode = chunk => {
+			for (const chunkGroup of chunk.groupsIterable) {
+				if (chunkGroup.getNumberOfChildren() > 0) return true;
+			}
+			return false;
+		};
+		const asyncChunkLoading = this.asyncChunkLoading;
+		mainTemplate.hooks.localVars.tap(
+			"NodeMainTemplatePlugin",
+			(source, chunk) => {
+				if (needChunkOnDemandLoadingCode(chunk)) {
+					return Template.asString([
+						source,
+						"",
+						"// object to store loaded chunks",
+						'// "0" means "already loaded"',
+						"var installedChunks = {",
+						Template.indent(
+							chunk.ids.map(id => `${JSON.stringify(id)}: 0`).join(",\n")
+						),
+						"};"
+					]);
+				}
+				return source;
+			}
+		);
+		mainTemplate.hooks.requireExtensions.tap(
+			"NodeMainTemplatePlugin",
+			(source, chunk) => {
+				if (needChunkOnDemandLoadingCode(chunk)) {
+					return Template.asString([
+						source,
+						"",
+						"// uncaught error handler for webpack runtime",
+						`${mainTemplate.requireFn}.oe = function(err) {`,
+						Template.indent([
+							"process.nextTick(function() {",
+							Template.indent(
+								"throw err; // catch this error by using import().catch()"
+							),
+							"});"
+						]),
+						"};"
+					]);
+				}
+				return source;
+			}
+		);
+		mainTemplate.hooks.requireEnsure.tap(
+			"NodeMainTemplatePlugin",
+			(source, chunk, hash) => {
+				const chunkFilename = mainTemplate.outputOptions.chunkFilename;
+				const chunkMaps = chunk.getChunkMaps();
+				const insertMoreModules = [
+					"var moreModules = chunk.modules, chunkIds = chunk.ids;",
+					"for(var moduleId in moreModules) {",
+					Template.indent(
+						mainTemplate.renderAddModule(
+							hash,
+							chunk,
+							"moduleId",
+							"moreModules[moduleId]"
+						)
+					),
+					"}"
+				];
+				if (asyncChunkLoading) {
+					return Template.asString([
+						source,
+						"",
+						"// ReadFile + VM.run chunk loading for javascript",
+						"",
+						"var installedChunkData = installedChunks[chunkId];",
+						'if(installedChunkData !== 0) { // 0 means "already installed".',
+						Template.indent([
+							'// array of [resolve, reject, promise] means "currently loading"',
+							"if(installedChunkData) {",
+							Template.indent(["promises.push(installedChunkData[2]);"]),
+							"} else {",
+							Template.indent([
+								"// load the chunk and return promise to it",
+								"var promise = new Promise(function(resolve, reject) {",
+								Template.indent([
+									"installedChunkData = installedChunks[chunkId] = [resolve, reject];",
+									"var filename = require('path').join(__dirname, " +
+										mainTemplate.getAssetPath(
+											JSON.stringify(`/${chunkFilename}`),
+											{
+												hash: `" + ${mainTemplate.renderCurrentHashCode(
+													hash
+												)} + "`,
+												hashWithLength: length =>
+													`" + ${mainTemplate.renderCurrentHashCode(
+														hash,
+														length
+													)} + "`,
+												chunk: {
+													id: '" + chunkId + "',
+													hash: `" + ${JSON.stringify(
+														chunkMaps.hash
+													)}[chunkId] + "`,
+													hashWithLength: length => {
+														const shortChunkHashMap = {};
+														for (const chunkId of Object.keys(chunkMaps.hash)) {
+															if (typeof chunkMaps.hash[chunkId] === "string") {
+																shortChunkHashMap[chunkId] = chunkMaps.hash[
+																	chunkId
+																].substr(0, length);
+															}
+														}
+														return `" + ${JSON.stringify(
+															shortChunkHashMap
+														)}[chunkId] + "`;
+													},
+													contentHash: {
+														javascript: `" + ${JSON.stringify(
+															chunkMaps.contentHash.javascript
+														)}[chunkId] + "`
+													},
+													contentHashWithLength: {
+														javascript: length => {
+															const shortContentHashMap = {};
+															const contentHash =
+																chunkMaps.contentHash.javascript;
+															for (const chunkId of Object.keys(contentHash)) {
+																if (typeof contentHash[chunkId] === "string") {
+																	shortContentHashMap[chunkId] = contentHash[
+																		chunkId
+																	].substr(0, length);
+																}
+															}
+															return `" + ${JSON.stringify(
+																shortContentHashMap
+															)}[chunkId] + "`;
+														}
+													},
+													name: `" + (${JSON.stringify(
+														chunkMaps.name
+													)}[chunkId]||chunkId) + "`
+												},
+												contentHashType: "javascript"
+											}
+										) +
+										");",
+									"require('fs').readFile(filename, 'utf-8',  function(err, content) {",
+									Template.indent(
+										[
+											"if(err) return reject(err);",
+											"var chunk = {};",
+											"require('vm').runInThisContext('(function(exports, require, __dirname, __filename) {' + content + '\\n})', filename)" +
+												"(chunk, require, require('path').dirname(filename), filename);"
+										]
+											.concat(insertMoreModules)
+											.concat([
+												"var callbacks = [];",
+												"for(var i = 0; i < chunkIds.length; i++) {",
+												Template.indent([
+													"if(installedChunks[chunkIds[i]])",
+													Template.indent([
+														"callbacks = callbacks.concat(installedChunks[chunkIds[i]][0]);"
+													]),
+													"installedChunks[chunkIds[i]] = 0;"
+												]),
+												"}",
+												"for(i = 0; i < callbacks.length; i++)",
+												Template.indent("callbacks[i]();")
+											])
+									),
+									"});"
+								]),
+								"});",
+								"promises.push(installedChunkData[2] = promise);"
+							]),
+							"}"
+						]),
+						"}"
+					]);
+				} else {
+					const request = mainTemplate.getAssetPath(
+						JSON.stringify(`./${chunkFilename}`),
+						{
+							hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+							hashWithLength: length =>
+								`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`,
+							chunk: {
+								id: '" + chunkId + "',
+								hash: `" + ${JSON.stringify(chunkMaps.hash)}[chunkId] + "`,
+								hashWithLength: length => {
+									const shortChunkHashMap = {};
+									for (const chunkId of Object.keys(chunkMaps.hash)) {
+										if (typeof chunkMaps.hash[chunkId] === "string") {
+											shortChunkHashMap[chunkId] = chunkMaps.hash[
+												chunkId
+											].substr(0, length);
+										}
+									}
+									return `" + ${JSON.stringify(
+										shortChunkHashMap
+									)}[chunkId] + "`;
+								},
+								contentHash: {
+									javascript: `" + ${JSON.stringify(
+										chunkMaps.contentHash.javascript
+									)}[chunkId] + "`
+								},
+								contentHashWithLength: {
+									javascript: length => {
+										const shortContentHashMap = {};
+										const contentHash = chunkMaps.contentHash.javascript;
+										for (const chunkId of Object.keys(contentHash)) {
+											if (typeof contentHash[chunkId] === "string") {
+												shortContentHashMap[chunkId] = contentHash[
+													chunkId
+												].substr(0, length);
+											}
+										}
+										return `" + ${JSON.stringify(
+											shortContentHashMap
+										)}[chunkId] + "`;
+									}
+								},
+								name: `" + (${JSON.stringify(
+									chunkMaps.name
+								)}[chunkId]||chunkId) + "`
+							},
+							contentHashType: "javascript"
+						}
+					);
+					return Template.asString([
+						source,
+						"",
+						"// require() chunk loading for javascript",
+						"",
+						'// "0" is the signal for "already loaded"',
+						"if(installedChunks[chunkId] !== 0) {",
+						Template.indent(
+							[`var chunk = require(${request});`]
+								.concat(insertMoreModules)
+								.concat([
+									"for(var i = 0; i < chunkIds.length; i++)",
+									Template.indent("installedChunks[chunkIds[i]] = 0;")
+								])
+						),
+						"}"
+					]);
+				}
+			}
+		);
+		mainTemplate.hooks.hotBootstrap.tap(
+			"NodeMainTemplatePlugin",
+			(source, chunk, hash) => {
+				const hotUpdateChunkFilename =
+					mainTemplate.outputOptions.hotUpdateChunkFilename;
+				const hotUpdateMainFilename =
+					mainTemplate.outputOptions.hotUpdateMainFilename;
+				const chunkMaps = chunk.getChunkMaps();
+				const currentHotUpdateChunkFilename = mainTemplate.getAssetPath(
+					JSON.stringify(hotUpdateChunkFilename),
+					{
+						hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+						hashWithLength: length =>
+							`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`,
+						chunk: {
+							id: '" + chunkId + "',
+							hash: `" + ${JSON.stringify(chunkMaps.hash)}[chunkId] + "`,
+							hashWithLength: length => {
+								const shortChunkHashMap = {};
+								for (const chunkId of Object.keys(chunkMaps.hash)) {
+									if (typeof chunkMaps.hash[chunkId] === "string") {
+										shortChunkHashMap[chunkId] = chunkMaps.hash[chunkId].substr(
+											0,
+											length
+										);
+									}
+								}
+								return `" + ${JSON.stringify(shortChunkHashMap)}[chunkId] + "`;
+							},
+							name: `" + (${JSON.stringify(
+								chunkMaps.name
+							)}[chunkId]||chunkId) + "`
+						}
+					}
+				);
+				const currentHotUpdateMainFilename = mainTemplate.getAssetPath(
+					JSON.stringify(hotUpdateMainFilename),
+					{
+						hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+						hashWithLength: length =>
+							`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`
+					}
+				);
+				return Template.getFunctionContent(
+					asyncChunkLoading
+						? require("./NodeMainTemplateAsync.runtime")
+						: require("./NodeMainTemplate.runtime")
+				)
+					.replace(/\$require\$/g, mainTemplate.requireFn)
+					.replace(/\$hotMainFilename\$/g, currentHotUpdateMainFilename)
+					.replace(/\$hotChunkFilename\$/g, currentHotUpdateChunkFilename);
+			}
+		);
+		mainTemplate.hooks.hash.tap("NodeMainTemplatePlugin", hash => {
+			hash.update("node");
+			hash.update("4");
+		});
+	}
+};
diff --git a/node_modules/webpack/lib/node/NodeOutputFileSystem.js b/node_modules/webpack/lib/node/NodeOutputFileSystem.js
new file mode 100644
index 0000000..2789b57
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeOutputFileSystem.js
@@ -0,0 +1,22 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const fs = require("fs");
+const path = require("path");
+const mkdirp = require("mkdirp");
+
+class NodeOutputFileSystem {
+	constructor() {
+		this.mkdirp = mkdirp;
+		this.mkdir = fs.mkdir.bind(fs);
+		this.rmdir = fs.rmdir.bind(fs);
+		this.unlink = fs.unlink.bind(fs);
+		this.writeFile = fs.writeFile.bind(fs);
+		this.join = path.join.bind(path);
+	}
+}
+
+module.exports = NodeOutputFileSystem;
diff --git a/node_modules/webpack/lib/node/NodeSourcePlugin.js b/node_modules/webpack/lib/node/NodeSourcePlugin.js
new file mode 100644
index 0000000..081e1a6
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeSourcePlugin.js
@@ -0,0 +1,141 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const AliasPlugin = require("enhanced-resolve/lib/AliasPlugin");
+const ParserHelpers = require("../ParserHelpers");
+const nodeLibsBrowser = require("node-libs-browser");
+
+module.exports = class NodeSourcePlugin {
+	constructor(options) {
+		this.options = options;
+	}
+	apply(compiler) {
+		const options = this.options;
+		if (options === false) {
+			// allow single kill switch to turn off this plugin
+			return;
+		}
+
+		const getPathToModule = (module, type) => {
+			if (type === true || (type === undefined && nodeLibsBrowser[module])) {
+				if (!nodeLibsBrowser[module]) {
+					throw new Error(
+						`No browser version for node.js core module ${module} available`
+					);
+				}
+				return nodeLibsBrowser[module];
+			} else if (type === "mock") {
+				return require.resolve(`node-libs-browser/mock/${module}`);
+			} else if (type === "empty") {
+				return require.resolve("node-libs-browser/mock/empty");
+			} else {
+				return module;
+			}
+		};
+
+		const addExpression = (parser, name, module, type, suffix) => {
+			suffix = suffix || "";
+			parser.hooks.expression.for(name).tap("NodeSourcePlugin", () => {
+				if (
+					parser.state.module &&
+					parser.state.module.resource === getPathToModule(module, type)
+				)
+					return;
+				const mockModule = ParserHelpers.requireFileAsExpression(
+					parser.state.module.context,
+					getPathToModule(module, type)
+				);
+				return ParserHelpers.addParsedVariableToModule(
+					parser,
+					name,
+					mockModule + suffix
+				);
+			});
+		};
+
+		compiler.hooks.compilation.tap(
+			"NodeSourcePlugin",
+			(compilation, { normalModuleFactory }) => {
+				const handler = (parser, parserOptions) => {
+					if (parserOptions.node === false) return;
+
+					let localOptions = options;
+					if (parserOptions.node) {
+						localOptions = Object.assign({}, localOptions, parserOptions.node);
+					}
+					if (localOptions.global) {
+						parser.hooks.expression
+							.for("global")
+							.tap("NodeSourcePlugin", () => {
+								const retrieveGlobalModule = ParserHelpers.requireFileAsExpression(
+									parser.state.module.context,
+									require.resolve("../../buildin/global")
+								);
+								return ParserHelpers.addParsedVariableToModule(
+									parser,
+									"global",
+									retrieveGlobalModule
+								);
+							});
+					}
+					if (localOptions.process) {
+						const processType = localOptions.process;
+						addExpression(parser, "process", "process", processType);
+					}
+					if (localOptions.console) {
+						const consoleType = localOptions.console;
+						addExpression(parser, "console", "console", consoleType);
+					}
+					const bufferType = localOptions.Buffer;
+					if (bufferType) {
+						addExpression(parser, "Buffer", "buffer", bufferType, ".Buffer");
+					}
+					if (localOptions.setImmediate) {
+						const setImmediateType = localOptions.setImmediate;
+						addExpression(
+							parser,
+							"setImmediate",
+							"timers",
+							setImmediateType,
+							".setImmediate"
+						);
+						addExpression(
+							parser,
+							"clearImmediate",
+							"timers",
+							setImmediateType,
+							".clearImmediate"
+						);
+					}
+				};
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("NodeSourcePlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("NodeSourcePlugin", handler);
+			}
+		);
+		compiler.hooks.afterResolvers.tap("NodeSourcePlugin", compiler => {
+			for (const lib of Object.keys(nodeLibsBrowser)) {
+				if (options[lib] !== false) {
+					compiler.resolverFactory.hooks.resolver
+						.for("normal")
+						.tap("NodeSourcePlugin", resolver => {
+							new AliasPlugin(
+								"described-resolve",
+								{
+									name: lib,
+									onlyModule: true,
+									alias: getPathToModule(lib, options[lib])
+								},
+								"resolve"
+							).apply(resolver);
+						});
+				}
+			}
+		});
+	}
+};
diff --git a/node_modules/webpack/lib/node/NodeTargetPlugin.js b/node_modules/webpack/lib/node/NodeTargetPlugin.js
new file mode 100644
index 0000000..1ac5d8a
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeTargetPlugin.js
@@ -0,0 +1,19 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const ExternalsPlugin = require("../ExternalsPlugin");
+
+const builtins =
+	// eslint-disable-next-line node/no-unsupported-features/node-builtins,node/no-deprecated-api
+	require("module").builtinModules || Object.keys(process.binding("natives"));
+
+class NodeTargetPlugin {
+	apply(compiler) {
+		new ExternalsPlugin("commonjs", builtins).apply(compiler);
+	}
+}
+
+module.exports = NodeTargetPlugin;
diff --git a/node_modules/webpack/lib/node/NodeTemplatePlugin.js b/node_modules/webpack/lib/node/NodeTemplatePlugin.js
new file mode 100644
index 0000000..cdb1076
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeTemplatePlugin.js
@@ -0,0 +1,31 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const NodeMainTemplatePlugin = require("./NodeMainTemplatePlugin");
+const NodeChunkTemplatePlugin = require("./NodeChunkTemplatePlugin");
+const NodeHotUpdateChunkTemplatePlugin = require("./NodeHotUpdateChunkTemplatePlugin");
+
+class NodeTemplatePlugin {
+	constructor(options) {
+		options = options || {};
+		this.asyncChunkLoading = options.asyncChunkLoading;
+	}
+
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap("NodeTemplatePlugin", compilation => {
+			new NodeMainTemplatePlugin(this.asyncChunkLoading).apply(
+				compilation.mainTemplate
+			);
+			new NodeChunkTemplatePlugin().apply(compilation.chunkTemplate);
+			new NodeHotUpdateChunkTemplatePlugin().apply(
+				compilation.hotUpdateChunkTemplate
+			);
+		});
+	}
+}
+
+module.exports = NodeTemplatePlugin;
diff --git a/node_modules/webpack/lib/node/NodeWatchFileSystem.js b/node_modules/webpack/lib/node/NodeWatchFileSystem.js
new file mode 100644
index 0000000..235e0f0
--- /dev/null
+++ b/node_modules/webpack/lib/node/NodeWatchFileSystem.js
@@ -0,0 +1,109 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Watchpack = require("watchpack");
+const objectToMap = require("../util/objectToMap");
+
+class NodeWatchFileSystem {
+	constructor(inputFileSystem) {
+		this.inputFileSystem = inputFileSystem;
+		this.watcherOptions = {
+			aggregateTimeout: 0
+		};
+		this.watcher = new Watchpack(this.watcherOptions);
+	}
+
+	watch(files, dirs, missing, startTime, options, callback, callbackUndelayed) {
+		if (!Array.isArray(files)) {
+			throw new Error("Invalid arguments: 'files'");
+		}
+		if (!Array.isArray(dirs)) {
+			throw new Error("Invalid arguments: 'dirs'");
+		}
+		if (!Array.isArray(missing)) {
+			throw new Error("Invalid arguments: 'missing'");
+		}
+		if (typeof callback !== "function") {
+			throw new Error("Invalid arguments: 'callback'");
+		}
+		if (typeof startTime !== "number" && startTime) {
+			throw new Error("Invalid arguments: 'startTime'");
+		}
+		if (typeof options !== "object") {
+			throw new Error("Invalid arguments: 'options'");
+		}
+		if (typeof callbackUndelayed !== "function" && callbackUndelayed) {
+			throw new Error("Invalid arguments: 'callbackUndelayed'");
+		}
+		const oldWatcher = this.watcher;
+		this.watcher = new Watchpack(options);
+
+		if (callbackUndelayed) {
+			this.watcher.once("change", callbackUndelayed);
+		}
+		const cachedFiles = files;
+		const cachedDirs = dirs;
+		this.watcher.once("aggregated", (changes, removals) => {
+			changes = changes.concat(removals);
+			if (this.inputFileSystem && this.inputFileSystem.purge) {
+				this.inputFileSystem.purge(changes);
+			}
+			const times = objectToMap(this.watcher.getTimes());
+			files = new Set(files);
+			dirs = new Set(dirs);
+			missing = new Set(missing);
+			removals = new Set(removals.filter(file => files.has(file)));
+			callback(
+				null,
+				changes.filter(file => files.has(file)).sort(),
+				changes.filter(file => dirs.has(file)).sort(),
+				changes.filter(file => missing.has(file)).sort(),
+				times,
+				times,
+				removals
+			);
+		});
+
+		this.watcher.watch(
+			cachedFiles.concat(missing),
+			cachedDirs.concat(missing),
+			startTime
+		);
+
+		if (oldWatcher) {
+			oldWatcher.close();
+		}
+		return {
+			close: () => {
+				if (this.watcher) {
+					this.watcher.close();
+					this.watcher = null;
+				}
+			},
+			pause: () => {
+				if (this.watcher) {
+					this.watcher.pause();
+				}
+			},
+			getFileTimestamps: () => {
+				if (this.watcher) {
+					return objectToMap(this.watcher.getTimes());
+				} else {
+					return new Map();
+				}
+			},
+			getContextTimestamps: () => {
+				if (this.watcher) {
+					return objectToMap(this.watcher.getTimes());
+				} else {
+					return new Map();
+				}
+			}
+		};
+	}
+}
+
+module.exports = NodeWatchFileSystem;
diff --git a/node_modules/webpack/lib/node/ReadFileCompileWasmTemplatePlugin.js b/node_modules/webpack/lib/node/ReadFileCompileWasmTemplatePlugin.js
new file mode 100644
index 0000000..a7566b8
--- /dev/null
+++ b/node_modules/webpack/lib/node/ReadFileCompileWasmTemplatePlugin.js
@@ -0,0 +1,61 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Template = require("../Template");
+const WasmMainTemplatePlugin = require("../wasm/WasmMainTemplatePlugin");
+
+class ReadFileCompileWasmTemplatePlugin {
+	constructor(options) {
+		this.options = options || {};
+	}
+
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap(
+			"ReadFileCompileWasmTemplatePlugin",
+			compilation => {
+				const generateLoadBinaryCode = path =>
+					Template.asString([
+						"new Promise(function (resolve, reject) {",
+						Template.indent([
+							"var { readFile } = require('fs');",
+							"var { join } = require('path');",
+							"",
+							"try {",
+							Template.indent([
+								`readFile(join(__dirname, ${path}), function(err, buffer){`,
+								Template.indent([
+									"if (err) return reject(err);",
+									"",
+									"// Fake fetch response",
+									"resolve({",
+									Template.indent([
+										"arrayBuffer() { return Promise.resolve(buffer); }"
+									]),
+									"});"
+								]),
+								"});"
+							]),
+							"} catch (err) { reject(err); }"
+						]),
+						"})"
+					]);
+
+				const plugin = new WasmMainTemplatePlugin(
+					Object.assign(
+						{
+							generateLoadBinaryCode,
+							supportsStreaming: false
+						},
+						this.options
+					)
+				);
+				plugin.apply(compilation.mainTemplate);
+			}
+		);
+	}
+}
+
+module.exports = ReadFileCompileWasmTemplatePlugin;
diff --git a/node_modules/webpack/lib/node/nodeConsole.js b/node_modules/webpack/lib/node/nodeConsole.js
new file mode 100644
index 0000000..32a8099
--- /dev/null
+++ b/node_modules/webpack/lib/node/nodeConsole.js
@@ -0,0 +1,135 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const truncateArgs = require("../logging/truncateArgs");
+const util = require("util");
+
+const tty = process.stderr.isTTY && process.env.TERM !== "dumb";
+
+let currentStatusMessage = undefined;
+let hasStatusMessage = false;
+let currentIndent = "";
+let currentCollapsed = 0;
+
+const indent = (str, prefix, colorPrefix, colorSuffix) => {
+	if (str === "") return str;
+	prefix = currentIndent + prefix;
+	if (tty) {
+		return (
+			prefix +
+			colorPrefix +
+			str.replace(/\n/g, colorSuffix + "\n" + prefix + colorPrefix) +
+			colorSuffix
+		);
+	} else {
+		return prefix + str.replace(/\n/g, "\n" + prefix);
+	}
+};
+
+const clearStatusMessage = () => {
+	if (hasStatusMessage) {
+		process.stderr.write("\x1b[2K\r");
+		hasStatusMessage = false;
+	}
+};
+
+const writeStatusMessage = () => {
+	if (!currentStatusMessage) return;
+	const l = process.stderr.columns;
+	const args = l
+		? truncateArgs(currentStatusMessage, l - 1)
+		: currentStatusMessage;
+	const str = args.join(" ");
+	const coloredStr = `\u001b[1m${str}\u001b[39m\u001b[22m`;
+	process.stderr.write(`\x1b[2K\r${coloredStr}`);
+	hasStatusMessage = true;
+};
+
+const writeColored = (prefix, colorPrefix, colorSuffix) => {
+	return (...args) => {
+		if (currentCollapsed > 0) return;
+		clearStatusMessage();
+		// @ts-ignore
+		const str = indent(util.format(...args), prefix, colorPrefix, colorSuffix);
+		process.stderr.write(str + "\n");
+		writeStatusMessage();
+	};
+};
+
+const writeGroupMessage = writeColored(
+	"<-> ",
+	"\u001b[1m\u001b[36m",
+	"\u001b[39m\u001b[22m"
+);
+
+const writeGroupCollapsedMessage = writeColored(
+	"<+> ",
+	"\u001b[1m\u001b[36m",
+	"\u001b[39m\u001b[22m"
+);
+
+module.exports = {
+	log: writeColored("    ", "\u001b[1m", "\u001b[22m"),
+	debug: writeColored("    ", "", ""),
+	trace: writeColored("    ", "", ""),
+	info: writeColored("<i> ", "\u001b[1m\u001b[32m", "\u001b[39m\u001b[22m"),
+	warn: writeColored("<w> ", "\u001b[1m\u001b[33m", "\u001b[39m\u001b[22m"),
+	error: writeColored("<e> ", "\u001b[1m\u001b[31m", "\u001b[39m\u001b[22m"),
+	logTime: writeColored("<t> ", "\u001b[1m\u001b[35m", "\u001b[39m\u001b[22m"),
+	group: (...args) => {
+		writeGroupMessage(...args);
+		if (currentCollapsed > 0) {
+			currentCollapsed++;
+		} else {
+			currentIndent += "  ";
+		}
+	},
+	groupCollapsed: (...args) => {
+		writeGroupCollapsedMessage(...args);
+		currentCollapsed++;
+	},
+	groupEnd: () => {
+		if (currentCollapsed > 0) currentCollapsed--;
+		else if (currentIndent.length >= 2)
+			currentIndent = currentIndent.slice(0, currentIndent.length - 2);
+	},
+	// eslint-disable-next-line node/no-unsupported-features/node-builtins
+	profile: console.profile && (name => console.profile(name)),
+	// eslint-disable-next-line node/no-unsupported-features/node-builtins
+	profileEnd: console.profileEnd && (name => console.profileEnd(name)),
+	clear:
+		tty &&
+		// eslint-disable-next-line node/no-unsupported-features/node-builtins
+		console.clear &&
+		(() => {
+			clearStatusMessage();
+			// eslint-disable-next-line node/no-unsupported-features/node-builtins
+			console.clear();
+			writeStatusMessage();
+		}),
+	status: tty
+		? (name, ...args) => {
+				args = args.filter(Boolean);
+				if (name === undefined && args.length === 0) {
+					clearStatusMessage();
+					currentStatusMessage = undefined;
+				} else if (
+					typeof name === "string" &&
+					name.startsWith("[webpack.Progress] ")
+				) {
+					currentStatusMessage = [name.slice(19), ...args];
+					writeStatusMessage();
+				} else if (name === "[webpack.Progress]") {
+					currentStatusMessage = [...args];
+					writeStatusMessage();
+				} else {
+					currentStatusMessage = [name, ...args];
+					writeStatusMessage();
+				}
+		  }
+		: writeColored("<s> ", "", "")
+};
diff --git a/node_modules/webpack/lib/optimize/AggressiveMergingPlugin.js b/node_modules/webpack/lib/optimize/AggressiveMergingPlugin.js
new file mode 100644
index 0000000..e3a4c37
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/AggressiveMergingPlugin.js
@@ -0,0 +1,87 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class AggressiveMergingPlugin {
+	constructor(options) {
+		if (
+			(options !== undefined && typeof options !== "object") ||
+			Array.isArray(options)
+		) {
+			throw new Error(
+				"Argument should be an options object. To use defaults, pass in nothing.\nFor more info on options, see https://webpack.js.org/plugins/"
+			);
+		}
+		this.options = options || {};
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		const minSizeReduce = options.minSizeReduce || 1.5;
+
+		compiler.hooks.thisCompilation.tap(
+			"AggressiveMergingPlugin",
+			compilation => {
+				compilation.hooks.optimizeChunksAdvanced.tap(
+					"AggressiveMergingPlugin",
+					chunks => {
+						let combinations = [];
+						chunks.forEach((a, idx) => {
+							if (a.canBeInitial()) return;
+							for (let i = 0; i < idx; i++) {
+								const b = chunks[i];
+								if (b.canBeInitial()) continue;
+								combinations.push({
+									a,
+									b,
+									improvement: undefined
+								});
+							}
+						});
+
+						for (const pair of combinations) {
+							const a = pair.b.size({
+								chunkOverhead: 0
+							});
+							const b = pair.a.size({
+								chunkOverhead: 0
+							});
+							const ab = pair.b.integratedSize(pair.a, {
+								chunkOverhead: 0
+							});
+							let newSize;
+							if (ab === false) {
+								pair.improvement = false;
+								return;
+							} else {
+								newSize = ab;
+							}
+
+							pair.improvement = (a + b) / newSize;
+						}
+						combinations = combinations.filter(pair => {
+							return pair.improvement !== false;
+						});
+						combinations.sort((a, b) => {
+							return b.improvement - a.improvement;
+						});
+
+						const pair = combinations[0];
+
+						if (!pair) return;
+						if (pair.improvement < minSizeReduce) return;
+
+						if (pair.b.integrate(pair.a, "aggressive-merge")) {
+							chunks.splice(chunks.indexOf(pair.a), 1);
+							return true;
+						}
+					}
+				);
+			}
+		);
+	}
+}
+
+module.exports = AggressiveMergingPlugin;
diff --git a/node_modules/webpack/lib/optimize/AggressiveSplittingPlugin.js b/node_modules/webpack/lib/optimize/AggressiveSplittingPlugin.js
new file mode 100644
index 0000000..3843878
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/AggressiveSplittingPlugin.js
@@ -0,0 +1,294 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const identifierUtils = require("../util/identifier");
+const { intersect } = require("../util/SetHelpers");
+const validateOptions = require("schema-utils");
+const schema = require("../../schemas/plugins/optimize/AggressiveSplittingPlugin.json");
+
+/** @typedef {import("../../declarations/plugins/optimize/AggressiveSplittingPlugin").AggressiveSplittingPluginOptions} AggressiveSplittingPluginOptions */
+
+const moveModuleBetween = (oldChunk, newChunk) => {
+	return module => {
+		oldChunk.moveModule(module, newChunk);
+	};
+};
+
+const isNotAEntryModule = entryModule => {
+	return module => {
+		return entryModule !== module;
+	};
+};
+
+class AggressiveSplittingPlugin {
+	/**
+	 * @param {AggressiveSplittingPluginOptions=} options options object
+	 */
+	constructor(options) {
+		if (!options) options = {};
+
+		validateOptions(schema, options, "Aggressive Splitting Plugin");
+
+		this.options = options;
+		if (typeof this.options.minSize !== "number") {
+			this.options.minSize = 30 * 1024;
+		}
+		if (typeof this.options.maxSize !== "number") {
+			this.options.maxSize = 50 * 1024;
+		}
+		if (typeof this.options.chunkOverhead !== "number") {
+			this.options.chunkOverhead = 0;
+		}
+		if (typeof this.options.entryChunkMultiplicator !== "number") {
+			this.options.entryChunkMultiplicator = 1;
+		}
+	}
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap(
+			"AggressiveSplittingPlugin",
+			compilation => {
+				let needAdditionalSeal = false;
+				let newSplits;
+				let fromAggressiveSplittingSet;
+				let chunkSplitDataMap;
+				compilation.hooks.optimize.tap("AggressiveSplittingPlugin", () => {
+					newSplits = [];
+					fromAggressiveSplittingSet = new Set();
+					chunkSplitDataMap = new Map();
+				});
+				compilation.hooks.optimizeChunksAdvanced.tap(
+					"AggressiveSplittingPlugin",
+					chunks => {
+						// Precompute stuff
+						const nameToModuleMap = new Map();
+						const moduleToNameMap = new Map();
+						for (const m of compilation.modules) {
+							const name = identifierUtils.makePathsRelative(
+								compiler.context,
+								m.identifier(),
+								compilation.cache
+							);
+							nameToModuleMap.set(name, m);
+							moduleToNameMap.set(m, name);
+						}
+
+						// Check used chunk ids
+						const usedIds = new Set();
+						for (const chunk of chunks) {
+							usedIds.add(chunk.id);
+						}
+
+						const recordedSplits =
+							(compilation.records && compilation.records.aggressiveSplits) ||
+							[];
+						const usedSplits = newSplits
+							? recordedSplits.concat(newSplits)
+							: recordedSplits;
+
+						const minSize = this.options.minSize;
+						const maxSize = this.options.maxSize;
+
+						const applySplit = splitData => {
+							// Cannot split if id is already taken
+							if (splitData.id !== undefined && usedIds.has(splitData.id)) {
+								return false;
+							}
+
+							// Get module objects from names
+							const selectedModules = splitData.modules.map(name =>
+								nameToModuleMap.get(name)
+							);
+
+							// Does the modules exist at all?
+							if (!selectedModules.every(Boolean)) return false;
+
+							// Check if size matches (faster than waiting for hash)
+							const size = selectedModules.reduce(
+								(sum, m) => sum + m.size(),
+								0
+							);
+							if (size !== splitData.size) return false;
+
+							// get chunks with all modules
+							const selectedChunks = intersect(
+								selectedModules.map(m => new Set(m.chunksIterable))
+							);
+
+							// No relevant chunks found
+							if (selectedChunks.size === 0) return false;
+
+							// The found chunk is already the split or similar
+							if (
+								selectedChunks.size === 1 &&
+								Array.from(selectedChunks)[0].getNumberOfModules() ===
+									selectedModules.length
+							) {
+								const chunk = Array.from(selectedChunks)[0];
+								if (fromAggressiveSplittingSet.has(chunk)) return false;
+								fromAggressiveSplittingSet.add(chunk);
+								chunkSplitDataMap.set(chunk, splitData);
+								return true;
+							}
+
+							// split the chunk into two parts
+							const newChunk = compilation.addChunk();
+							newChunk.chunkReason = "aggressive splitted";
+							for (const chunk of selectedChunks) {
+								selectedModules.forEach(moveModuleBetween(chunk, newChunk));
+								chunk.split(newChunk);
+								chunk.name = null;
+							}
+							fromAggressiveSplittingSet.add(newChunk);
+							chunkSplitDataMap.set(newChunk, splitData);
+
+							if (splitData.id !== null && splitData.id !== undefined) {
+								newChunk.id = splitData.id;
+							}
+							return true;
+						};
+
+						// try to restore to recorded splitting
+						let changed = false;
+						for (let j = 0; j < usedSplits.length; j++) {
+							const splitData = usedSplits[j];
+							if (applySplit(splitData)) changed = true;
+						}
+
+						// for any chunk which isn't splitted yet, split it and create a new entry
+						// start with the biggest chunk
+						const sortedChunks = chunks.slice().sort((a, b) => {
+							const diff1 = b.modulesSize() - a.modulesSize();
+							if (diff1) return diff1;
+							const diff2 = a.getNumberOfModules() - b.getNumberOfModules();
+							if (diff2) return diff2;
+							const modulesA = Array.from(a.modulesIterable);
+							const modulesB = Array.from(b.modulesIterable);
+							modulesA.sort();
+							modulesB.sort();
+							const aI = modulesA[Symbol.iterator]();
+							const bI = modulesB[Symbol.iterator]();
+							// eslint-disable-next-line no-constant-condition
+							while (true) {
+								const aItem = aI.next();
+								const bItem = bI.next();
+								if (aItem.done) return 0;
+								const aModuleIdentifier = aItem.value.identifier();
+								const bModuleIdentifier = bItem.value.identifier();
+								if (aModuleIdentifier > bModuleIdentifier) return -1;
+								if (aModuleIdentifier < bModuleIdentifier) return 1;
+							}
+						});
+						for (const chunk of sortedChunks) {
+							if (fromAggressiveSplittingSet.has(chunk)) continue;
+							const size = chunk.modulesSize();
+							if (size > maxSize && chunk.getNumberOfModules() > 1) {
+								const modules = chunk
+									.getModules()
+									.filter(isNotAEntryModule(chunk.entryModule))
+									.sort((a, b) => {
+										a = a.identifier();
+										b = b.identifier();
+										if (a > b) return 1;
+										if (a < b) return -1;
+										return 0;
+									});
+								const selectedModules = [];
+								let selectedModulesSize = 0;
+								for (let k = 0; k < modules.length; k++) {
+									const module = modules[k];
+									const newSize = selectedModulesSize + module.size();
+									if (newSize > maxSize && selectedModulesSize >= minSize) {
+										break;
+									}
+									selectedModulesSize = newSize;
+									selectedModules.push(module);
+								}
+								if (selectedModules.length === 0) continue;
+								const splitData = {
+									modules: selectedModules
+										.map(m => moduleToNameMap.get(m))
+										.sort(),
+									size: selectedModulesSize
+								};
+
+								if (applySplit(splitData)) {
+									newSplits = (newSplits || []).concat(splitData);
+									changed = true;
+								}
+							}
+						}
+						if (changed) return true;
+					}
+				);
+				compilation.hooks.recordHash.tap(
+					"AggressiveSplittingPlugin",
+					records => {
+						// 4. save made splittings to records
+						const allSplits = new Set();
+						const invalidSplits = new Set();
+
+						// Check if some splittings are invalid
+						// We remove invalid splittings and try again
+						for (const chunk of compilation.chunks) {
+							const splitData = chunkSplitDataMap.get(chunk);
+							if (splitData !== undefined) {
+								if (splitData.hash && chunk.hash !== splitData.hash) {
+									// Split was successful, but hash doesn't equal
+									// We can throw away the split since it's useless now
+									invalidSplits.add(splitData);
+								}
+							}
+						}
+
+						if (invalidSplits.size > 0) {
+							records.aggressiveSplits = records.aggressiveSplits.filter(
+								splitData => !invalidSplits.has(splitData)
+							);
+							needAdditionalSeal = true;
+						} else {
+							// set hash and id values on all (new) splittings
+							for (const chunk of compilation.chunks) {
+								const splitData = chunkSplitDataMap.get(chunk);
+								if (splitData !== undefined) {
+									splitData.hash = chunk.hash;
+									splitData.id = chunk.id;
+									allSplits.add(splitData);
+									// set flag for stats
+									chunk.recorded = true;
+								}
+							}
+
+							// Also add all unused historial splits (after the used ones)
+							// They can still be used in some future compilation
+							const recordedSplits =
+								compilation.records && compilation.records.aggressiveSplits;
+							if (recordedSplits) {
+								for (const splitData of recordedSplits) {
+									if (!invalidSplits.has(splitData)) allSplits.add(splitData);
+								}
+							}
+
+							// record all splits
+							records.aggressiveSplits = Array.from(allSplits);
+
+							needAdditionalSeal = false;
+						}
+					}
+				);
+				compilation.hooks.needAdditionalSeal.tap(
+					"AggressiveSplittingPlugin",
+					() => {
+						if (needAdditionalSeal) {
+							needAdditionalSeal = false;
+							return true;
+						}
+					}
+				);
+			}
+		);
+	}
+}
+module.exports = AggressiveSplittingPlugin;
diff --git a/node_modules/webpack/lib/optimize/ChunkModuleIdRangePlugin.js b/node_modules/webpack/lib/optimize/ChunkModuleIdRangePlugin.js
new file mode 100644
index 0000000..9e3abd3
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/ChunkModuleIdRangePlugin.js
@@ -0,0 +1,66 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const sortByIndex = (a, b) => {
+	return a.index - b.index;
+};
+
+const sortByIndex2 = (a, b) => {
+	return a.index2 - b.index2;
+};
+
+class ChunkModuleIdRangePlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		compiler.hooks.compilation.tap("ChunkModuleIdRangePlugin", compilation => {
+			compilation.hooks.moduleIds.tap("ChunkModuleIdRangePlugin", modules => {
+				const chunk = compilation.chunks.find(
+					chunk => chunk.name === options.name
+				);
+				if (!chunk) {
+					throw new Error(
+						`ChunkModuleIdRangePlugin: Chunk with name '${options.name}"' was not found`
+					);
+				}
+
+				let chunkModules;
+				if (options.order) {
+					chunkModules = Array.from(chunk.modulesIterable);
+					switch (options.order) {
+						case "index":
+							chunkModules.sort(sortByIndex);
+							break;
+						case "index2":
+							chunkModules.sort(sortByIndex2);
+							break;
+						default:
+							throw new Error(
+								"ChunkModuleIdRangePlugin: unexpected value of order"
+							);
+					}
+				} else {
+					chunkModules = modules.filter(m => {
+						return m.chunksIterable.has(chunk);
+					});
+				}
+
+				let currentId = options.start || 0;
+				for (let i = 0; i < chunkModules.length; i++) {
+					const m = chunkModules[i];
+					if (m.id === null) {
+						m.id = currentId++;
+					}
+					if (options.end && currentId > options.end) break;
+				}
+			});
+		});
+	}
+}
+module.exports = ChunkModuleIdRangePlugin;
diff --git a/node_modules/webpack/lib/optimize/ConcatenatedModule.js b/node_modules/webpack/lib/optimize/ConcatenatedModule.js
new file mode 100644
index 0000000..df4d216
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/ConcatenatedModule.js
@@ -0,0 +1,1477 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Module = require("../Module");
+const Template = require("../Template");
+const Parser = require("../Parser");
+const eslintScope = require("eslint-scope");
+const { ConcatSource, ReplaceSource } = require("webpack-sources");
+const DependencyReference = require("../dependencies/DependencyReference");
+const HarmonyImportDependency = require("../dependencies/HarmonyImportDependency");
+const HarmonyImportSideEffectDependency = require("../dependencies/HarmonyImportSideEffectDependency");
+const HarmonyImportSpecifierDependency = require("../dependencies/HarmonyImportSpecifierDependency");
+const HarmonyExportSpecifierDependency = require("../dependencies/HarmonyExportSpecifierDependency");
+const HarmonyExportExpressionDependency = require("../dependencies/HarmonyExportExpressionDependency");
+const HarmonyExportImportedSpecifierDependency = require("../dependencies/HarmonyExportImportedSpecifierDependency");
+const HarmonyCompatibilityDependency = require("../dependencies/HarmonyCompatibilityDependency");
+const createHash = require("../util/createHash");
+
+/** @typedef {import("../Dependency")} Dependency */
+/** @typedef {import("../Compilation")} Compilation */
+/** @typedef {import("../util/createHash").Hash} Hash */
+/** @typedef {import("../RequestShortener")} RequestShortener */
+
+const joinIterableWithComma = iterable => {
+	// This is more performant than Array.from().join(", ")
+	// as it doesn't create an array
+	let str = "";
+	let first = true;
+	for (const item of iterable) {
+		if (first) {
+			first = false;
+		} else {
+			str += ", ";
+		}
+		str += item;
+	}
+	return str;
+};
+
+/**
+ * @typedef {Object} ConcatenationEntry
+ * @property {"concatenated" | "external"} type
+ * @property {Module} module
+ */
+
+const ensureNsObjSource = (
+	info,
+	moduleToInfoMap,
+	requestShortener,
+	strictHarmonyModule
+) => {
+	if (!info.hasNamespaceObject) {
+		info.hasNamespaceObject = true;
+		const name = info.exportMap.get(true);
+		const nsObj = [`var ${name} = {};`, `__webpack_require__.r(${name});`];
+		for (const exportName of info.module.buildMeta.providedExports) {
+			const finalName = getFinalName(
+				info,
+				exportName,
+				moduleToInfoMap,
+				requestShortener,
+				false,
+				strictHarmonyModule
+			);
+			nsObj.push(
+				`__webpack_require__.d(${name}, ${JSON.stringify(
+					exportName
+				)}, function() { return ${finalName}; });`
+			);
+		}
+		info.namespaceObjectSource = nsObj.join("\n") + "\n";
+	}
+};
+
+const getExternalImport = (
+	importedModule,
+	info,
+	exportName,
+	asCall,
+	strictHarmonyModule
+) => {
+	const used = importedModule.isUsed(exportName);
+	if (!used) return "/* unused reexport */undefined";
+	const comment =
+		used !== exportName ? ` ${Template.toNormalComment(exportName)}` : "";
+	switch (importedModule.buildMeta.exportsType) {
+		case "named":
+			if (exportName === "default") {
+				return info.name;
+			} else if (exportName === true) {
+				info.interopNamespaceObjectUsed = true;
+				return info.interopNamespaceObjectName;
+			} else {
+				break;
+			}
+		case "namespace":
+			if (exportName === true) {
+				return info.name;
+			} else {
+				break;
+			}
+		default:
+			if (strictHarmonyModule) {
+				if (exportName === "default") {
+					return info.name;
+				} else if (exportName === true) {
+					info.interopNamespaceObjectUsed = true;
+					return info.interopNamespaceObjectName;
+				} else {
+					return "/* non-default import from non-esm module */undefined";
+				}
+			} else {
+				if (exportName === "default") {
+					info.interopDefaultAccessUsed = true;
+					return asCall
+						? `${info.interopDefaultAccessName}()`
+						: `${info.interopDefaultAccessName}.a`;
+				} else if (exportName === true) {
+					return info.name;
+				} else {
+					break;
+				}
+			}
+	}
+	const reference = `${info.name}[${JSON.stringify(used)}${comment}]`;
+	if (asCall) return `Object(${reference})`;
+	return reference;
+};
+
+const getFinalName = (
+	info,
+	exportName,
+	moduleToInfoMap,
+	requestShortener,
+	asCall,
+	strictHarmonyModule,
+	alreadyVisited = new Set()
+) => {
+	switch (info.type) {
+		case "concatenated": {
+			const directExport = info.exportMap.get(exportName);
+			if (directExport) {
+				if (exportName === true) {
+					ensureNsObjSource(
+						info,
+						moduleToInfoMap,
+						requestShortener,
+						strictHarmonyModule
+					);
+				} else if (!info.module.isUsed(exportName)) {
+					return "/* unused export */ undefined";
+				}
+				if (info.globalExports.has(directExport)) {
+					return directExport;
+				}
+				const name = info.internalNames.get(directExport);
+				if (!name) {
+					throw new Error(
+						`The export "${directExport}" in "${info.module.readableIdentifier(
+							requestShortener
+						)}" has no internal name`
+					);
+				}
+				return name;
+			}
+			const reexport = info.reexportMap.get(exportName);
+			if (reexport) {
+				if (alreadyVisited.has(reexport)) {
+					throw new Error(
+						`Circular reexports ${Array.from(
+							alreadyVisited,
+							e =>
+								`"${e.module.readableIdentifier(requestShortener)}".${
+									e.exportName
+								}`
+						).join(
+							" --> "
+						)} -(circular)-> "${reexport.module.readableIdentifier(
+							requestShortener
+						)}".${reexport.exportName}`
+					);
+				}
+				alreadyVisited.add(reexport);
+				const refInfo = moduleToInfoMap.get(reexport.module);
+				if (refInfo) {
+					// module is in the concatenation
+					return getFinalName(
+						refInfo,
+						reexport.exportName,
+						moduleToInfoMap,
+						requestShortener,
+						asCall,
+						strictHarmonyModule,
+						alreadyVisited
+					);
+				}
+			}
+			const problem =
+				`Cannot get final name for export "${exportName}" in "${info.module.readableIdentifier(
+					requestShortener
+				)}"` +
+				` (known exports: ${Array.from(info.exportMap.keys())
+					.filter(name => name !== true)
+					.join(" ")}, ` +
+				`known reexports: ${Array.from(info.reexportMap.keys()).join(" ")})`;
+			return `${Template.toNormalComment(problem)} undefined`;
+		}
+		case "external": {
+			const importedModule = info.module;
+			return getExternalImport(
+				importedModule,
+				info,
+				exportName,
+				asCall,
+				strictHarmonyModule
+			);
+		}
+	}
+};
+
+const addScopeSymbols1 = (s, nameSet, scopeSet) => {
+	let scope = s;
+	while (scope) {
+		if (scopeSet.has(scope)) break;
+		scopeSet.add(scope);
+		for (const variable of scope.variables) {
+			nameSet.add(variable.name);
+		}
+		scope = scope.upper;
+	}
+};
+
+const addScopeSymbols2 = (s, nameSet, scopeSet1, scopeSet2) => {
+	let scope = s;
+	while (scope) {
+		if (scopeSet1.has(scope)) break;
+		if (scopeSet2.has(scope)) break;
+		scopeSet1.add(scope);
+		for (const variable of scope.variables) {
+			nameSet.add(variable.name);
+		}
+		scope = scope.upper;
+	}
+};
+
+const getAllReferences = variable => {
+	let set = variable.references;
+	// Look for inner scope variables too (like in class Foo { t() { Foo } })
+	const identifiers = new Set(variable.identifiers);
+	for (const scope of variable.scope.childScopes) {
+		for (const innerVar of scope.variables) {
+			if (innerVar.identifiers.some(id => identifiers.has(id))) {
+				set = set.concat(innerVar.references);
+				break;
+			}
+		}
+	}
+	return set;
+};
+
+const getPathInAst = (ast, node) => {
+	if (ast === node) {
+		return [];
+	}
+
+	const nr = node.range;
+
+	const enterNode = n => {
+		if (!n) return undefined;
+		const r = n.range;
+		if (r) {
+			if (r[0] <= nr[0] && r[1] >= nr[1]) {
+				const path = getPathInAst(n, node);
+				if (path) {
+					path.push(n);
+					return path;
+				}
+			}
+		}
+		return undefined;
+	};
+
+	var i;
+	if (Array.isArray(ast)) {
+		for (i = 0; i < ast.length; i++) {
+			const enterResult = enterNode(ast[i]);
+			if (enterResult !== undefined) return enterResult;
+		}
+	} else if (ast && typeof ast === "object") {
+		const keys = Object.keys(ast);
+		for (i = 0; i < keys.length; i++) {
+			const value = ast[keys[i]];
+			if (Array.isArray(value)) {
+				const pathResult = getPathInAst(value, node);
+				if (pathResult !== undefined) return pathResult;
+			} else if (value && typeof value === "object") {
+				const enterResult = enterNode(value);
+				if (enterResult !== undefined) return enterResult;
+			}
+		}
+	}
+};
+
+const getHarmonyExportImportedSpecifierDependencyExports = dep => {
+	const importModule = dep._module;
+	if (!importModule) return [];
+	if (dep._id) {
+		// export { named } from "module"
+		return [
+			{
+				name: dep.name,
+				id: dep._id,
+				module: importModule
+			}
+		];
+	}
+	if (dep.name) {
+		// export * as abc from "module"
+		return [
+			{
+				name: dep.name,
+				id: true,
+				module: importModule
+			}
+		];
+	}
+	// export * from "module"
+	return importModule.buildMeta.providedExports
+		.filter(exp => exp !== "default" && !dep.activeExports.has(exp))
+		.map(exp => {
+			return {
+				name: exp,
+				id: exp,
+				module: importModule
+			};
+		});
+};
+
+class ConcatenatedModule extends Module {
+	constructor(rootModule, modules, concatenationList) {
+		super("javascript/esm", null);
+		super.setChunks(rootModule._chunks);
+
+		// Info from Factory
+		this.rootModule = rootModule;
+		this.factoryMeta = rootModule.factoryMeta;
+
+		// Info from Compilation
+		this.index = rootModule.index;
+		this.index2 = rootModule.index2;
+		this.depth = rootModule.depth;
+
+		// Info from Optimization
+		this.used = rootModule.used;
+		this.usedExports = rootModule.usedExports;
+
+		// Info from Build
+		this.buildInfo = {
+			strict: true,
+			cacheable: modules.every(m => m.buildInfo.cacheable),
+			moduleArgument: rootModule.buildInfo.moduleArgument,
+			exportsArgument: rootModule.buildInfo.exportsArgument,
+			fileDependencies: new Set(),
+			contextDependencies: new Set(),
+			assets: undefined
+		};
+		this.built = modules.some(m => m.built);
+		this.buildMeta = rootModule.buildMeta;
+
+		// Caching
+		this._numberOfConcatenatedModules = modules.length;
+
+		// Graph
+		const modulesSet = new Set(modules);
+		this.reasons = rootModule.reasons.filter(
+			reason =>
+				!(reason.dependency instanceof HarmonyImportDependency) ||
+				!modulesSet.has(reason.module)
+		);
+
+		this.dependencies = [];
+		this.blocks = [];
+
+		this.warnings = [];
+		this.errors = [];
+		this._orderedConcatenationList =
+			concatenationList ||
+			ConcatenatedModule.createConcatenationList(rootModule, modulesSet, null);
+		for (const info of this._orderedConcatenationList) {
+			if (info.type === "concatenated") {
+				const m = info.module;
+
+				// populate dependencies
+				for (const d of m.dependencies.filter(
+					dep =>
+						!(dep instanceof HarmonyImportDependency) ||
+						!modulesSet.has(dep._module)
+				)) {
+					this.dependencies.push(d);
+				}
+				// populate blocks
+				for (const d of m.blocks) {
+					this.blocks.push(d);
+				}
+				// populate file dependencies
+				if (m.buildInfo.fileDependencies) {
+					for (const file of m.buildInfo.fileDependencies) {
+						this.buildInfo.fileDependencies.add(file);
+					}
+				}
+				// populate context dependencies
+				if (m.buildInfo.contextDependencies) {
+					for (const context of m.buildInfo.contextDependencies) {
+						this.buildInfo.contextDependencies.add(context);
+					}
+				}
+				// populate warnings
+				for (const warning of m.warnings) {
+					this.warnings.push(warning);
+				}
+				// populate errors
+				for (const error of m.errors) {
+					this.errors.push(error);
+				}
+
+				if (m.buildInfo.assets) {
+					if (this.buildInfo.assets === undefined) {
+						this.buildInfo.assets = Object.create(null);
+					}
+					Object.assign(this.buildInfo.assets, m.buildInfo.assets);
+				}
+				if (m.buildInfo.assetsInfo) {
+					if (this.buildInfo.assetsInfo === undefined) {
+						this.buildInfo.assetsInfo = new Map();
+					}
+					for (const [key, value] of m.buildInfo.assetsInfo) {
+						this.buildInfo.assetsInfo.set(key, value);
+					}
+				}
+			}
+		}
+		this._identifier = this._createIdentifier();
+	}
+
+	get modules() {
+		return this._orderedConcatenationList
+			.filter(info => info.type === "concatenated")
+			.map(info => info.module);
+	}
+
+	identifier() {
+		return this._identifier;
+	}
+
+	readableIdentifier(requestShortener) {
+		return (
+			this.rootModule.readableIdentifier(requestShortener) +
+			` + ${this._numberOfConcatenatedModules - 1} modules`
+		);
+	}
+
+	libIdent(options) {
+		return this.rootModule.libIdent(options);
+	}
+
+	nameForCondition() {
+		return this.rootModule.nameForCondition();
+	}
+
+	build(options, compilation, resolver, fs, callback) {
+		throw new Error("Cannot build this module. It should be already built.");
+	}
+
+	size() {
+		// Guess size from embedded modules
+		return this._orderedConcatenationList.reduce((sum, info) => {
+			switch (info.type) {
+				case "concatenated":
+					return sum + info.module.size();
+				case "external":
+					return sum + 5;
+			}
+			return sum;
+		}, 0);
+	}
+
+	/**
+	 * @param {Module} rootModule the root of the concatenation
+	 * @param {Set<Module>} modulesSet a set of modules which should be concatenated
+	 * @param {Compilation} compilation the compilation context
+	 * @returns {ConcatenationEntry[]} concatenation list
+	 */
+	static createConcatenationList(rootModule, modulesSet, compilation) {
+		const list = [];
+		const set = new Set();
+
+		/**
+		 * @param {Module} module a module
+		 * @returns {(function(): Module)[]} imported modules in order
+		 */
+		const getConcatenatedImports = module => {
+			/** @type {WeakMap<DependencyReference, Dependency>} */
+			const map = new WeakMap();
+			const references = module.dependencies
+				.filter(dep => dep instanceof HarmonyImportDependency)
+				.map(dep => {
+					const ref = compilation.getDependencyReference(module, dep);
+					if (ref) map.set(ref, dep);
+					return ref;
+				})
+				.filter(ref => ref);
+			DependencyReference.sort(references);
+			// TODO webpack 5: remove this hack, see also DependencyReference
+			return references.map(ref => {
+				const dep = map.get(ref);
+				return () => compilation.getDependencyReference(module, dep).module;
+			});
+		};
+
+		const enterModule = getModule => {
+			const module = getModule();
+			if (!module) return;
+			if (set.has(module)) return;
+			set.add(module);
+			if (modulesSet.has(module)) {
+				const imports = getConcatenatedImports(module);
+				imports.forEach(enterModule);
+				list.push({
+					type: "concatenated",
+					module
+				});
+			} else {
+				list.push({
+					type: "external",
+					get module() {
+						// We need to use a getter here, because the module in the dependency
+						// could be replaced by some other process (i. e. also replaced with a
+						// concatenated module)
+						return getModule();
+					}
+				});
+			}
+		};
+
+		enterModule(() => rootModule);
+
+		return list;
+	}
+
+	_createIdentifier() {
+		let orderedConcatenationListIdentifiers = "";
+		for (let i = 0; i < this._orderedConcatenationList.length; i++) {
+			if (this._orderedConcatenationList[i].type === "concatenated") {
+				orderedConcatenationListIdentifiers += this._orderedConcatenationList[
+					i
+				].module.identifier();
+				orderedConcatenationListIdentifiers += " ";
+			}
+		}
+		const hash = createHash("md4");
+		hash.update(orderedConcatenationListIdentifiers);
+		return this.rootModule.identifier() + " " + hash.digest("hex");
+	}
+
+	source(dependencyTemplates, runtimeTemplate) {
+		const requestShortener = runtimeTemplate.requestShortener;
+		// Metainfo for each module
+		const modulesWithInfo = this._orderedConcatenationList.map((info, idx) => {
+			switch (info.type) {
+				case "concatenated": {
+					const exportMap = new Map();
+					const reexportMap = new Map();
+					for (const dep of info.module.dependencies) {
+						if (dep instanceof HarmonyExportSpecifierDependency) {
+							if (!exportMap.has(dep.name)) {
+								exportMap.set(dep.name, dep.id);
+							}
+						} else if (dep instanceof HarmonyExportExpressionDependency) {
+							if (!exportMap.has("default")) {
+								exportMap.set("default", "__WEBPACK_MODULE_DEFAULT_EXPORT__");
+							}
+						} else if (
+							dep instanceof HarmonyExportImportedSpecifierDependency
+						) {
+							const exportName = dep.name;
+							const importName = dep._id;
+							const importedModule = dep._module;
+							if (exportName && importName) {
+								if (!reexportMap.has(exportName)) {
+									reexportMap.set(exportName, {
+										module: importedModule,
+										exportName: importName,
+										dependency: dep
+									});
+								}
+							} else if (exportName) {
+								if (!reexportMap.has(exportName)) {
+									reexportMap.set(exportName, {
+										module: importedModule,
+										exportName: true,
+										dependency: dep
+									});
+								}
+							} else if (importedModule) {
+								for (const name of importedModule.buildMeta.providedExports) {
+									if (dep.activeExports.has(name) || name === "default") {
+										continue;
+									}
+									if (!reexportMap.has(name)) {
+										reexportMap.set(name, {
+											module: importedModule,
+											exportName: name,
+											dependency: dep
+										});
+									}
+								}
+							}
+						}
+					}
+					return {
+						type: "concatenated",
+						module: info.module,
+						index: idx,
+						ast: undefined,
+						internalSource: undefined,
+						source: undefined,
+						globalScope: undefined,
+						moduleScope: undefined,
+						internalNames: new Map(),
+						globalExports: new Set(),
+						exportMap: exportMap,
+						reexportMap: reexportMap,
+						hasNamespaceObject: false,
+						namespaceObjectSource: null
+					};
+				}
+				case "external":
+					return {
+						type: "external",
+						module: info.module,
+						index: idx,
+						name: undefined,
+						interopNamespaceObjectUsed: false,
+						interopNamespaceObjectName: undefined,
+						interopDefaultAccessUsed: false,
+						interopDefaultAccessName: undefined
+					};
+				default:
+					throw new Error(`Unsupported concatenation entry type ${info.type}`);
+			}
+		});
+
+		// Create mapping from module to info
+		const moduleToInfoMap = new Map();
+		for (const m of modulesWithInfo) {
+			moduleToInfoMap.set(m.module, m);
+		}
+
+		// Configure template decorators for dependencies
+		const innerDependencyTemplates = new Map(dependencyTemplates);
+
+		innerDependencyTemplates.set(
+			HarmonyImportSpecifierDependency,
+			new HarmonyImportSpecifierDependencyConcatenatedTemplate(
+				dependencyTemplates.get(HarmonyImportSpecifierDependency),
+				moduleToInfoMap
+			)
+		);
+		innerDependencyTemplates.set(
+			HarmonyImportSideEffectDependency,
+			new HarmonyImportSideEffectDependencyConcatenatedTemplate(
+				dependencyTemplates.get(HarmonyImportSideEffectDependency),
+				moduleToInfoMap
+			)
+		);
+		innerDependencyTemplates.set(
+			HarmonyExportSpecifierDependency,
+			new NullTemplate()
+		);
+		innerDependencyTemplates.set(
+			HarmonyExportExpressionDependency,
+			new HarmonyExportExpressionDependencyConcatenatedTemplate(
+				dependencyTemplates.get(HarmonyExportExpressionDependency),
+				this.rootModule
+			)
+		);
+		innerDependencyTemplates.set(
+			HarmonyExportImportedSpecifierDependency,
+			new NullTemplate()
+		);
+		innerDependencyTemplates.set(
+			HarmonyCompatibilityDependency,
+			new NullTemplate()
+		);
+
+		// Must use full identifier in our cache here to ensure that the source
+		// is updated should our dependencies list change.
+		// TODO webpack 5 refactor
+		innerDependencyTemplates.set(
+			"hash",
+			innerDependencyTemplates.get("hash") + this.identifier()
+		);
+
+		// Generate source code and analyse scopes
+		// Prepare a ReplaceSource for the final source
+		for (const info of modulesWithInfo) {
+			if (info.type === "concatenated") {
+				const m = info.module;
+				const source = m.source(innerDependencyTemplates, runtimeTemplate);
+				const code = source.source();
+				let ast;
+				try {
+					ast = Parser.parse(code, {
+						sourceType: "module"
+					});
+				} catch (err) {
+					if (
+						err.loc &&
+						typeof err.loc === "object" &&
+						typeof err.loc.line === "number"
+					) {
+						const lineNumber = err.loc.line;
+						const lines = code.split("\n");
+						err.message +=
+							"\n| " +
+							lines
+								.slice(Math.max(0, lineNumber - 3), lineNumber + 2)
+								.join("\n| ");
+					}
+					throw err;
+				}
+				const scopeManager = eslintScope.analyze(ast, {
+					ecmaVersion: 6,
+					sourceType: "module",
+					optimistic: true,
+					ignoreEval: true,
+					impliedStrict: true
+				});
+				const globalScope = scopeManager.acquire(ast);
+				const moduleScope = globalScope.childScopes[0];
+				const resultSource = new ReplaceSource(source);
+				info.ast = ast;
+				info.internalSource = source;
+				info.source = resultSource;
+				info.globalScope = globalScope;
+				info.moduleScope = moduleScope;
+			}
+		}
+
+		// List of all used names to avoid conflicts
+		const allUsedNames = new Set([
+			"__WEBPACK_MODULE_DEFAULT_EXPORT__", // avoid using this internal name
+
+			"abstract",
+			"arguments",
+			"async",
+			"await",
+			"boolean",
+			"break",
+			"byte",
+			"case",
+			"catch",
+			"char",
+			"class",
+			"const",
+			"continue",
+			"debugger",
+			"default",
+			"delete",
+			"do",
+			"double",
+			"else",
+			"enum",
+			"eval",
+			"export",
+			"extends",
+			"false",
+			"final",
+			"finally",
+			"float",
+			"for",
+			"function",
+			"goto",
+			"if",
+			"implements",
+			"import",
+			"in",
+			"instanceof",
+			"int",
+			"interface",
+			"let",
+			"long",
+			"native",
+			"new",
+			"null",
+			"package",
+			"private",
+			"protected",
+			"public",
+			"return",
+			"short",
+			"static",
+			"super",
+			"switch",
+			"synchronized",
+			"this",
+			"throw",
+			"throws",
+			"transient",
+			"true",
+			"try",
+			"typeof",
+			"var",
+			"void",
+			"volatile",
+			"while",
+			"with",
+			"yield",
+
+			"module",
+			"__dirname",
+			"__filename",
+			"exports",
+
+			"Array",
+			"Date",
+			"eval",
+			"function",
+			"hasOwnProperty",
+			"Infinity",
+			"isFinite",
+			"isNaN",
+			"isPrototypeOf",
+			"length",
+			"Math",
+			"NaN",
+			"name",
+			"Number",
+			"Object",
+			"prototype",
+			"String",
+			"toString",
+			"undefined",
+			"valueOf",
+
+			"alert",
+			"all",
+			"anchor",
+			"anchors",
+			"area",
+			"assign",
+			"blur",
+			"button",
+			"checkbox",
+			"clearInterval",
+			"clearTimeout",
+			"clientInformation",
+			"close",
+			"closed",
+			"confirm",
+			"constructor",
+			"crypto",
+			"decodeURI",
+			"decodeURIComponent",
+			"defaultStatus",
+			"document",
+			"element",
+			"elements",
+			"embed",
+			"embeds",
+			"encodeURI",
+			"encodeURIComponent",
+			"escape",
+			"event",
+			"fileUpload",
+			"focus",
+			"form",
+			"forms",
+			"frame",
+			"innerHeight",
+			"innerWidth",
+			"layer",
+			"layers",
+			"link",
+			"location",
+			"mimeTypes",
+			"navigate",
+			"navigator",
+			"frames",
+			"frameRate",
+			"hidden",
+			"history",
+			"image",
+			"images",
+			"offscreenBuffering",
+			"open",
+			"opener",
+			"option",
+			"outerHeight",
+			"outerWidth",
+			"packages",
+			"pageXOffset",
+			"pageYOffset",
+			"parent",
+			"parseFloat",
+			"parseInt",
+			"password",
+			"pkcs11",
+			"plugin",
+			"prompt",
+			"propertyIsEnum",
+			"radio",
+			"reset",
+			"screenX",
+			"screenY",
+			"scroll",
+			"secure",
+			"select",
+			"self",
+			"setInterval",
+			"setTimeout",
+			"status",
+			"submit",
+			"taint",
+			"text",
+			"textarea",
+			"top",
+			"unescape",
+			"untaint",
+			"window",
+
+			"onblur",
+			"onclick",
+			"onerror",
+			"onfocus",
+			"onkeydown",
+			"onkeypress",
+			"onkeyup",
+			"onmouseover",
+			"onload",
+			"onmouseup",
+			"onmousedown",
+			"onsubmit"
+		]);
+
+		// Set of already checked scopes
+		const alreadyCheckedScopes = new Set();
+
+		// get all global names
+		for (const info of modulesWithInfo) {
+			const superClassExpressions = [];
+
+			// ignore symbols from moduleScope
+			if (info.moduleScope) {
+				alreadyCheckedScopes.add(info.moduleScope);
+
+				// The super class expression in class scopes behaves weird
+				// We store ranges of all super class expressions to make
+				// renaming to work correctly
+				for (const childScope of info.moduleScope.childScopes) {
+					if (childScope.type !== "class") continue;
+					if (!childScope.block.superClass) continue;
+					superClassExpressions.push({
+						range: childScope.block.superClass.range,
+						variables: childScope.variables
+					});
+				}
+			}
+
+			// add global symbols
+			if (info.globalScope) {
+				for (const reference of info.globalScope.through) {
+					const name = reference.identifier.name;
+					if (
+						/^__WEBPACK_MODULE_REFERENCE__\d+_([\da-f]+|ns)(_call)?(_strict)?__$/.test(
+							name
+						)
+					) {
+						for (const expr of superClassExpressions) {
+							if (
+								expr.range[0] <= reference.identifier.range[0] &&
+								expr.range[1] >= reference.identifier.range[1]
+							) {
+								for (const variable of expr.variables) {
+									allUsedNames.add(variable.name);
+								}
+							}
+						}
+						addScopeSymbols1(
+							reference.from,
+							allUsedNames,
+							alreadyCheckedScopes
+						);
+					} else {
+						allUsedNames.add(name);
+					}
+				}
+			}
+
+			// add exported globals
+			if (info.type === "concatenated") {
+				const variables = new Set();
+				for (const variable of info.moduleScope.variables) {
+					variables.add(variable.name);
+				}
+				for (const [, variable] of info.exportMap) {
+					if (!variables.has(variable)) {
+						info.globalExports.add(variable);
+					}
+				}
+			}
+		}
+
+		// generate names for symbols
+		for (const info of modulesWithInfo) {
+			switch (info.type) {
+				case "concatenated": {
+					const namespaceObjectName = this.findNewName(
+						"namespaceObject",
+						allUsedNames,
+						null,
+						info.module.readableIdentifier(requestShortener)
+					);
+					allUsedNames.add(namespaceObjectName);
+					info.internalNames.set(namespaceObjectName, namespaceObjectName);
+					info.exportMap.set(true, namespaceObjectName);
+					for (const variable of info.moduleScope.variables) {
+						const name = variable.name;
+						if (allUsedNames.has(name)) {
+							const references = getAllReferences(variable);
+							const symbolsInReferences = new Set();
+							const alreadyCheckedInnerScopes = new Set();
+							for (const ref of references) {
+								addScopeSymbols2(
+									ref.from,
+									symbolsInReferences,
+									alreadyCheckedInnerScopes,
+									alreadyCheckedScopes
+								);
+							}
+							const newName = this.findNewName(
+								name,
+								allUsedNames,
+								symbolsInReferences,
+								info.module.readableIdentifier(requestShortener)
+							);
+							allUsedNames.add(newName);
+							info.internalNames.set(name, newName);
+							const source = info.source;
+							const allIdentifiers = new Set(
+								references.map(r => r.identifier).concat(variable.identifiers)
+							);
+							for (const identifier of allIdentifiers) {
+								const r = identifier.range;
+								const path = getPathInAst(info.ast, identifier);
+								if (
+									path &&
+									path.length > 1 &&
+									path[1].type === "Property" &&
+									path[1].shorthand
+								) {
+									source.insert(r[1], `: ${newName}`);
+								} else {
+									source.replace(r[0], r[1] - 1, newName);
+								}
+							}
+						} else {
+							allUsedNames.add(name);
+							info.internalNames.set(name, name);
+						}
+					}
+					break;
+				}
+				case "external": {
+					const externalName = this.findNewName(
+						"",
+						allUsedNames,
+						null,
+						info.module.readableIdentifier(requestShortener)
+					);
+					allUsedNames.add(externalName);
+					info.name = externalName;
+					if (
+						info.module.buildMeta.exportsType === "named" ||
+						!info.module.buildMeta.exportsType
+					) {
+						const externalNameInterop = this.findNewName(
+							"namespaceObject",
+							allUsedNames,
+							null,
+							info.module.readableIdentifier(requestShortener)
+						);
+						allUsedNames.add(externalNameInterop);
+						info.interopNamespaceObjectName = externalNameInterop;
+					}
+					if (!info.module.buildMeta.exportsType) {
+						const externalNameInterop = this.findNewName(
+							"default",
+							allUsedNames,
+							null,
+							info.module.readableIdentifier(requestShortener)
+						);
+						allUsedNames.add(externalNameInterop);
+						info.interopDefaultAccessName = externalNameInterop;
+					}
+					break;
+				}
+			}
+		}
+
+		// Find and replace referenced to modules
+		for (const info of modulesWithInfo) {
+			if (info.type === "concatenated") {
+				for (const reference of info.globalScope.through) {
+					const name = reference.identifier.name;
+					const match = /^__WEBPACK_MODULE_REFERENCE__(\d+)_([\da-f]+|ns)(_call)?(_strict)?__$/.exec(
+						name
+					);
+					if (match) {
+						const referencedModule = modulesWithInfo[+match[1]];
+						let exportName;
+						if (match[2] === "ns") {
+							exportName = true;
+						} else {
+							const exportData = match[2];
+							exportName = Buffer.from(exportData, "hex").toString("utf-8");
+						}
+						const asCall = !!match[3];
+						const strictHarmonyModule = !!match[4];
+						const finalName = getFinalName(
+							referencedModule,
+							exportName,
+							moduleToInfoMap,
+							requestShortener,
+							asCall,
+							strictHarmonyModule
+						);
+						const r = reference.identifier.range;
+						const source = info.source;
+						source.replace(r[0], r[1] - 1, finalName);
+					}
+				}
+			}
+		}
+
+		// Map with all root exposed used exports
+		/** @type {Map<string, function(RequestShortener): string>} */
+		const exportsMap = new Map();
+
+		// Set with all root exposed unused exports
+		/** @type {Set<string>} */
+		const unusedExports = new Set();
+
+		for (const dep of this.rootModule.dependencies) {
+			if (dep instanceof HarmonyExportSpecifierDependency) {
+				const used = this.rootModule.isUsed(dep.name);
+				if (used) {
+					const info = moduleToInfoMap.get(this.rootModule);
+					if (!exportsMap.has(used)) {
+						exportsMap.set(
+							used,
+							() => `/* binding */ ${info.internalNames.get(dep.id)}`
+						);
+					}
+				} else {
+					unusedExports.add(dep.name || "namespace");
+				}
+			} else if (dep instanceof HarmonyExportImportedSpecifierDependency) {
+				const exportDefs = getHarmonyExportImportedSpecifierDependencyExports(
+					dep
+				);
+				for (const def of exportDefs) {
+					const info = moduleToInfoMap.get(def.module);
+					const used = dep.originModule.isUsed(def.name);
+					if (used) {
+						if (!exportsMap.has(used)) {
+							exportsMap.set(used, requestShortener => {
+								const finalName = getFinalName(
+									info,
+									def.id,
+									moduleToInfoMap,
+									requestShortener,
+									false,
+									this.rootModule.buildMeta.strictHarmonyModule
+								);
+								return `/* reexport */ ${finalName}`;
+							});
+						}
+					} else {
+						unusedExports.add(def.name);
+					}
+				}
+			}
+		}
+
+		const result = new ConcatSource();
+
+		// add harmony compatibility flag (must be first because of possible circular dependencies)
+		const usedExports = this.rootModule.usedExports;
+		if (usedExports === true || usedExports === null) {
+			result.add(`// ESM COMPAT FLAG\n`);
+			result.add(
+				runtimeTemplate.defineEsModuleFlagStatement({
+					exportsArgument: this.exportsArgument
+				})
+			);
+		}
+
+		// define exports
+		if (exportsMap.size > 0) {
+			result.add(`\n// EXPORTS\n`);
+			for (const [key, value] of exportsMap) {
+				result.add(
+					`__webpack_require__.d(${this.exportsArgument}, ${JSON.stringify(
+						key
+					)}, function() { return ${value(requestShortener)}; });\n`
+				);
+			}
+		}
+
+		// list unused exports
+		if (unusedExports.size > 0) {
+			result.add(
+				`\n// UNUSED EXPORTS: ${joinIterableWithComma(unusedExports)}\n`
+			);
+		}
+
+		// define required namespace objects (must be before evaluation modules)
+		for (const info of modulesWithInfo) {
+			if (info.namespaceObjectSource) {
+				result.add(
+					`\n// NAMESPACE OBJECT: ${info.module.readableIdentifier(
+						requestShortener
+					)}\n`
+				);
+				result.add(info.namespaceObjectSource);
+			}
+		}
+
+		// evaluate modules in order
+		for (const info of modulesWithInfo) {
+			switch (info.type) {
+				case "concatenated":
+					result.add(
+						`\n// CONCATENATED MODULE: ${info.module.readableIdentifier(
+							requestShortener
+						)}\n`
+					);
+					result.add(info.source);
+					break;
+				case "external":
+					result.add(
+						`\n// EXTERNAL MODULE: ${info.module.readableIdentifier(
+							requestShortener
+						)}\n`
+					);
+					result.add(
+						`var ${info.name} = __webpack_require__(${JSON.stringify(
+							info.module.id
+						)});\n`
+					);
+					if (info.interopNamespaceObjectUsed) {
+						if (info.module.buildMeta.exportsType === "named") {
+							result.add(
+								`var ${info.interopNamespaceObjectName} = /*#__PURE__*/__webpack_require__.t(${info.name}, 2);\n`
+							);
+						} else if (!info.module.buildMeta.exportsType) {
+							result.add(
+								`var ${info.interopNamespaceObjectName} = /*#__PURE__*/__webpack_require__.t(${info.name});\n`
+							);
+						}
+					}
+					if (info.interopDefaultAccessUsed) {
+						result.add(
+							`var ${info.interopDefaultAccessName} = /*#__PURE__*/__webpack_require__.n(${info.name});\n`
+						);
+					}
+					break;
+				default:
+					throw new Error(`Unsupported concatenation entry type ${info.type}`);
+			}
+		}
+
+		return result;
+	}
+
+	findNewName(oldName, usedNamed1, usedNamed2, extraInfo) {
+		let name = oldName;
+
+		if (name === "__WEBPACK_MODULE_DEFAULT_EXPORT__") name = "";
+
+		// Remove uncool stuff
+		extraInfo = extraInfo.replace(
+			/\.+\/|(\/index)?\.([a-zA-Z0-9]{1,4})($|\s|\?)|\s*\+\s*\d+\s*modules/g,
+			""
+		);
+
+		const splittedInfo = extraInfo.split("/");
+		while (splittedInfo.length) {
+			name = splittedInfo.pop() + (name ? "_" + name : "");
+			const nameIdent = Template.toIdentifier(name);
+			if (
+				!usedNamed1.has(nameIdent) &&
+				(!usedNamed2 || !usedNamed2.has(nameIdent))
+			)
+				return nameIdent;
+		}
+
+		let i = 0;
+		let nameWithNumber = Template.toIdentifier(`${name}_${i}`);
+		while (
+			usedNamed1.has(nameWithNumber) ||
+			(usedNamed2 && usedNamed2.has(nameWithNumber))
+		) {
+			i++;
+			nameWithNumber = Template.toIdentifier(`${name}_${i}`);
+		}
+		return nameWithNumber;
+	}
+
+	/**
+	 * @param {Hash} hash the hash used to track dependencies
+	 * @returns {void}
+	 */
+	updateHash(hash) {
+		for (const info of this._orderedConcatenationList) {
+			switch (info.type) {
+				case "concatenated":
+					info.module.updateHash(hash);
+					break;
+				case "external":
+					hash.update(`${info.module.id}`);
+					break;
+			}
+		}
+		super.updateHash(hash);
+	}
+}
+
+class HarmonyImportSpecifierDependencyConcatenatedTemplate {
+	constructor(originalTemplate, modulesMap) {
+		this.originalTemplate = originalTemplate;
+		this.modulesMap = modulesMap;
+	}
+
+	getHarmonyInitOrder(dep) {
+		const module = dep._module;
+		const info = this.modulesMap.get(module);
+		if (!info) {
+			return this.originalTemplate.getHarmonyInitOrder(dep);
+		}
+		return NaN;
+	}
+
+	harmonyInit(dep, source, runtimeTemplate, dependencyTemplates) {
+		const module = dep._module;
+		const info = this.modulesMap.get(module);
+		if (!info) {
+			this.originalTemplate.harmonyInit(
+				dep,
+				source,
+				runtimeTemplate,
+				dependencyTemplates
+			);
+			return;
+		}
+	}
+
+	apply(dep, source, runtime, dependencyTemplates) {
+		const module = dep._module;
+		const info = this.modulesMap.get(module);
+		if (!info) {
+			this.originalTemplate.apply(dep, source, runtime, dependencyTemplates);
+			return;
+		}
+		let content;
+		const callFlag = dep.call ? "_call" : "";
+		const strictFlag = dep.originModule.buildMeta.strictHarmonyModule
+			? "_strict"
+			: "";
+		if (dep._id === null) {
+			content = `__WEBPACK_MODULE_REFERENCE__${info.index}_ns${strictFlag}__`;
+		} else if (dep.namespaceObjectAsContext) {
+			content = `__WEBPACK_MODULE_REFERENCE__${
+				info.index
+			}_ns${strictFlag}__[${JSON.stringify(dep._id)}]`;
+		} else {
+			const exportData = Buffer.from(dep._id, "utf-8").toString("hex");
+			content = `__WEBPACK_MODULE_REFERENCE__${info.index}_${exportData}${callFlag}${strictFlag}__`;
+		}
+		if (dep.shorthand) {
+			content = dep.name + ": " + content;
+		}
+		source.replace(dep.range[0], dep.range[1] - 1, content);
+	}
+}
+
+class HarmonyImportSideEffectDependencyConcatenatedTemplate {
+	constructor(originalTemplate, modulesMap) {
+		this.originalTemplate = originalTemplate;
+		this.modulesMap = modulesMap;
+	}
+
+	getHarmonyInitOrder(dep) {
+		const module = dep._module;
+		const info = this.modulesMap.get(module);
+		if (!info) {
+			return this.originalTemplate.getHarmonyInitOrder(dep);
+		}
+		return NaN;
+	}
+
+	harmonyInit(dep, source, runtime, dependencyTemplates) {
+		const module = dep._module;
+		const info = this.modulesMap.get(module);
+		if (!info) {
+			this.originalTemplate.harmonyInit(
+				dep,
+				source,
+				runtime,
+				dependencyTemplates
+			);
+			return;
+		}
+	}
+
+	apply(dep, source, runtime, dependencyTemplates) {
+		const module = dep._module;
+		const info = this.modulesMap.get(module);
+		if (!info) {
+			this.originalTemplate.apply(dep, source, runtime, dependencyTemplates);
+			return;
+		}
+	}
+}
+
+class HarmonyExportExpressionDependencyConcatenatedTemplate {
+	constructor(originalTemplate, rootModule) {
+		this.originalTemplate = originalTemplate;
+		this.rootModule = rootModule;
+	}
+
+	apply(dep, source, runtime, dependencyTemplates) {
+		let content =
+			"/* harmony default export */ var __WEBPACK_MODULE_DEFAULT_EXPORT__ = ";
+		if (dep.originModule === this.rootModule) {
+			const used = dep.originModule.isUsed("default");
+			const exportsName = dep.originModule.exportsArgument;
+			if (used) content += `${exportsName}[${JSON.stringify(used)}] = `;
+		}
+
+		if (dep.range) {
+			source.replace(
+				dep.rangeStatement[0],
+				dep.range[0] - 1,
+				content + "(" + dep.prefix
+			);
+			source.replace(dep.range[1], dep.rangeStatement[1] - 1, ");");
+			return;
+		}
+
+		source.replace(
+			dep.rangeStatement[0],
+			dep.rangeStatement[1] - 1,
+			content + dep.prefix
+		);
+	}
+}
+
+class NullTemplate {
+	apply() {}
+}
+
+module.exports = ConcatenatedModule;
diff --git a/node_modules/webpack/lib/optimize/EnsureChunkConditionsPlugin.js b/node_modules/webpack/lib/optimize/EnsureChunkConditionsPlugin.js
new file mode 100644
index 0000000..5d05ec8
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/EnsureChunkConditionsPlugin.js
@@ -0,0 +1,70 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const GraphHelpers = require("../GraphHelpers");
+
+class EnsureChunkConditionsPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"EnsureChunkConditionsPlugin",
+			compilation => {
+				const handler = chunks => {
+					let changed = false;
+					for (const module of compilation.modules) {
+						if (!module.chunkCondition) continue;
+						const sourceChunks = new Set();
+						const chunkGroups = new Set();
+						for (const chunk of module.chunksIterable) {
+							if (!module.chunkCondition(chunk)) {
+								sourceChunks.add(chunk);
+								for (const group of chunk.groupsIterable) {
+									chunkGroups.add(group);
+								}
+							}
+						}
+						if (sourceChunks.size === 0) continue;
+						const targetChunks = new Set();
+						chunkGroupLoop: for (const chunkGroup of chunkGroups) {
+							// Can module be placed in a chunk of this group?
+							for (const chunk of chunkGroup.chunks) {
+								if (module.chunkCondition(chunk)) {
+									targetChunks.add(chunk);
+									continue chunkGroupLoop;
+								}
+							}
+							// We reached the entrypoint: fail
+							if (chunkGroup.isInitial()) {
+								throw new Error(
+									"Cannot fullfil chunk condition of " + module.identifier()
+								);
+							}
+							// Try placing in all parents
+							for (const group of chunkGroup.parentsIterable) {
+								chunkGroups.add(group);
+							}
+						}
+						for (const sourceChunk of sourceChunks) {
+							GraphHelpers.disconnectChunkAndModule(sourceChunk, module);
+						}
+						for (const targetChunk of targetChunks) {
+							GraphHelpers.connectChunkAndModule(targetChunk, module);
+						}
+					}
+					if (changed) return true;
+				};
+				compilation.hooks.optimizeChunksBasic.tap(
+					"EnsureChunkConditionsPlugin",
+					handler
+				);
+				compilation.hooks.optimizeExtractedChunksBasic.tap(
+					"EnsureChunkConditionsPlugin",
+					handler
+				);
+			}
+		);
+	}
+}
+module.exports = EnsureChunkConditionsPlugin;
diff --git a/node_modules/webpack/lib/optimize/FlagIncludedChunksPlugin.js b/node_modules/webpack/lib/optimize/FlagIncludedChunksPlugin.js
new file mode 100644
index 0000000..1890f05
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/FlagIncludedChunksPlugin.js
@@ -0,0 +1,99 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class FlagIncludedChunksPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap("FlagIncludedChunksPlugin", compilation => {
+			compilation.hooks.optimizeChunkIds.tap(
+				"FlagIncludedChunksPlugin",
+				chunks => {
+					// prepare two bit integers for each module
+					// 2^31 is the max number represented as SMI in v8
+					// we want the bits distributed this way:
+					// the bit 2^31 is pretty rar and only one module should get it
+					// so it has a probability of 1 / modulesCount
+					// the first bit (2^0) is the easiest and every module could get it
+					// if it doesn't get a better bit
+					// from bit 2^n to 2^(n+1) there is a probability of p
+					// so 1 / modulesCount == p^31
+					// <=> p = sqrt31(1 / modulesCount)
+					// so we use a modulo of 1 / sqrt31(1 / modulesCount)
+					const moduleBits = new WeakMap();
+					const modulesCount = compilation.modules.length;
+
+					// precalculate the modulo values for each bit
+					const modulo = 1 / Math.pow(1 / modulesCount, 1 / 31);
+					const modulos = Array.from(
+						{ length: 31 },
+						(x, i) => Math.pow(modulo, i) | 0
+					);
+
+					// iterate all modules to generate bit values
+					let i = 0;
+					for (const module of compilation.modules) {
+						let bit = 30;
+						while (i % modulos[bit] !== 0) {
+							bit--;
+						}
+						moduleBits.set(module, 1 << bit);
+						i++;
+					}
+
+					// interate all chunks to generate bitmaps
+					const chunkModulesHash = new WeakMap();
+					for (const chunk of chunks) {
+						let hash = 0;
+						for (const module of chunk.modulesIterable) {
+							hash |= moduleBits.get(module);
+						}
+						chunkModulesHash.set(chunk, hash);
+					}
+
+					for (const chunkA of chunks) {
+						const chunkAHash = chunkModulesHash.get(chunkA);
+						const chunkAModulesCount = chunkA.getNumberOfModules();
+						if (chunkAModulesCount === 0) continue;
+						let bestModule = undefined;
+						for (const module of chunkA.modulesIterable) {
+							if (
+								bestModule === undefined ||
+								bestModule.getNumberOfChunks() > module.getNumberOfChunks()
+							)
+								bestModule = module;
+						}
+						loopB: for (const chunkB of bestModule.chunksIterable) {
+							// as we iterate the same iterables twice
+							// skip if we find ourselves
+							if (chunkA === chunkB) continue;
+
+							const chunkBModulesCount = chunkB.getNumberOfModules();
+
+							// ids for empty chunks are not included
+							if (chunkBModulesCount === 0) continue;
+
+							// instead of swapping A and B just bail
+							// as we loop twice the current A will be B and B then A
+							if (chunkAModulesCount > chunkBModulesCount) continue;
+
+							// is chunkA in chunkB?
+
+							// we do a cheap check for the hash value
+							const chunkBHash = chunkModulesHash.get(chunkB);
+							if ((chunkBHash & chunkAHash) !== chunkAHash) continue;
+
+							// compare all modules
+							for (const m of chunkA.modulesIterable) {
+								if (!chunkB.containsModule(m)) continue loopB;
+							}
+							chunkB.ids.push(chunkA.id);
+						}
+					}
+				}
+			);
+		});
+	}
+}
+module.exports = FlagIncludedChunksPlugin;
diff --git a/node_modules/webpack/lib/optimize/LimitChunkCountPlugin.js b/node_modules/webpack/lib/optimize/LimitChunkCountPlugin.js
new file mode 100644
index 0000000..87f2849
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/LimitChunkCountPlugin.js
@@ -0,0 +1,231 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const validateOptions = require("schema-utils");
+const schema = require("../../schemas/plugins/optimize/LimitChunkCountPlugin.json");
+const LazyBucketSortedSet = require("../util/LazyBucketSortedSet");
+
+/** @typedef {import("../../declarations/plugins/optimize/LimitChunkCountPlugin").LimitChunkCountPluginOptions} LimitChunkCountPluginOptions */
+/** @typedef {import("../Chunk")} Chunk */
+/** @typedef {import("../Compiler")} Compiler */
+
+/**
+ * @typedef {Object} ChunkCombination
+ * @property {boolean} deleted this is set to true when combination was removed
+ * @property {number} sizeDiff
+ * @property {number} integratedSize
+ * @property {Chunk} a
+ * @property {Chunk} b
+ * @property {number} aIdx
+ * @property {number} bIdx
+ * @property {number} aSize
+ * @property {number} bSize
+ */
+
+const addToSetMap = (map, key, value) => {
+	const set = map.get(key);
+	if (set === undefined) {
+		map.set(key, new Set([value]));
+	} else {
+		set.add(value);
+	}
+};
+
+class LimitChunkCountPlugin {
+	/**
+	 * @param {LimitChunkCountPluginOptions=} options options object
+	 */
+	constructor(options) {
+		if (!options) options = {};
+
+		validateOptions(schema, options, "Limit Chunk Count Plugin");
+		this.options = options;
+	}
+
+	/**
+	 * @param {Compiler} compiler the webpack compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		const options = this.options;
+		compiler.hooks.compilation.tap("LimitChunkCountPlugin", compilation => {
+			compilation.hooks.optimizeChunksAdvanced.tap(
+				"LimitChunkCountPlugin",
+				chunks => {
+					const maxChunks = options.maxChunks;
+					if (!maxChunks) return;
+					if (maxChunks < 1) return;
+					if (chunks.length <= maxChunks) return;
+
+					let remainingChunksToMerge = chunks.length - maxChunks;
+
+					// order chunks in a deterministic way
+					const orderedChunks = chunks.slice().sort((a, b) => a.compareTo(b));
+
+					// create a lazy sorted data structure to keep all combinations
+					// this is large. Size = chunks * (chunks - 1) / 2
+					// It uses a multi layer bucket sort plus normal sort in the last layer
+					// It's also lazy so only accessed buckets are sorted
+					const combinations = new LazyBucketSortedSet(
+						// Layer 1: ordered by largest size benefit
+						c => c.sizeDiff,
+						(a, b) => b - a,
+						// Layer 2: ordered by smallest combined size
+						c => c.integratedSize,
+						(a, b) => a - b,
+						// Layer 3: ordered by position difference in orderedChunk (-> to be deterministic)
+						c => c.bIdx - c.aIdx,
+						(a, b) => a - b,
+						// Layer 4: ordered by position in orderedChunk (-> to be deterministic)
+						(a, b) => a.bIdx - b.bIdx
+					);
+
+					// we keep a mappng from chunk to all combinations
+					// but this mapping is not kept up-to-date with deletions
+					// so `deleted` flag need to be considered when iterating this
+					/** @type {Map<Chunk, Set<ChunkCombination>>} */
+					const combinationsByChunk = new Map();
+
+					orderedChunks.forEach((b, bIdx) => {
+						// create combination pairs with size and integrated size
+						for (let aIdx = 0; aIdx < bIdx; aIdx++) {
+							const a = orderedChunks[aIdx];
+							const integratedSize = a.integratedSize(b, options);
+
+							// filter pairs that do not have an integratedSize
+							// meaning they can NOT be integrated!
+							if (integratedSize === false) continue;
+
+							const aSize = a.size(options);
+							const bSize = b.size(options);
+							const c = {
+								deleted: false,
+								sizeDiff: aSize + bSize - integratedSize,
+								integratedSize,
+								a,
+								b,
+								aIdx,
+								bIdx,
+								aSize,
+								bSize
+							};
+							combinations.add(c);
+							addToSetMap(combinationsByChunk, a, c);
+							addToSetMap(combinationsByChunk, b, c);
+						}
+						return combinations;
+					});
+
+					// list of modified chunks during this run
+					// combinations affected by this change are skipped to allow
+					// futher optimizations
+					/** @type {Set<Chunk>} */
+					const modifiedChunks = new Set();
+
+					let changed = false;
+					// eslint-disable-next-line no-constant-condition
+					loop: while (true) {
+						const combination = combinations.popFirst();
+						if (combination === undefined) break;
+
+						combination.deleted = true;
+						const { a, b, integratedSize } = combination;
+
+						// skip over pair when
+						// one of the already merged chunks is a parent of one of the chunks
+						if (modifiedChunks.size > 0) {
+							const queue = new Set(a.groupsIterable);
+							for (const group of b.groupsIterable) {
+								queue.add(group);
+							}
+							for (const group of queue) {
+								for (const mChunk of modifiedChunks) {
+									if (mChunk !== a && mChunk !== b && mChunk.isInGroup(group)) {
+										// This is a potential pair which needs recalculation
+										// We can't do that now, but it merge before following pairs
+										// so we leave space for it, and consider chunks as modified
+										// just for the worse case
+										remainingChunksToMerge--;
+										if (remainingChunksToMerge <= 0) break loop;
+										modifiedChunks.add(a);
+										modifiedChunks.add(b);
+										continue loop;
+									}
+								}
+								for (const parent of group.parentsIterable) {
+									queue.add(parent);
+								}
+							}
+						}
+
+						// merge the chunks
+						if (a.integrate(b, "limit")) {
+							chunks.splice(chunks.indexOf(b), 1);
+
+							// flag chunk a as modified as further optimization are possible for all children here
+							modifiedChunks.add(a);
+
+							changed = true;
+							remainingChunksToMerge--;
+							if (remainingChunksToMerge <= 0) break;
+
+							// Update all affected combinations
+							// delete all combination with the removed chunk
+							// we will use combinations with the kept chunk instead
+							for (const combination of combinationsByChunk.get(b)) {
+								if (combination.deleted) continue;
+								combination.deleted = true;
+								combinations.delete(combination);
+							}
+
+							// Update combinations with the kept chunk with new sizes
+							for (const combination of combinationsByChunk.get(a)) {
+								if (combination.deleted) continue;
+								if (combination.a === a) {
+									// Update size
+									const newIntegratedSize = a.integratedSize(
+										combination.b,
+										options
+									);
+									if (newIntegratedSize === false) {
+										combination.deleted = true;
+										combinations.delete(combination);
+										continue;
+									}
+									const finishUpdate = combinations.startUpdate(combination);
+									combination.integratedSize = newIntegratedSize;
+									combination.aSize = integratedSize;
+									combination.sizeDiff =
+										combination.bSize + integratedSize - newIntegratedSize;
+									finishUpdate();
+								} else if (combination.b === a) {
+									// Update size
+									const newIntegratedSize = combination.a.integratedSize(
+										a,
+										options
+									);
+									if (newIntegratedSize === false) {
+										combination.deleted = true;
+										combinations.delete(combination);
+										continue;
+									}
+									const finishUpdate = combinations.startUpdate(combination);
+									combination.integratedSize = newIntegratedSize;
+									combination.bSize = integratedSize;
+									combination.sizeDiff =
+										integratedSize + combination.aSize - newIntegratedSize;
+									finishUpdate();
+								}
+							}
+						}
+					}
+					if (changed) return true;
+				}
+			);
+		});
+	}
+}
+module.exports = LimitChunkCountPlugin;
diff --git a/node_modules/webpack/lib/optimize/MergeDuplicateChunksPlugin.js b/node_modules/webpack/lib/optimize/MergeDuplicateChunksPlugin.js
new file mode 100644
index 0000000..1c3e23a
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/MergeDuplicateChunksPlugin.js
@@ -0,0 +1,78 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class MergeDuplicateChunksPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"MergeDuplicateChunksPlugin",
+			compilation => {
+				compilation.hooks.optimizeChunksBasic.tap(
+					"MergeDuplicateChunksPlugin",
+					chunks => {
+						// remember already tested chunks for performance
+						const notDuplicates = new Set();
+
+						// for each chunk
+						for (const chunk of chunks) {
+							// track a Set of all chunk that could be duplicates
+							let possibleDuplicates;
+							for (const module of chunk.modulesIterable) {
+								if (possibleDuplicates === undefined) {
+									// when possibleDuplicates is not yet set,
+									// create a new Set from chunks of the current module
+									// including only chunks with the same number of modules
+									for (const dup of module.chunksIterable) {
+										if (
+											dup !== chunk &&
+											chunk.getNumberOfModules() === dup.getNumberOfModules() &&
+											!notDuplicates.has(dup)
+										) {
+											// delay allocating the new Set until here, reduce memory pressure
+											if (possibleDuplicates === undefined) {
+												possibleDuplicates = new Set();
+											}
+											possibleDuplicates.add(dup);
+										}
+									}
+									// when no chunk is possible we can break here
+									if (possibleDuplicates === undefined) break;
+								} else {
+									// validate existing possible duplicates
+									for (const dup of possibleDuplicates) {
+										// remove possible duplicate when module is not contained
+										if (!dup.containsModule(module)) {
+											possibleDuplicates.delete(dup);
+										}
+									}
+									// when all chunks has been removed we can break here
+									if (possibleDuplicates.size === 0) break;
+								}
+							}
+
+							// when we found duplicates
+							if (
+								possibleDuplicates !== undefined &&
+								possibleDuplicates.size > 0
+							) {
+								for (const otherChunk of possibleDuplicates) {
+									if (otherChunk.hasRuntime() !== chunk.hasRuntime()) continue;
+									// merge them
+									if (chunk.integrate(otherChunk, "duplicate")) {
+										chunks.splice(chunks.indexOf(otherChunk), 1);
+									}
+								}
+							}
+
+							// don't check already processed chunks twice
+							notDuplicates.add(chunk);
+						}
+					}
+				);
+			}
+		);
+	}
+}
+module.exports = MergeDuplicateChunksPlugin;
diff --git a/node_modules/webpack/lib/optimize/MinChunkSizePlugin.js b/node_modules/webpack/lib/optimize/MinChunkSizePlugin.js
new file mode 100644
index 0000000..144af27
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/MinChunkSizePlugin.js
@@ -0,0 +1,82 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const validateOptions = require("schema-utils");
+const schema = require("../../schemas/plugins/optimize/MinChunkSizePlugin.json");
+
+/** @typedef {import("../../declarations/plugins/optimize/MinChunkSizePlugin").MinChunkSizePluginOptions} MinChunkSizePluginOptions */
+
+class MinChunkSizePlugin {
+	/**
+	 * @param {MinChunkSizePluginOptions} options options object
+	 */
+	constructor(options) {
+		validateOptions(schema, options, "Min Chunk Size Plugin");
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const options = this.options;
+		const minChunkSize = options.minChunkSize;
+		compiler.hooks.compilation.tap("MinChunkSizePlugin", compilation => {
+			compilation.hooks.optimizeChunksAdvanced.tap(
+				"MinChunkSizePlugin",
+				chunks => {
+					const equalOptions = {
+						chunkOverhead: 1,
+						entryChunkMultiplicator: 1
+					};
+
+					const sortedSizeFilteredExtendedPairCombinations = chunks
+						.reduce((combinations, a, idx) => {
+							// create combination pairs
+							for (let i = 0; i < idx; i++) {
+								const b = chunks[i];
+								combinations.push([b, a]);
+							}
+							return combinations;
+						}, [])
+						.filter(pair => {
+							// check if one of the chunks sizes is smaller than the minChunkSize
+							const p0SmallerThanMinChunkSize =
+								pair[0].size(equalOptions) < minChunkSize;
+							const p1SmallerThanMinChunkSize =
+								pair[1].size(equalOptions) < minChunkSize;
+							return p0SmallerThanMinChunkSize || p1SmallerThanMinChunkSize;
+						})
+						.map(pair => {
+							// extend combination pairs with size and integrated size
+							const a = pair[0].size(options);
+							const b = pair[1].size(options);
+							const ab = pair[0].integratedSize(pair[1], options);
+							return [a + b - ab, ab, pair[0], pair[1]];
+						})
+						.filter(pair => {
+							// filter pairs that do not have an integratedSize
+							// meaning they can NOT be integrated!
+							return pair[1] !== false;
+						})
+						.sort((a, b) => {
+							// sadly javascript does an inplace sort here
+							// sort by size
+							const diff = b[0] - a[0];
+							if (diff !== 0) return diff;
+							return a[1] - b[1];
+						});
+
+					if (sortedSizeFilteredExtendedPairCombinations.length === 0) return;
+
+					const pair = sortedSizeFilteredExtendedPairCombinations[0];
+
+					pair[2].integrate(pair[3], "min-size");
+					chunks.splice(chunks.indexOf(pair[3]), 1);
+					return true;
+				}
+			);
+		});
+	}
+}
+module.exports = MinChunkSizePlugin;
diff --git a/node_modules/webpack/lib/optimize/MinMaxSizeWarning.js b/node_modules/webpack/lib/optimize/MinMaxSizeWarning.js
new file mode 100644
index 0000000..255e918
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/MinMaxSizeWarning.js
@@ -0,0 +1,29 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebpackError = require("../WebpackError");
+const SizeFormatHelpers = require("../SizeFormatHelpers");
+
+class MinMaxSizeWarning extends WebpackError {
+	constructor(keys, minSize, maxSize) {
+		let keysMessage = "Fallback cache group";
+		if (keys) {
+			keysMessage =
+				keys.length > 1
+					? `Cache groups ${keys.sort().join(", ")}`
+					: `Cache group ${keys[0]}`;
+		}
+		super(
+			`SplitChunksPlugin\n` +
+				`${keysMessage}\n` +
+				`Configured minSize (${SizeFormatHelpers.formatSize(minSize)}) is ` +
+				`bigger than maxSize (${SizeFormatHelpers.formatSize(maxSize)}).\n` +
+				"This seem to be a invalid optimiziation.splitChunks configuration."
+		);
+	}
+}
+
+module.exports = MinMaxSizeWarning;
diff --git a/node_modules/webpack/lib/optimize/ModuleConcatenationPlugin.js b/node_modules/webpack/lib/optimize/ModuleConcatenationPlugin.js
new file mode 100644
index 0000000..0c5bfd3
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/ModuleConcatenationPlugin.js
@@ -0,0 +1,485 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const HarmonyImportDependency = require("../dependencies/HarmonyImportDependency");
+const ModuleHotAcceptDependency = require("../dependencies/ModuleHotAcceptDependency");
+const ModuleHotDeclineDependency = require("../dependencies/ModuleHotDeclineDependency");
+const ConcatenatedModule = require("./ConcatenatedModule");
+const HarmonyCompatibilityDependency = require("../dependencies/HarmonyCompatibilityDependency");
+const StackedSetMap = require("../util/StackedSetMap");
+
+const formatBailoutReason = msg => {
+	return "ModuleConcatenation bailout: " + msg;
+};
+
+class ModuleConcatenationPlugin {
+	constructor(options) {
+		if (typeof options !== "object") options = {};
+		this.options = options;
+	}
+
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"ModuleConcatenationPlugin",
+			(compilation, { normalModuleFactory }) => {
+				const handler = (parser, parserOptions) => {
+					parser.hooks.call.for("eval").tap("ModuleConcatenationPlugin", () => {
+						// Because of variable renaming we can't use modules with eval.
+						parser.state.module.buildMeta.moduleConcatenationBailout = "eval()";
+					});
+				};
+
+				normalModuleFactory.hooks.parser
+					.for("javascript/auto")
+					.tap("ModuleConcatenationPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/dynamic")
+					.tap("ModuleConcatenationPlugin", handler);
+				normalModuleFactory.hooks.parser
+					.for("javascript/esm")
+					.tap("ModuleConcatenationPlugin", handler);
+
+				const bailoutReasonMap = new Map();
+
+				const setBailoutReason = (module, reason) => {
+					bailoutReasonMap.set(module, reason);
+					module.optimizationBailout.push(
+						typeof reason === "function"
+							? rs => formatBailoutReason(reason(rs))
+							: formatBailoutReason(reason)
+					);
+				};
+
+				const getBailoutReason = (module, requestShortener) => {
+					const reason = bailoutReasonMap.get(module);
+					if (typeof reason === "function") return reason(requestShortener);
+					return reason;
+				};
+
+				compilation.hooks.optimizeChunkModules.tap(
+					"ModuleConcatenationPlugin",
+					(allChunks, modules) => {
+						const relevantModules = [];
+						const possibleInners = new Set();
+						for (const module of modules) {
+							// Only harmony modules are valid for optimization
+							if (
+								!module.buildMeta ||
+								module.buildMeta.exportsType !== "namespace" ||
+								!module.dependencies.some(
+									d => d instanceof HarmonyCompatibilityDependency
+								)
+							) {
+								setBailoutReason(module, "Module is not an ECMAScript module");
+								continue;
+							}
+
+							// Some expressions are not compatible with module concatenation
+							// because they may produce unexpected results. The plugin bails out
+							// if some were detected upfront.
+							if (
+								module.buildMeta &&
+								module.buildMeta.moduleConcatenationBailout
+							) {
+								setBailoutReason(
+									module,
+									`Module uses ${module.buildMeta.moduleConcatenationBailout}`
+								);
+								continue;
+							}
+
+							// Exports must be known (and not dynamic)
+							if (!Array.isArray(module.buildMeta.providedExports)) {
+								setBailoutReason(module, "Module exports are unknown");
+								continue;
+							}
+
+							// Using dependency variables is not possible as this wraps the code in a function
+							if (module.variables.length > 0) {
+								setBailoutReason(
+									module,
+									`Module uses injected variables (${module.variables
+										.map(v => v.name)
+										.join(", ")})`
+								);
+								continue;
+							}
+
+							// Hot Module Replacement need it's own module to work correctly
+							if (
+								module.dependencies.some(
+									dep =>
+										dep instanceof ModuleHotAcceptDependency ||
+										dep instanceof ModuleHotDeclineDependency
+								)
+							) {
+								setBailoutReason(module, "Module uses Hot Module Replacement");
+								continue;
+							}
+
+							relevantModules.push(module);
+
+							// Module must not be the entry points
+							if (module.isEntryModule()) {
+								setBailoutReason(module, "Module is an entry point");
+								continue;
+							}
+
+							// Module must be in any chunk (we don't want to do useless work)
+							if (module.getNumberOfChunks() === 0) {
+								setBailoutReason(module, "Module is not in any chunk");
+								continue;
+							}
+
+							// Module must only be used by Harmony Imports
+							const nonHarmonyReasons = module.reasons.filter(
+								reason =>
+									!reason.dependency ||
+									!(reason.dependency instanceof HarmonyImportDependency)
+							);
+							if (nonHarmonyReasons.length > 0) {
+								const importingModules = new Set(
+									nonHarmonyReasons.map(r => r.module).filter(Boolean)
+								);
+								const importingExplanations = new Set(
+									nonHarmonyReasons.map(r => r.explanation).filter(Boolean)
+								);
+								const importingModuleTypes = new Map(
+									Array.from(importingModules).map(
+										m => /** @type {[string, Set]} */ ([
+											m,
+											new Set(
+												nonHarmonyReasons
+													.filter(r => r.module === m)
+													.map(r => r.dependency.type)
+													.sort()
+											)
+										])
+									)
+								);
+								setBailoutReason(module, requestShortener => {
+									const names = Array.from(importingModules)
+										.map(
+											m =>
+												`${m.readableIdentifier(
+													requestShortener
+												)} (referenced with ${Array.from(
+													importingModuleTypes.get(m)
+												).join(", ")})`
+										)
+										.sort();
+									const explanations = Array.from(importingExplanations).sort();
+									if (names.length > 0 && explanations.length === 0) {
+										return `Module is referenced from these modules with unsupported syntax: ${names.join(
+											", "
+										)}`;
+									} else if (names.length === 0 && explanations.length > 0) {
+										return `Module is referenced by: ${explanations.join(
+											", "
+										)}`;
+									} else if (names.length > 0 && explanations.length > 0) {
+										return `Module is referenced from these modules with unsupported syntax: ${names.join(
+											", "
+										)} and by: ${explanations.join(", ")}`;
+									} else {
+										return "Module is referenced in a unsupported way";
+									}
+								});
+								continue;
+							}
+
+							possibleInners.add(module);
+						}
+						// sort by depth
+						// modules with lower depth are more likely suited as roots
+						// this improves performance, because modules already selected as inner are skipped
+						relevantModules.sort((a, b) => {
+							return a.depth - b.depth;
+						});
+						const concatConfigurations = [];
+						const usedAsInner = new Set();
+						for (const currentRoot of relevantModules) {
+							// when used by another configuration as inner:
+							// the other configuration is better and we can skip this one
+							if (usedAsInner.has(currentRoot)) continue;
+
+							// create a configuration with the root
+							const currentConfiguration = new ConcatConfiguration(currentRoot);
+
+							// cache failures to add modules
+							const failureCache = new Map();
+
+							// try to add all imports
+							for (const imp of this._getImports(compilation, currentRoot)) {
+								const problem = this._tryToAdd(
+									compilation,
+									currentConfiguration,
+									imp,
+									possibleInners,
+									failureCache
+								);
+								if (problem) {
+									failureCache.set(imp, problem);
+									currentConfiguration.addWarning(imp, problem);
+								}
+							}
+							if (!currentConfiguration.isEmpty()) {
+								concatConfigurations.push(currentConfiguration);
+								for (const module of currentConfiguration.getModules()) {
+									if (module !== currentConfiguration.rootModule) {
+										usedAsInner.add(module);
+									}
+								}
+							}
+						}
+						// HACK: Sort configurations by length and start with the longest one
+						// to get the biggers groups possible. Used modules are marked with usedModules
+						// TODO: Allow to reuse existing configuration while trying to add dependencies.
+						// This would improve performance. O(n^2) -> O(n)
+						concatConfigurations.sort((a, b) => {
+							return b.modules.size - a.modules.size;
+						});
+						const usedModules = new Set();
+						for (const concatConfiguration of concatConfigurations) {
+							if (usedModules.has(concatConfiguration.rootModule)) continue;
+							const modules = concatConfiguration.getModules();
+							const rootModule = concatConfiguration.rootModule;
+							const newModule = new ConcatenatedModule(
+								rootModule,
+								Array.from(modules),
+								ConcatenatedModule.createConcatenationList(
+									rootModule,
+									modules,
+									compilation
+								)
+							);
+							for (const warning of concatConfiguration.getWarningsSorted()) {
+								newModule.optimizationBailout.push(requestShortener => {
+									const reason = getBailoutReason(warning[0], requestShortener);
+									const reasonWithPrefix = reason ? ` (<- ${reason})` : "";
+									if (warning[0] === warning[1]) {
+										return formatBailoutReason(
+											`Cannot concat with ${warning[0].readableIdentifier(
+												requestShortener
+											)}${reasonWithPrefix}`
+										);
+									} else {
+										return formatBailoutReason(
+											`Cannot concat with ${warning[0].readableIdentifier(
+												requestShortener
+											)} because of ${warning[1].readableIdentifier(
+												requestShortener
+											)}${reasonWithPrefix}`
+										);
+									}
+								});
+							}
+							const chunks = concatConfiguration.rootModule.getChunks();
+							for (const m of modules) {
+								usedModules.add(m);
+								for (const chunk of chunks) {
+									chunk.removeModule(m);
+								}
+							}
+							for (const chunk of chunks) {
+								chunk.addModule(newModule);
+								newModule.addChunk(chunk);
+							}
+							for (const chunk of allChunks) {
+								if (chunk.entryModule === concatConfiguration.rootModule) {
+									chunk.entryModule = newModule;
+								}
+							}
+							compilation.modules.push(newModule);
+							for (const reason of newModule.reasons) {
+								if (reason.dependency.module === concatConfiguration.rootModule)
+									reason.dependency.module = newModule;
+								if (
+									reason.dependency.redirectedModule ===
+									concatConfiguration.rootModule
+								)
+									reason.dependency.redirectedModule = newModule;
+							}
+							// TODO: remove when LTS node version contains fixed v8 version
+							// @see https://github.com/webpack/webpack/pull/6613
+							// Turbofan does not correctly inline for-of loops with polymorphic input arrays.
+							// Work around issue by using a standard for loop and assigning dep.module.reasons
+							for (let i = 0; i < newModule.dependencies.length; i++) {
+								let dep = newModule.dependencies[i];
+								if (dep.module) {
+									let reasons = dep.module.reasons;
+									for (let j = 0; j < reasons.length; j++) {
+										let reason = reasons[j];
+										if (reason.dependency === dep) {
+											reason.module = newModule;
+										}
+									}
+								}
+							}
+						}
+						compilation.modules = compilation.modules.filter(
+							m => !usedModules.has(m)
+						);
+					}
+				);
+			}
+		);
+	}
+
+	_getImports(compilation, module) {
+		return new Set(
+			module.dependencies
+
+				// Get reference info only for harmony Dependencies
+				.map(dep => {
+					if (!(dep instanceof HarmonyImportDependency)) return null;
+					if (!compilation) return dep.getReference();
+					return compilation.getDependencyReference(module, dep);
+				})
+
+				// Reference is valid and has a module
+				// Dependencies are simple enough to concat them
+				.filter(
+					ref =>
+						ref &&
+						ref.module &&
+						(Array.isArray(ref.importedNames) ||
+							Array.isArray(ref.module.buildMeta.providedExports))
+				)
+
+				// Take the imported module
+				.map(ref => ref.module)
+		);
+	}
+
+	_tryToAdd(compilation, config, module, possibleModules, failureCache) {
+		const cacheEntry = failureCache.get(module);
+		if (cacheEntry) {
+			return cacheEntry;
+		}
+
+		// Already added?
+		if (config.has(module)) {
+			return null;
+		}
+
+		// Not possible to add?
+		if (!possibleModules.has(module)) {
+			failureCache.set(module, module); // cache failures for performance
+			return module;
+		}
+
+		// module must be in the same chunks
+		if (!config.rootModule.hasEqualsChunks(module)) {
+			failureCache.set(module, module); // cache failures for performance
+			return module;
+		}
+
+		// Clone config to make experimental changes
+		const testConfig = config.clone();
+
+		// Add the module
+		testConfig.add(module);
+
+		// Every module which depends on the added module must be in the configuration too.
+		for (const reason of module.reasons) {
+			// Modules that are not used can be ignored
+			if (
+				reason.module.factoryMeta.sideEffectFree &&
+				reason.module.used === false
+			)
+				continue;
+
+			const problem = this._tryToAdd(
+				compilation,
+				testConfig,
+				reason.module,
+				possibleModules,
+				failureCache
+			);
+			if (problem) {
+				failureCache.set(module, problem); // cache failures for performance
+				return problem;
+			}
+		}
+
+		// Commit experimental changes
+		config.set(testConfig);
+
+		// Eagerly try to add imports too if possible
+		for (const imp of this._getImports(compilation, module)) {
+			const problem = this._tryToAdd(
+				compilation,
+				config,
+				imp,
+				possibleModules,
+				failureCache
+			);
+			if (problem) {
+				config.addWarning(imp, problem);
+			}
+		}
+		return null;
+	}
+}
+
+class ConcatConfiguration {
+	constructor(rootModule, cloneFrom) {
+		this.rootModule = rootModule;
+		if (cloneFrom) {
+			this.modules = cloneFrom.modules.createChild(5);
+			this.warnings = cloneFrom.warnings.createChild(5);
+		} else {
+			this.modules = new StackedSetMap();
+			this.modules.add(rootModule);
+			this.warnings = new StackedSetMap();
+		}
+	}
+
+	add(module) {
+		this.modules.add(module);
+	}
+
+	has(module) {
+		return this.modules.has(module);
+	}
+
+	isEmpty() {
+		return this.modules.size === 1;
+	}
+
+	addWarning(module, problem) {
+		this.warnings.set(module, problem);
+	}
+
+	getWarningsSorted() {
+		return new Map(
+			this.warnings.asPairArray().sort((a, b) => {
+				const ai = a[0].identifier();
+				const bi = b[0].identifier();
+				if (ai < bi) return -1;
+				if (ai > bi) return 1;
+				return 0;
+			})
+		);
+	}
+
+	getModules() {
+		return this.modules.asSet();
+	}
+
+	clone() {
+		return new ConcatConfiguration(this.rootModule, this);
+	}
+
+	set(config) {
+		this.rootModule = config.rootModule;
+		this.modules = config.modules;
+		this.warnings = config.warnings;
+	}
+}
+
+module.exports = ModuleConcatenationPlugin;
diff --git a/node_modules/webpack/lib/optimize/NaturalChunkOrderPlugin.js b/node_modules/webpack/lib/optimize/NaturalChunkOrderPlugin.js
new file mode 100644
index 0000000..00f8010
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/NaturalChunkOrderPlugin.js
@@ -0,0 +1,41 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+/** @typedef {import("../Compiler")} Compiler */
+
+class NaturalChunkOrderPlugin {
+	/**
+	 * @param {Compiler} compiler webpack compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap("NaturalChunkOrderPlugin", compilation => {
+			compilation.hooks.optimizeChunkOrder.tap(
+				"NaturalChunkOrderPlugin",
+				chunks => {
+					chunks.sort((chunkA, chunkB) => {
+						const a = chunkA.modulesIterable[Symbol.iterator]();
+						const b = chunkB.modulesIterable[Symbol.iterator]();
+						// eslint-disable-next-line no-constant-condition
+						while (true) {
+							const aItem = a.next();
+							const bItem = b.next();
+							if (aItem.done && bItem.done) return 0;
+							if (aItem.done) return -1;
+							if (bItem.done) return 1;
+							const aModuleId = aItem.value.id;
+							const bModuleId = bItem.value.id;
+							if (aModuleId < bModuleId) return -1;
+							if (aModuleId > bModuleId) return 1;
+						}
+					});
+				}
+			);
+		});
+	}
+}
+
+module.exports = NaturalChunkOrderPlugin;
diff --git a/node_modules/webpack/lib/optimize/OccurrenceChunkOrderPlugin.js b/node_modules/webpack/lib/optimize/OccurrenceChunkOrderPlugin.js
new file mode 100644
index 0000000..4f7ec9a
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/OccurrenceChunkOrderPlugin.js
@@ -0,0 +1,66 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const validateOptions = require("schema-utils");
+const schema = require("../../schemas/plugins/optimize/OccurrenceOrderChunkIdsPlugin.json");
+
+/** @typedef {import("../../declarations/plugins/optimize/OccurrenceOrderChunkIdsPlugin").OccurrenceOrderChunkIdsPluginOptions} OccurrenceOrderChunkIdsPluginOptions */
+
+class OccurrenceOrderChunkIdsPlugin {
+	/**
+	 * @param {OccurrenceOrderChunkIdsPluginOptions=} options options object
+	 */
+	constructor(options = {}) {
+		validateOptions(schema, options, "Occurrence Order Chunk Ids Plugin");
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const prioritiseInitial = this.options.prioritiseInitial;
+		compiler.hooks.compilation.tap(
+			"OccurrenceOrderChunkIdsPlugin",
+			compilation => {
+				compilation.hooks.optimizeChunkOrder.tap(
+					"OccurrenceOrderChunkIdsPlugin",
+					chunks => {
+						const occursInInitialChunksMap = new Map();
+						const originalOrder = new Map();
+
+						let i = 0;
+						for (const c of chunks) {
+							let occurs = 0;
+							for (const chunkGroup of c.groupsIterable) {
+								for (const parent of chunkGroup.parentsIterable) {
+									if (parent.isInitial()) occurs++;
+								}
+							}
+							occursInInitialChunksMap.set(c, occurs);
+							originalOrder.set(c, i++);
+						}
+
+						chunks.sort((a, b) => {
+							if (prioritiseInitial) {
+								const aEntryOccurs = occursInInitialChunksMap.get(a);
+								const bEntryOccurs = occursInInitialChunksMap.get(b);
+								if (aEntryOccurs > bEntryOccurs) return -1;
+								if (aEntryOccurs < bEntryOccurs) return 1;
+							}
+							const aOccurs = a.getNumberOfGroups();
+							const bOccurs = b.getNumberOfGroups();
+							if (aOccurs > bOccurs) return -1;
+							if (aOccurs < bOccurs) return 1;
+							const orgA = originalOrder.get(a);
+							const orgB = originalOrder.get(b);
+							return orgA - orgB;
+						});
+					}
+				);
+			}
+		);
+	}
+}
+
+module.exports = OccurrenceOrderChunkIdsPlugin;
diff --git a/node_modules/webpack/lib/optimize/OccurrenceModuleOrderPlugin.js b/node_modules/webpack/lib/optimize/OccurrenceModuleOrderPlugin.js
new file mode 100644
index 0000000..cb9a3e8
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/OccurrenceModuleOrderPlugin.js
@@ -0,0 +1,112 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const validateOptions = require("schema-utils");
+const schema = require("../../schemas/plugins/optimize/OccurrenceOrderModuleIdsPlugin.json");
+
+/** @typedef {import("../../declarations/plugins/optimize/OccurrenceOrderModuleIdsPlugin").OccurrenceOrderModuleIdsPluginOptions} OccurrenceOrderModuleIdsPluginOptions */
+
+class OccurrenceOrderModuleIdsPlugin {
+	/**
+	 * @param {OccurrenceOrderModuleIdsPluginOptions=} options options object
+	 */
+	constructor(options = {}) {
+		validateOptions(schema, options, "Occurrence Order Module Ids Plugin");
+		this.options = options;
+	}
+
+	apply(compiler) {
+		const prioritiseInitial = this.options.prioritiseInitial;
+		compiler.hooks.compilation.tap(
+			"OccurrenceOrderModuleIdsPlugin",
+			compilation => {
+				compilation.hooks.optimizeModuleOrder.tap(
+					"OccurrenceOrderModuleIdsPlugin",
+					modules => {
+						const occursInInitialChunksMap = new Map();
+						const occursInAllChunksMap = new Map();
+
+						const initialChunkChunkMap = new Map();
+						const entryCountMap = new Map();
+						for (const m of modules) {
+							let initial = 0;
+							let entry = 0;
+							for (const c of m.chunksIterable) {
+								if (c.canBeInitial()) initial++;
+								if (c.entryModule === m) entry++;
+							}
+							initialChunkChunkMap.set(m, initial);
+							entryCountMap.set(m, entry);
+						}
+
+						const countOccursInEntry = (sum, r) => {
+							if (!r.module) {
+								return sum;
+							}
+							const count = initialChunkChunkMap.get(r.module);
+							if (!count) {
+								return sum;
+							}
+							return sum + count;
+						};
+						const countOccurs = (sum, r) => {
+							if (!r.module) {
+								return sum;
+							}
+							let factor = 1;
+							if (typeof r.dependency.getNumberOfIdOccurrences === "function") {
+								factor = r.dependency.getNumberOfIdOccurrences();
+							}
+							if (factor === 0) {
+								return sum;
+							}
+							return sum + factor * r.module.getNumberOfChunks();
+						};
+
+						if (prioritiseInitial) {
+							for (const m of modules) {
+								const result =
+									m.reasons.reduce(countOccursInEntry, 0) +
+									initialChunkChunkMap.get(m) +
+									entryCountMap.get(m);
+								occursInInitialChunksMap.set(m, result);
+							}
+						}
+
+						const originalOrder = new Map();
+						let i = 0;
+						for (const m of modules) {
+							const result =
+								m.reasons.reduce(countOccurs, 0) +
+								m.getNumberOfChunks() +
+								entryCountMap.get(m);
+							occursInAllChunksMap.set(m, result);
+							originalOrder.set(m, i++);
+						}
+
+						modules.sort((a, b) => {
+							if (prioritiseInitial) {
+								const aEntryOccurs = occursInInitialChunksMap.get(a);
+								const bEntryOccurs = occursInInitialChunksMap.get(b);
+								if (aEntryOccurs > bEntryOccurs) return -1;
+								if (aEntryOccurs < bEntryOccurs) return 1;
+							}
+							const aOccurs = occursInAllChunksMap.get(a);
+							const bOccurs = occursInAllChunksMap.get(b);
+							if (aOccurs > bOccurs) return -1;
+							if (aOccurs < bOccurs) return 1;
+							const orgA = originalOrder.get(a);
+							const orgB = originalOrder.get(b);
+							return orgA - orgB;
+						});
+					}
+				);
+			}
+		);
+	}
+}
+
+module.exports = OccurrenceOrderModuleIdsPlugin;
diff --git a/node_modules/webpack/lib/optimize/OccurrenceOrderPlugin.js b/node_modules/webpack/lib/optimize/OccurrenceOrderPlugin.js
new file mode 100644
index 0000000..c73ec8e
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/OccurrenceOrderPlugin.js
@@ -0,0 +1,135 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+// TODO webpack 5 remove this plugin
+// It has been splitted into separate plugins for modules and chunks
+class OccurrenceOrderPlugin {
+	constructor(preferEntry) {
+		if (preferEntry !== undefined && typeof preferEntry !== "boolean") {
+			throw new Error(
+				"Argument should be a boolean.\nFor more info on this plugin, see https://webpack.js.org/plugins/"
+			);
+		}
+		this.preferEntry = preferEntry;
+	}
+	apply(compiler) {
+		const preferEntry = this.preferEntry;
+		compiler.hooks.compilation.tap("OccurrenceOrderPlugin", compilation => {
+			compilation.hooks.optimizeModuleOrder.tap(
+				"OccurrenceOrderPlugin",
+				modules => {
+					const occursInInitialChunksMap = new Map();
+					const occursInAllChunksMap = new Map();
+
+					const initialChunkChunkMap = new Map();
+					const entryCountMap = new Map();
+					for (const m of modules) {
+						let initial = 0;
+						let entry = 0;
+						for (const c of m.chunksIterable) {
+							if (c.canBeInitial()) initial++;
+							if (c.entryModule === m) entry++;
+						}
+						initialChunkChunkMap.set(m, initial);
+						entryCountMap.set(m, entry);
+					}
+
+					const countOccursInEntry = (sum, r) => {
+						if (!r.module) {
+							return sum;
+						}
+						return sum + initialChunkChunkMap.get(r.module);
+					};
+					const countOccurs = (sum, r) => {
+						if (!r.module) {
+							return sum;
+						}
+						let factor = 1;
+						if (typeof r.dependency.getNumberOfIdOccurrences === "function") {
+							factor = r.dependency.getNumberOfIdOccurrences();
+						}
+						if (factor === 0) {
+							return sum;
+						}
+						return sum + factor * r.module.getNumberOfChunks();
+					};
+
+					if (preferEntry) {
+						for (const m of modules) {
+							const result =
+								m.reasons.reduce(countOccursInEntry, 0) +
+								initialChunkChunkMap.get(m) +
+								entryCountMap.get(m);
+							occursInInitialChunksMap.set(m, result);
+						}
+					}
+
+					const originalOrder = new Map();
+					let i = 0;
+					for (const m of modules) {
+						const result =
+							m.reasons.reduce(countOccurs, 0) +
+							m.getNumberOfChunks() +
+							entryCountMap.get(m);
+						occursInAllChunksMap.set(m, result);
+						originalOrder.set(m, i++);
+					}
+
+					modules.sort((a, b) => {
+						if (preferEntry) {
+							const aEntryOccurs = occursInInitialChunksMap.get(a);
+							const bEntryOccurs = occursInInitialChunksMap.get(b);
+							if (aEntryOccurs > bEntryOccurs) return -1;
+							if (aEntryOccurs < bEntryOccurs) return 1;
+						}
+						const aOccurs = occursInAllChunksMap.get(a);
+						const bOccurs = occursInAllChunksMap.get(b);
+						if (aOccurs > bOccurs) return -1;
+						if (aOccurs < bOccurs) return 1;
+						const orgA = originalOrder.get(a);
+						const orgB = originalOrder.get(b);
+						return orgA - orgB;
+					});
+				}
+			);
+			compilation.hooks.optimizeChunkOrder.tap(
+				"OccurrenceOrderPlugin",
+				chunks => {
+					const occursInInitialChunksMap = new Map();
+					const originalOrder = new Map();
+
+					let i = 0;
+					for (const c of chunks) {
+						let occurs = 0;
+						for (const chunkGroup of c.groupsIterable) {
+							for (const parent of chunkGroup.parentsIterable) {
+								if (parent.isInitial()) occurs++;
+							}
+						}
+						occursInInitialChunksMap.set(c, occurs);
+						originalOrder.set(c, i++);
+					}
+
+					chunks.sort((a, b) => {
+						const aEntryOccurs = occursInInitialChunksMap.get(a);
+						const bEntryOccurs = occursInInitialChunksMap.get(b);
+						if (aEntryOccurs > bEntryOccurs) return -1;
+						if (aEntryOccurs < bEntryOccurs) return 1;
+						const aOccurs = a.getNumberOfGroups();
+						const bOccurs = b.getNumberOfGroups();
+						if (aOccurs > bOccurs) return -1;
+						if (aOccurs < bOccurs) return 1;
+						const orgA = originalOrder.get(a);
+						const orgB = originalOrder.get(b);
+						return orgA - orgB;
+					});
+				}
+			);
+		});
+	}
+}
+
+module.exports = OccurrenceOrderPlugin;
diff --git a/node_modules/webpack/lib/optimize/RemoveEmptyChunksPlugin.js b/node_modules/webpack/lib/optimize/RemoveEmptyChunksPlugin.js
new file mode 100644
index 0000000..42ba24a
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/RemoveEmptyChunksPlugin.js
@@ -0,0 +1,42 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class RemoveEmptyChunksPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap("RemoveEmptyChunksPlugin", compilation => {
+			const handler = chunks => {
+				for (let i = chunks.length - 1; i >= 0; i--) {
+					const chunk = chunks[i];
+					if (
+						chunk.isEmpty() &&
+						!chunk.hasRuntime() &&
+						!chunk.hasEntryModule()
+					) {
+						chunk.remove("empty");
+						chunks.splice(i, 1);
+					}
+				}
+			};
+			compilation.hooks.optimizeChunksBasic.tap(
+				"RemoveEmptyChunksPlugin",
+				handler
+			);
+			compilation.hooks.optimizeChunksAdvanced.tap(
+				"RemoveEmptyChunksPlugin",
+				handler
+			);
+			compilation.hooks.optimizeExtractedChunksBasic.tap(
+				"RemoveEmptyChunksPlugin",
+				handler
+			);
+			compilation.hooks.optimizeExtractedChunksAdvanced.tap(
+				"RemoveEmptyChunksPlugin",
+				handler
+			);
+		});
+	}
+}
+module.exports = RemoveEmptyChunksPlugin;
diff --git a/node_modules/webpack/lib/optimize/RemoveParentModulesPlugin.js b/node_modules/webpack/lib/optimize/RemoveParentModulesPlugin.js
new file mode 100644
index 0000000..7fff592
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/RemoveParentModulesPlugin.js
@@ -0,0 +1,127 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Queue = require("../util/Queue");
+const { intersect } = require("../util/SetHelpers");
+
+const getParentChunksWithModule = (currentChunk, module) => {
+	const chunks = [];
+	const stack = new Set(currentChunk.parentsIterable);
+
+	for (const chunk of stack) {
+		if (chunk.containsModule(module)) {
+			chunks.push(chunk);
+		} else {
+			for (const parent of chunk.parentsIterable) {
+				stack.add(parent);
+			}
+		}
+	}
+
+	return chunks;
+};
+
+class RemoveParentModulesPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap("RemoveParentModulesPlugin", compilation => {
+			const handler = (chunks, chunkGroups) => {
+				const queue = new Queue();
+				const availableModulesMap = new WeakMap();
+
+				for (const chunkGroup of compilation.entrypoints.values()) {
+					// initialize available modules for chunks without parents
+					availableModulesMap.set(chunkGroup, new Set());
+					for (const child of chunkGroup.childrenIterable) {
+						queue.enqueue(child);
+					}
+				}
+
+				while (queue.length > 0) {
+					const chunkGroup = queue.dequeue();
+					let availableModules = availableModulesMap.get(chunkGroup);
+					let changed = false;
+					for (const parent of chunkGroup.parentsIterable) {
+						const availableModulesInParent = availableModulesMap.get(parent);
+						if (availableModulesInParent !== undefined) {
+							// If we know the available modules in parent: process these
+							if (availableModules === undefined) {
+								// if we have not own info yet: create new entry
+								availableModules = new Set(availableModulesInParent);
+								for (const chunk of parent.chunks) {
+									for (const m of chunk.modulesIterable) {
+										availableModules.add(m);
+									}
+								}
+								availableModulesMap.set(chunkGroup, availableModules);
+								changed = true;
+							} else {
+								for (const m of availableModules) {
+									if (
+										!parent.containsModule(m) &&
+										!availableModulesInParent.has(m)
+									) {
+										availableModules.delete(m);
+										changed = true;
+									}
+								}
+							}
+						}
+					}
+					if (changed) {
+						// if something changed: enqueue our children
+						for (const child of chunkGroup.childrenIterable) {
+							queue.enqueue(child);
+						}
+					}
+				}
+
+				// now we have available modules for every chunk
+				for (const chunk of chunks) {
+					const availableModulesSets = Array.from(
+						chunk.groupsIterable,
+						chunkGroup => availableModulesMap.get(chunkGroup)
+					);
+					if (availableModulesSets.some(s => s === undefined)) continue; // No info about this chunk group
+					const availableModules =
+						availableModulesSets.length === 1
+							? availableModulesSets[0]
+							: intersect(availableModulesSets);
+					const numberOfModules = chunk.getNumberOfModules();
+					const toRemove = new Set();
+					if (numberOfModules < availableModules.size) {
+						for (const m of chunk.modulesIterable) {
+							if (availableModules.has(m)) {
+								toRemove.add(m);
+							}
+						}
+					} else {
+						for (const m of availableModules) {
+							if (chunk.containsModule(m)) {
+								toRemove.add(m);
+							}
+						}
+					}
+					for (const module of toRemove) {
+						module.rewriteChunkInReasons(
+							chunk,
+							getParentChunksWithModule(chunk, module)
+						);
+						chunk.removeModule(module);
+					}
+				}
+			};
+			compilation.hooks.optimizeChunksBasic.tap(
+				"RemoveParentModulesPlugin",
+				handler
+			);
+			compilation.hooks.optimizeExtractedChunksBasic.tap(
+				"RemoveParentModulesPlugin",
+				handler
+			);
+		});
+	}
+}
+module.exports = RemoveParentModulesPlugin;
diff --git a/node_modules/webpack/lib/optimize/RuntimeChunkPlugin.js b/node_modules/webpack/lib/optimize/RuntimeChunkPlugin.js
new file mode 100644
index 0000000..1325dfc
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/RuntimeChunkPlugin.js
@@ -0,0 +1,41 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+module.exports = class RuntimeChunkPlugin {
+	constructor(options) {
+		this.options = Object.assign(
+			{
+				name: entrypoint => `runtime~${entrypoint.name}`
+			},
+			options
+		);
+	}
+
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap("RuntimeChunkPlugin", compilation => {
+			compilation.hooks.optimizeChunksAdvanced.tap("RuntimeChunkPlugin", () => {
+				for (const entrypoint of compilation.entrypoints.values()) {
+					const chunk = entrypoint.getRuntimeChunk();
+					let name = this.options.name;
+					if (typeof name === "function") {
+						name = name(entrypoint);
+					}
+					if (
+						chunk.getNumberOfModules() > 0 ||
+						!chunk.preventIntegration ||
+						chunk.name !== name
+					) {
+						const newChunk = compilation.addChunk(name);
+						newChunk.preventIntegration = true;
+						entrypoint.unshiftChunk(newChunk);
+						newChunk.addGroup(entrypoint);
+						entrypoint.setRuntimeChunk(newChunk);
+					}
+				}
+			});
+		});
+	}
+};
diff --git a/node_modules/webpack/lib/optimize/SideEffectsFlagPlugin.js b/node_modules/webpack/lib/optimize/SideEffectsFlagPlugin.js
new file mode 100644
index 0000000..5db780c
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/SideEffectsFlagPlugin.js
@@ -0,0 +1,352 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const mm = require("micromatch");
+const HarmonyExportImportedSpecifierDependency = require("../dependencies/HarmonyExportImportedSpecifierDependency");
+const HarmonyImportSideEffectDependency = require("../dependencies/HarmonyImportSideEffectDependency");
+const HarmonyImportSpecifierDependency = require("../dependencies/HarmonyImportSpecifierDependency");
+
+/** @typedef {import("../Module")} Module */
+/** @typedef {import("../Dependency")} Dependency */
+
+/**
+ * @typedef {Object} ExportInModule
+ * @property {Module} module the module
+ * @property {string} exportName the name of the export
+ * @property {boolean} checked if the export is conditional
+ */
+
+/**
+ * @typedef {Object} ReexportInfo
+ * @property {Map<string, ExportInModule[]>} static
+ * @property {Map<Module, Set<string>>} dynamic
+ */
+
+/**
+ * @param {ReexportInfo} info info object
+ * @param {string} exportName name of export
+ * @returns {ExportInModule | undefined} static export
+ */
+const getMappingFromInfo = (info, exportName) => {
+	const staticMappings = info.static.get(exportName);
+	if (staticMappings !== undefined) {
+		if (staticMappings.length === 1) return staticMappings[0];
+		return undefined;
+	}
+	const dynamicMappings = Array.from(info.dynamic).filter(
+		([_, ignored]) => !ignored.has(exportName)
+	);
+	if (dynamicMappings.length === 1) {
+		return {
+			module: dynamicMappings[0][0],
+			exportName,
+			checked: true
+		};
+	}
+	return undefined;
+};
+
+/**
+ * @param {ReexportInfo} info info object
+ * @param {string} exportName name of export of source module
+ * @param {Module} module the target module
+ * @param {string} innerExportName name of export of target module
+ * @param {boolean} checked true, if existence of target module is checked
+ */
+const addStaticReexport = (
+	info,
+	exportName,
+	module,
+	innerExportName,
+	checked
+) => {
+	let mappings = info.static.get(exportName);
+	if (mappings !== undefined) {
+		for (const mapping of mappings) {
+			if (mapping.module === module && mapping.exportName === innerExportName) {
+				mapping.checked = mapping.checked && checked;
+				return;
+			}
+		}
+	} else {
+		mappings = [];
+		info.static.set(exportName, mappings);
+	}
+	mappings.push({
+		module,
+		exportName: innerExportName,
+		checked
+	});
+};
+
+/**
+ * @param {ReexportInfo} info info object
+ * @param {Module} module the reexport module
+ * @param {Set<string>} ignored ignore list
+ * @returns {void}
+ */
+const addDynamicReexport = (info, module, ignored) => {
+	const existingList = info.dynamic.get(module);
+	if (existingList !== undefined) {
+		for (const key of existingList) {
+			if (!ignored.has(key)) existingList.delete(key);
+		}
+	} else {
+		info.dynamic.set(module, new Set(ignored));
+	}
+};
+
+class SideEffectsFlagPlugin {
+	apply(compiler) {
+		compiler.hooks.normalModuleFactory.tap("SideEffectsFlagPlugin", nmf => {
+			nmf.hooks.module.tap("SideEffectsFlagPlugin", (module, data) => {
+				const resolveData = data.resourceResolveData;
+				if (
+					resolveData &&
+					resolveData.descriptionFileData &&
+					resolveData.relativePath
+				) {
+					const sideEffects = resolveData.descriptionFileData.sideEffects;
+					const hasSideEffects = SideEffectsFlagPlugin.moduleHasSideEffects(
+						resolveData.relativePath,
+						sideEffects
+					);
+					if (!hasSideEffects) {
+						module.factoryMeta.sideEffectFree = true;
+					}
+				}
+
+				return module;
+			});
+			nmf.hooks.module.tap("SideEffectsFlagPlugin", (module, data) => {
+				if (data.settings.sideEffects === false) {
+					module.factoryMeta.sideEffectFree = true;
+				} else if (data.settings.sideEffects === true) {
+					module.factoryMeta.sideEffectFree = false;
+				}
+			});
+		});
+		compiler.hooks.compilation.tap("SideEffectsFlagPlugin", compilation => {
+			compilation.hooks.optimizeDependencies.tap(
+				"SideEffectsFlagPlugin",
+				modules => {
+					/** @type {Map<Module, ReexportInfo>} */
+					const reexportMaps = new Map();
+
+					// Capture reexports of sideEffectFree modules
+					for (const module of modules) {
+						/** @type {Dependency[]} */
+						const removeDependencies = [];
+						for (const dep of module.dependencies) {
+							if (dep instanceof HarmonyImportSideEffectDependency) {
+								if (dep.module && dep.module.factoryMeta.sideEffectFree) {
+									removeDependencies.push(dep);
+								}
+							} else if (
+								dep instanceof HarmonyExportImportedSpecifierDependency
+							) {
+								if (module.factoryMeta.sideEffectFree) {
+									const mode = dep.getMode(true);
+									if (
+										mode.type === "safe-reexport" ||
+										mode.type === "checked-reexport" ||
+										mode.type === "dynamic-reexport" ||
+										mode.type === "reexport-non-harmony-default" ||
+										mode.type === "reexport-non-harmony-default-strict" ||
+										mode.type === "reexport-named-default"
+									) {
+										let info = reexportMaps.get(module);
+										if (!info) {
+											reexportMaps.set(
+												module,
+												(info = {
+													static: new Map(),
+													dynamic: new Map()
+												})
+											);
+										}
+										const targetModule = dep._module;
+										switch (mode.type) {
+											case "safe-reexport":
+												for (const [key, id] of mode.map) {
+													if (id) {
+														addStaticReexport(
+															info,
+															key,
+															targetModule,
+															id,
+															false
+														);
+													}
+												}
+												break;
+											case "checked-reexport":
+												for (const [key, id] of mode.map) {
+													if (id) {
+														addStaticReexport(
+															info,
+															key,
+															targetModule,
+															id,
+															true
+														);
+													}
+												}
+												break;
+											case "dynamic-reexport":
+												addDynamicReexport(info, targetModule, mode.ignored);
+												break;
+											case "reexport-non-harmony-default":
+											case "reexport-non-harmony-default-strict":
+											case "reexport-named-default":
+												addStaticReexport(
+													info,
+													mode.name,
+													targetModule,
+													"default",
+													false
+												);
+												break;
+										}
+									}
+								}
+							}
+						}
+					}
+
+					// Flatten reexports
+					for (const info of reexportMaps.values()) {
+						const dynamicReexports = info.dynamic;
+						info.dynamic = new Map();
+						for (const reexport of dynamicReexports) {
+							let [targetModule, ignored] = reexport;
+							for (;;) {
+								const innerInfo = reexportMaps.get(targetModule);
+								if (!innerInfo) break;
+
+								for (const [key, reexports] of innerInfo.static) {
+									if (ignored.has(key)) continue;
+									for (const { module, exportName, checked } of reexports) {
+										addStaticReexport(info, key, module, exportName, checked);
+									}
+								}
+
+								// Follow dynamic reexport if there is only one
+								if (innerInfo.dynamic.size !== 1) {
+									// When there are more then one, we don't know which one
+									break;
+								}
+
+								ignored = new Set(ignored);
+								for (const [innerModule, innerIgnored] of innerInfo.dynamic) {
+									for (const key of innerIgnored) {
+										if (ignored.has(key)) continue;
+										// This reexports ends here
+										addStaticReexport(info, key, targetModule, key, true);
+										ignored.add(key);
+									}
+									targetModule = innerModule;
+								}
+							}
+
+							// Update reexport as all other cases has been handled
+							addDynamicReexport(info, targetModule, ignored);
+						}
+					}
+
+					for (const info of reexportMaps.values()) {
+						const staticReexports = info.static;
+						info.static = new Map();
+						for (const [key, reexports] of staticReexports) {
+							for (let mapping of reexports) {
+								for (;;) {
+									const innerInfo = reexportMaps.get(mapping.module);
+									if (!innerInfo) break;
+
+									const newMapping = getMappingFromInfo(
+										innerInfo,
+										mapping.exportName
+									);
+									if (!newMapping) break;
+									mapping = newMapping;
+								}
+								addStaticReexport(
+									info,
+									key,
+									mapping.module,
+									mapping.exportName,
+									mapping.checked
+								);
+							}
+						}
+					}
+
+					// Update imports along the reexports from sideEffectFree modules
+					for (const pair of reexportMaps) {
+						const module = pair[0];
+						const info = pair[1];
+						let newReasons = undefined;
+						for (let i = 0; i < module.reasons.length; i++) {
+							const reason = module.reasons[i];
+							const dep = reason.dependency;
+							if (
+								(dep instanceof HarmonyExportImportedSpecifierDependency ||
+									(dep instanceof HarmonyImportSpecifierDependency &&
+										!dep.namespaceObjectAsContext)) &&
+								dep._id
+							) {
+								const mapping = getMappingFromInfo(info, dep._id);
+								if (mapping) {
+									dep.redirectedModule = mapping.module;
+									dep.redirectedId = mapping.exportName;
+									mapping.module.addReason(
+										reason.module,
+										dep,
+										reason.explanation
+											? reason.explanation +
+													" (skipped side-effect-free modules)"
+											: "(skipped side-effect-free modules)"
+									);
+									// removing the currect reason, by not adding it to the newReasons array
+									// lazily create the newReasons array
+									if (newReasons === undefined) {
+										newReasons = i === 0 ? [] : module.reasons.slice(0, i);
+									}
+									continue;
+								}
+							}
+							if (newReasons !== undefined) newReasons.push(reason);
+						}
+						if (newReasons !== undefined) {
+							module.reasons = newReasons;
+						}
+					}
+				}
+			);
+		});
+	}
+
+	static moduleHasSideEffects(moduleName, flagValue) {
+		switch (typeof flagValue) {
+			case "undefined":
+				return true;
+			case "boolean":
+				return flagValue;
+			case "string":
+				if (process.platform === "win32") {
+					flagValue = flagValue.replace(/\\/g, "/");
+				}
+				return mm.isMatch(moduleName, flagValue, {
+					matchBase: true
+				});
+			case "object":
+				return flagValue.some(glob =>
+					SideEffectsFlagPlugin.moduleHasSideEffects(moduleName, glob)
+				);
+		}
+	}
+}
+module.exports = SideEffectsFlagPlugin;
diff --git a/node_modules/webpack/lib/optimize/SplitChunksPlugin.js b/node_modules/webpack/lib/optimize/SplitChunksPlugin.js
new file mode 100644
index 0000000..439e407
--- /dev/null
+++ b/node_modules/webpack/lib/optimize/SplitChunksPlugin.js
@@ -0,0 +1,968 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const crypto = require("crypto");
+const SortableSet = require("../util/SortableSet");
+const GraphHelpers = require("../GraphHelpers");
+const { isSubset } = require("../util/SetHelpers");
+const deterministicGrouping = require("../util/deterministicGrouping");
+const MinMaxSizeWarning = require("./MinMaxSizeWarning");
+const contextify = require("../util/identifier").contextify;
+
+/** @typedef {import("../Compiler")} Compiler */
+/** @typedef {import("../Chunk")} Chunk */
+/** @typedef {import("../Module")} Module */
+/** @typedef {import("../util/deterministicGrouping").Options<Module>} DeterministicGroupingOptionsForModule */
+/** @typedef {import("../util/deterministicGrouping").GroupedItems<Module>} DeterministicGroupingGroupedItemsForModule */
+
+const deterministicGroupingForModules = /** @type {function(DeterministicGroupingOptionsForModule): DeterministicGroupingGroupedItemsForModule[]} */ (deterministicGrouping);
+
+const hashFilename = name => {
+	return crypto
+		.createHash("md4")
+		.update(name)
+		.digest("hex")
+		.slice(0, 8);
+};
+
+const sortByIdentifier = (a, b) => {
+	if (a.identifier() > b.identifier()) return 1;
+	if (a.identifier() < b.identifier()) return -1;
+	return 0;
+};
+
+const getRequests = chunk => {
+	let requests = 0;
+	for (const chunkGroup of chunk.groupsIterable) {
+		requests = Math.max(requests, chunkGroup.chunks.length);
+	}
+	return requests;
+};
+
+const getModulesSize = modules => {
+	let sum = 0;
+	for (const m of modules) {
+		sum += m.size();
+	}
+	return sum;
+};
+
+/**
+ * @template T
+ * @param {Set<T>} a set
+ * @param {Set<T>} b other set
+ * @returns {boolean} true if at least one item of a is in b
+ */
+const isOverlap = (a, b) => {
+	for (const item of a) {
+		if (b.has(item)) return true;
+	}
+	return false;
+};
+
+const compareEntries = (a, b) => {
+	// 1. by priority
+	const diffPriority = a.cacheGroup.priority - b.cacheGroup.priority;
+	if (diffPriority) return diffPriority;
+	// 2. by number of chunks
+	const diffCount = a.chunks.size - b.chunks.size;
+	if (diffCount) return diffCount;
+	// 3. by size reduction
+	const aSizeReduce = a.size * (a.chunks.size - 1);
+	const bSizeReduce = b.size * (b.chunks.size - 1);
+	const diffSizeReduce = aSizeReduce - bSizeReduce;
+	if (diffSizeReduce) return diffSizeReduce;
+	// 4. by cache group index
+	const indexDiff = a.cacheGroupIndex - b.cacheGroupIndex;
+	if (indexDiff) return indexDiff;
+	// 5. by number of modules (to be able to compare by identifier)
+	const modulesA = a.modules;
+	const modulesB = b.modules;
+	const diff = modulesA.size - modulesB.size;
+	if (diff) return diff;
+	// 6. by module identifiers
+	modulesA.sort();
+	modulesB.sort();
+	const aI = modulesA[Symbol.iterator]();
+	const bI = modulesB[Symbol.iterator]();
+	// eslint-disable-next-line no-constant-condition
+	while (true) {
+		const aItem = aI.next();
+		const bItem = bI.next();
+		if (aItem.done) return 0;
+		const aModuleIdentifier = aItem.value.identifier();
+		const bModuleIdentifier = bItem.value.identifier();
+		if (aModuleIdentifier > bModuleIdentifier) return -1;
+		if (aModuleIdentifier < bModuleIdentifier) return 1;
+	}
+};
+
+const compareNumbers = (a, b) => a - b;
+
+const INITIAL_CHUNK_FILTER = chunk => chunk.canBeInitial();
+const ASYNC_CHUNK_FILTER = chunk => !chunk.canBeInitial();
+const ALL_CHUNK_FILTER = chunk => true;
+
+module.exports = class SplitChunksPlugin {
+	constructor(options) {
+		this.options = SplitChunksPlugin.normalizeOptions(options);
+	}
+
+	static normalizeOptions(options = {}) {
+		return {
+			chunksFilter: SplitChunksPlugin.normalizeChunksFilter(
+				options.chunks || "all"
+			),
+			minSize: options.minSize || 0,
+			enforceSizeThreshold: options.enforceSizeThreshold || 0,
+			maxSize: options.maxSize || 0,
+			minChunks: options.minChunks || 1,
+			maxAsyncRequests: options.maxAsyncRequests || 1,
+			maxInitialRequests: options.maxInitialRequests || 1,
+			hidePathInfo: options.hidePathInfo || false,
+			filename: options.filename || undefined,
+			getCacheGroups: SplitChunksPlugin.normalizeCacheGroups({
+				cacheGroups: options.cacheGroups,
+				name: options.name,
+				automaticNameDelimiter: options.automaticNameDelimiter,
+				automaticNameMaxLength: options.automaticNameMaxLength
+			}),
+			automaticNameDelimiter: options.automaticNameDelimiter,
+			automaticNameMaxLength: options.automaticNameMaxLength || 109,
+			fallbackCacheGroup: SplitChunksPlugin.normalizeFallbackCacheGroup(
+				options.fallbackCacheGroup || {},
+				options
+			)
+		};
+	}
+
+	static normalizeName({
+		name,
+		automaticNameDelimiter,
+		automaticNamePrefix,
+		automaticNameMaxLength
+	}) {
+		if (name === true) {
+			/** @type {WeakMap<Chunk[], Record<string, string>>} */
+			const cache = new WeakMap();
+			const fn = (module, chunks, cacheGroup) => {
+				let cacheEntry = cache.get(chunks);
+				if (cacheEntry === undefined) {
+					cacheEntry = {};
+					cache.set(chunks, cacheEntry);
+				} else if (cacheGroup in cacheEntry) {
+					return cacheEntry[cacheGroup];
+				}
+				const names = chunks.map(c => c.name);
+				if (!names.every(Boolean)) {
+					cacheEntry[cacheGroup] = undefined;
+					return;
+				}
+				names.sort();
+				const prefix =
+					typeof automaticNamePrefix === "string"
+						? automaticNamePrefix
+						: cacheGroup;
+				const namePrefix = prefix ? prefix + automaticNameDelimiter : "";
+				let name = namePrefix + names.join(automaticNameDelimiter);
+				// Filenames and paths can't be too long otherwise an
+				// ENAMETOOLONG error is raised. If the generated name if too
+				// long, it is truncated and a hash is appended. The limit has
+				// been set to 109 to prevent `[name].[chunkhash].[ext]` from
+				// generating a 256+ character string.
+				if (name.length > automaticNameMaxLength) {
+					const hashedFilename = hashFilename(name);
+					const sliceLength =
+						automaticNameMaxLength -
+						(automaticNameDelimiter.length + hashedFilename.length);
+					name =
+						name.slice(0, sliceLength) +
+						automaticNameDelimiter +
+						hashedFilename;
+				}
+				cacheEntry[cacheGroup] = name;
+				return name;
+			};
+			return fn;
+		}
+		if (typeof name === "string") {
+			const fn = () => {
+				return name;
+			};
+			return fn;
+		}
+		if (typeof name === "function") return name;
+	}
+
+	static normalizeChunksFilter(chunks) {
+		if (chunks === "initial") {
+			return INITIAL_CHUNK_FILTER;
+		}
+		if (chunks === "async") {
+			return ASYNC_CHUNK_FILTER;
+		}
+		if (chunks === "all") {
+			return ALL_CHUNK_FILTER;
+		}
+		if (typeof chunks === "function") return chunks;
+	}
+
+	static normalizeFallbackCacheGroup(
+		{
+			minSize = undefined,
+			maxSize = undefined,
+			automaticNameDelimiter = undefined
+		},
+		{
+			minSize: defaultMinSize = undefined,
+			maxSize: defaultMaxSize = undefined,
+			automaticNameDelimiter: defaultAutomaticNameDelimiter = undefined
+		}
+	) {
+		return {
+			minSize: typeof minSize === "number" ? minSize : defaultMinSize || 0,
+			maxSize: typeof maxSize === "number" ? maxSize : defaultMaxSize || 0,
+			automaticNameDelimiter:
+				automaticNameDelimiter || defaultAutomaticNameDelimiter || "~"
+		};
+	}
+
+	static normalizeCacheGroups({
+		cacheGroups,
+		name,
+		automaticNameDelimiter,
+		automaticNameMaxLength
+	}) {
+		if (typeof cacheGroups === "function") {
+			// TODO webpack 5 remove this
+			if (cacheGroups.length !== 1) {
+				return module => cacheGroups(module, module.getChunks());
+			}
+			return cacheGroups;
+		}
+		if (cacheGroups && typeof cacheGroups === "object") {
+			const fn = module => {
+				let results;
+				for (const key of Object.keys(cacheGroups)) {
+					let option = cacheGroups[key];
+					if (option === false) continue;
+					if (option instanceof RegExp || typeof option === "string") {
+						option = {
+							test: option
+						};
+					}
+					if (typeof option === "function") {
+						let result = option(module);
+						if (result) {
+							if (results === undefined) results = [];
+							for (const r of Array.isArray(result) ? result : [result]) {
+								const result = Object.assign({ key }, r);
+								if (result.name) result.getName = () => result.name;
+								if (result.chunks) {
+									result.chunksFilter = SplitChunksPlugin.normalizeChunksFilter(
+										result.chunks
+									);
+								}
+								results.push(result);
+							}
+						}
+					} else if (SplitChunksPlugin.checkTest(option.test, module)) {
+						if (results === undefined) results = [];
+						results.push({
+							key: key,
+							priority: option.priority,
+							getName:
+								SplitChunksPlugin.normalizeName({
+									name: option.name || name,
+									automaticNameDelimiter:
+										typeof option.automaticNameDelimiter === "string"
+											? option.automaticNameDelimiter
+											: automaticNameDelimiter,
+									automaticNamePrefix: option.automaticNamePrefix,
+									automaticNameMaxLength:
+										option.automaticNameMaxLength || automaticNameMaxLength
+								}) || (() => {}),
+							chunksFilter: SplitChunksPlugin.normalizeChunksFilter(
+								option.chunks
+							),
+							enforce: option.enforce,
+							minSize: option.minSize,
+							enforceSizeThreshold: option.enforceSizeThreshold,
+							maxSize: option.maxSize,
+							minChunks: option.minChunks,
+							maxAsyncRequests: option.maxAsyncRequests,
+							maxInitialRequests: option.maxInitialRequests,
+							filename: option.filename,
+							reuseExistingChunk: option.reuseExistingChunk
+						});
+					}
+				}
+				return results;
+			};
+			return fn;
+		}
+		const fn = () => {};
+		return fn;
+	}
+
+	static checkTest(test, module) {
+		if (test === undefined) return true;
+		if (typeof test === "function") {
+			if (test.length !== 1) {
+				return test(module, module.getChunks());
+			}
+			return test(module);
+		}
+		if (typeof test === "boolean") return test;
+		if (typeof test === "string") {
+			if (
+				module.nameForCondition &&
+				module.nameForCondition().startsWith(test)
+			) {
+				return true;
+			}
+			for (const chunk of module.chunksIterable) {
+				if (chunk.name && chunk.name.startsWith(test)) {
+					return true;
+				}
+			}
+			return false;
+		}
+		if (test instanceof RegExp) {
+			if (module.nameForCondition && test.test(module.nameForCondition())) {
+				return true;
+			}
+			for (const chunk of module.chunksIterable) {
+				if (chunk.name && test.test(chunk.name)) {
+					return true;
+				}
+			}
+			return false;
+		}
+		return false;
+	}
+
+	/**
+	 * @param {Compiler} compiler webpack compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap("SplitChunksPlugin", compilation => {
+			let alreadyOptimized = false;
+			compilation.hooks.unseal.tap("SplitChunksPlugin", () => {
+				alreadyOptimized = false;
+			});
+			compilation.hooks.optimizeChunksAdvanced.tap(
+				"SplitChunksPlugin",
+				chunks => {
+					if (alreadyOptimized) return;
+					alreadyOptimized = true;
+					// Give each selected chunk an index (to create strings from chunks)
+					const indexMap = new Map();
+					let index = 1;
+					for (const chunk of chunks) {
+						indexMap.set(chunk, index++);
+					}
+					const getKey = chunks => {
+						return Array.from(chunks, c => indexMap.get(c))
+							.sort(compareNumbers)
+							.join();
+					};
+					/** @type {Map<string, Set<Chunk>>} */
+					const chunkSetsInGraph = new Map();
+					for (const module of compilation.modules) {
+						const chunksKey = getKey(module.chunksIterable);
+						if (!chunkSetsInGraph.has(chunksKey)) {
+							chunkSetsInGraph.set(chunksKey, new Set(module.chunksIterable));
+						}
+					}
+
+					// group these set of chunks by count
+					// to allow to check less sets via isSubset
+					// (only smaller sets can be subset)
+					/** @type {Map<number, Array<Set<Chunk>>>} */
+					const chunkSetsByCount = new Map();
+					for (const chunksSet of chunkSetsInGraph.values()) {
+						const count = chunksSet.size;
+						let array = chunkSetsByCount.get(count);
+						if (array === undefined) {
+							array = [];
+							chunkSetsByCount.set(count, array);
+						}
+						array.push(chunksSet);
+					}
+
+					// Create a list of possible combinations
+					const combinationsCache = new Map(); // Map<string, Set<Chunk>[]>
+
+					const getCombinations = key => {
+						const chunksSet = chunkSetsInGraph.get(key);
+						var array = [chunksSet];
+						if (chunksSet.size > 1) {
+							for (const [count, setArray] of chunkSetsByCount) {
+								// "equal" is not needed because they would have been merge in the first step
+								if (count < chunksSet.size) {
+									for (const set of setArray) {
+										if (isSubset(chunksSet, set)) {
+											array.push(set);
+										}
+									}
+								}
+							}
+						}
+						return array;
+					};
+
+					/**
+					 * @typedef {Object} SelectedChunksResult
+					 * @property {Chunk[]} chunks the list of chunks
+					 * @property {string} key a key of the list
+					 */
+
+					/**
+					 * @typedef {function(Chunk): boolean} ChunkFilterFunction
+					 */
+
+					/** @type {WeakMap<Set<Chunk>, WeakMap<ChunkFilterFunction, SelectedChunksResult>>} */
+					const selectedChunksCacheByChunksSet = new WeakMap();
+
+					/**
+					 * get list and key by applying the filter function to the list
+					 * It is cached for performance reasons
+					 * @param {Set<Chunk>} chunks list of chunks
+					 * @param {ChunkFilterFunction} chunkFilter filter function for chunks
+					 * @returns {SelectedChunksResult} list and key
+					 */
+					const getSelectedChunks = (chunks, chunkFilter) => {
+						let entry = selectedChunksCacheByChunksSet.get(chunks);
+						if (entry === undefined) {
+							entry = new WeakMap();
+							selectedChunksCacheByChunksSet.set(chunks, entry);
+						}
+						/** @type {SelectedChunksResult} */
+						let entry2 = entry.get(chunkFilter);
+						if (entry2 === undefined) {
+							/** @type {Chunk[]} */
+							const selectedChunks = [];
+							for (const chunk of chunks) {
+								if (chunkFilter(chunk)) selectedChunks.push(chunk);
+							}
+							entry2 = {
+								chunks: selectedChunks,
+								key: getKey(selectedChunks)
+							};
+							entry.set(chunkFilter, entry2);
+						}
+						return entry2;
+					};
+
+					/**
+					 * @typedef {Object} ChunksInfoItem
+					 * @property {SortableSet} modules
+					 * @property {TODO} cacheGroup
+					 * @property {number} cacheGroupIndex
+					 * @property {string} name
+					 * @property {number} size
+					 * @property {Set<Chunk>} chunks
+					 * @property {Set<Chunk>} reuseableChunks
+					 * @property {Set<string>} chunksKeys
+					 */
+
+					// Map a list of chunks to a list of modules
+					// For the key the chunk "index" is used, the value is a SortableSet of modules
+					/** @type {Map<string, ChunksInfoItem>} */
+					const chunksInfoMap = new Map();
+
+					/**
+					 * @param {TODO} cacheGroup the current cache group
+					 * @param {number} cacheGroupIndex the index of the cache group of ordering
+					 * @param {Chunk[]} selectedChunks chunks selected for this module
+					 * @param {string} selectedChunksKey a key of selectedChunks
+					 * @param {Module} module the current module
+					 * @returns {void}
+					 */
+					const addModuleToChunksInfoMap = (
+						cacheGroup,
+						cacheGroupIndex,
+						selectedChunks,
+						selectedChunksKey,
+						module
+					) => {
+						// Break if minimum number of chunks is not reached
+						if (selectedChunks.length < cacheGroup.minChunks) return;
+						// Determine name for split chunk
+						const name = cacheGroup.getName(
+							module,
+							selectedChunks,
+							cacheGroup.key
+						);
+						// Create key for maps
+						// When it has a name we use the name as key
+						// Elsewise we create the key from chunks and cache group key
+						// This automatically merges equal names
+						const key =
+							cacheGroup.key +
+							(name ? ` name:${name}` : ` chunks:${selectedChunksKey}`);
+						// Add module to maps
+						let info = chunksInfoMap.get(key);
+						if (info === undefined) {
+							chunksInfoMap.set(
+								key,
+								(info = {
+									modules: new SortableSet(undefined, sortByIdentifier),
+									cacheGroup,
+									cacheGroupIndex,
+									name,
+									size: 0,
+									chunks: new Set(),
+									reuseableChunks: new Set(),
+									chunksKeys: new Set()
+								})
+							);
+						}
+						info.modules.add(module);
+						info.size += module.size();
+						if (!info.chunksKeys.has(selectedChunksKey)) {
+							info.chunksKeys.add(selectedChunksKey);
+							for (const chunk of selectedChunks) {
+								info.chunks.add(chunk);
+							}
+						}
+					};
+
+					// Walk through all modules
+					for (const module of compilation.modules) {
+						// Get cache group
+						let cacheGroups = this.options.getCacheGroups(module);
+						if (!Array.isArray(cacheGroups) || cacheGroups.length === 0) {
+							continue;
+						}
+
+						// Prepare some values
+						const chunksKey = getKey(module.chunksIterable);
+						let combs = combinationsCache.get(chunksKey);
+						if (combs === undefined) {
+							combs = getCombinations(chunksKey);
+							combinationsCache.set(chunksKey, combs);
+						}
+
+						let cacheGroupIndex = 0;
+						for (const cacheGroupSource of cacheGroups) {
+							const minSize =
+								cacheGroupSource.minSize !== undefined
+									? cacheGroupSource.minSize
+									: cacheGroupSource.enforce
+									? 0
+									: this.options.minSize;
+							const enforceSizeThreshold =
+								cacheGroupSource.enforceSizeThreshold !== undefined
+									? cacheGroupSource.enforceSizeThreshold
+									: cacheGroupSource.enforce
+									? 0
+									: this.options.enforceSizeThreshold;
+							const cacheGroup = {
+								key: cacheGroupSource.key,
+								priority: cacheGroupSource.priority || 0,
+								chunksFilter:
+									cacheGroupSource.chunksFilter || this.options.chunksFilter,
+								minSize,
+								minSizeForMaxSize:
+									cacheGroupSource.minSize !== undefined
+										? cacheGroupSource.minSize
+										: this.options.minSize,
+								enforceSizeThreshold,
+								maxSize:
+									cacheGroupSource.maxSize !== undefined
+										? cacheGroupSource.maxSize
+										: cacheGroupSource.enforce
+										? 0
+										: this.options.maxSize,
+								minChunks:
+									cacheGroupSource.minChunks !== undefined
+										? cacheGroupSource.minChunks
+										: cacheGroupSource.enforce
+										? 1
+										: this.options.minChunks,
+								maxAsyncRequests:
+									cacheGroupSource.maxAsyncRequests !== undefined
+										? cacheGroupSource.maxAsyncRequests
+										: cacheGroupSource.enforce
+										? Infinity
+										: this.options.maxAsyncRequests,
+								maxInitialRequests:
+									cacheGroupSource.maxInitialRequests !== undefined
+										? cacheGroupSource.maxInitialRequests
+										: cacheGroupSource.enforce
+										? Infinity
+										: this.options.maxInitialRequests,
+								getName:
+									cacheGroupSource.getName !== undefined
+										? cacheGroupSource.getName
+										: this.options.getName,
+								filename:
+									cacheGroupSource.filename !== undefined
+										? cacheGroupSource.filename
+										: this.options.filename,
+								automaticNameDelimiter:
+									cacheGroupSource.automaticNameDelimiter !== undefined
+										? cacheGroupSource.automaticNameDelimiter
+										: this.options.automaticNameDelimiter,
+								reuseExistingChunk: cacheGroupSource.reuseExistingChunk,
+								_validateSize: minSize > 0,
+								_conditionalEnforce: enforceSizeThreshold > 0
+							};
+							// For all combination of chunk selection
+							for (const chunkCombination of combs) {
+								// Break if minimum number of chunks is not reached
+								if (chunkCombination.size < cacheGroup.minChunks) continue;
+								// Select chunks by configuration
+								const {
+									chunks: selectedChunks,
+									key: selectedChunksKey
+								} = getSelectedChunks(
+									chunkCombination,
+									cacheGroup.chunksFilter
+								);
+
+								addModuleToChunksInfoMap(
+									cacheGroup,
+									cacheGroupIndex,
+									selectedChunks,
+									selectedChunksKey,
+									module
+								);
+							}
+							cacheGroupIndex++;
+						}
+					}
+
+					// Filter items were size < minSize
+					for (const pair of chunksInfoMap) {
+						const info = pair[1];
+						if (
+							info.cacheGroup._validateSize &&
+							info.size < info.cacheGroup.minSize
+						) {
+							chunksInfoMap.delete(pair[0]);
+						}
+					}
+
+					/** @type {Map<Chunk, {minSize: number, maxSize: number, automaticNameDelimiter: string, keys: string[]}>} */
+					const maxSizeQueueMap = new Map();
+
+					while (chunksInfoMap.size > 0) {
+						// Find best matching entry
+						let bestEntryKey;
+						let bestEntry;
+						for (const pair of chunksInfoMap) {
+							const key = pair[0];
+							const info = pair[1];
+							if (bestEntry === undefined) {
+								bestEntry = info;
+								bestEntryKey = key;
+							} else if (compareEntries(bestEntry, info) < 0) {
+								bestEntry = info;
+								bestEntryKey = key;
+							}
+						}
+
+						const item = bestEntry;
+						chunksInfoMap.delete(bestEntryKey);
+
+						let chunkName = item.name;
+						// Variable for the new chunk (lazy created)
+						/** @type {Chunk} */
+						let newChunk;
+						// When no chunk name, check if we can reuse a chunk instead of creating a new one
+						let isReused = false;
+						if (item.cacheGroup.reuseExistingChunk) {
+							outer: for (const chunk of item.chunks) {
+								if (chunk.getNumberOfModules() !== item.modules.size) continue;
+								if (chunk.hasEntryModule()) continue;
+								for (const module of item.modules) {
+									if (!chunk.containsModule(module)) continue outer;
+								}
+								if (!newChunk || !newChunk.name) {
+									newChunk = chunk;
+								} else if (
+									chunk.name &&
+									chunk.name.length < newChunk.name.length
+								) {
+									newChunk = chunk;
+								} else if (
+									chunk.name &&
+									chunk.name.length === newChunk.name.length &&
+									chunk.name < newChunk.name
+								) {
+									newChunk = chunk;
+								}
+								chunkName = undefined;
+								isReused = true;
+							}
+						}
+						// Check if maxRequests condition can be fulfilled
+
+						const selectedChunks = Array.from(item.chunks).filter(chunk => {
+							// skip if we address ourself
+							return (
+								(!chunkName || chunk.name !== chunkName) && chunk !== newChunk
+							);
+						});
+
+						const enforced =
+							item.cacheGroup._conditionalEnforce &&
+							item.size >= item.cacheGroup.enforceSizeThreshold;
+
+						// Skip when no chunk selected
+						if (selectedChunks.length === 0) continue;
+
+						const usedChunks = new Set(selectedChunks);
+
+						// Check if maxRequests condition can be fulfilled
+						if (
+							!enforced &&
+							(Number.isFinite(item.cacheGroup.maxInitialRequests) ||
+								Number.isFinite(item.cacheGroup.maxAsyncRequests))
+						) {
+							for (const chunk of usedChunks) {
+								// respect max requests
+								const maxRequests = chunk.isOnlyInitial()
+									? item.cacheGroup.maxInitialRequests
+									: chunk.canBeInitial()
+									? Math.min(
+											item.cacheGroup.maxInitialRequests,
+											item.cacheGroup.maxAsyncRequests
+									  )
+									: item.cacheGroup.maxAsyncRequests;
+								if (
+									isFinite(maxRequests) &&
+									getRequests(chunk) >= maxRequests
+								) {
+									usedChunks.delete(chunk);
+								}
+							}
+						}
+
+						outer: for (const chunk of usedChunks) {
+							for (const module of item.modules) {
+								if (chunk.containsModule(module)) continue outer;
+							}
+							usedChunks.delete(chunk);
+						}
+
+						// Were some (invalid) chunks removed from usedChunks?
+						// => readd all modules to the queue, as things could have been changed
+						if (usedChunks.size < selectedChunks.length) {
+							if (usedChunks.size >= item.cacheGroup.minChunks) {
+								const chunksArr = Array.from(usedChunks);
+								for (const module of item.modules) {
+									addModuleToChunksInfoMap(
+										item.cacheGroup,
+										item.cacheGroupIndex,
+										chunksArr,
+										getKey(usedChunks),
+										module
+									);
+								}
+							}
+							continue;
+						}
+
+						// Create the new chunk if not reusing one
+						if (!isReused) {
+							newChunk = compilation.addChunk(chunkName);
+						}
+						// Walk through all chunks
+						for (const chunk of usedChunks) {
+							// Add graph connections for splitted chunk
+							chunk.split(newChunk);
+						}
+
+						// Add a note to the chunk
+						newChunk.chunkReason = isReused
+							? "reused as split chunk"
+							: "split chunk";
+						if (item.cacheGroup.key) {
+							newChunk.chunkReason += ` (cache group: ${item.cacheGroup.key})`;
+						}
+						if (chunkName) {
+							newChunk.chunkReason += ` (name: ${chunkName})`;
+							// If the chosen name is already an entry point we remove the entry point
+							const entrypoint = compilation.entrypoints.get(chunkName);
+							if (entrypoint) {
+								compilation.entrypoints.delete(chunkName);
+								entrypoint.remove();
+								newChunk.entryModule = undefined;
+							}
+						}
+						if (item.cacheGroup.filename) {
+							if (!newChunk.isOnlyInitial()) {
+								throw new Error(
+									"SplitChunksPlugin: You are trying to set a filename for a chunk which is (also) loaded on demand. " +
+										"The runtime can only handle loading of chunks which match the chunkFilename schema. " +
+										"Using a custom filename would fail at runtime. " +
+										`(cache group: ${item.cacheGroup.key})`
+								);
+							}
+							newChunk.filenameTemplate = item.cacheGroup.filename;
+						}
+						if (!isReused) {
+							// Add all modules to the new chunk
+							for (const module of item.modules) {
+								if (typeof module.chunkCondition === "function") {
+									if (!module.chunkCondition(newChunk)) continue;
+								}
+								// Add module to new chunk
+								GraphHelpers.connectChunkAndModule(newChunk, module);
+								// Remove module from used chunks
+								for (const chunk of usedChunks) {
+									chunk.removeModule(module);
+									module.rewriteChunkInReasons(chunk, [newChunk]);
+								}
+							}
+						} else {
+							// Remove all modules from used chunks
+							for (const module of item.modules) {
+								for (const chunk of usedChunks) {
+									chunk.removeModule(module);
+									module.rewriteChunkInReasons(chunk, [newChunk]);
+								}
+							}
+						}
+
+						if (item.cacheGroup.maxSize > 0) {
+							const oldMaxSizeSettings = maxSizeQueueMap.get(newChunk);
+							maxSizeQueueMap.set(newChunk, {
+								minSize: Math.max(
+									oldMaxSizeSettings ? oldMaxSizeSettings.minSize : 0,
+									item.cacheGroup.minSizeForMaxSize
+								),
+								maxSize: Math.min(
+									oldMaxSizeSettings ? oldMaxSizeSettings.maxSize : Infinity,
+									item.cacheGroup.maxSize
+								),
+								automaticNameDelimiter: item.cacheGroup.automaticNameDelimiter,
+								keys: oldMaxSizeSettings
+									? oldMaxSizeSettings.keys.concat(item.cacheGroup.key)
+									: [item.cacheGroup.key]
+							});
+						}
+
+						// remove all modules from other entries and update size
+						for (const [key, info] of chunksInfoMap) {
+							if (isOverlap(info.chunks, usedChunks)) {
+								// update modules and total size
+								// may remove it from the map when < minSize
+								const oldSize = info.modules.size;
+								for (const module of item.modules) {
+									info.modules.delete(module);
+								}
+								if (info.modules.size !== oldSize) {
+									if (info.modules.size === 0) {
+										chunksInfoMap.delete(key);
+										continue;
+									}
+									info.size = getModulesSize(info.modules);
+									if (
+										info.cacheGroup._validateSize &&
+										info.size < info.cacheGroup.minSize
+									) {
+										chunksInfoMap.delete(key);
+									}
+									if (info.modules.size === 0) {
+										chunksInfoMap.delete(key);
+									}
+								}
+							}
+						}
+					}
+
+					const incorrectMinMaxSizeSet = new Set();
+
+					// Make sure that maxSize is fulfilled
+					for (const chunk of compilation.chunks.slice()) {
+						const { minSize, maxSize, automaticNameDelimiter, keys } =
+							maxSizeQueueMap.get(chunk) || this.options.fallbackCacheGroup;
+						if (!maxSize) continue;
+						if (minSize > maxSize) {
+							const warningKey = `${keys && keys.join()} ${minSize} ${maxSize}`;
+							if (!incorrectMinMaxSizeSet.has(warningKey)) {
+								incorrectMinMaxSizeSet.add(warningKey);
+								compilation.warnings.push(
+									new MinMaxSizeWarning(keys, minSize, maxSize)
+								);
+							}
+						}
+						const results = deterministicGroupingForModules({
+							maxSize: Math.max(minSize, maxSize),
+							minSize,
+							items: chunk.modulesIterable,
+							getKey(module) {
+								const ident = contextify(
+									compilation.options.context,
+									module.identifier()
+								);
+								const name = module.nameForCondition
+									? contextify(
+											compilation.options.context,
+											module.nameForCondition()
+									  )
+									: ident.replace(/^.*!|\?[^?!]*$/g, "");
+								const fullKey =
+									name + automaticNameDelimiter + hashFilename(ident);
+								return fullKey.replace(/[\\/?]/g, "_");
+							},
+							getSize(module) {
+								return module.size();
+							}
+						});
+						results.sort((a, b) => {
+							if (a.key < b.key) return -1;
+							if (a.key > b.key) return 1;
+							return 0;
+						});
+						for (let i = 0; i < results.length; i++) {
+							const group = results[i];
+							const key = this.options.hidePathInfo
+								? hashFilename(group.key)
+								: group.key;
+							let name = chunk.name
+								? chunk.name + automaticNameDelimiter + key
+								: null;
+							if (name && name.length > 100) {
+								name =
+									name.slice(0, 100) +
+									automaticNameDelimiter +
+									hashFilename(name);
+							}
+							let newPart;
+							if (i !== results.length - 1) {
+								newPart = compilation.addChunk(name);
+								chunk.split(newPart);
+								newPart.chunkReason = chunk.chunkReason;
+								// Add all modules to the new chunk
+								for (const module of group.items) {
+									if (typeof module.chunkCondition === "function") {
+										if (!module.chunkCondition(newPart)) continue;
+									}
+									// Add module to new chunk
+									GraphHelpers.connectChunkAndModule(newPart, module);
+									// Remove module from used chunks
+									chunk.removeModule(module);
+									module.rewriteChunkInReasons(chunk, [newPart]);
+								}
+							} else {
+								// change the chunk to be a part
+								newPart = chunk;
+								chunk.name = name;
+							}
+						}
+					}
+				}
+			);
+		});
+	}
+};
diff --git a/node_modules/webpack/lib/performance/AssetsOverSizeLimitWarning.js b/node_modules/webpack/lib/performance/AssetsOverSizeLimitWarning.js
new file mode 100644
index 0000000..aac8b65
--- /dev/null
+++ b/node_modules/webpack/lib/performance/AssetsOverSizeLimitWarning.js
@@ -0,0 +1,30 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Sean Larkin @thelarkinn
+*/
+"use strict";
+
+const WebpackError = require("../WebpackError");
+const SizeFormatHelpers = require("../SizeFormatHelpers");
+
+module.exports = class AssetsOverSizeLimitWarning extends WebpackError {
+	constructor(assetsOverSizeLimit, assetLimit) {
+		const assetLists = assetsOverSizeLimit
+			.map(
+				asset =>
+					`\n  ${asset.name} (${SizeFormatHelpers.formatSize(asset.size)})`
+			)
+			.join("");
+
+		super(`asset size limit: The following asset(s) exceed the recommended size limit (${SizeFormatHelpers.formatSize(
+			assetLimit
+		)}).
+This can impact web performance.
+Assets: ${assetLists}`);
+
+		this.name = "AssetsOverSizeLimitWarning";
+		this.assets = assetsOverSizeLimit;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/performance/EntrypointsOverSizeLimitWarning.js b/node_modules/webpack/lib/performance/EntrypointsOverSizeLimitWarning.js
new file mode 100644
index 0000000..3c29553
--- /dev/null
+++ b/node_modules/webpack/lib/performance/EntrypointsOverSizeLimitWarning.js
@@ -0,0 +1,30 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Sean Larkin @thelarkinn
+*/
+"use strict";
+
+const WebpackError = require("../WebpackError");
+const SizeFormatHelpers = require("../SizeFormatHelpers");
+
+module.exports = class EntrypointsOverSizeLimitWarning extends WebpackError {
+	constructor(entrypoints, entrypointLimit) {
+		const entrypointList = entrypoints
+			.map(
+				entrypoint =>
+					`\n  ${entrypoint.name} (${SizeFormatHelpers.formatSize(
+						entrypoint.size
+					)})\n${entrypoint.files.map(asset => `      ${asset}`).join("\n")}`
+			)
+			.join("");
+		super(`entrypoint size limit: The following entrypoint(s) combined asset size exceeds the recommended limit (${SizeFormatHelpers.formatSize(
+			entrypointLimit
+		)}). This can impact web performance.
+Entrypoints:${entrypointList}\n`);
+
+		this.name = "EntrypointsOverSizeLimitWarning";
+		this.entrypoints = entrypoints;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/performance/NoAsyncChunksWarning.js b/node_modules/webpack/lib/performance/NoAsyncChunksWarning.js
new file mode 100644
index 0000000..c64475f
--- /dev/null
+++ b/node_modules/webpack/lib/performance/NoAsyncChunksWarning.js
@@ -0,0 +1,21 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Sean Larkin @thelarkinn
+*/
+"use strict";
+
+const WebpackError = require("../WebpackError");
+
+module.exports = class NoAsyncChunksWarning extends WebpackError {
+	constructor() {
+		super(
+			"webpack performance recommendations: \n" +
+				"You can limit the size of your bundles by using import() or require.ensure to lazy load some parts of your application.\n" +
+				"For more info visit https://webpack.js.org/guides/code-splitting/"
+		);
+
+		this.name = "NoAsyncChunksWarning";
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/performance/SizeLimitsPlugin.js b/node_modules/webpack/lib/performance/SizeLimitsPlugin.js
new file mode 100644
index 0000000..7b45740
--- /dev/null
+++ b/node_modules/webpack/lib/performance/SizeLimitsPlugin.js
@@ -0,0 +1,125 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Sean Larkin @thelarkinn
+*/
+"use strict";
+const EntrypointsOverSizeLimitWarning = require("./EntrypointsOverSizeLimitWarning");
+const AssetsOverSizeLimitWarning = require("./AssetsOverSizeLimitWarning");
+const NoAsyncChunksWarning = require("./NoAsyncChunksWarning");
+
+/** @typedef {import("../Compiler")} Compiler */
+/** @typedef {import("../Entrypoint")} Entrypoint */
+
+module.exports = class SizeLimitsPlugin {
+	constructor(options) {
+		this.hints = options.hints;
+		this.maxAssetSize = options.maxAssetSize;
+		this.maxEntrypointSize = options.maxEntrypointSize;
+		this.assetFilter = options.assetFilter;
+	}
+
+	/**
+	 * @param {Compiler} compiler webpack compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		const entrypointSizeLimit = this.maxEntrypointSize;
+		const assetSizeLimit = this.maxAssetSize;
+		const hints = this.hints;
+		const assetFilter =
+			this.assetFilter || ((name, source, info) => !info.development);
+
+		compiler.hooks.afterEmit.tap("SizeLimitsPlugin", compilation => {
+			const warnings = [];
+
+			/**
+			 * @param {Entrypoint} entrypoint an entrypoint
+			 * @returns {number} the size of the entrypoint
+			 */
+			const getEntrypointSize = entrypoint =>
+				entrypoint.getFiles().reduce((currentSize, file) => {
+					const asset = compilation.getAsset(file);
+					if (
+						asset &&
+						assetFilter(asset.name, asset.source, asset.info) &&
+						asset.source
+					) {
+						return currentSize + (asset.info.size || asset.source.size());
+					}
+
+					return currentSize;
+				}, 0);
+
+			const assetsOverSizeLimit = [];
+			for (const { name, source, info } of compilation.getAssets()) {
+				if (!assetFilter(name, source, info) || !source) {
+					continue;
+				}
+
+				const size = info.size || source.size();
+				if (size > assetSizeLimit) {
+					assetsOverSizeLimit.push({
+						name,
+						size
+					});
+					/** @type {any} */ (source).isOverSizeLimit = true;
+				}
+			}
+
+			const fileFilter = name => {
+				const asset = compilation.getAsset(name);
+				return asset && assetFilter(asset.name, asset.source, asset.info);
+			};
+
+			const entrypointsOverLimit = [];
+			for (const [name, entry] of compilation.entrypoints) {
+				const size = getEntrypointSize(entry);
+
+				if (size > entrypointSizeLimit) {
+					entrypointsOverLimit.push({
+						name: name,
+						size: size,
+						files: entry.getFiles().filter(fileFilter)
+					});
+					/** @type {any} */ (entry).isOverSizeLimit = true;
+				}
+			}
+
+			if (hints) {
+				// 1. Individual Chunk: Size < 250kb
+				// 2. Collective Initial Chunks [entrypoint] (Each Set?): Size < 250kb
+				// 3. No Async Chunks
+				// if !1, then 2, if !2 return
+				if (assetsOverSizeLimit.length > 0) {
+					warnings.push(
+						new AssetsOverSizeLimitWarning(assetsOverSizeLimit, assetSizeLimit)
+					);
+				}
+				if (entrypointsOverLimit.length > 0) {
+					warnings.push(
+						new EntrypointsOverSizeLimitWarning(
+							entrypointsOverLimit,
+							entrypointSizeLimit
+						)
+					);
+				}
+
+				if (warnings.length > 0) {
+					const hasAsyncChunks =
+						compilation.chunks.filter(chunk => !chunk.canBeInitial()).length >
+						0;
+
+					if (!hasAsyncChunks) {
+						warnings.push(new NoAsyncChunksWarning());
+					}
+
+					if (hints === "error") {
+						compilation.errors.push(...warnings);
+					} else {
+						compilation.warnings.push(...warnings);
+					}
+				}
+			}
+		});
+	}
+};
diff --git a/node_modules/webpack/lib/util/LazyBucketSortedSet.js b/node_modules/webpack/lib/util/LazyBucketSortedSet.js
new file mode 100644
index 0000000..61d3d3f
--- /dev/null
+++ b/node_modules/webpack/lib/util/LazyBucketSortedSet.js
@@ -0,0 +1,235 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const SortableSet = require("./SortableSet");
+
+/**
+ * @template T
+ * @template K
+ * Multi layer bucket sorted set
+ * Supports adding non-existing items (DO NOT ADD ITEM TWICE)
+ * Supports removing exiting items (DO NOT REMOVE ITEM NOT IN SET)
+ * Supports popping the first items according to defined order
+ * Supports iterating all items without order
+ * Supports updating an item in an efficient way
+ * Supports size property, which is the number of items
+ * Items are lazy partially sorted when needed
+ */
+class LazyBucketSortedSet {
+	/**
+	 * @param {function(T): K} getKey function to get key from item
+	 * @param {function(K, K): number} comparator comparator to sort keys
+	 * @param  {...((function(T): any) | (function(any, any): number))} args more pairs of getKey and comparator plus optional final comparator for the last layer
+	 */
+	constructor(getKey, comparator, ...args) {
+		this._getKey = getKey;
+		this._innerArgs = args;
+		this._leaf = args.length <= 1;
+		this._keys = new SortableSet(undefined, comparator);
+		/** @type {Map<K, LazyBucketSortedSet<T, any> | SortableSet<T>>} */
+		this._map = new Map();
+		this._unsortedItems = new Set();
+		this.size = 0;
+	}
+
+	/**
+	 * @param {T} item an item
+	 * @returns {void}
+	 */
+	add(item) {
+		this.size++;
+		this._unsortedItems.add(item);
+	}
+
+	/**
+	 * @param {K} key key of item
+	 * @param {T} item the item
+	 * @returns {void}
+	 */
+	_addInternal(key, item) {
+		let entry = this._map.get(key);
+		if (entry === undefined) {
+			entry = this._leaf
+				? new SortableSet(undefined, this._innerArgs[0])
+				: new /** @type {any} */ (LazyBucketSortedSet)(...this._innerArgs);
+			this._keys.add(key);
+			this._map.set(key, entry);
+		}
+		entry.add(item);
+	}
+
+	/**
+	 * @param {T} item an item
+	 * @returns {void}
+	 */
+	delete(item) {
+		this.size--;
+		if (this._unsortedItems.has(item)) {
+			this._unsortedItems.delete(item);
+			return;
+		}
+		const key = this._getKey(item);
+		const entry = this._map.get(key);
+		entry.delete(item);
+		if (entry.size === 0) {
+			this._deleteKey(key);
+		}
+	}
+
+	/**
+	 * @param {K} key key to be removed
+	 * @returns {void}
+	 */
+	_deleteKey(key) {
+		this._keys.delete(key);
+		this._map.delete(key);
+	}
+
+	/**
+	 * @returns {T | undefined} an item
+	 */
+	popFirst() {
+		if (this.size === 0) return undefined;
+		this.size--;
+		if (this._unsortedItems.size > 0) {
+			for (const item of this._unsortedItems) {
+				const key = this._getKey(item);
+				this._addInternal(key, item);
+			}
+			this._unsortedItems.clear();
+		}
+		this._keys.sort();
+		const key = this._keys.values().next().value;
+		const entry = this._map.get(key);
+		if (this._leaf) {
+			const leafEntry = /** @type {SortableSet<T>} */ (entry);
+			leafEntry.sort();
+			const item = leafEntry.values().next().value;
+			leafEntry.delete(item);
+			if (leafEntry.size === 0) {
+				this._deleteKey(key);
+			}
+			return item;
+		} else {
+			const nodeEntry = /** @type {LazyBucketSortedSet<T, any>} */ (entry);
+			const item = nodeEntry.popFirst();
+			if (nodeEntry.size === 0) {
+				this._deleteKey(key);
+			}
+			return item;
+		}
+	}
+
+	/**
+	 * @param {T} item to be updated item
+	 * @returns {function(true=): void} finish update
+	 */
+	startUpdate(item) {
+		if (this._unsortedItems.has(item)) {
+			return remove => {
+				if (remove) {
+					this._unsortedItems.delete(item);
+					this.size--;
+					return;
+				}
+			};
+		}
+		const key = this._getKey(item);
+		if (this._leaf) {
+			const oldEntry = /** @type {SortableSet<T>} */ (this._map.get(key));
+			return remove => {
+				if (remove) {
+					this.size--;
+					oldEntry.delete(item);
+					if (oldEntry.size === 0) {
+						this._deleteKey(key);
+					}
+					return;
+				}
+				const newKey = this._getKey(item);
+				if (key === newKey) {
+					// This flags the sortable set as unordered
+					oldEntry.add(item);
+				} else {
+					oldEntry.delete(item);
+					if (oldEntry.size === 0) {
+						this._deleteKey(key);
+					}
+					this._addInternal(newKey, item);
+				}
+			};
+		} else {
+			const oldEntry = /** @type {LazyBucketSortedSet<T, any>} */ (this._map.get(
+				key
+			));
+			const finishUpdate = oldEntry.startUpdate(item);
+			return remove => {
+				if (remove) {
+					this.size--;
+					finishUpdate(true);
+					if (oldEntry.size === 0) {
+						this._deleteKey(key);
+					}
+					return;
+				}
+				const newKey = this._getKey(item);
+				if (key === newKey) {
+					finishUpdate();
+				} else {
+					finishUpdate(true);
+					if (oldEntry.size === 0) {
+						this._deleteKey(key);
+					}
+					this._addInternal(newKey, item);
+				}
+			};
+		}
+	}
+
+	/**
+	 * @param {Iterator<T>[]} iterators list of iterators to append to
+	 * @returns {void}
+	 */
+	_appendIterators(iterators) {
+		if (this._unsortedItems.size > 0)
+			iterators.push(this._unsortedItems[Symbol.iterator]());
+		for (const key of this._keys) {
+			const entry = this._map.get(key);
+			if (this._leaf) {
+				const leafEntry = /** @type {SortableSet<T>} */ (entry);
+				const iterator = leafEntry[Symbol.iterator]();
+				iterators.push(iterator);
+			} else {
+				const nodeEntry = /** @type {LazyBucketSortedSet<T, any>} */ (entry);
+				nodeEntry._appendIterators(iterators);
+			}
+		}
+	}
+
+	/**
+	 * @returns {Iterator<T>} the iterator
+	 */
+	[Symbol.iterator]() {
+		const iterators = [];
+		this._appendIterators(iterators);
+		iterators.reverse();
+		let currentIterator = iterators.pop();
+		return {
+			next: () => {
+				const res = currentIterator.next();
+				if (res.done) {
+					if (iterators.length === 0) return res;
+					currentIterator = iterators.pop();
+					return currentIterator.next();
+				}
+				return res;
+			}
+		};
+	}
+}
+
+module.exports = LazyBucketSortedSet;
diff --git a/node_modules/webpack/lib/util/Queue.js b/node_modules/webpack/lib/util/Queue.js
new file mode 100644
index 0000000..6615e9f
--- /dev/null
+++ b/node_modules/webpack/lib/util/Queue.js
@@ -0,0 +1,46 @@
+"use strict";
+
+/**
+ * @template T
+ */
+class Queue {
+	/**
+	 * @param {Iterable<T>=} items The initial elements.
+	 */
+	constructor(items) {
+		/** @private @type {Set<T>} */
+		this.set = new Set(items);
+		/** @private @type {Iterator<T>} */
+		this.iterator = this.set[Symbol.iterator]();
+	}
+
+	/**
+	 * Returns the number of elements in this queue.
+	 * @returns {number} The number of elements in this queue.
+	 */
+	get length() {
+		return this.set.size;
+	}
+
+	/**
+	 * Appends the specified element to this queue.
+	 * @param {T} item The element to add.
+	 * @returns {void}
+	 */
+	enqueue(item) {
+		this.set.add(item);
+	}
+
+	/**
+	 * Retrieves and removes the head of this queue.
+	 * @returns {T | undefined} The head of the queue of `undefined` if this queue is empty.
+	 */
+	dequeue() {
+		const result = this.iterator.next();
+		if (result.done) return undefined;
+		this.set.delete(result.value);
+		return result.value;
+	}
+}
+
+module.exports = Queue;
diff --git a/node_modules/webpack/lib/util/Semaphore.js b/node_modules/webpack/lib/util/Semaphore.js
new file mode 100644
index 0000000..d6c8766
--- /dev/null
+++ b/node_modules/webpack/lib/util/Semaphore.js
@@ -0,0 +1,53 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class Semaphore {
+	/**
+	 * Creates an instance of Semaphore.
+	 *
+	 * @param {number} available the amount available number of "tasks"
+	 * in the Semaphore
+	 */
+	constructor(available) {
+		this.available = available;
+		/** @type {(function(): void)[]} */
+		this.waiters = [];
+		/** @private */
+		this._continue = this._continue.bind(this);
+	}
+
+	/**
+	 * @param {function(): void} callback function block to capture and run
+	 * @returns {void}
+	 */
+	acquire(callback) {
+		if (this.available > 0) {
+			this.available--;
+			callback();
+		} else {
+			this.waiters.push(callback);
+		}
+	}
+
+	release() {
+		this.available++;
+		if (this.waiters.length > 0) {
+			process.nextTick(this._continue);
+		}
+	}
+
+	_continue() {
+		if (this.available > 0) {
+			if (this.waiters.length > 0) {
+				this.available--;
+				const callback = this.waiters.pop();
+				callback();
+			}
+		}
+	}
+}
+
+module.exports = Semaphore;
diff --git a/node_modules/webpack/lib/util/SetHelpers.js b/node_modules/webpack/lib/util/SetHelpers.js
new file mode 100644
index 0000000..96c063c
--- /dev/null
+++ b/node_modules/webpack/lib/util/SetHelpers.js
@@ -0,0 +1,48 @@
+"use strict";
+
+/**
+ * intersect creates Set containing the intersection of elements between all sets
+ * @param {Set[]} sets an array of sets being checked for shared elements
+ * @returns {Set<TODO>} returns a new Set containing the intersecting items
+ */
+const intersect = sets => {
+	if (sets.length === 0) return new Set();
+	if (sets.length === 1) return new Set(sets[0]);
+	let minSize = Infinity;
+	let minIndex = -1;
+	for (let i = 0; i < sets.length; i++) {
+		const size = sets[i].size;
+		if (size < minSize) {
+			minIndex = i;
+			minSize = size;
+		}
+	}
+	const current = new Set(sets[minIndex]);
+	for (let i = 0; i < sets.length; i++) {
+		if (i === minIndex) continue;
+		const set = sets[i];
+		for (const item of current) {
+			if (!set.has(item)) {
+				current.delete(item);
+			}
+		}
+	}
+	return current;
+};
+
+/**
+ * Checks if a set is the subset of another set
+ * @param {Set<TODO>} bigSet a Set which contains the original elements to compare against
+ * @param {Set<TODO>} smallSet the set whos elements might be contained inside of bigSet
+ * @returns {boolean} returns true if smallSet contains all elements inside of the bigSet
+ */
+const isSubset = (bigSet, smallSet) => {
+	if (bigSet.size < smallSet.size) return false;
+	for (const item of smallSet) {
+		if (!bigSet.has(item)) return false;
+	}
+	return true;
+};
+
+exports.intersect = intersect;
+exports.isSubset = isSubset;
diff --git a/node_modules/webpack/lib/util/SortableSet.js b/node_modules/webpack/lib/util/SortableSet.js
new file mode 100644
index 0000000..44b692f
--- /dev/null
+++ b/node_modules/webpack/lib/util/SortableSet.js
@@ -0,0 +1,140 @@
+"use strict";
+
+/**
+ * A subset of Set that offers sorting functionality
+ * @template T item type in set
+ * @extends {Set<T>}
+ */
+class SortableSet extends Set {
+	/**
+	 * Create a new sortable set
+	 * @param {Iterable<T>=} initialIterable The initial iterable value
+	 * @typedef {function(T, T): number} SortFunction
+	 * @param {SortFunction=} defaultSort Default sorting function
+	 */
+	constructor(initialIterable, defaultSort) {
+		super(initialIterable);
+		/** @private @type {function(T, T): number}} */
+		this._sortFn = defaultSort;
+		/** @private @type {function(T, T): number} | null} */
+		this._lastActiveSortFn = null;
+		/** @private @type {Map<Function, T[]> | undefined} */
+		this._cache = undefined;
+		/** @private @type {Map<Function, T[]|string|number> | undefined} */
+		this._cacheOrderIndependent = undefined;
+	}
+
+	/**
+	 * @param {T} value value to add to set
+	 * @returns {this} returns itself
+	 */
+	add(value) {
+		this._lastActiveSortFn = null;
+		this._invalidateCache();
+		this._invalidateOrderedCache();
+		super.add(value);
+		return this;
+	}
+
+	/**
+	 * @param {T} value value to delete
+	 * @returns {boolean} true if value existed in set, false otherwise
+	 */
+	delete(value) {
+		this._invalidateCache();
+		this._invalidateOrderedCache();
+		return super.delete(value);
+	}
+
+	/**
+	 * @returns {void}
+	 */
+	clear() {
+		this._invalidateCache();
+		this._invalidateOrderedCache();
+		return super.clear();
+	}
+
+	/**
+	 * Sort with a comparer function
+	 * @param {SortFunction} sortFn Sorting comparer function
+	 * @returns {void}
+	 */
+	sortWith(sortFn) {
+		if (this.size <= 1 || sortFn === this._lastActiveSortFn) {
+			// already sorted - nothing to do
+			return;
+		}
+
+		const sortedArray = Array.from(this).sort(sortFn);
+		super.clear();
+		for (let i = 0; i < sortedArray.length; i += 1) {
+			super.add(sortedArray[i]);
+		}
+		this._lastActiveSortFn = sortFn;
+		this._invalidateCache();
+	}
+
+	sort() {
+		this.sortWith(this._sortFn);
+	}
+
+	/**
+	 * Get data from cache
+	 * @param {function(SortableSet<T>): T[]} fn function to calculate value
+	 * @returns {T[]} returns result of fn(this), cached until set changes
+	 */
+	getFromCache(fn) {
+		if (this._cache === undefined) {
+			this._cache = new Map();
+		} else {
+			const data = this._cache.get(fn);
+			if (data !== undefined) {
+				return data;
+			}
+		}
+		const newData = fn(this);
+		this._cache.set(fn, newData);
+		return newData;
+	}
+
+	/**
+	 * @param {function(SortableSet<T>): string|number|T[]} fn function to calculate value
+	 * @returns {any} returns result of fn(this), cached until set changes
+	 */
+	getFromUnorderedCache(fn) {
+		if (this._cacheOrderIndependent === undefined) {
+			this._cacheOrderIndependent = new Map();
+		} else {
+			const data = this._cacheOrderIndependent.get(fn);
+			if (data !== undefined) {
+				return data;
+			}
+		}
+		const newData = fn(this);
+		this._cacheOrderIndependent.set(fn, newData);
+		return newData;
+	}
+
+	/**
+	 * @private
+	 * @returns {void}
+	 */
+	_invalidateCache() {
+		if (this._cache !== undefined) {
+			this._cache.clear();
+		}
+	}
+
+	/**
+	 * @private
+	 * @returns {void}
+	 */
+	_invalidateOrderedCache() {
+		if (this._cacheOrderIndependent !== undefined) {
+			this._cacheOrderIndependent.clear();
+		}
+	}
+}
+
+module.exports = SortableSet;
diff --git a/node_modules/webpack/lib/util/StackedSetMap.js b/node_modules/webpack/lib/util/StackedSetMap.js
new file mode 100644
index 0000000..1805155
--- /dev/null
+++ b/node_modules/webpack/lib/util/StackedSetMap.js
@@ -0,0 +1,142 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const util = require("util");
+
+const TOMBSTONE = {};
+const UNDEFINED_MARKER = {};
+
+class StackedSetMap {
+	constructor(parentStack) {
+		this.stack = parentStack === undefined ? [] : parentStack.slice();
+		this.map = new Map();
+		this.stack.push(this.map);
+	}
+
+	add(item) {
+		this.map.set(item, true);
+	}
+
+	set(item, value) {
+		this.map.set(item, value === undefined ? UNDEFINED_MARKER : value);
+	}
+
+	delete(item) {
+		if (this.stack.length > 1) {
+			this.map.set(item, TOMBSTONE);
+		} else {
+			this.map.delete(item);
+		}
+	}
+
+	has(item) {
+		const topValue = this.map.get(item);
+		if (topValue !== undefined) return topValue !== TOMBSTONE;
+		if (this.stack.length > 1) {
+			for (var i = this.stack.length - 2; i >= 0; i--) {
+				const value = this.stack[i].get(item);
+				if (value !== undefined) {
+					this.map.set(item, value);
+					return value !== TOMBSTONE;
+				}
+			}
+			this.map.set(item, TOMBSTONE);
+		}
+		return false;
+	}
+
+	get(item) {
+		const topValue = this.map.get(item);
+		if (topValue !== undefined) {
+			return topValue === TOMBSTONE || topValue === UNDEFINED_MARKER
+				? undefined
+				: topValue;
+		}
+		if (this.stack.length > 1) {
+			for (var i = this.stack.length - 2; i >= 0; i--) {
+				const value = this.stack[i].get(item);
+				if (value !== undefined) {
+					this.map.set(item, value);
+					return value === TOMBSTONE || value === UNDEFINED_MARKER
+						? undefined
+						: value;
+				}
+			}
+			this.map.set(item, TOMBSTONE);
+		}
+		return undefined;
+	}
+
+	_compress() {
+		if (this.stack.length === 1) return;
+		this.map = new Map();
+		for (const data of this.stack) {
+			for (const pair of data) {
+				if (pair[1] === TOMBSTONE) {
+					this.map.delete(pair[0]);
+				} else {
+					this.map.set(pair[0], pair[1]);
+				}
+			}
+		}
+		this.stack = [this.map];
+	}
+
+	asArray() {
+		this._compress();
+		return Array.from(this.map.entries(), pair => pair[0]);
+	}
+
+	asSet() {
+		return new Set(this.asArray());
+	}
+
+	asPairArray() {
+		this._compress();
+		return Array.from(this.map.entries(), pair =>
+			/** @type {[TODO, TODO]} */ (pair[1] === UNDEFINED_MARKER
+				? [pair[0], undefined]
+				: pair)
+		);
+	}
+
+	asMap() {
+		return new Map(this.asPairArray());
+	}
+
+	get size() {
+		this._compress();
+		return this.map.size;
+	}
+
+	createChild() {
+		return new StackedSetMap(this.stack);
+	}
+
+	get length() {
+		throw new Error("This is no longer an Array");
+	}
+
+	set length(value) {
+		throw new Error("This is no longer an Array");
+	}
+}
+
+// TODO remove in webpack 5
+StackedSetMap.prototype.push = util.deprecate(
+	/**
+	 * @deprecated
+	 * @this {StackedSetMap}
+	 * @param {any} item Item to add
+	 * @returns {void}
+	 */
+	function(item) {
+		this.add(item);
+	},
+	"This is no longer an Array: Use add instead."
+);
+
+module.exports = StackedSetMap;
diff --git a/node_modules/webpack/lib/util/TrackingSet.js b/node_modules/webpack/lib/util/TrackingSet.js
new file mode 100644
index 0000000..b52a440
--- /dev/null
+++ b/node_modules/webpack/lib/util/TrackingSet.js
@@ -0,0 +1,35 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+module.exports = class TrackingSet {
+	constructor(set) {
+		this.set = set;
+		this.set2 = new Set();
+		this.stack = set.stack;
+	}
+
+	add(item) {
+		this.set2.add(item);
+		return this.set.add(item);
+	}
+
+	delete(item) {
+		this.set2.delete(item);
+		return this.set.delete(item);
+	}
+
+	has(item) {
+		return this.set.has(item);
+	}
+
+	createChild() {
+		return this.set.createChild();
+	}
+
+	getAddedItems() {
+		return this.set2;
+	}
+};
diff --git a/node_modules/webpack/lib/util/cachedMerge.js b/node_modules/webpack/lib/util/cachedMerge.js
new file mode 100644
index 0000000..124f647
--- /dev/null
+++ b/node_modules/webpack/lib/util/cachedMerge.js
@@ -0,0 +1,35 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const mergeCache = new WeakMap();
+
+/**
+ * Merges two given objects and caches the result to avoid computation if same objects passed as arguments again.
+ * @example
+ * // performs Object.assign(first, second), stores the result in WeakMap and returns result
+ * cachedMerge({a: 1}, {a: 2})
+ * {a: 2}
+ *  // when same arguments passed, gets the result from WeakMap and returns it.
+ * cachedMerge({a: 1}, {a: 2})
+ * {a: 2}
+ * @param {object} first first object
+ * @param {object} second second object
+ * @returns {object} merged object of first and second object
+ */
+const cachedMerge = (first, second) => {
+	let innerCache = mergeCache.get(first);
+	if (innerCache === undefined) {
+		innerCache = new WeakMap();
+		mergeCache.set(first, innerCache);
+	}
+	const prevMerge = innerCache.get(second);
+	if (prevMerge !== undefined) return prevMerge;
+	const newMerge = Object.assign({}, first, second);
+	innerCache.set(second, newMerge);
+	return newMerge;
+};
+
+module.exports = cachedMerge;
diff --git a/node_modules/webpack/lib/util/cleverMerge.js b/node_modules/webpack/lib/util/cleverMerge.js
new file mode 100644
index 0000000..23060ce
--- /dev/null
+++ b/node_modules/webpack/lib/util/cleverMerge.js
@@ -0,0 +1,77 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+
+"use strict";
+
+const mergeCache = new WeakMap();
+
+/**
+ * Merges two given objects and caches the result to avoid computation if same objects passed as arguments again.
+ * @example
+ * // performs cleverMerge(first, second), stores the result in WeakMap and returns result
+ * cachedCleverMerge({a: 1}, {a: 2})
+ * {a: 2}
+ *  // when same arguments passed, gets the result from WeakMap and returns it.
+ * cachedCleverMerge({a: 1}, {a: 2})
+ * {a: 2}
+ * @param {object} first first object
+ * @param {object} second second object
+ * @returns {object} merged object of first and second object
+ */
+const cachedCleverMerge = (first, second) => {
+	let innerCache = mergeCache.get(first);
+	if (innerCache === undefined) {
+		innerCache = new WeakMap();
+		mergeCache.set(first, innerCache);
+	}
+	const prevMerge = innerCache.get(second);
+	if (prevMerge !== undefined) return prevMerge;
+	const newMerge = cleverMerge(first, second);
+	innerCache.set(second, newMerge);
+	return newMerge;
+};
+
+/**
+ * Merges two objects. Objects are not deeply merged.
+ * TODO webpack 5: merge objects deeply clever.
+ * Arrays might reference the old value with "..."
+ * @param {object} first first object
+ * @param {object} second second object
+ * @returns {object} merged object of first and second object
+ */
+const cleverMerge = (first, second) => {
+	const newObject = Object.assign({}, first);
+	for (const key of Object.keys(second)) {
+		if (!(key in newObject)) {
+			newObject[key] = second[key];
+			continue;
+		}
+		const secondValue = second[key];
+		if (!Array.isArray(secondValue)) {
+			newObject[key] = secondValue;
+			continue;
+		}
+		const firstValue = newObject[key];
+		if (Array.isArray(firstValue)) {
+			const newArray = [];
+			for (const item of secondValue) {
+				if (item === "...") {
+					for (const item of firstValue) {
+						newArray.push(item);
+					}
+				} else {
+					newArray.push(item);
+				}
+			}
+			newObject[key] = newArray;
+		} else {
+			newObject[key] = secondValue;
+		}
+	}
+	return newObject;
+};
+
+exports.cachedCleverMerge = cachedCleverMerge;
+exports.cleverMerge = cleverMerge;
diff --git a/node_modules/webpack/lib/util/createHash.js b/node_modules/webpack/lib/util/createHash.js
new file mode 100644
index 0000000..64de510
--- /dev/null
+++ b/node_modules/webpack/lib/util/createHash.js
@@ -0,0 +1,137 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const AbstractMethodError = require("../AbstractMethodError");
+
+const BULK_SIZE = 1000;
+
+class Hash {
+	/**
+	 * Update hash {@link https://nodejs.org/api/crypto.html#crypto_hash_update_data_inputencoding}
+	 * @param {string|Buffer} data data
+	 * @param {string=} inputEncoding data encoding
+	 * @returns {this} updated hash
+	 */
+	update(data, inputEncoding) {
+		throw new AbstractMethodError();
+	}
+
+	/**
+	 * Calculates the digest {@link https://nodejs.org/api/crypto.html#crypto_hash_digest_encoding}
+	 * @param {string=} encoding encoding of the return value
+	 * @returns {string|Buffer} digest
+	 */
+	digest(encoding) {
+		throw new AbstractMethodError();
+	}
+}
+
+exports.Hash = Hash;
+/** @typedef {typeof Hash} HashConstructor */
+
+class BulkUpdateDecorator extends Hash {
+	/**
+	 * @param {Hash} hash hash
+	 */
+	constructor(hash) {
+		super();
+		this.hash = hash;
+		this.buffer = "";
+	}
+
+	/**
+	 * Update hash {@link https://nodejs.org/api/crypto.html#crypto_hash_update_data_inputencoding}
+	 * @param {string|Buffer} data data
+	 * @param {string=} inputEncoding data encoding
+	 * @returns {this} updated hash
+	 */
+	update(data, inputEncoding) {
+		if (
+			inputEncoding !== undefined ||
+			typeof data !== "string" ||
+			data.length > BULK_SIZE
+		) {
+			if (this.buffer.length > 0) {
+				this.hash.update(this.buffer);
+				this.buffer = "";
+			}
+			this.hash.update(data, inputEncoding);
+		} else {
+			this.buffer += data;
+			if (this.buffer.length > BULK_SIZE) {
+				this.hash.update(this.buffer);
+				this.buffer = "";
+			}
+		}
+		return this;
+	}
+
+	/**
+	 * Calculates the digest {@link https://nodejs.org/api/crypto.html#crypto_hash_digest_encoding}
+	 * @param {string=} encoding encoding of the return value
+	 * @returns {string|Buffer} digest
+	 */
+	digest(encoding) {
+		if (this.buffer.length > 0) {
+			this.hash.update(this.buffer);
+		}
+		var digestResult = this.hash.digest(encoding);
+		return typeof digestResult === "string"
+			? digestResult
+			: digestResult.toString();
+	}
+}
+
+/**
+ * istanbul ignore next
+ */
+class DebugHash extends Hash {
+	constructor() {
+		super();
+		this.string = "";
+	}
+
+	/**
+	 * Update hash {@link https://nodejs.org/api/crypto.html#crypto_hash_update_data_inputencoding}
+	 * @param {string|Buffer} data data
+	 * @param {string=} inputEncoding data encoding
+	 * @returns {this} updated hash
+	 */
+	update(data, inputEncoding) {
+		if (typeof data !== "string") data = data.toString("utf-8");
+		this.string += data;
+		return this;
+	}
+
+	/**
+	 * Calculates the digest {@link https://nodejs.org/api/crypto.html#crypto_hash_digest_encoding}
+	 * @param {string=} encoding encoding of the return value
+	 * @returns {string|Buffer} digest
+	 */
+	digest(encoding) {
+		return this.string.replace(/[^a-z0-9]+/gi, m =>
+			Buffer.from(m).toString("hex")
+		);
+	}
+}
+
+/**
+ * Creates a hash by name or function
+ * @param {string | HashConstructor} algorithm the algorithm name or a constructor creating a hash
+ * @returns {Hash} the hash
+ */
+module.exports = algorithm => {
+	if (typeof algorithm === "function") {
+		return new BulkUpdateDecorator(new algorithm());
+	}
+	switch (algorithm) {
+		// TODO add non-cryptographic algorithm here
+		case "debug":
+			return new DebugHash();
+		default:
+			return new BulkUpdateDecorator(require("crypto").createHash(algorithm));
+	}
+};
diff --git a/node_modules/webpack/lib/util/deterministicGrouping.js b/node_modules/webpack/lib/util/deterministicGrouping.js
new file mode 100644
index 0000000..825e4bc
--- /dev/null
+++ b/node_modules/webpack/lib/util/deterministicGrouping.js
@@ -0,0 +1,274 @@
+"use strict";
+
+// Simulations show these probabilities for a single change
+// 93.1% that one group is invalidated
+// 4.8% that two groups are invalidated
+// 1.1% that 3 groups are invalidated
+// 0.1% that 4 or more groups are invalidated
+//
+// And these for removing/adding 10 lexically adjacent files
+// 64.5% that one group is invalidated
+// 24.8% that two groups are invalidated
+// 7.8% that 3 groups are invalidated
+// 2.7% that 4 or more groups are invalidated
+//
+// And these for removing/adding 3 random files
+// 0% that one group is invalidated
+// 3.7% that two groups are invalidated
+// 80.8% that 3 groups are invalidated
+// 12.3% that 4 groups are invalidated
+// 3.2% that 5 or more groups are invalidated
+
+/**
+ *
+ * @param {string} a key
+ * @param {string} b key
+ * @returns {number} the similarity as number
+ */
+const similarity = (a, b) => {
+	const l = Math.min(a.length, b.length);
+	let dist = 0;
+	for (let i = 0; i < l; i++) {
+		const ca = a.charCodeAt(i);
+		const cb = b.charCodeAt(i);
+		dist += Math.max(0, 10 - Math.abs(ca - cb));
+	}
+	return dist;
+};
+
+/**
+ * @param {string} a key
+ * @param {string} b key
+ * @returns {string} the common part and a single char for the difference
+ */
+const getName = (a, b) => {
+	const l = Math.min(a.length, b.length);
+	let r = "";
+	for (let i = 0; i < l; i++) {
+		const ca = a.charAt(i);
+		const cb = b.charAt(i);
+		r += ca;
+		if (ca === cb) {
+			continue;
+		}
+		return r;
+	}
+	return a;
+};
+
+/**
+ * @template T
+ */
+class Node {
+	/**
+	 * @param {T} item item
+	 * @param {string} key key
+	 * @param {number} size size
+	 */
+	constructor(item, key, size) {
+		this.item = item;
+		this.key = key;
+		this.size = size;
+	}
+}
+
+/**
+ * @template T
+ */
+class Group {
+	/**
+	 * @param {Node<T>[]} nodes nodes
+	 * @param {number[]} similarities similarities between the nodes (length = nodes.length - 1)
+	 */
+	constructor(nodes, similarities) {
+		this.nodes = nodes;
+		this.similarities = similarities;
+		this.size = nodes.reduce((size, node) => size + node.size, 0);
+		/** @type {string} */
+		this.key = undefined;
+	}
+}
+
+/**
+ * @template T
+ * @typedef {Object} GroupedItems<T>
+ * @property {string} key
+ * @property {T[]} items
+ * @property {number} size
+ */
+
+/**
+ * @template T
+ * @typedef {Object} Options
+ * @property {number} maxSize maximum size of a group
+ * @property {number} minSize minimum size of a group (preferred over maximum size)
+ * @property {Iterable<T>} items a list of items
+ * @property {function(T): number} getSize function to get size of an item
+ * @property {function(T): string} getKey function to get the key of an item
+ */
+
+/**
+ * @template T
+ * @param {Options<T>} options options object
+ * @returns {GroupedItems<T>[]} grouped items
+ */
+module.exports = ({ maxSize, minSize, items, getSize, getKey }) => {
+	/** @type {Group<T>[]} */
+	const result = [];
+
+	const nodes = Array.from(
+		items,
+		item => new Node(item, getKey(item), getSize(item))
+	);
+
+	/** @type {Node<T>[]} */
+	const initialNodes = [];
+
+	// lexically ordering of keys
+	nodes.sort((a, b) => {
+		if (a.key < b.key) return -1;
+		if (a.key > b.key) return 1;
+		return 0;
+	});
+
+	// return nodes bigger than maxSize directly as group
+	for (const node of nodes) {
+		if (node.size >= maxSize) {
+			result.push(new Group([node], []));
+		} else {
+			initialNodes.push(node);
+		}
+	}
+
+	if (initialNodes.length > 0) {
+		// calculate similarities between lexically adjacent nodes
+		/** @type {number[]} */
+		const similarities = [];
+		for (let i = 1; i < initialNodes.length; i++) {
+			const a = initialNodes[i - 1];
+			const b = initialNodes[i];
+			similarities.push(similarity(a.key, b.key));
+		}
+
+		const initialGroup = new Group(initialNodes, similarities);
+
+		if (initialGroup.size < minSize) {
+			// We hit an edgecase where the working set is already smaller than minSize
+			// We merge it with the smallest result node to keep minSize intact
+			if (result.length > 0) {
+				const smallestGroup = result.reduce((min, group) =>
+					min.size > group.size ? group : min
+				);
+				for (const node of initialGroup.nodes) smallestGroup.nodes.push(node);
+				smallestGroup.nodes.sort((a, b) => {
+					if (a.key < b.key) return -1;
+					if (a.key > b.key) return 1;
+					return 0;
+				});
+			} else {
+				// There are no other nodes
+				// We use all nodes and have to accept that it's smaller than minSize
+				result.push(initialGroup);
+			}
+		} else {
+			const queue = [initialGroup];
+
+			while (queue.length) {
+				const group = queue.pop();
+				// only groups bigger than maxSize need to be splitted
+				if (group.size < maxSize) {
+					result.push(group);
+					continue;
+				}
+
+				// find unsplittable area from left and right
+				// going minSize from left and right
+				// at least one node need to be included otherwise we get stuck
+				let left = 0;
+				let leftSize = 0;
+				while (leftSize <= minSize) {
+					leftSize += group.nodes[left].size;
+					left++;
+				}
+				let right = group.nodes.length - 1;
+				let rightSize = 0;
+				while (rightSize <= minSize) {
+					rightSize += group.nodes[right].size;
+					right--;
+				}
+
+				if (left - 1 > right) {
+					// can't split group while holding minSize
+					// because minSize is preferred of maxSize we return
+					// the group here even while it's too big
+					// To avoid this make sure maxSize > minSize * 3
+					result.push(group);
+					continue;
+				}
+				if (left <= right) {
+					// when there is a area between left and right
+					// we look for best split point
+					// we split at the minimum similarity
+					// here key space is separated the most
+					let best = left - 1;
+					let bestSimilarity = group.similarities[best];
+					for (let i = left; i <= right; i++) {
+						const similarity = group.similarities[i];
+						if (similarity < bestSimilarity) {
+							best = i;
+							bestSimilarity = similarity;
+						}
+					}
+					left = best + 1;
+					right = best;
+				}
+
+				// create two new groups for left and right area
+				// and queue them up
+				const rightNodes = [group.nodes[right + 1]];
+				/** @type {number[]} */
+				const rightSimilaries = [];
+				for (let i = right + 2; i < group.nodes.length; i++) {
+					rightSimilaries.push(group.similarities[i - 1]);
+					rightNodes.push(group.nodes[i]);
+				}
+				queue.push(new Group(rightNodes, rightSimilaries));
+
+				const leftNodes = [group.nodes[0]];
+				/** @type {number[]} */
+				const leftSimilaries = [];
+				for (let i = 1; i < left; i++) {
+					leftSimilaries.push(group.similarities[i - 1]);
+					leftNodes.push(group.nodes[i]);
+				}
+				queue.push(new Group(leftNodes, leftSimilaries));
+			}
+		}
+	}
+
+	// lexically ordering
+	result.sort((a, b) => {
+		if (a.nodes[0].key < b.nodes[0].key) return -1;
+		if (a.nodes[0].key > b.nodes[0].key) return 1;
+		return 0;
+	});
+
+	// give every group a name
+	for (let i = 0; i < result.length; i++) {
+		const group = result[i];
+		const first = group.nodes[0];
+		const last = group.nodes[group.nodes.length - 1];
+		let name = getName(first.key, last.key);
+		group.key = name;
+	}
+
+	// return the results
+	return result.map(group => {
+		/** @type {GroupedItems} */
+		return {
+			key: group.key,
+			items: group.nodes.map(node => node.item),
+			size: group.size
+		};
+	});
+};
diff --git a/node_modules/webpack/lib/util/identifier.js b/node_modules/webpack/lib/util/identifier.js
new file mode 100644
index 0000000..0c573e8
--- /dev/null
+++ b/node_modules/webpack/lib/util/identifier.js
@@ -0,0 +1,127 @@
+"use strict";
+const path = require("path");
+
+/**
+ * @param {string} context context for relative path
+ * @param {string} relativePath path
+ * @returns {string} absolute path
+ */
+const requestToAbsolute = (context, relativePath) => {
+	if (relativePath.startsWith("./") || relativePath.startsWith("../"))
+		return path.join(context, relativePath);
+	return relativePath;
+};
+
+/**
+ * @typedef {Object} MakeRelativePathsCache
+ * @property {Map<string, Map<string, string>>=} relativePaths
+ */
+
+/**
+ *
+ * @param {string} maybeAbsolutePath path to check
+ * @returns {boolean} returns true if path is "Absolute Path"-like
+ */
+const looksLikeAbsolutePath = maybeAbsolutePath => {
+	if (/^\/.*\/$/.test(maybeAbsolutePath)) {
+		// this 'path' is actually a regexp generated by dynamic requires.
+		// Don't treat it as an absolute path.
+		return false;
+	}
+	return /^(?:[a-z]:\\|\/)/i.test(maybeAbsolutePath);
+};
+
+/**
+ *
+ * @param {string} p path to normalize
+ * @returns {string} normalized version of path
+ */
+const normalizePathSeparator = p => p.replace(/\\/g, "/");
+
+/**
+ *
+ * @param {string} context context for relative path
+ * @param {string} identifier identifier for path
+ * @returns {string} a converted relative path
+ */
+const _makePathsRelative = (context, identifier) => {
+	return identifier
+		.split(/([|! ])/)
+		.map(str =>
+			looksLikeAbsolutePath(str)
+				? normalizePathSeparator(path.relative(context, str))
+				: str
+		)
+		.join("");
+};
+
+/**
+ *
+ * @param {string} context context used to create relative path
+ * @param {string} identifier identifier used to create relative path
+ * @param {MakeRelativePathsCache=} cache the cache object being set
+ * @returns {string} the returned relative path
+ */
+exports.makePathsRelative = (context, identifier, cache) => {
+	if (!cache) return _makePathsRelative(context, identifier);
+
+	const relativePaths =
+		cache.relativePaths || (cache.relativePaths = new Map());
+
+	let cachedResult;
+	let contextCache = relativePaths.get(context);
+	if (contextCache === undefined) {
+		relativePaths.set(context, (contextCache = new Map()));
+	} else {
+		cachedResult = contextCache.get(identifier);
+	}
+
+	if (cachedResult !== undefined) {
+		return cachedResult;
+	} else {
+		const relativePath = _makePathsRelative(context, identifier);
+		contextCache.set(identifier, relativePath);
+		return relativePath;
+	}
+};
+
+/**
+ * @param {string} context absolute context path
+ * @param {string} request any request string may containing absolute paths, query string, etc.
+ * @returns {string} a new request string avoiding absolute paths when possible
+ */
+exports.contextify = (context, request) => {
+	return request
+		.split("!")
+		.map(r => {
+			const splitPath = r.split("?", 2);
+			if (/^[a-zA-Z]:\\/.test(splitPath[0])) {
+				splitPath[0] = path.win32.relative(context, splitPath[0]);
+				if (!/^[a-zA-Z]:\\/.test(splitPath[0])) {
+					splitPath[0] = splitPath[0].replace(/\\/g, "/");
+				}
+			}
+			if (/^\//.test(splitPath[0])) {
+				splitPath[0] = path.posix.relative(context, splitPath[0]);
+			}
+			if (!/^(\.\.\/|\/|[a-zA-Z]:\\)/.test(splitPath[0])) {
+				splitPath[0] = "./" + splitPath[0];
+			}
+			return splitPath.join("?");
+		})
+		.join("!");
+};
+
+/**
+ * @param {string} context absolute context path
+ * @param {string} request any request string
+ * @returns {string} a new request string using absolute paths when possible
+ */
+const _absolutify = (context, request) => {
+	return request
+		.split("!")
+		.map(r => requestToAbsolute(context, r))
+		.join("!");
+};
+
+exports.absolutify = _absolutify;
diff --git a/node_modules/webpack/lib/util/objectToMap.js b/node_modules/webpack/lib/util/objectToMap.js
new file mode 100644
index 0000000..f8c13c2
--- /dev/null
+++ b/node_modules/webpack/lib/util/objectToMap.js
@@ -0,0 +1,16 @@
+/**
+ * convert an object into its 2D array equivalent to be turned
+ * into an ES6 map
+ *
+ * @param {object} obj any object type that works with Object.keys()
+ * @returns {Map<TODO, TODO>} an ES6 Map of KV pairs
+ */
+module.exports = function objectToMap(obj) {
+	return new Map(
+		Object.keys(obj).map(key => {
+			/** @type {[string, string]} */
+			const pair = [key, obj[key]];
+			return pair;
+		})
+	);
+};
diff --git a/node_modules/webpack/lib/validateSchema.js b/node_modules/webpack/lib/validateSchema.js
new file mode 100644
index 0000000..b748c2c
--- /dev/null
+++ b/node_modules/webpack/lib/validateSchema.js
@@ -0,0 +1,67 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Gajus Kuizinas @gajus
+*/
+"use strict";
+
+const Ajv = require("ajv");
+const ajv = new Ajv({
+	errorDataPath: "configuration",
+	allErrors: true,
+	verbose: true
+});
+require("ajv-keywords")(ajv, ["instanceof"]);
+require("../schemas/ajv.absolutePath")(ajv);
+
+const validateSchema = (schema, options) => {
+	if (Array.isArray(options)) {
+		const errors = options.map(options => validateObject(schema, options));
+		errors.forEach((list, idx) => {
+			const applyPrefix = err => {
+				err.dataPath = `[${idx}]${err.dataPath}`;
+				if (err.children) {
+					err.children.forEach(applyPrefix);
+				}
+			};
+			list.forEach(applyPrefix);
+		});
+		return errors.reduce((arr, items) => {
+			return arr.concat(items);
+		}, []);
+	} else {
+		return validateObject(schema, options);
+	}
+};
+
+const validateObject = (schema, options) => {
+	const validate = ajv.compile(schema);
+	const valid = validate(options);
+	return valid ? [] : filterErrors(validate.errors);
+};
+
+const filterErrors = errors => {
+	let newErrors = [];
+	for (const err of errors) {
+		const dataPath = err.dataPath;
+		let children = [];
+		newErrors = newErrors.filter(oldError => {
+			if (oldError.dataPath.includes(dataPath)) {
+				if (oldError.children) {
+					children = children.concat(oldError.children.slice(0));
+				}
+				oldError.children = undefined;
+				children.push(oldError);
+				return false;
+			}
+			return true;
+		});
+		if (children.length) {
+			err.children = children;
+		}
+		newErrors.push(err);
+	}
+
+	return newErrors;
+};
+
+module.exports = validateSchema;
diff --git a/node_modules/webpack/lib/wasm/UnsupportedWebAssemblyFeatureError.js b/node_modules/webpack/lib/wasm/UnsupportedWebAssemblyFeatureError.js
new file mode 100644
index 0000000..fede4eb
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/UnsupportedWebAssemblyFeatureError.js
@@ -0,0 +1,17 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+*/
+"use strict";
+
+const WebpackError = require("../WebpackError");
+
+module.exports = class UnsupportedWebAssemblyFeatureError extends WebpackError {
+	/** @param {string} message Error message */
+	constructor(message) {
+		super(message);
+		this.name = "UnsupportedWebAssemblyFeatureError";
+		this.hideStack = true;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/wasm/WasmFinalizeExportsPlugin.js b/node_modules/webpack/lib/wasm/WasmFinalizeExportsPlugin.js
new file mode 100644
index 0000000..52df869
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/WasmFinalizeExportsPlugin.js
@@ -0,0 +1,69 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+	*/
+"use strict";
+
+const UnsupportedWebAssemblyFeatureError = require("./UnsupportedWebAssemblyFeatureError");
+
+class WasmFinalizeExportsPlugin {
+	apply(compiler) {
+		compiler.hooks.compilation.tap("WasmFinalizeExportsPlugin", compilation => {
+			compilation.hooks.finishModules.tap(
+				"WasmFinalizeExportsPlugin",
+				modules => {
+					for (const module of modules) {
+						// 1. if a WebAssembly module
+						if (module.type.startsWith("webassembly") === true) {
+							const jsIncompatibleExports =
+								module.buildMeta.jsIncompatibleExports;
+
+							if (jsIncompatibleExports === undefined) {
+								continue;
+							}
+
+							for (const reason of module.reasons) {
+								// 2. is referenced by a non-WebAssembly module
+								if (reason.module.type.startsWith("webassembly") === false) {
+									const ref = compilation.getDependencyReference(
+										reason.module,
+										reason.dependency
+									);
+
+									if (!ref) continue;
+
+									const importedNames = ref.importedNames;
+
+									if (Array.isArray(importedNames)) {
+										importedNames.forEach(name => {
+											// 3. and uses a func with an incompatible JS signature
+											if (
+												Object.prototype.hasOwnProperty.call(
+													jsIncompatibleExports,
+													name
+												)
+											) {
+												// 4. error
+												/** @type {any} */
+												const error = new UnsupportedWebAssemblyFeatureError(
+													`Export "${name}" with ${jsIncompatibleExports[name]} can only be used for direct wasm to wasm dependencies`
+												);
+												error.module = module;
+												error.origin = reason.module;
+												error.originLoc = reason.dependency.loc;
+												error.dependencies = [reason.dependency];
+												compilation.errors.push(error);
+											}
+										});
+									}
+								}
+							}
+						}
+					}
+				}
+			);
+		});
+	}
+}
+
+module.exports = WasmFinalizeExportsPlugin;
diff --git a/node_modules/webpack/lib/wasm/WasmMainTemplatePlugin.js b/node_modules/webpack/lib/wasm/WasmMainTemplatePlugin.js
new file mode 100644
index 0000000..494c8ec
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/WasmMainTemplatePlugin.js
@@ -0,0 +1,341 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Template = require("../Template");
+const WebAssemblyUtils = require("./WebAssemblyUtils");
+
+/** @typedef {import("../Module")} Module */
+/** @typedef {import("../MainTemplate")} MainTemplate */
+
+// Get all wasm modules
+const getAllWasmModules = chunk => {
+	const wasmModules = chunk.getAllAsyncChunks();
+	const array = [];
+	for (const chunk of wasmModules) {
+		for (const m of chunk.modulesIterable) {
+			if (m.type.startsWith("webassembly")) {
+				array.push(m);
+			}
+		}
+	}
+
+	return array;
+};
+
+/**
+ * generates the import object function for a module
+ * @param {Module} module the module
+ * @param {boolean} mangle mangle imports
+ * @returns {string} source code
+ */
+const generateImportObject = (module, mangle) => {
+	const waitForInstances = new Map();
+	const properties = [];
+	const usedWasmDependencies = WebAssemblyUtils.getUsedDependencies(
+		module,
+		mangle
+	);
+	for (const usedDep of usedWasmDependencies) {
+		const dep = usedDep.dependency;
+		const importedModule = dep.module;
+		const exportName = dep.name;
+		const usedName = importedModule && importedModule.isUsed(exportName);
+		const description = dep.description;
+		const direct = dep.onlyDirectImport;
+
+		const module = usedDep.module;
+		const name = usedDep.name;
+
+		if (direct) {
+			const instanceVar = `m${waitForInstances.size}`;
+			waitForInstances.set(instanceVar, importedModule.id);
+			properties.push({
+				module,
+				name,
+				value: `${instanceVar}[${JSON.stringify(usedName)}]`
+			});
+		} else {
+			const params = description.signature.params.map(
+				(param, k) => "p" + k + param.valtype
+			);
+
+			const mod = `installedModules[${JSON.stringify(importedModule.id)}]`;
+			const func = `${mod}.exports[${JSON.stringify(usedName)}]`;
+
+			properties.push({
+				module,
+				name,
+				value: Template.asString([
+					(importedModule.type.startsWith("webassembly")
+						? `${mod} ? ${func} : `
+						: "") + `function(${params}) {`,
+					Template.indent([`return ${func}(${params});`]),
+					"}"
+				])
+			});
+		}
+	}
+
+	let importObject;
+	if (mangle) {
+		importObject = [
+			"return {",
+			Template.indent([
+				properties.map(p => `${JSON.stringify(p.name)}: ${p.value}`).join(",\n")
+			]),
+			"};"
+		];
+	} else {
+		const propertiesByModule = new Map();
+		for (const p of properties) {
+			let list = propertiesByModule.get(p.module);
+			if (list === undefined) {
+				propertiesByModule.set(p.module, (list = []));
+			}
+			list.push(p);
+		}
+		importObject = [
+			"return {",
+			Template.indent([
+				Array.from(propertiesByModule, ([module, list]) => {
+					return Template.asString([
+						`${JSON.stringify(module)}: {`,
+						Template.indent([
+							list.map(p => `${JSON.stringify(p.name)}: ${p.value}`).join(",\n")
+						]),
+						"}"
+					]);
+				}).join(",\n")
+			]),
+			"};"
+		];
+	}
+
+	if (waitForInstances.size === 1) {
+		const moduleId = Array.from(waitForInstances.values())[0];
+		const promise = `installedWasmModules[${JSON.stringify(moduleId)}]`;
+		const variable = Array.from(waitForInstances.keys())[0];
+		return Template.asString([
+			`${JSON.stringify(module.id)}: function() {`,
+			Template.indent([
+				`return promiseResolve().then(function() { return ${promise}; }).then(function(${variable}) {`,
+				Template.indent(importObject),
+				"});"
+			]),
+			"},"
+		]);
+	} else if (waitForInstances.size > 0) {
+		const promises = Array.from(
+			waitForInstances.values(),
+			id => `installedWasmModules[${JSON.stringify(id)}]`
+		).join(", ");
+		const variables = Array.from(
+			waitForInstances.keys(),
+			(name, i) => `${name} = array[${i}]`
+		).join(", ");
+		return Template.asString([
+			`${JSON.stringify(module.id)}: function() {`,
+			Template.indent([
+				`return promiseResolve().then(function() { return Promise.all([${promises}]); }).then(function(array) {`,
+				Template.indent([`var ${variables};`, ...importObject]),
+				"});"
+			]),
+			"},"
+		]);
+	} else {
+		return Template.asString([
+			`${JSON.stringify(module.id)}: function() {`,
+			Template.indent(importObject),
+			"},"
+		]);
+	}
+};
+
+class WasmMainTemplatePlugin {
+	constructor({ generateLoadBinaryCode, supportsStreaming, mangleImports }) {
+		this.generateLoadBinaryCode = generateLoadBinaryCode;
+		this.supportsStreaming = supportsStreaming;
+		this.mangleImports = mangleImports;
+	}
+
+	/**
+	 * @param {MainTemplate} mainTemplate main template
+	 * @returns {void}
+	 */
+	apply(mainTemplate) {
+		mainTemplate.hooks.localVars.tap(
+			"WasmMainTemplatePlugin",
+			(source, chunk) => {
+				const wasmModules = getAllWasmModules(chunk);
+				if (wasmModules.length === 0) return source;
+				const importObjects = wasmModules.map(module => {
+					return generateImportObject(module, this.mangleImports);
+				});
+				return Template.asString([
+					source,
+					"",
+					"// object to store loaded and loading wasm modules",
+					"var installedWasmModules = {};",
+					"",
+					// This function is used to delay reading the installed wasm module promises
+					// by a microtask. Sorting them doesn't help because there are egdecases where
+					// sorting is not possible (modules splitted into different chunks).
+					// So we not even trying and solve this by a microtask delay.
+					"function promiseResolve() { return Promise.resolve(); }",
+					"",
+					"var wasmImportObjects = {",
+					Template.indent(importObjects),
+					"};"
+				]);
+			}
+		);
+		mainTemplate.hooks.requireEnsure.tap(
+			"WasmMainTemplatePlugin",
+			(source, chunk, hash) => {
+				const webassemblyModuleFilename =
+					mainTemplate.outputOptions.webassemblyModuleFilename;
+
+				const chunkModuleMaps = chunk.getChunkModuleMaps(m =>
+					m.type.startsWith("webassembly")
+				);
+				if (Object.keys(chunkModuleMaps.id).length === 0) return source;
+				const wasmModuleSrcPath = mainTemplate.getAssetPath(
+					JSON.stringify(webassemblyModuleFilename),
+					{
+						hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+						hashWithLength: length =>
+							`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`,
+						module: {
+							id: '" + wasmModuleId + "',
+							hash: `" + ${JSON.stringify(
+								chunkModuleMaps.hash
+							)}[wasmModuleId] + "`,
+							hashWithLength(length) {
+								const shortChunkHashMap = Object.create(null);
+								for (const wasmModuleId of Object.keys(chunkModuleMaps.hash)) {
+									if (typeof chunkModuleMaps.hash[wasmModuleId] === "string") {
+										shortChunkHashMap[wasmModuleId] = chunkModuleMaps.hash[
+											wasmModuleId
+										].substr(0, length);
+									}
+								}
+								return `" + ${JSON.stringify(
+									shortChunkHashMap
+								)}[wasmModuleId] + "`;
+							}
+						}
+					}
+				);
+				const createImportObject = content =>
+					this.mangleImports
+						? `{ ${JSON.stringify(
+								WebAssemblyUtils.MANGLED_MODULE
+						  )}: ${content} }`
+						: content;
+				return Template.asString([
+					source,
+					"",
+					"// Fetch + compile chunk loading for webassembly",
+					"",
+					`var wasmModules = ${JSON.stringify(
+						chunkModuleMaps.id
+					)}[chunkId] || [];`,
+					"",
+					"wasmModules.forEach(function(wasmModuleId) {",
+					Template.indent([
+						"var installedWasmModuleData = installedWasmModules[wasmModuleId];",
+						"",
+						'// a Promise means "currently loading" or "already loaded".',
+						"if(installedWasmModuleData)",
+						Template.indent(["promises.push(installedWasmModuleData);"]),
+						"else {",
+						Template.indent([
+							`var importObject = wasmImportObjects[wasmModuleId]();`,
+							`var req = ${this.generateLoadBinaryCode(wasmModuleSrcPath)};`,
+							"var promise;",
+							this.supportsStreaming
+								? Template.asString([
+										"if(importObject instanceof Promise && typeof WebAssembly.compileStreaming === 'function') {",
+										Template.indent([
+											"promise = Promise.all([WebAssembly.compileStreaming(req), importObject]).then(function(items) {",
+											Template.indent([
+												`return WebAssembly.instantiate(items[0], ${createImportObject(
+													"items[1]"
+												)});`
+											]),
+											"});"
+										]),
+										"} else if(typeof WebAssembly.instantiateStreaming === 'function') {",
+										Template.indent([
+											`promise = WebAssembly.instantiateStreaming(req, ${createImportObject(
+												"importObject"
+											)});`
+										])
+								  ])
+								: Template.asString([
+										"if(importObject instanceof Promise) {",
+										Template.indent([
+											"var bytesPromise = req.then(function(x) { return x.arrayBuffer(); });",
+											"promise = Promise.all([",
+											Template.indent([
+												"bytesPromise.then(function(bytes) { return WebAssembly.compile(bytes); }),",
+												"importObject"
+											]),
+											"]).then(function(items) {",
+											Template.indent([
+												`return WebAssembly.instantiate(items[0], ${createImportObject(
+													"items[1]"
+												)});`
+											]),
+											"});"
+										])
+								  ]),
+							"} else {",
+							Template.indent([
+								"var bytesPromise = req.then(function(x) { return x.arrayBuffer(); });",
+								"promise = bytesPromise.then(function(bytes) {",
+								Template.indent([
+									`return WebAssembly.instantiate(bytes, ${createImportObject(
+										"importObject"
+									)});`
+								]),
+								"});"
+							]),
+							"}",
+							"promises.push(installedWasmModules[wasmModuleId] = promise.then(function(res) {",
+							Template.indent([
+								`return ${mainTemplate.requireFn}.w[wasmModuleId] = (res.instance || res).exports;`
+							]),
+							"}));"
+						]),
+						"}"
+					]),
+					"});"
+				]);
+			}
+		);
+		mainTemplate.hooks.requireExtensions.tap(
+			"WasmMainTemplatePlugin",
+			(source, chunk) => {
+				if (!chunk.hasModuleInGraph(m => m.type.startsWith("webassembly"))) {
+					return source;
+				}
+				return Template.asString([
+					source,
+					"",
+					"// object with all WebAssembly.instance exports",
+					`${mainTemplate.requireFn}.w = {};`
+				]);
+			}
+		);
+		mainTemplate.hooks.hash.tap("WasmMainTemplatePlugin", hash => {
+			hash.update("WasmMainTemplatePlugin");
+			hash.update("2");
+		});
+	}
+}
+
+module.exports = WasmMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/wasm/WebAssemblyGenerator.js b/node_modules/webpack/lib/wasm/WebAssemblyGenerator.js
new file mode 100644
index 0000000..dbee5bd
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/WebAssemblyGenerator.js
@@ -0,0 +1,458 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Generator = require("../Generator");
+const Template = require("../Template");
+const WebAssemblyUtils = require("./WebAssemblyUtils");
+const { RawSource } = require("webpack-sources");
+
+const { editWithAST, addWithAST } = require("@webassemblyjs/wasm-edit");
+const { decode } = require("@webassemblyjs/wasm-parser");
+const t = require("@webassemblyjs/ast");
+const {
+	moduleContextFromModuleAST
+} = require("@webassemblyjs/helper-module-context");
+
+const WebAssemblyExportImportedDependency = require("../dependencies/WebAssemblyExportImportedDependency");
+
+/** @typedef {import("../Module")} Module */
+/** @typedef {import("./WebAssemblyUtils").UsedWasmDependency} UsedWasmDependency */
+/** @typedef {import("../NormalModule")} NormalModule */
+/** @typedef {import("../RuntimeTemplate")} RuntimeTemplate */
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("../Dependency").DependencyTemplate} DependencyTemplate */
+
+/**
+ * @typedef {(ArrayBuffer) => ArrayBuffer} ArrayBufferTransform
+ */
+
+/**
+ * @template T
+ * @param {Function[]} fns transforms
+ * @returns {Function} composed transform
+ */
+const compose = (...fns) => {
+	return fns.reduce(
+		(prevFn, nextFn) => {
+			return value => nextFn(prevFn(value));
+		},
+		value => value
+	);
+};
+
+// TODO replace with @callback
+
+/**
+ * Removes the start instruction
+ *
+ * @param {Object} state unused state
+ * @returns {ArrayBufferTransform} transform
+ */
+const removeStartFunc = state => bin => {
+	return editWithAST(state.ast, bin, {
+		Start(path) {
+			path.remove();
+		}
+	});
+};
+
+/**
+ * Get imported globals
+ *
+ * @param {Object} ast Module's AST
+ * @returns {Array<t.ModuleImport>} - nodes
+ */
+const getImportedGlobals = ast => {
+	const importedGlobals = [];
+
+	t.traverse(ast, {
+		ModuleImport({ node }) {
+			if (t.isGlobalType(node.descr)) {
+				importedGlobals.push(node);
+			}
+		}
+	});
+
+	return importedGlobals;
+};
+
+/**
+ * Get the count for imported func
+ *
+ * @param {Object} ast Module's AST
+ * @returns {Number} - count
+ */
+const getCountImportedFunc = ast => {
+	let count = 0;
+
+	t.traverse(ast, {
+		ModuleImport({ node }) {
+			if (t.isFuncImportDescr(node.descr)) {
+				count++;
+			}
+		}
+	});
+
+	return count;
+};
+
+/**
+ * Get next type index
+ *
+ * @param {Object} ast Module's AST
+ * @returns {t.Index} - index
+ */
+const getNextTypeIndex = ast => {
+	const typeSectionMetadata = t.getSectionMetadata(ast, "type");
+
+	if (typeSectionMetadata === undefined) {
+		return t.indexLiteral(0);
+	}
+
+	return t.indexLiteral(typeSectionMetadata.vectorOfSize.value);
+};
+
+/**
+ * Get next func index
+ *
+ * The Func section metadata provide informations for implemented funcs
+ * in order to have the correct index we shift the index by number of external
+ * functions.
+ *
+ * @param {Object} ast Module's AST
+ * @param {Number} countImportedFunc number of imported funcs
+ * @returns {t.Index} - index
+ */
+const getNextFuncIndex = (ast, countImportedFunc) => {
+	const funcSectionMetadata = t.getSectionMetadata(ast, "func");
+
+	if (funcSectionMetadata === undefined) {
+		return t.indexLiteral(0 + countImportedFunc);
+	}
+
+	const vectorOfSize = funcSectionMetadata.vectorOfSize.value;
+
+	return t.indexLiteral(vectorOfSize + countImportedFunc);
+};
+
+/**
+ * Creates an init instruction for a global type
+ * @param {t.GlobalType} globalType the global type
+ * @returns {t.Instruction} init expression
+ */
+const createDefaultInitForGlobal = globalType => {
+	if (globalType.valtype[0] === "i") {
+		// create NumberLiteral global initializer
+		return t.objectInstruction("const", globalType.valtype, [
+			t.numberLiteralFromRaw(66)
+		]);
+	} else if (globalType.valtype[0] === "f") {
+		// create FloatLiteral global initializer
+		return t.objectInstruction("const", globalType.valtype, [
+			t.floatLiteral(66, false, false, "66")
+		]);
+	} else {
+		throw new Error("unknown type: " + globalType.valtype);
+	}
+};
+
+/**
+ * Rewrite the import globals:
+ * - removes the ModuleImport instruction
+ * - injects at the same offset a mutable global of the same type
+ *
+ * Since the imported globals are before the other global declarations, our
+ * indices will be preserved.
+ *
+ * Note that globals will become mutable.
+ *
+ * @param {Object} state unused state
+ * @returns {ArrayBufferTransform} transform
+ */
+const rewriteImportedGlobals = state => bin => {
+	const additionalInitCode = state.additionalInitCode;
+	const newGlobals = [];
+
+	bin = editWithAST(state.ast, bin, {
+		ModuleImport(path) {
+			if (t.isGlobalType(path.node.descr)) {
+				const globalType = path.node.descr;
+
+				globalType.mutability = "var";
+
+				const init = [
+					createDefaultInitForGlobal(globalType),
+					t.instruction("end")
+				];
+
+				newGlobals.push(t.global(globalType, init));
+
+				path.remove();
+			}
+		},
+
+		// in order to preserve non-imported global's order we need to re-inject
+		// those as well
+		Global(path) {
+			const { node } = path;
+			const [init] = node.init;
+
+			if (init.id === "get_global") {
+				node.globalType.mutability = "var";
+
+				const initialGlobalidx = init.args[0];
+
+				node.init = [
+					createDefaultInitForGlobal(node.globalType),
+					t.instruction("end")
+				];
+
+				additionalInitCode.push(
+					/**
+					 * get_global in global initializer only works for imported globals.
+					 * They have the same indices as the init params, so use the
+					 * same index.
+					 */
+					t.instruction("get_local", [initialGlobalidx]),
+					t.instruction("set_global", [t.indexLiteral(newGlobals.length)])
+				);
+			}
+
+			newGlobals.push(node);
+
+			path.remove();
+		}
+	});
+
+	// Add global declaration instructions
+	return addWithAST(state.ast, bin, newGlobals);
+};
+
+/**
+ * Rewrite the export names
+ * @param {Object} state state
+ * @param {Object} state.ast Module's ast
+ * @param {Module} state.module Module
+ * @param {Set<string>} state.externalExports Module
+ * @returns {ArrayBufferTransform} transform
+ */
+const rewriteExportNames = ({ ast, module, externalExports }) => bin => {
+	return editWithAST(ast, bin, {
+		ModuleExport(path) {
+			const isExternal = externalExports.has(path.node.name);
+			if (isExternal) {
+				path.remove();
+				return;
+			}
+			const usedName = module.isUsed(path.node.name);
+			if (!usedName) {
+				path.remove();
+				return;
+			}
+			path.node.name = usedName;
+		}
+	});
+};
+
+/**
+ * Mangle import names and modules
+ * @param {Object} state state
+ * @param {Object} state.ast Module's ast
+ * @param {Map<string, UsedWasmDependency>} state.usedDependencyMap mappings to mangle names
+ * @returns {ArrayBufferTransform} transform
+ */
+const rewriteImports = ({ ast, usedDependencyMap }) => bin => {
+	return editWithAST(ast, bin, {
+		ModuleImport(path) {
+			const result = usedDependencyMap.get(
+				path.node.module + ":" + path.node.name
+			);
+
+			if (result !== undefined) {
+				path.node.module = result.module;
+				path.node.name = result.name;
+			}
+		}
+	});
+};
+
+/**
+ * Add an init function.
+ *
+ * The init function fills the globals given input arguments.
+ *
+ * @param {Object} state transformation state
+ * @param {Object} state.ast Module's ast
+ * @param {t.Identifier} state.initFuncId identifier of the init function
+ * @param {t.Index} state.startAtFuncOffset index of the start function
+ * @param {t.ModuleImport[]} state.importedGlobals list of imported globals
+ * @param {t.Instruction[]} state.additionalInitCode list of addition instructions for the init function
+ * @param {t.Index} state.nextFuncIndex index of the next function
+ * @param {t.Index} state.nextTypeIndex index of the next type
+ * @returns {ArrayBufferTransform} transform
+ */
+const addInitFunction = ({
+	ast,
+	initFuncId,
+	startAtFuncOffset,
+	importedGlobals,
+	additionalInitCode,
+	nextFuncIndex,
+	nextTypeIndex
+}) => bin => {
+	const funcParams = importedGlobals.map(importedGlobal => {
+		// used for debugging
+		const id = t.identifier(`${importedGlobal.module}.${importedGlobal.name}`);
+
+		return t.funcParam(importedGlobal.descr.valtype, id);
+	});
+
+	const funcBody = importedGlobals.reduce((acc, importedGlobal, index) => {
+		const args = [t.indexLiteral(index)];
+		const body = [
+			t.instruction("get_local", args),
+			t.instruction("set_global", args)
+		];
+
+		return [...acc, ...body];
+	}, []);
+
+	if (typeof startAtFuncOffset === "number") {
+		funcBody.push(t.callInstruction(t.numberLiteralFromRaw(startAtFuncOffset)));
+	}
+
+	for (const instr of additionalInitCode) {
+		funcBody.push(instr);
+	}
+
+	funcBody.push(t.instruction("end"));
+
+	const funcResults = [];
+
+	// Code section
+	const funcSignature = t.signature(funcParams, funcResults);
+	const func = t.func(initFuncId, funcSignature, funcBody);
+
+	// Type section
+	const functype = t.typeInstruction(undefined, funcSignature);
+
+	// Func section
+	const funcindex = t.indexInFuncSection(nextTypeIndex);
+
+	// Export section
+	const moduleExport = t.moduleExport(
+		initFuncId.value,
+		t.moduleExportDescr("Func", nextFuncIndex)
+	);
+
+	return addWithAST(ast, bin, [func, moduleExport, funcindex, functype]);
+};
+
+/**
+ * Extract mangle mappings from module
+ * @param {Module} module current module
+ * @param {boolean} mangle mangle imports
+ * @returns {Map<string, UsedWasmDependency>} mappings to mangled names
+ */
+const getUsedDependencyMap = (module, mangle) => {
+	/** @type {Map<string, UsedWasmDependency>} */
+	const map = new Map();
+	for (const usedDep of WebAssemblyUtils.getUsedDependencies(module, mangle)) {
+		const dep = usedDep.dependency;
+		const request = dep.request;
+		const exportName = dep.name;
+		map.set(request + ":" + exportName, usedDep);
+	}
+	return map;
+};
+
+class WebAssemblyGenerator extends Generator {
+	constructor(options) {
+		super();
+		this.options = options;
+	}
+
+	/**
+	 * @param {NormalModule} module module for which the code should be generated
+	 * @param {Map<Function, DependencyTemplate>} dependencyTemplates mapping from dependencies to templates
+	 * @param {RuntimeTemplate} runtimeTemplate the runtime template
+	 * @param {string} type which kind of code should be generated
+	 * @returns {Source} generated code
+	 */
+	generate(module, dependencyTemplates, runtimeTemplate, type) {
+		let bin = module.originalSource().source();
+
+		const initFuncId = t.identifier(
+			Array.isArray(module.usedExports)
+				? Template.numberToIdentifer(module.usedExports.length)
+				: "__webpack_init__"
+		);
+
+		// parse it
+		const ast = decode(bin, {
+			ignoreDataSection: true,
+			ignoreCodeSection: true,
+			ignoreCustomNameSection: true
+		});
+
+		const moduleContext = moduleContextFromModuleAST(ast.body[0]);
+
+		const importedGlobals = getImportedGlobals(ast);
+		const countImportedFunc = getCountImportedFunc(ast);
+		const startAtFuncOffset = moduleContext.getStart();
+		const nextFuncIndex = getNextFuncIndex(ast, countImportedFunc);
+		const nextTypeIndex = getNextTypeIndex(ast);
+
+		const usedDependencyMap = getUsedDependencyMap(
+			module,
+			this.options.mangleImports
+		);
+		const externalExports = new Set(
+			module.dependencies
+				.filter(d => d instanceof WebAssemblyExportImportedDependency)
+				.map(d => {
+					const wasmDep = /** @type {WebAssemblyExportImportedDependency} */ (d);
+					return wasmDep.exportName;
+				})
+		);
+
+		/** @type {t.Instruction[]} */
+		const additionalInitCode = [];
+
+		const transform = compose(
+			rewriteExportNames({
+				ast,
+				module,
+				externalExports
+			}),
+
+			removeStartFunc({ ast }),
+
+			rewriteImportedGlobals({ ast, additionalInitCode }),
+
+			rewriteImports({
+				ast,
+				usedDependencyMap
+			}),
+
+			addInitFunction({
+				ast,
+				initFuncId,
+				importedGlobals,
+				additionalInitCode,
+				startAtFuncOffset,
+				nextFuncIndex,
+				nextTypeIndex
+			})
+		);
+
+		const newBin = transform(bin);
+
+		return new RawSource(newBin);
+	}
+}
+
+module.exports = WebAssemblyGenerator;
diff --git a/node_modules/webpack/lib/wasm/WebAssemblyInInitialChunkError.js b/node_modules/webpack/lib/wasm/WebAssemblyInInitialChunkError.js
new file mode 100644
index 0000000..319e757
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/WebAssemblyInInitialChunkError.js
@@ -0,0 +1,88 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+*/
+"use strict";
+
+const WebpackError = require("../WebpackError");
+
+/** @typedef {import("../Module")} Module */
+/** @typedef {import("../RequestShortener")} RequestShortener */
+
+/**
+ * @param {Module} module module to get chains from
+ * @param {RequestShortener} requestShortener to make readable identifiers
+ * @returns {string[]} all chains to the module
+ */
+const getInitialModuleChains = (module, requestShortener) => {
+	const queue = [
+		{ head: module, message: module.readableIdentifier(requestShortener) }
+	];
+	/** @type {Set<string>} */
+	const results = new Set();
+	/** @type {Set<string>} */
+	const incompleteResults = new Set();
+	/** @type {Set<Module>} */
+	const visitedModules = new Set();
+
+	for (const chain of queue) {
+		const { head, message } = chain;
+		let final = true;
+		/** @type {Set<Module>} */
+		const alreadyReferencedModules = new Set();
+		for (const reason of head.reasons) {
+			const newHead = reason.module;
+			if (newHead) {
+				if (!newHead.getChunks().some(c => c.canBeInitial())) continue;
+				final = false;
+				if (alreadyReferencedModules.has(newHead)) continue;
+				alreadyReferencedModules.add(newHead);
+				const moduleName = newHead.readableIdentifier(requestShortener);
+				const detail = reason.explanation ? ` (${reason.explanation})` : "";
+				const newMessage = `${moduleName}${detail} --> ${message}`;
+				if (visitedModules.has(newHead)) {
+					incompleteResults.add(`... --> ${newMessage}`);
+					continue;
+				}
+				visitedModules.add(newHead);
+				queue.push({
+					head: newHead,
+					message: newMessage
+				});
+			} else {
+				final = false;
+				const newMessage = reason.explanation
+					? `(${reason.explanation}) --> ${message}`
+					: message;
+				results.add(newMessage);
+			}
+		}
+		if (final) {
+			results.add(message);
+		}
+	}
+	for (const result of incompleteResults) {
+		results.add(result);
+	}
+	return Array.from(results);
+};
+
+module.exports = class WebAssemblyInInitialChunkError extends WebpackError {
+	/**
+	 * @param {Module} module WASM module
+	 * @param {RequestShortener} requestShortener request shortener
+	 */
+	constructor(module, requestShortener) {
+		const moduleChains = getInitialModuleChains(module, requestShortener);
+		const message = `WebAssembly module is included in initial chunk.
+This is not allowed, because WebAssembly download and compilation must happen asynchronous.
+Add an async splitpoint (i. e. import()) somewhere between your entrypoint and the WebAssembly module:
+${moduleChains.map(s => `* ${s}`).join("\n")}`;
+
+		super(message);
+		this.name = "WebAssemblyInInitialChunkError";
+		this.hideStack = true;
+		this.module = module;
+
+		Error.captureStackTrace(this, this.constructor);
+	}
+};
diff --git a/node_modules/webpack/lib/wasm/WebAssemblyJavascriptGenerator.js b/node_modules/webpack/lib/wasm/WebAssemblyJavascriptGenerator.js
new file mode 100644
index 0000000..22dfb79
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/WebAssemblyJavascriptGenerator.js
@@ -0,0 +1,152 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Generator = require("../Generator");
+const Template = require("../Template");
+const { RawSource } = require("webpack-sources");
+const WebAssemblyImportDependency = require("../dependencies/WebAssemblyImportDependency");
+const WebAssemblyExportImportedDependency = require("../dependencies/WebAssemblyExportImportedDependency");
+
+/** @typedef {import("../NormalModule")} NormalModule */
+/** @typedef {import("../RuntimeTemplate")} RuntimeTemplate */
+/** @typedef {import("webpack-sources").Source} Source */
+/** @typedef {import("../Dependency").DependencyTemplate} DependencyTemplate */
+
+class WebAssemblyJavascriptGenerator extends Generator {
+	/**
+	 * @param {NormalModule} module module for which the code should be generated
+	 * @param {Map<Function, DependencyTemplate>} dependencyTemplates mapping from dependencies to templates
+	 * @param {RuntimeTemplate} runtimeTemplate the runtime template
+	 * @param {string} type which kind of code should be generated
+	 * @returns {Source} generated code
+	 */
+	generate(module, dependencyTemplates, runtimeTemplate, type) {
+		const initIdentifer = Array.isArray(module.usedExports)
+			? Template.numberToIdentifer(module.usedExports.length)
+			: "__webpack_init__";
+
+		let needExportsCopy = false;
+		const importedModules = new Map();
+		const initParams = [];
+		let index = 0;
+		for (const dep of module.dependencies) {
+			const depAsAny = /** @type {any} */ (dep);
+			if (dep.module) {
+				let importData = importedModules.get(dep.module);
+				if (importData === undefined) {
+					importedModules.set(
+						dep.module,
+						(importData = {
+							importVar: `m${index}`,
+							index,
+							request:
+								"userRequest" in depAsAny ? depAsAny.userRequest : undefined,
+							names: new Set(),
+							reexports: []
+						})
+					);
+					index++;
+				}
+				if (dep instanceof WebAssemblyImportDependency) {
+					importData.names.add(dep.name);
+					if (dep.description.type === "GlobalType") {
+						const exportName = dep.name;
+						const usedName = dep.module && dep.module.isUsed(exportName);
+
+						if (dep.module) {
+							if (usedName) {
+								initParams.push(
+									runtimeTemplate.exportFromImport({
+										module: dep.module,
+										request: dep.request,
+										importVar: importData.importVar,
+										originModule: module,
+										exportName: dep.name,
+										asiSafe: true,
+										isCall: false,
+										callContext: null
+									})
+								);
+							}
+						}
+					}
+				}
+				if (dep instanceof WebAssemblyExportImportedDependency) {
+					importData.names.add(dep.name);
+					const usedName = module.isUsed(dep.exportName);
+					if (usedName) {
+						const exportProp = `${module.exportsArgument}[${JSON.stringify(
+							usedName
+						)}]`;
+						const defineStatement = Template.asString([
+							`${exportProp} = ${runtimeTemplate.exportFromImport({
+								module: dep.module,
+								request: dep.request,
+								importVar: importData.importVar,
+								originModule: module,
+								exportName: dep.name,
+								asiSafe: true,
+								isCall: false,
+								callContext: null
+							})};`,
+							`if(WebAssembly.Global) ${exportProp} = ` +
+								`new WebAssembly.Global({ value: ${JSON.stringify(
+									dep.valueType
+								)} }, ${exportProp});`
+						]);
+						importData.reexports.push(defineStatement);
+						needExportsCopy = true;
+					}
+				}
+			}
+		}
+		const importsCode = Template.asString(
+			Array.from(
+				importedModules,
+				([module, { importVar, request, reexports }]) => {
+					const importStatement = runtimeTemplate.importStatement({
+						module,
+						request,
+						importVar,
+						originModule: module
+					});
+					return importStatement + reexports.join("\n");
+				}
+			)
+		);
+
+		// create source
+		const source = new RawSource(
+			[
+				'"use strict";',
+				"// Instantiate WebAssembly module",
+				"var wasmExports = __webpack_require__.w[module.i];",
+
+				!Array.isArray(module.usedExports)
+					? `__webpack_require__.r(${module.exportsArgument});`
+					: "",
+
+				// this must be before import for circular dependencies
+				"// export exports from WebAssembly module",
+				Array.isArray(module.usedExports) && !needExportsCopy
+					? `${module.moduleArgument}.exports = wasmExports;`
+					: "for(var name in wasmExports) " +
+					  `if(name != ${JSON.stringify(initIdentifer)}) ` +
+					  `${module.exportsArgument}[name] = wasmExports[name];`,
+				"// exec imports from WebAssembly module (for esm order)",
+				importsCode,
+				"",
+				"// exec wasm module",
+				`wasmExports[${JSON.stringify(initIdentifer)}](${initParams.join(
+					", "
+				)})`
+			].join("\n")
+		);
+		return source;
+	}
+}
+
+module.exports = WebAssemblyJavascriptGenerator;
diff --git a/node_modules/webpack/lib/wasm/WebAssemblyModulesPlugin.js b/node_modules/webpack/lib/wasm/WebAssemblyModulesPlugin.js
new file mode 100644
index 0000000..a4dd8a5
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/WebAssemblyModulesPlugin.js
@@ -0,0 +1,128 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Generator = require("../Generator");
+const WebAssemblyExportImportedDependency = require("../dependencies/WebAssemblyExportImportedDependency");
+const WebAssemblyImportDependency = require("../dependencies/WebAssemblyImportDependency");
+const WebAssemblyInInitialChunkError = require("./WebAssemblyInInitialChunkError");
+
+/** @typedef {import("../Compiler")} Compiler */
+
+let WebAssemblyGenerator;
+let WebAssemblyJavascriptGenerator;
+let WebAssemblyParser;
+
+class WebAssemblyModulesPlugin {
+	constructor(options) {
+		this.options = options;
+	}
+
+	/**
+	 * @param {Compiler} compiler compiler
+	 * @returns {void}
+	 */
+	apply(compiler) {
+		compiler.hooks.compilation.tap(
+			"WebAssemblyModulesPlugin",
+			(compilation, { normalModuleFactory }) => {
+				compilation.dependencyFactories.set(
+					WebAssemblyImportDependency,
+					normalModuleFactory
+				);
+
+				compilation.dependencyFactories.set(
+					WebAssemblyExportImportedDependency,
+					normalModuleFactory
+				);
+
+				normalModuleFactory.hooks.createParser
+					.for("webassembly/experimental")
+					.tap("WebAssemblyModulesPlugin", () => {
+						if (WebAssemblyParser === undefined) {
+							WebAssemblyParser = require("./WebAssemblyParser");
+						}
+						return new WebAssemblyParser();
+					});
+
+				normalModuleFactory.hooks.createGenerator
+					.for("webassembly/experimental")
+					.tap("WebAssemblyModulesPlugin", () => {
+						if (WebAssemblyGenerator === undefined) {
+							WebAssemblyGenerator = require("./WebAssemblyGenerator");
+						}
+						if (WebAssemblyJavascriptGenerator === undefined) {
+							WebAssemblyJavascriptGenerator = require("./WebAssemblyJavascriptGenerator");
+						}
+						return Generator.byType({
+							javascript: new WebAssemblyJavascriptGenerator(),
+							webassembly: new WebAssemblyGenerator(this.options)
+						});
+					});
+
+				compilation.chunkTemplate.hooks.renderManifest.tap(
+					"WebAssemblyModulesPlugin",
+					(result, options) => {
+						const chunk = options.chunk;
+						const outputOptions = options.outputOptions;
+						const moduleTemplates = options.moduleTemplates;
+						const dependencyTemplates = options.dependencyTemplates;
+
+						for (const module of chunk.modulesIterable) {
+							if (module.type && module.type.startsWith("webassembly")) {
+								const filenameTemplate =
+									outputOptions.webassemblyModuleFilename;
+
+								result.push({
+									render: () =>
+										this.renderWebAssembly(
+											module,
+											moduleTemplates.webassembly,
+											dependencyTemplates
+										),
+									filenameTemplate,
+									pathOptions: {
+										module
+									},
+									identifier: `webassemblyModule${module.id}`,
+									hash: module.hash
+								});
+							}
+						}
+
+						return result;
+					}
+				);
+
+				compilation.hooks.afterChunks.tap("WebAssemblyModulesPlugin", () => {
+					const initialWasmModules = new Set();
+					for (const chunk of compilation.chunks) {
+						if (chunk.canBeInitial()) {
+							for (const module of chunk.modulesIterable) {
+								if (module.type.startsWith("webassembly")) {
+									initialWasmModules.add(module);
+								}
+							}
+						}
+					}
+					for (const module of initialWasmModules) {
+						compilation.errors.push(
+							new WebAssemblyInInitialChunkError(
+								module,
+								compilation.requestShortener
+							)
+						);
+					}
+				});
+			}
+		);
+	}
+
+	renderWebAssembly(module, moduleTemplate, dependencyTemplates) {
+		return moduleTemplate.render(module, dependencyTemplates, {});
+	}
+}
+
+module.exports = WebAssemblyModulesPlugin;
diff --git a/node_modules/webpack/lib/wasm/WebAssemblyParser.js b/node_modules/webpack/lib/wasm/WebAssemblyParser.js
new file mode 100644
index 0000000..eb49fb1
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/WebAssemblyParser.js
@@ -0,0 +1,175 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const t = require("@webassemblyjs/ast");
+const { decode } = require("@webassemblyjs/wasm-parser");
+const {
+	moduleContextFromModuleAST
+} = require("@webassemblyjs/helper-module-context");
+
+const { Tapable } = require("tapable");
+const WebAssemblyImportDependency = require("../dependencies/WebAssemblyImportDependency");
+const WebAssemblyExportImportedDependency = require("../dependencies/WebAssemblyExportImportedDependency");
+
+/** @typedef {import("../Module")} Module */
+
+const JS_COMPAT_TYPES = new Set(["i32", "f32", "f64"]);
+
+/**
+ * @param {t.Signature} signature the func signature
+ * @returns {null | string} the type incompatible with js types
+ */
+const getJsIncompatibleType = signature => {
+	for (const param of signature.params) {
+		if (!JS_COMPAT_TYPES.has(param.valtype)) {
+			return `${param.valtype} as parameter`;
+		}
+	}
+	for (const type of signature.results) {
+		if (!JS_COMPAT_TYPES.has(type)) return `${type} as result`;
+	}
+	return null;
+};
+
+/**
+ * TODO why are there two different Signature types?
+ * @param {t.FuncSignature} signature the func signature
+ * @returns {null | string} the type incompatible with js types
+ */
+const getJsIncompatibleTypeOfFuncSignature = signature => {
+	for (const param of signature.args) {
+		if (!JS_COMPAT_TYPES.has(param)) {
+			return `${param} as parameter`;
+		}
+	}
+	for (const type of signature.result) {
+		if (!JS_COMPAT_TYPES.has(type)) return `${type} as result`;
+	}
+	return null;
+};
+
+const decoderOpts = {
+	ignoreCodeSection: true,
+	ignoreDataSection: true,
+
+	// this will avoid having to lookup with identifiers in the ModuleContext
+	ignoreCustomNameSection: true
+};
+
+class WebAssemblyParser extends Tapable {
+	constructor(options) {
+		super();
+		this.hooks = {};
+		this.options = options;
+	}
+
+	parse(binary, state) {
+		// flag it as ESM
+		state.module.buildMeta.exportsType = "namespace";
+
+		// parse it
+		const program = decode(binary, decoderOpts);
+		const module = program.body[0];
+
+		const moduleContext = moduleContextFromModuleAST(module);
+
+		// extract imports and exports
+		const exports = (state.module.buildMeta.providedExports = []);
+		const jsIncompatibleExports = (state.module.buildMeta.jsIncompatibleExports = []);
+
+		const importedGlobals = [];
+		t.traverse(module, {
+			ModuleExport({ node }) {
+				const descriptor = node.descr;
+
+				if (descriptor.exportType === "Func") {
+					const funcidx = descriptor.id.value;
+
+					/** @type {t.FuncSignature} */
+					const funcSignature = moduleContext.getFunction(funcidx);
+
+					const incompatibleType = getJsIncompatibleTypeOfFuncSignature(
+						funcSignature
+					);
+
+					if (incompatibleType) {
+						jsIncompatibleExports[node.name] = incompatibleType;
+					}
+				}
+
+				exports.push(node.name);
+
+				if (node.descr && node.descr.exportType === "Global") {
+					const refNode = importedGlobals[node.descr.id.value];
+					if (refNode) {
+						const dep = new WebAssemblyExportImportedDependency(
+							node.name,
+							refNode.module,
+							refNode.name,
+							refNode.descr.valtype
+						);
+
+						state.module.addDependency(dep);
+					}
+				}
+			},
+
+			Global({ node }) {
+				const init = node.init[0];
+
+				let importNode = null;
+
+				if (init.id === "get_global") {
+					const globalIdx = init.args[0].value;
+
+					if (globalIdx < importedGlobals.length) {
+						importNode = importedGlobals[globalIdx];
+					}
+				}
+
+				importedGlobals.push(importNode);
+			},
+
+			ModuleImport({ node }) {
+				/** @type {false | string} */
+				let onlyDirectImport = false;
+
+				if (t.isMemory(node.descr) === true) {
+					onlyDirectImport = "Memory";
+				} else if (t.isTable(node.descr) === true) {
+					onlyDirectImport = "Table";
+				} else if (t.isFuncImportDescr(node.descr) === true) {
+					const incompatibleType = getJsIncompatibleType(node.descr.signature);
+					if (incompatibleType) {
+						onlyDirectImport = `Non-JS-compatible Func Sigurature (${incompatibleType})`;
+					}
+				} else if (t.isGlobalType(node.descr) === true) {
+					const type = node.descr.valtype;
+					if (!JS_COMPAT_TYPES.has(type)) {
+						onlyDirectImport = `Non-JS-compatible Global Type (${type})`;
+					}
+				}
+
+				const dep = new WebAssemblyImportDependency(
+					node.module,
+					node.name,
+					node.descr,
+					onlyDirectImport
+				);
+
+				state.module.addDependency(dep);
+
+				if (t.isGlobalType(node.descr)) {
+					importedGlobals.push(node);
+				}
+			}
+		});
+
+		return state;
+	}
+}
+
+module.exports = WebAssemblyParser;
diff --git a/node_modules/webpack/lib/wasm/WebAssemblyUtils.js b/node_modules/webpack/lib/wasm/WebAssemblyUtils.js
new file mode 100644
index 0000000..75eb6d2
--- /dev/null
+++ b/node_modules/webpack/lib/wasm/WebAssemblyUtils.js
@@ -0,0 +1,59 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Template = require("../Template");
+const WebAssemblyImportDependency = require("../dependencies/WebAssemblyImportDependency");
+
+/** @typedef {import("../Module")} Module */
+
+/** @typedef {Object} UsedWasmDependency
+ * @property {WebAssemblyImportDependency} dependency the dependency
+ * @property {string} name the export name
+ * @property {string} module the module name
+ */
+
+const MANGLED_MODULE = "a";
+
+/**
+ * @param {Module} module the module
+ * @param {boolean} mangle mangle module and export names
+ * @returns {UsedWasmDependency[]} used dependencies and (mangled) name
+ */
+const getUsedDependencies = (module, mangle) => {
+	/** @type {UsedWasmDependency[]} */
+	const array = [];
+	let importIndex = 0;
+	for (const dep of module.dependencies) {
+		if (dep instanceof WebAssemblyImportDependency) {
+			if (dep.description.type === "GlobalType" || dep.module === null) {
+				continue;
+			}
+
+			const exportName = dep.name;
+			// TODO add the following 3 lines when removing of ModuleExport is possible
+			// const importedModule = dep.module;
+			// const usedName = importedModule && importedModule.isUsed(exportName);
+			// if (usedName !== false) {
+			if (mangle) {
+				array.push({
+					dependency: dep,
+					name: Template.numberToIdentifer(importIndex++),
+					module: MANGLED_MODULE
+				});
+			} else {
+				array.push({
+					dependency: dep,
+					name: exportName,
+					module: dep.request
+				});
+			}
+		}
+	}
+	return array;
+};
+
+exports.getUsedDependencies = getUsedDependencies;
+exports.MANGLED_MODULE = MANGLED_MODULE;
diff --git a/node_modules/webpack/lib/web/FetchCompileWasmTemplatePlugin.js b/node_modules/webpack/lib/web/FetchCompileWasmTemplatePlugin.js
new file mode 100644
index 0000000..025921f
--- /dev/null
+++ b/node_modules/webpack/lib/web/FetchCompileWasmTemplatePlugin.js
@@ -0,0 +1,37 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WasmMainTemplatePlugin = require("../wasm/WasmMainTemplatePlugin");
+
+class FetchCompileWasmTemplatePlugin {
+	constructor(options) {
+		this.options = options || {};
+	}
+
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap(
+			"FetchCompileWasmTemplatePlugin",
+			compilation => {
+				const mainTemplate = compilation.mainTemplate;
+				const generateLoadBinaryCode = path =>
+					`fetch(${mainTemplate.requireFn}.p + ${path})`;
+
+				const plugin = new WasmMainTemplatePlugin(
+					Object.assign(
+						{
+							generateLoadBinaryCode,
+							supportsStreaming: true
+						},
+						this.options
+					)
+				);
+				plugin.apply(mainTemplate);
+			}
+		);
+	}
+}
+
+module.exports = FetchCompileWasmTemplatePlugin;
diff --git a/node_modules/webpack/lib/web/JsonpChunkTemplatePlugin.js b/node_modules/webpack/lib/web/JsonpChunkTemplatePlugin.js
new file mode 100644
index 0000000..123dd52
--- /dev/null
+++ b/node_modules/webpack/lib/web/JsonpChunkTemplatePlugin.js
@@ -0,0 +1,71 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+
+/** @typedef {import("../ChunkTemplate")} ChunkTemplate */
+
+const getEntryInfo = chunk => {
+	return [chunk.entryModule].filter(Boolean).map(m =>
+		[m.id].concat(
+			Array.from(chunk.groupsIterable)[0]
+				.chunks.filter(c => c !== chunk)
+				.map(c => c.id)
+		)
+	);
+};
+
+class JsonpChunkTemplatePlugin {
+	/**
+	 * @param {ChunkTemplate} chunkTemplate the chunk template
+	 * @returns {void}
+	 */
+	apply(chunkTemplate) {
+		chunkTemplate.hooks.render.tap(
+			"JsonpChunkTemplatePlugin",
+			(modules, chunk) => {
+				const jsonpFunction = chunkTemplate.outputOptions.jsonpFunction;
+				const globalObject = chunkTemplate.outputOptions.globalObject;
+				const source = new ConcatSource();
+				const prefetchChunks = chunk.getChildIdsByOrders().prefetch;
+				source.add(
+					`(${globalObject}[${JSON.stringify(
+						jsonpFunction
+					)}] = ${globalObject}[${JSON.stringify(
+						jsonpFunction
+					)}] || []).push([${JSON.stringify(chunk.ids)},`
+				);
+				source.add(modules);
+				const entries = getEntryInfo(chunk);
+				if (entries.length > 0) {
+					source.add(`,${JSON.stringify(entries)}`);
+				} else if (prefetchChunks && prefetchChunks.length) {
+					source.add(`,0`);
+				}
+
+				if (prefetchChunks && prefetchChunks.length) {
+					source.add(`,${JSON.stringify(prefetchChunks)}`);
+				}
+				source.add("])");
+				return source;
+			}
+		);
+		chunkTemplate.hooks.hash.tap("JsonpChunkTemplatePlugin", hash => {
+			hash.update("JsonpChunkTemplatePlugin");
+			hash.update("4");
+			hash.update(`${chunkTemplate.outputOptions.jsonpFunction}`);
+			hash.update(`${chunkTemplate.outputOptions.globalObject}`);
+		});
+		chunkTemplate.hooks.hashForChunk.tap(
+			"JsonpChunkTemplatePlugin",
+			(hash, chunk) => {
+				hash.update(JSON.stringify(getEntryInfo(chunk)));
+				hash.update(JSON.stringify(chunk.getChildIdsByOrders().prefetch) || "");
+			}
+		);
+	}
+}
+module.exports = JsonpChunkTemplatePlugin;
diff --git a/node_modules/webpack/lib/web/JsonpExportMainTemplatePlugin.js b/node_modules/webpack/lib/web/JsonpExportMainTemplatePlugin.js
new file mode 100644
index 0000000..064b249
--- /dev/null
+++ b/node_modules/webpack/lib/web/JsonpExportMainTemplatePlugin.js
@@ -0,0 +1,50 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+
+class JsonpExportMainTemplatePlugin {
+	/**
+	 * @param {string} name jsonp function name
+	 */
+	constructor(name) {
+		this.name = name;
+	}
+
+	apply(compilation) {
+		const { mainTemplate, chunkTemplate } = compilation;
+
+		const onRenderWithEntry = (source, chunk, hash) => {
+			const name = mainTemplate.getAssetPath(this.name || "", {
+				hash,
+				chunk
+			});
+			return new ConcatSource(`${name}(`, source, ");");
+		};
+
+		for (const template of [mainTemplate, chunkTemplate]) {
+			template.hooks.renderWithEntry.tap(
+				"JsonpExportMainTemplatePlugin",
+				onRenderWithEntry
+			);
+		}
+
+		mainTemplate.hooks.globalHashPaths.tap(
+			"JsonpExportMainTemplatePlugin",
+			paths => {
+				if (this.name) paths.push(this.name);
+				return paths;
+			}
+		);
+
+		mainTemplate.hooks.hash.tap("JsonpExportMainTemplatePlugin", hash => {
+			hash.update("jsonp export");
+			hash.update(`${this.name}`);
+		});
+	}
+}
+
+module.exports = JsonpExportMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/web/JsonpHotUpdateChunkTemplatePlugin.js b/node_modules/webpack/lib/web/JsonpHotUpdateChunkTemplatePlugin.js
new file mode 100644
index 0000000..bff023c
--- /dev/null
+++ b/node_modules/webpack/lib/web/JsonpHotUpdateChunkTemplatePlugin.js
@@ -0,0 +1,39 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+
+class JsonpHotUpdateChunkTemplatePlugin {
+	apply(hotUpdateChunkTemplate) {
+		hotUpdateChunkTemplate.hooks.render.tap(
+			"JsonpHotUpdateChunkTemplatePlugin",
+			(modulesSource, modules, removedModules, hash, id) => {
+				const source = new ConcatSource();
+				source.add(
+					`${
+						hotUpdateChunkTemplate.outputOptions.hotUpdateFunction
+					}(${JSON.stringify(id)},`
+				);
+				source.add(modulesSource);
+				source.add(")");
+				return source;
+			}
+		);
+		hotUpdateChunkTemplate.hooks.hash.tap(
+			"JsonpHotUpdateChunkTemplatePlugin",
+			hash => {
+				hash.update("JsonpHotUpdateChunkTemplatePlugin");
+				hash.update("3");
+				hash.update(
+					`${hotUpdateChunkTemplate.outputOptions.hotUpdateFunction}`
+				);
+				hash.update(`${hotUpdateChunkTemplate.outputOptions.library}`);
+			}
+		);
+	}
+}
+
+module.exports = JsonpHotUpdateChunkTemplatePlugin;
diff --git a/node_modules/webpack/lib/web/JsonpMainTemplate.runtime.js b/node_modules/webpack/lib/web/JsonpMainTemplate.runtime.js
new file mode 100644
index 0000000..cbaa01e
--- /dev/null
+++ b/node_modules/webpack/lib/web/JsonpMainTemplate.runtime.js
@@ -0,0 +1,71 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+// eslint-disable-next-line no-unused-vars
+var hotAddUpdateChunk = undefined;
+var parentHotUpdateCallback = undefined;
+var $require$ = undefined;
+var $hotMainFilename$ = undefined;
+var $hotChunkFilename$ = undefined;
+var $crossOriginLoading$ = undefined;
+
+module.exports = function() {
+	// eslint-disable-next-line no-unused-vars
+	function webpackHotUpdateCallback(chunkId, moreModules) {
+		hotAddUpdateChunk(chunkId, moreModules);
+		if (parentHotUpdateCallback) parentHotUpdateCallback(chunkId, moreModules);
+	} //$semicolon
+
+	// eslint-disable-next-line no-unused-vars
+	function hotDownloadUpdateChunk(chunkId) {
+		var script = document.createElement("script");
+		script.charset = "utf-8";
+		script.src = $require$.p + $hotChunkFilename$;
+		if ($crossOriginLoading$) script.crossOrigin = $crossOriginLoading$;
+		document.head.appendChild(script);
+	}
+
+	// eslint-disable-next-line no-unused-vars
+	function hotDownloadManifest(requestTimeout) {
+		requestTimeout = requestTimeout || 10000;
+		return new Promise(function(resolve, reject) {
+			if (typeof XMLHttpRequest === "undefined") {
+				return reject(new Error("No browser support"));
+			}
+			try {
+				var request = new XMLHttpRequest();
+				var requestPath = $require$.p + $hotMainFilename$;
+				request.open("GET", requestPath, true);
+				request.timeout = requestTimeout;
+				request.send(null);
+			} catch (err) {
+				return reject(err);
+			}
+			request.onreadystatechange = function() {
+				if (request.readyState !== 4) return;
+				if (request.status === 0) {
+					// timeout
+					reject(
+						new Error("Manifest request to " + requestPath + " timed out.")
+					);
+				} else if (request.status === 404) {
+					// no update available
+					resolve();
+				} else if (request.status !== 200 && request.status !== 304) {
+					// other failure
+					reject(new Error("Manifest request to " + requestPath + " failed."));
+				} else {
+					// success
+					try {
+						var update = JSON.parse(request.responseText);
+					} catch (e) {
+						reject(e);
+						return;
+					}
+					resolve(update);
+				}
+			};
+		});
+	}
+};
diff --git a/node_modules/webpack/lib/web/JsonpMainTemplatePlugin.js b/node_modules/webpack/lib/web/JsonpMainTemplatePlugin.js
new file mode 100644
index 0000000..5fcc8d8
--- /dev/null
+++ b/node_modules/webpack/lib/web/JsonpMainTemplatePlugin.js
@@ -0,0 +1,615 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { SyncWaterfallHook } = require("tapable");
+const Template = require("../Template");
+
+class JsonpMainTemplatePlugin {
+	apply(mainTemplate) {
+		const needChunkOnDemandLoadingCode = chunk => {
+			for (const chunkGroup of chunk.groupsIterable) {
+				if (chunkGroup.getNumberOfChildren() > 0) return true;
+			}
+			return false;
+		};
+		const needChunkLoadingCode = chunk => {
+			for (const chunkGroup of chunk.groupsIterable) {
+				if (chunkGroup.chunks.length > 1) return true;
+				if (chunkGroup.getNumberOfChildren() > 0) return true;
+			}
+			return false;
+		};
+		const needEntryDeferringCode = chunk => {
+			for (const chunkGroup of chunk.groupsIterable) {
+				if (chunkGroup.chunks.length > 1) return true;
+			}
+			return false;
+		};
+		const needPrefetchingCode = chunk => {
+			const allPrefetchChunks = chunk.getChildIdsByOrdersMap(true).prefetch;
+			return allPrefetchChunks && Object.keys(allPrefetchChunks).length;
+		};
+
+		// TODO webpack 5, no adding to .hooks, use WeakMap and static methods
+		["jsonpScript", "linkPreload", "linkPrefetch"].forEach(hook => {
+			if (!mainTemplate.hooks[hook]) {
+				mainTemplate.hooks[hook] = new SyncWaterfallHook([
+					"source",
+					"chunk",
+					"hash"
+				]);
+			}
+		});
+
+		const getScriptSrcPath = (hash, chunk, chunkIdExpression) => {
+			const chunkFilename = mainTemplate.outputOptions.chunkFilename;
+			const chunkMaps = chunk.getChunkMaps();
+			return mainTemplate.getAssetPath(JSON.stringify(chunkFilename), {
+				hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+				hashWithLength: length =>
+					`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`,
+				chunk: {
+					id: `" + ${chunkIdExpression} + "`,
+					hash: `" + ${JSON.stringify(
+						chunkMaps.hash
+					)}[${chunkIdExpression}] + "`,
+					hashWithLength(length) {
+						const shortChunkHashMap = Object.create(null);
+						for (const chunkId of Object.keys(chunkMaps.hash)) {
+							if (typeof chunkMaps.hash[chunkId] === "string") {
+								shortChunkHashMap[chunkId] = chunkMaps.hash[chunkId].substr(
+									0,
+									length
+								);
+							}
+						}
+						return `" + ${JSON.stringify(
+							shortChunkHashMap
+						)}[${chunkIdExpression}] + "`;
+					},
+					name: `" + (${JSON.stringify(
+						chunkMaps.name
+					)}[${chunkIdExpression}]||${chunkIdExpression}) + "`,
+					contentHash: {
+						javascript: `" + ${JSON.stringify(
+							chunkMaps.contentHash.javascript
+						)}[${chunkIdExpression}] + "`
+					},
+					contentHashWithLength: {
+						javascript: length => {
+							const shortContentHashMap = {};
+							const contentHash = chunkMaps.contentHash.javascript;
+							for (const chunkId of Object.keys(contentHash)) {
+								if (typeof contentHash[chunkId] === "string") {
+									shortContentHashMap[chunkId] = contentHash[chunkId].substr(
+										0,
+										length
+									);
+								}
+							}
+							return `" + ${JSON.stringify(
+								shortContentHashMap
+							)}[${chunkIdExpression}] + "`;
+						}
+					}
+				},
+				contentHashType: "javascript"
+			});
+		};
+		mainTemplate.hooks.localVars.tap(
+			"JsonpMainTemplatePlugin",
+			(source, chunk, hash) => {
+				const extraCode = [];
+				if (needChunkLoadingCode(chunk)) {
+					extraCode.push(
+						"",
+						"// object to store loaded and loading chunks",
+						"// undefined = chunk not loaded, null = chunk preloaded/prefetched",
+						"// Promise = chunk loading, 0 = chunk loaded",
+						"var installedChunks = {",
+						Template.indent(
+							chunk.ids.map(id => `${JSON.stringify(id)}: 0`).join(",\n")
+						),
+						"};",
+						"",
+						needEntryDeferringCode(chunk)
+							? needPrefetchingCode(chunk)
+								? "var deferredModules = [], deferredPrefetch = [];"
+								: "var deferredModules = [];"
+							: ""
+					);
+				}
+				if (needChunkOnDemandLoadingCode(chunk)) {
+					extraCode.push(
+						"",
+						"// script path function",
+						"function jsonpScriptSrc(chunkId) {",
+						Template.indent([
+							`return ${mainTemplate.requireFn}.p + ${getScriptSrcPath(
+								hash,
+								chunk,
+								"chunkId"
+							)}`
+						]),
+						"}"
+					);
+				}
+				if (extraCode.length === 0) return source;
+				return Template.asString([source, ...extraCode]);
+			}
+		);
+
+		mainTemplate.hooks.jsonpScript.tap(
+			"JsonpMainTemplatePlugin",
+			(_, chunk, hash) => {
+				const crossOriginLoading =
+					mainTemplate.outputOptions.crossOriginLoading;
+				const chunkLoadTimeout = mainTemplate.outputOptions.chunkLoadTimeout;
+				const jsonpScriptType = mainTemplate.outputOptions.jsonpScriptType;
+
+				return Template.asString([
+					"var script = document.createElement('script');",
+					"var onScriptComplete;",
+					jsonpScriptType
+						? `script.type = ${JSON.stringify(jsonpScriptType)};`
+						: "",
+					"script.charset = 'utf-8';",
+					`script.timeout = ${chunkLoadTimeout / 1000};`,
+					`if (${mainTemplate.requireFn}.nc) {`,
+					Template.indent(
+						`script.setAttribute("nonce", ${mainTemplate.requireFn}.nc);`
+					),
+					"}",
+					"script.src = jsonpScriptSrc(chunkId);",
+					crossOriginLoading
+						? Template.asString([
+								"if (script.src.indexOf(window.location.origin + '/') !== 0) {",
+								Template.indent(
+									`script.crossOrigin = ${JSON.stringify(crossOriginLoading)};`
+								),
+								"}"
+						  ])
+						: "",
+					"// create error before stack unwound to get useful stacktrace later",
+					"var error = new Error();",
+					"onScriptComplete = function (event) {",
+					Template.indent([
+						"// avoid mem leaks in IE.",
+						"script.onerror = script.onload = null;",
+						"clearTimeout(timeout);",
+						"var chunk = installedChunks[chunkId];",
+						"if(chunk !== 0) {",
+						Template.indent([
+							"if(chunk) {",
+							Template.indent([
+								"var errorType = event && (event.type === 'load' ? 'missing' : event.type);",
+								"var realSrc = event && event.target && event.target.src;",
+								"error.message = 'Loading chunk ' + chunkId + ' failed.\\n(' + errorType + ': ' + realSrc + ')';",
+								"error.name = 'ChunkLoadError';",
+								"error.type = errorType;",
+								"error.request = realSrc;",
+								"chunk[1](error);"
+							]),
+							"}",
+							"installedChunks[chunkId] = undefined;"
+						]),
+						"}"
+					]),
+					"};",
+					"var timeout = setTimeout(function(){",
+					Template.indent([
+						"onScriptComplete({ type: 'timeout', target: script });"
+					]),
+					`}, ${chunkLoadTimeout});`,
+					"script.onerror = script.onload = onScriptComplete;"
+				]);
+			}
+		);
+		mainTemplate.hooks.linkPreload.tap(
+			"JsonpMainTemplatePlugin",
+			(_, chunk, hash) => {
+				const crossOriginLoading =
+					mainTemplate.outputOptions.crossOriginLoading;
+				const jsonpScriptType = mainTemplate.outputOptions.jsonpScriptType;
+
+				return Template.asString([
+					"var link = document.createElement('link');",
+					jsonpScriptType
+						? `link.type = ${JSON.stringify(jsonpScriptType)};`
+						: "",
+					"link.charset = 'utf-8';",
+					`if (${mainTemplate.requireFn}.nc) {`,
+					Template.indent(
+						`link.setAttribute("nonce", ${mainTemplate.requireFn}.nc);`
+					),
+					"}",
+					'link.rel = "preload";',
+					'link.as = "script";',
+					"link.href = jsonpScriptSrc(chunkId);",
+					crossOriginLoading
+						? Template.asString([
+								"if (link.href.indexOf(window.location.origin + '/') !== 0) {",
+								Template.indent(
+									`link.crossOrigin = ${JSON.stringify(crossOriginLoading)};`
+								),
+								"}"
+						  ])
+						: ""
+				]);
+			}
+		);
+		mainTemplate.hooks.linkPrefetch.tap(
+			"JsonpMainTemplatePlugin",
+			(_, chunk, hash) => {
+				const crossOriginLoading =
+					mainTemplate.outputOptions.crossOriginLoading;
+
+				return Template.asString([
+					"var link = document.createElement('link');",
+					crossOriginLoading
+						? `link.crossOrigin = ${JSON.stringify(crossOriginLoading)};`
+						: "",
+					`if (${mainTemplate.requireFn}.nc) {`,
+					Template.indent(
+						`link.setAttribute("nonce", ${mainTemplate.requireFn}.nc);`
+					),
+					"}",
+					'link.rel = "prefetch";',
+					'link.as = "script";',
+					"link.href = jsonpScriptSrc(chunkId);"
+				]);
+			}
+		);
+		mainTemplate.hooks.requireEnsure.tap(
+			"JsonpMainTemplatePlugin load",
+			(source, chunk, hash) => {
+				return Template.asString([
+					source,
+					"",
+					"// JSONP chunk loading for javascript",
+					"",
+					"var installedChunkData = installedChunks[chunkId];",
+					'if(installedChunkData !== 0) { // 0 means "already installed".',
+					Template.indent([
+						"",
+						'// a Promise means "currently loading".',
+						"if(installedChunkData) {",
+						Template.indent(["promises.push(installedChunkData[2]);"]),
+						"} else {",
+						Template.indent([
+							"// setup Promise in chunk cache",
+							"var promise = new Promise(function(resolve, reject) {",
+							Template.indent([
+								"installedChunkData = installedChunks[chunkId] = [resolve, reject];"
+							]),
+							"});",
+							"promises.push(installedChunkData[2] = promise);",
+							"",
+							"// start chunk loading",
+							mainTemplate.hooks.jsonpScript.call("", chunk, hash),
+							"document.head.appendChild(script);"
+						]),
+						"}"
+					]),
+					"}"
+				]);
+			}
+		);
+		mainTemplate.hooks.requireEnsure.tap(
+			{
+				name: "JsonpMainTemplatePlugin preload",
+				stage: 10
+			},
+			(source, chunk, hash) => {
+				const chunkMap = chunk.getChildIdsByOrdersMap().preload;
+				if (!chunkMap || Object.keys(chunkMap).length === 0) return source;
+				return Template.asString([
+					source,
+					"",
+					"// chunk preloadng for javascript",
+					"",
+					`var chunkPreloadMap = ${JSON.stringify(chunkMap, null, "\t")};`,
+					"",
+					"var chunkPreloadData = chunkPreloadMap[chunkId];",
+					"if(chunkPreloadData) {",
+					Template.indent([
+						"chunkPreloadData.forEach(function(chunkId) {",
+						Template.indent([
+							"if(installedChunks[chunkId] === undefined) {",
+							Template.indent([
+								"installedChunks[chunkId] = null;",
+								mainTemplate.hooks.linkPreload.call("", chunk, hash),
+								"document.head.appendChild(link);"
+							]),
+							"}"
+						]),
+						"});"
+					]),
+					"}"
+				]);
+			}
+		);
+		mainTemplate.hooks.requireExtensions.tap(
+			"JsonpMainTemplatePlugin",
+			(source, chunk) => {
+				if (!needChunkOnDemandLoadingCode(chunk)) return source;
+
+				return Template.asString([
+					source,
+					"",
+					"// on error function for async loading",
+					`${mainTemplate.requireFn}.oe = function(err) { console.error(err); throw err; };`
+				]);
+			}
+		);
+		mainTemplate.hooks.bootstrap.tap(
+			"JsonpMainTemplatePlugin",
+			(source, chunk, hash) => {
+				if (needChunkLoadingCode(chunk)) {
+					const withDefer = needEntryDeferringCode(chunk);
+					const withPrefetch = needPrefetchingCode(chunk);
+					return Template.asString([
+						source,
+						"",
+						"// install a JSONP callback for chunk loading",
+						"function webpackJsonpCallback(data) {",
+						Template.indent([
+							"var chunkIds = data[0];",
+							"var moreModules = data[1];",
+							withDefer ? "var executeModules = data[2];" : "",
+							withPrefetch ? "var prefetchChunks = data[3] || [];" : "",
+							'// add "moreModules" to the modules object,',
+							'// then flag all "chunkIds" as loaded and fire callback',
+							"var moduleId, chunkId, i = 0, resolves = [];",
+							"for(;i < chunkIds.length; i++) {",
+							Template.indent([
+								"chunkId = chunkIds[i];",
+								"if(Object.prototype.hasOwnProperty.call(installedChunks, chunkId) && installedChunks[chunkId]) {",
+								Template.indent("resolves.push(installedChunks[chunkId][0]);"),
+								"}",
+								"installedChunks[chunkId] = 0;"
+							]),
+							"}",
+							"for(moduleId in moreModules) {",
+							Template.indent([
+								"if(Object.prototype.hasOwnProperty.call(moreModules, moduleId)) {",
+								Template.indent(
+									mainTemplate.renderAddModule(
+										hash,
+										chunk,
+										"moduleId",
+										"moreModules[moduleId]"
+									)
+								),
+								"}"
+							]),
+							"}",
+							"if(parentJsonpFunction) parentJsonpFunction(data);",
+							withPrefetch
+								? withDefer
+									? "deferredPrefetch.push.apply(deferredPrefetch, prefetchChunks);"
+									: Template.asString([
+											"// chunk prefetching for javascript",
+											"prefetchChunks.forEach(function(chunkId) {",
+											Template.indent([
+												"if(installedChunks[chunkId] === undefined) {",
+												Template.indent([
+													"installedChunks[chunkId] = null;",
+													mainTemplate.hooks.linkPrefetch.call("", chunk, hash),
+													"document.head.appendChild(link);"
+												]),
+												"}"
+											]),
+											"});"
+									  ])
+								: "",
+							"while(resolves.length) {",
+							Template.indent("resolves.shift()();"),
+							"}",
+							withDefer
+								? Template.asString([
+										"",
+										"// add entry modules from loaded chunk to deferred list",
+										"deferredModules.push.apply(deferredModules, executeModules || []);",
+										"",
+										"// run deferred modules when all chunks ready",
+										"return checkDeferredModules();"
+								  ])
+								: ""
+						]),
+						"};",
+						withDefer
+							? Template.asString([
+									"function checkDeferredModules() {",
+									Template.indent([
+										"var result;",
+										"for(var i = 0; i < deferredModules.length; i++) {",
+										Template.indent([
+											"var deferredModule = deferredModules[i];",
+											"var fulfilled = true;",
+											"for(var j = 1; j < deferredModule.length; j++) {",
+											Template.indent([
+												"var depId = deferredModule[j];",
+												"if(installedChunks[depId] !== 0) fulfilled = false;"
+											]),
+											"}",
+											"if(fulfilled) {",
+											Template.indent([
+												"deferredModules.splice(i--, 1);",
+												"result = " +
+													mainTemplate.requireFn +
+													"(" +
+													mainTemplate.requireFn +
+													".s = deferredModule[0]);"
+											]),
+											"}"
+										]),
+										"}",
+										withPrefetch
+											? Template.asString([
+													"if(deferredModules.length === 0) {",
+													Template.indent([
+														"// chunk prefetching for javascript",
+														"deferredPrefetch.forEach(function(chunkId) {",
+														Template.indent([
+															"if(installedChunks[chunkId] === undefined) {",
+															Template.indent([
+																"installedChunks[chunkId] = null;",
+																mainTemplate.hooks.linkPrefetch.call(
+																	"",
+																	chunk,
+																	hash
+																),
+																"document.head.appendChild(link);"
+															]),
+															"}"
+														]),
+														"});",
+														"deferredPrefetch.length = 0;"
+													]),
+													"}"
+											  ])
+											: "",
+										"return result;"
+									]),
+									"}"
+							  ])
+							: ""
+					]);
+				}
+				return source;
+			}
+		);
+		mainTemplate.hooks.beforeStartup.tap(
+			"JsonpMainTemplatePlugin",
+			(source, chunk, hash) => {
+				if (needChunkLoadingCode(chunk)) {
+					var jsonpFunction = mainTemplate.outputOptions.jsonpFunction;
+					var globalObject = mainTemplate.outputOptions.globalObject;
+					return Template.asString([
+						`var jsonpArray = ${globalObject}[${JSON.stringify(
+							jsonpFunction
+						)}] = ${globalObject}[${JSON.stringify(jsonpFunction)}] || [];`,
+						"var oldJsonpFunction = jsonpArray.push.bind(jsonpArray);",
+						"jsonpArray.push = webpackJsonpCallback;",
+						"jsonpArray = jsonpArray.slice();",
+						"for(var i = 0; i < jsonpArray.length; i++) webpackJsonpCallback(jsonpArray[i]);",
+						"var parentJsonpFunction = oldJsonpFunction;",
+						"",
+						source
+					]);
+				}
+				return source;
+			}
+		);
+		mainTemplate.hooks.afterStartup.tap(
+			"JsonpMainTemplatePlugin",
+			(source, chunk, hash) => {
+				const prefetchChunks = chunk.getChildIdsByOrders().prefetch;
+				if (
+					needChunkLoadingCode(chunk) &&
+					prefetchChunks &&
+					prefetchChunks.length
+				) {
+					return Template.asString([
+						source,
+						`webpackJsonpCallback([[], {}, 0, ${JSON.stringify(
+							prefetchChunks
+						)}]);`
+					]);
+				}
+				return source;
+			}
+		);
+		mainTemplate.hooks.startup.tap(
+			"JsonpMainTemplatePlugin",
+			(source, chunk, hash) => {
+				if (needEntryDeferringCode(chunk)) {
+					if (chunk.hasEntryModule()) {
+						const entries = [chunk.entryModule].filter(Boolean).map(m =>
+							[m.id].concat(
+								Array.from(chunk.groupsIterable)[0]
+									.chunks.filter(c => c !== chunk)
+									.map(c => c.id)
+							)
+						);
+						return Template.asString([
+							"// add entry module to deferred list",
+							`deferredModules.push(${entries
+								.map(e => JSON.stringify(e))
+								.join(", ")});`,
+							"// run deferred modules when ready",
+							"return checkDeferredModules();"
+						]);
+					} else {
+						return Template.asString([
+							"// run deferred modules from other chunks",
+							"checkDeferredModules();"
+						]);
+					}
+				}
+				return source;
+			}
+		);
+		mainTemplate.hooks.hotBootstrap.tap(
+			"JsonpMainTemplatePlugin",
+			(source, chunk, hash) => {
+				const globalObject = mainTemplate.outputOptions.globalObject;
+				const hotUpdateChunkFilename =
+					mainTemplate.outputOptions.hotUpdateChunkFilename;
+				const hotUpdateMainFilename =
+					mainTemplate.outputOptions.hotUpdateMainFilename;
+				const crossOriginLoading =
+					mainTemplate.outputOptions.crossOriginLoading;
+				const hotUpdateFunction = mainTemplate.outputOptions.hotUpdateFunction;
+				const currentHotUpdateChunkFilename = mainTemplate.getAssetPath(
+					JSON.stringify(hotUpdateChunkFilename),
+					{
+						hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+						hashWithLength: length =>
+							`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`,
+						chunk: {
+							id: '" + chunkId + "'
+						}
+					}
+				);
+				const currentHotUpdateMainFilename = mainTemplate.getAssetPath(
+					JSON.stringify(hotUpdateMainFilename),
+					{
+						hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+						hashWithLength: length =>
+							`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`
+					}
+				);
+				const runtimeSource = Template.getFunctionContent(
+					require("./JsonpMainTemplate.runtime")
+				)
+					.replace(/\/\/\$semicolon/g, ";")
+					.replace(/\$require\$/g, mainTemplate.requireFn)
+					.replace(
+						/\$crossOriginLoading\$/g,
+						crossOriginLoading ? JSON.stringify(crossOriginLoading) : "null"
+					)
+					.replace(/\$hotMainFilename\$/g, currentHotUpdateMainFilename)
+					.replace(/\$hotChunkFilename\$/g, currentHotUpdateChunkFilename)
+					.replace(/\$hash\$/g, JSON.stringify(hash));
+				return `${source}
+function hotDisposeChunk(chunkId) {
+	delete installedChunks[chunkId];
+}
+var parentHotUpdateCallback = ${globalObject}[${JSON.stringify(
+					hotUpdateFunction
+				)}];
+${globalObject}[${JSON.stringify(hotUpdateFunction)}] = ${runtimeSource}`;
+			}
+		);
+		mainTemplate.hooks.hash.tap("JsonpMainTemplatePlugin", hash => {
+			hash.update("jsonp");
+			hash.update("6");
+		});
+	}
+}
+module.exports = JsonpMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/web/JsonpTemplatePlugin.js b/node_modules/webpack/lib/web/JsonpTemplatePlugin.js
new file mode 100644
index 0000000..80a6b5b
--- /dev/null
+++ b/node_modules/webpack/lib/web/JsonpTemplatePlugin.js
@@ -0,0 +1,23 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const JsonpMainTemplatePlugin = require("./JsonpMainTemplatePlugin");
+const JsonpChunkTemplatePlugin = require("./JsonpChunkTemplatePlugin");
+const JsonpHotUpdateChunkTemplatePlugin = require("./JsonpHotUpdateChunkTemplatePlugin");
+
+class JsonpTemplatePlugin {
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap("JsonpTemplatePlugin", compilation => {
+			new JsonpMainTemplatePlugin().apply(compilation.mainTemplate);
+			new JsonpChunkTemplatePlugin().apply(compilation.chunkTemplate);
+			new JsonpHotUpdateChunkTemplatePlugin().apply(
+				compilation.hotUpdateChunkTemplate
+			);
+		});
+	}
+}
+
+module.exports = JsonpTemplatePlugin;
diff --git a/node_modules/webpack/lib/web/WebEnvironmentPlugin.js b/node_modules/webpack/lib/web/WebEnvironmentPlugin.js
new file mode 100644
index 0000000..9b0df57
--- /dev/null
+++ b/node_modules/webpack/lib/web/WebEnvironmentPlugin.js
@@ -0,0 +1,18 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+class WebEnvironmentPlugin {
+	constructor(inputFileSystem, outputFileSystem) {
+		this.inputFileSystem = inputFileSystem;
+		this.outputFileSystem = outputFileSystem;
+	}
+
+	apply(compiler) {
+		compiler.outputFileSystem = this.outputFileSystem;
+	}
+}
+
+module.exports = WebEnvironmentPlugin;
diff --git a/node_modules/webpack/lib/webpack.js b/node_modules/webpack/lib/webpack.js
new file mode 100644
index 0000000..80f810b
--- /dev/null
+++ b/node_modules/webpack/lib/webpack.js
@@ -0,0 +1,206 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Compiler = require("./Compiler");
+const MultiCompiler = require("./MultiCompiler");
+const NodeEnvironmentPlugin = require("./node/NodeEnvironmentPlugin");
+const WebpackOptionsApply = require("./WebpackOptionsApply");
+const WebpackOptionsDefaulter = require("./WebpackOptionsDefaulter");
+const validateSchema = require("./validateSchema");
+const WebpackOptionsValidationError = require("./WebpackOptionsValidationError");
+const webpackOptionsSchema = require("../schemas/WebpackOptions.json");
+const RemovedPluginError = require("./RemovedPluginError");
+const version = require("../package.json").version;
+
+/** @typedef {import("../declarations/WebpackOptions").WebpackOptions} WebpackOptions */
+
+/**
+ * @param {WebpackOptions} options options object
+ * @param {function(Error=, Stats=): void=} callback callback
+ * @returns {Compiler | MultiCompiler} the compiler object
+ */
+const webpack = (options, callback) => {
+	const webpackOptionsValidationErrors = validateSchema(
+		webpackOptionsSchema,
+		options
+	);
+	if (webpackOptionsValidationErrors.length) {
+		throw new WebpackOptionsValidationError(webpackOptionsValidationErrors);
+	}
+	let compiler;
+	if (Array.isArray(options)) {
+		compiler = new MultiCompiler(
+			Array.from(options).map(options => webpack(options))
+		);
+	} else if (typeof options === "object") {
+		options = new WebpackOptionsDefaulter().process(options);
+
+		compiler = new Compiler(options.context);
+		compiler.options = options;
+		new NodeEnvironmentPlugin({
+			infrastructureLogging: options.infrastructureLogging
+		}).apply(compiler);
+		if (options.plugins && Array.isArray(options.plugins)) {
+			for (const plugin of options.plugins) {
+				if (typeof plugin === "function") {
+					plugin.call(compiler, compiler);
+				} else {
+					plugin.apply(compiler);
+				}
+			}
+		}
+		compiler.hooks.environment.call();
+		compiler.hooks.afterEnvironment.call();
+		compiler.options = new WebpackOptionsApply().process(options, compiler);
+	} else {
+		throw new Error("Invalid argument: options");
+	}
+	if (callback) {
+		if (typeof callback !== "function") {
+			throw new Error("Invalid argument: callback");
+		}
+		if (
+			options.watch === true ||
+			(Array.isArray(options) && options.some(o => o.watch))
+		) {
+			const watchOptions = Array.isArray(options)
+				? options.map(o => o.watchOptions || {})
+				: options.watchOptions || {};
+			return compiler.watch(watchOptions, callback);
+		}
+		compiler.run(callback);
+	}
+	return compiler;
+};
+
+exports = module.exports = webpack;
+exports.version = version;
+
+webpack.WebpackOptionsDefaulter = WebpackOptionsDefaulter;
+webpack.WebpackOptionsApply = WebpackOptionsApply;
+webpack.Compiler = Compiler;
+webpack.MultiCompiler = MultiCompiler;
+webpack.NodeEnvironmentPlugin = NodeEnvironmentPlugin;
+// @ts-ignore Global @this directive is not supported
+webpack.validate = validateSchema.bind(this, webpackOptionsSchema);
+webpack.validateSchema = validateSchema;
+webpack.WebpackOptionsValidationError = WebpackOptionsValidationError;
+
+const exportPlugins = (obj, mappings) => {
+	for (const name of Object.keys(mappings)) {
+		Object.defineProperty(obj, name, {
+			configurable: false,
+			enumerable: true,
+			get: mappings[name]
+		});
+	}
+};
+
+exportPlugins(exports, {
+	AutomaticPrefetchPlugin: () => require("./AutomaticPrefetchPlugin"),
+	BannerPlugin: () => require("./BannerPlugin"),
+	CachePlugin: () => require("./CachePlugin"),
+	ContextExclusionPlugin: () => require("./ContextExclusionPlugin"),
+	ContextReplacementPlugin: () => require("./ContextReplacementPlugin"),
+	DefinePlugin: () => require("./DefinePlugin"),
+	Dependency: () => require("./Dependency"),
+	DllPlugin: () => require("./DllPlugin"),
+	DllReferencePlugin: () => require("./DllReferencePlugin"),
+	EnvironmentPlugin: () => require("./EnvironmentPlugin"),
+	EvalDevToolModulePlugin: () => require("./EvalDevToolModulePlugin"),
+	EvalSourceMapDevToolPlugin: () => require("./EvalSourceMapDevToolPlugin"),
+	ExtendedAPIPlugin: () => require("./ExtendedAPIPlugin"),
+	ExternalsPlugin: () => require("./ExternalsPlugin"),
+	HashedModuleIdsPlugin: () => require("./HashedModuleIdsPlugin"),
+	HotModuleReplacementPlugin: () => require("./HotModuleReplacementPlugin"),
+	IgnorePlugin: () => require("./IgnorePlugin"),
+	LibraryTemplatePlugin: () => require("./LibraryTemplatePlugin"),
+	LoaderOptionsPlugin: () => require("./LoaderOptionsPlugin"),
+	LoaderTargetPlugin: () => require("./LoaderTargetPlugin"),
+	MemoryOutputFileSystem: () => require("./MemoryOutputFileSystem"),
+	Module: () => require("./Module"),
+	ModuleFilenameHelpers: () => require("./ModuleFilenameHelpers"),
+	NamedChunksPlugin: () => require("./NamedChunksPlugin"),
+	NamedModulesPlugin: () => require("./NamedModulesPlugin"),
+	NoEmitOnErrorsPlugin: () => require("./NoEmitOnErrorsPlugin"),
+	NormalModuleReplacementPlugin: () =>
+		require("./NormalModuleReplacementPlugin"),
+	PrefetchPlugin: () => require("./PrefetchPlugin"),
+	ProgressPlugin: () => require("./ProgressPlugin"),
+	ProvidePlugin: () => require("./ProvidePlugin"),
+	SetVarMainTemplatePlugin: () => require("./SetVarMainTemplatePlugin"),
+	SingleEntryPlugin: () => require("./SingleEntryPlugin"),
+	SourceMapDevToolPlugin: () => require("./SourceMapDevToolPlugin"),
+	Stats: () => require("./Stats"),
+	Template: () => require("./Template"),
+	UmdMainTemplatePlugin: () => require("./UmdMainTemplatePlugin"),
+	WatchIgnorePlugin: () => require("./WatchIgnorePlugin")
+});
+exportPlugins((exports.dependencies = {}), {
+	DependencyReference: () => require("./dependencies/DependencyReference")
+});
+exportPlugins((exports.optimize = {}), {
+	AggressiveMergingPlugin: () => require("./optimize/AggressiveMergingPlugin"),
+	AggressiveSplittingPlugin: () =>
+		require("./optimize/AggressiveSplittingPlugin"),
+	ChunkModuleIdRangePlugin: () =>
+		require("./optimize/ChunkModuleIdRangePlugin"),
+	LimitChunkCountPlugin: () => require("./optimize/LimitChunkCountPlugin"),
+	MinChunkSizePlugin: () => require("./optimize/MinChunkSizePlugin"),
+	ModuleConcatenationPlugin: () =>
+		require("./optimize/ModuleConcatenationPlugin"),
+	OccurrenceOrderPlugin: () => require("./optimize/OccurrenceOrderPlugin"),
+	OccurrenceModuleOrderPlugin: () =>
+		require("./optimize/OccurrenceModuleOrderPlugin"),
+	OccurrenceChunkOrderPlugin: () =>
+		require("./optimize/OccurrenceChunkOrderPlugin"),
+	RuntimeChunkPlugin: () => require("./optimize/RuntimeChunkPlugin"),
+	SideEffectsFlagPlugin: () => require("./optimize/SideEffectsFlagPlugin"),
+	SplitChunksPlugin: () => require("./optimize/SplitChunksPlugin")
+});
+exportPlugins((exports.web = {}), {
+	FetchCompileWasmTemplatePlugin: () =>
+		require("./web/FetchCompileWasmTemplatePlugin"),
+	JsonpTemplatePlugin: () => require("./web/JsonpTemplatePlugin")
+});
+exportPlugins((exports.webworker = {}), {
+	WebWorkerTemplatePlugin: () => require("./webworker/WebWorkerTemplatePlugin")
+});
+exportPlugins((exports.node = {}), {
+	NodeTemplatePlugin: () => require("./node/NodeTemplatePlugin"),
+	ReadFileCompileWasmTemplatePlugin: () =>
+		require("./node/ReadFileCompileWasmTemplatePlugin")
+});
+exportPlugins((exports.debug = {}), {
+	ProfilingPlugin: () => require("./debug/ProfilingPlugin")
+});
+exportPlugins((exports.util = {}), {
+	createHash: () => require("./util/createHash")
+});
+
+const defineMissingPluginError = (namespace, pluginName, errorMessage) => {
+	Object.defineProperty(namespace, pluginName, {
+		configurable: false,
+		enumerable: true,
+		get() {
+			throw new RemovedPluginError(errorMessage);
+		}
+	});
+};
+
+// TODO remove in webpack 5
+defineMissingPluginError(
+	exports.optimize,
+	"UglifyJsPlugin",
+	"webpack.optimize.UglifyJsPlugin has been removed, please use config.optimization.minimize instead."
+);
+
+// TODO remove in webpack 5
+defineMissingPluginError(
+	exports.optimize,
+	"CommonsChunkPlugin",
+	"webpack.optimize.CommonsChunkPlugin has been removed, please use config.optimization.splitChunks instead."
+);
diff --git a/node_modules/webpack/lib/webpack.web.js b/node_modules/webpack/lib/webpack.web.js
new file mode 100644
index 0000000..1f60eab
--- /dev/null
+++ b/node_modules/webpack/lib/webpack.web.js
@@ -0,0 +1,31 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Compiler = require("./Compiler");
+const WebEnvironmentPlugin = require("./web/WebEnvironmentPlugin");
+const WebpackOptionsApply = require("./WebpackOptionsApply");
+const WebpackOptionsDefaulter = require("./WebpackOptionsDefaulter");
+
+const webpack = (options, callback) => {
+	new WebpackOptionsDefaulter().process(options);
+
+	const compiler = new Compiler();
+	compiler.options = new WebpackOptionsApply().process(options, compiler);
+	new WebEnvironmentPlugin(
+		options.inputFileSystem,
+		options.outputFileSystem
+	).apply(compiler);
+	if (callback) {
+		compiler.run(callback);
+	}
+	return compiler;
+};
+module.exports = webpack;
+
+webpack.WebpackOptionsDefaulter = WebpackOptionsDefaulter;
+webpack.WebpackOptionsApply = WebpackOptionsApply;
+webpack.Compiler = Compiler;
+webpack.WebEnvironmentPlugin = WebEnvironmentPlugin;
diff --git a/node_modules/webpack/lib/webworker/WebWorkerChunkTemplatePlugin.js b/node_modules/webpack/lib/webworker/WebWorkerChunkTemplatePlugin.js
new file mode 100644
index 0000000..f44ca26
--- /dev/null
+++ b/node_modules/webpack/lib/webworker/WebWorkerChunkTemplatePlugin.js
@@ -0,0 +1,35 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const { ConcatSource } = require("webpack-sources");
+
+class WebWorkerChunkTemplatePlugin {
+	apply(chunkTemplate) {
+		chunkTemplate.hooks.render.tap(
+			"WebWorkerChunkTemplatePlugin",
+			(modules, chunk) => {
+				const chunkCallbackName = chunkTemplate.outputOptions.chunkCallbackName;
+				const globalObject = chunkTemplate.outputOptions.globalObject;
+				const source = new ConcatSource();
+				source.add(
+					`${globalObject}[${JSON.stringify(
+						chunkCallbackName
+					)}](${JSON.stringify(chunk.ids)},`
+				);
+				source.add(modules);
+				source.add(")");
+				return source;
+			}
+		);
+		chunkTemplate.hooks.hash.tap("WebWorkerChunkTemplatePlugin", hash => {
+			hash.update("webworker");
+			hash.update("3");
+			hash.update(`${chunkTemplate.outputOptions.chunkCallbackName}`);
+			hash.update(`${chunkTemplate.outputOptions.globalObject}`);
+		});
+	}
+}
+module.exports = WebWorkerChunkTemplatePlugin;
diff --git a/node_modules/webpack/lib/webworker/WebWorkerHotUpdateChunkTemplatePlugin.js b/node_modules/webpack/lib/webworker/WebWorkerHotUpdateChunkTemplatePlugin.js
new file mode 100644
index 0000000..8b02611
--- /dev/null
+++ b/node_modules/webpack/lib/webworker/WebWorkerHotUpdateChunkTemplatePlugin.js
@@ -0,0 +1,40 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+const { ConcatSource } = require("webpack-sources");
+
+class WebWorkerHotUpdateChunkTemplatePlugin {
+	apply(hotUpdateChunkTemplate) {
+		hotUpdateChunkTemplate.hooks.render.tap(
+			"WebWorkerHotUpdateChunkTemplatePlugin",
+			(modulesSource, modules, removedModules, hash, id) => {
+				const hotUpdateFunction =
+					hotUpdateChunkTemplate.outputOptions.hotUpdateFunction;
+				const globalObject = hotUpdateChunkTemplate.outputOptions.globalObject;
+				const source = new ConcatSource();
+				source.add(
+					`${globalObject}[${JSON.stringify(
+						hotUpdateFunction
+					)}](${JSON.stringify(id)},`
+				);
+				source.add(modulesSource);
+				source.add(")");
+				return source;
+			}
+		);
+		hotUpdateChunkTemplate.hooks.hash.tap(
+			"WebWorkerHotUpdateChunkTemplatePlugin",
+			hash => {
+				hash.update("WebWorkerHotUpdateChunkTemplatePlugin");
+				hash.update("3");
+				hash.update(
+					hotUpdateChunkTemplate.outputOptions.hotUpdateFunction + ""
+				);
+				hash.update(hotUpdateChunkTemplate.outputOptions.globalObject + "");
+			}
+		);
+	}
+}
+module.exports = WebWorkerHotUpdateChunkTemplatePlugin;
diff --git a/node_modules/webpack/lib/webworker/WebWorkerMainTemplate.runtime.js b/node_modules/webpack/lib/webworker/WebWorkerMainTemplate.runtime.js
new file mode 100644
index 0000000..aa240b2
--- /dev/null
+++ b/node_modules/webpack/lib/webworker/WebWorkerMainTemplate.runtime.js
@@ -0,0 +1,73 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+// eslint-disable-next-line no-unused-vars
+var hotAddUpdateChunk = undefined;
+var parentHotUpdateCallback = undefined;
+var $require$ = undefined;
+var $hotChunkFilename$ = undefined;
+var $hotMainFilename$ = undefined;
+var installedChunks = undefined;
+var importScripts = undefined;
+
+module.exports = function() {
+	// eslint-disable-next-line no-unused-vars
+	function webpackHotUpdateCallback(chunkId, moreModules) {
+		hotAddUpdateChunk(chunkId, moreModules);
+		if (parentHotUpdateCallback) parentHotUpdateCallback(chunkId, moreModules);
+	} //$semicolon
+
+	// eslint-disable-next-line no-unused-vars
+	function hotDownloadUpdateChunk(chunkId) {
+		importScripts($require$.p + $hotChunkFilename$);
+	}
+
+	// eslint-disable-next-line no-unused-vars
+	function hotDownloadManifest(requestTimeout) {
+		requestTimeout = requestTimeout || 10000;
+		return new Promise(function(resolve, reject) {
+			if (typeof XMLHttpRequest === "undefined") {
+				return reject(new Error("No browser support"));
+			}
+			try {
+				var request = new XMLHttpRequest();
+				var requestPath = $require$.p + $hotMainFilename$;
+				request.open("GET", requestPath, true);
+				request.timeout = requestTimeout;
+				request.send(null);
+			} catch (err) {
+				return reject(err);
+			}
+			request.onreadystatechange = function() {
+				if (request.readyState !== 4) return;
+				if (request.status === 0) {
+					// timeout
+					reject(
+						new Error("Manifest request to " + requestPath + " timed out.")
+					);
+				} else if (request.status === 404) {
+					// no update available
+					resolve();
+				} else if (request.status !== 200 && request.status !== 304) {
+					// other failure
+					reject(new Error("Manifest request to " + requestPath + " failed."));
+				} else {
+					// success
+					try {
+						var update = JSON.parse(request.responseText);
+					} catch (e) {
+						reject(e);
+						return;
+					}
+					resolve(update);
+				}
+			};
+		});
+	}
+
+	//eslint-disable-next-line no-unused-vars
+	function hotDisposeChunk(chunkId) {
+		delete installedChunks[chunkId];
+	}
+};
diff --git a/node_modules/webpack/lib/webworker/WebWorkerMainTemplatePlugin.js b/node_modules/webpack/lib/webworker/WebWorkerMainTemplatePlugin.js
new file mode 100644
index 0000000..0cc84c6
--- /dev/null
+++ b/node_modules/webpack/lib/webworker/WebWorkerMainTemplatePlugin.js
@@ -0,0 +1,192 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const Template = require("../Template");
+
+class WebWorkerMainTemplatePlugin {
+	apply(mainTemplate) {
+		const needChunkOnDemandLoadingCode = chunk => {
+			for (const chunkGroup of chunk.groupsIterable) {
+				if (chunkGroup.getNumberOfChildren() > 0) return true;
+			}
+			return false;
+		};
+		mainTemplate.hooks.localVars.tap(
+			"WebWorkerMainTemplatePlugin",
+			(source, chunk) => {
+				if (needChunkOnDemandLoadingCode(chunk)) {
+					return Template.asString([
+						source,
+						"",
+						"// object to store loaded chunks",
+						'// "1" means "already loaded"',
+						"var installedChunks = {",
+						Template.indent(
+							chunk.ids.map(id => `${JSON.stringify(id)}: 1`).join(",\n")
+						),
+						"};"
+					]);
+				}
+				return source;
+			}
+		);
+		mainTemplate.hooks.requireEnsure.tap(
+			"WebWorkerMainTemplatePlugin",
+			(_, chunk, hash) => {
+				const chunkFilename = mainTemplate.outputOptions.chunkFilename;
+				const chunkMaps = chunk.getChunkMaps();
+				return Template.asString([
+					"promises.push(Promise.resolve().then(function() {",
+					Template.indent([
+						'// "1" is the signal for "already loaded"',
+						"if(!installedChunks[chunkId]) {",
+						Template.indent([
+							"importScripts(" +
+								"__webpack_require__.p + " +
+								mainTemplate.getAssetPath(JSON.stringify(chunkFilename), {
+									hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+									hashWithLength: length =>
+										`" + ${mainTemplate.renderCurrentHashCode(
+											hash,
+											length
+										)} + "`,
+									chunk: {
+										id: '" + chunkId + "',
+										hash: `" + ${JSON.stringify(chunkMaps.hash)}[chunkId] + "`,
+										hashWithLength(length) {
+											const shortChunkHashMap = Object.create(null);
+											for (const chunkId of Object.keys(chunkMaps.hash)) {
+												if (typeof chunkMaps.hash[chunkId] === "string") {
+													shortChunkHashMap[chunkId] = chunkMaps.hash[
+														chunkId
+													].substr(0, length);
+												}
+											}
+											return `" + ${JSON.stringify(
+												shortChunkHashMap
+											)}[chunkId] + "`;
+										},
+										contentHash: {
+											javascript: `" + ${JSON.stringify(
+												chunkMaps.contentHash.javascript
+											)}[chunkId] + "`
+										},
+										contentHashWithLength: {
+											javascript: length => {
+												const shortContentHashMap = {};
+												const contentHash = chunkMaps.contentHash.javascript;
+												for (const chunkId of Object.keys(contentHash)) {
+													if (typeof contentHash[chunkId] === "string") {
+														shortContentHashMap[chunkId] = contentHash[
+															chunkId
+														].substr(0, length);
+													}
+												}
+												return `" + ${JSON.stringify(
+													shortContentHashMap
+												)}[chunkId] + "`;
+											}
+										},
+										name: `" + (${JSON.stringify(
+											chunkMaps.name
+										)}[chunkId]||chunkId) + "`
+									},
+									contentHashType: "javascript"
+								}) +
+								");"
+						]),
+						"}"
+					]),
+					"}));"
+				]);
+			}
+		);
+		mainTemplate.hooks.bootstrap.tap(
+			"WebWorkerMainTemplatePlugin",
+			(source, chunk, hash) => {
+				if (needChunkOnDemandLoadingCode(chunk)) {
+					const chunkCallbackName =
+						mainTemplate.outputOptions.chunkCallbackName;
+					const globalObject = mainTemplate.outputOptions.globalObject;
+					return Template.asString([
+						source,
+						`${globalObject}[${JSON.stringify(
+							chunkCallbackName
+						)}] = function webpackChunkCallback(chunkIds, moreModules) {`,
+						Template.indent([
+							"for(var moduleId in moreModules) {",
+							Template.indent(
+								mainTemplate.renderAddModule(
+									hash,
+									chunk,
+									"moduleId",
+									"moreModules[moduleId]"
+								)
+							),
+							"}",
+							"while(chunkIds.length)",
+							Template.indent("installedChunks[chunkIds.pop()] = 1;")
+						]),
+						"};"
+					]);
+				}
+				return source;
+			}
+		);
+		mainTemplate.hooks.hotBootstrap.tap(
+			"WebWorkerMainTemplatePlugin",
+			(source, chunk, hash) => {
+				const hotUpdateChunkFilename =
+					mainTemplate.outputOptions.hotUpdateChunkFilename;
+				const hotUpdateMainFilename =
+					mainTemplate.outputOptions.hotUpdateMainFilename;
+				const hotUpdateFunction = mainTemplate.outputOptions.hotUpdateFunction;
+				const globalObject = mainTemplate.outputOptions.globalObject;
+				const currentHotUpdateChunkFilename = mainTemplate.getAssetPath(
+					JSON.stringify(hotUpdateChunkFilename),
+					{
+						hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+						hashWithLength: length =>
+							`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`,
+						chunk: {
+							id: '" + chunkId + "'
+						}
+					}
+				);
+				const currentHotUpdateMainFilename = mainTemplate.getAssetPath(
+					JSON.stringify(hotUpdateMainFilename),
+					{
+						hash: `" + ${mainTemplate.renderCurrentHashCode(hash)} + "`,
+						hashWithLength: length =>
+							`" + ${mainTemplate.renderCurrentHashCode(hash, length)} + "`
+					}
+				);
+
+				return (
+					source +
+					"\n" +
+					`var parentHotUpdateCallback = ${globalObject}[${JSON.stringify(
+						hotUpdateFunction
+					)}];\n` +
+					`${globalObject}[${JSON.stringify(hotUpdateFunction)}] = ` +
+					Template.getFunctionContent(
+						require("./WebWorkerMainTemplate.runtime")
+					)
+						.replace(/\/\/\$semicolon/g, ";")
+						.replace(/\$require\$/g, mainTemplate.requireFn)
+						.replace(/\$hotMainFilename\$/g, currentHotUpdateMainFilename)
+						.replace(/\$hotChunkFilename\$/g, currentHotUpdateChunkFilename)
+						.replace(/\$hash\$/g, JSON.stringify(hash))
+				);
+			}
+		);
+		mainTemplate.hooks.hash.tap("WebWorkerMainTemplatePlugin", hash => {
+			hash.update("webworker");
+			hash.update("4");
+		});
+	}
+}
+module.exports = WebWorkerMainTemplatePlugin;
diff --git a/node_modules/webpack/lib/webworker/WebWorkerTemplatePlugin.js b/node_modules/webpack/lib/webworker/WebWorkerTemplatePlugin.js
new file mode 100644
index 0000000..5ad89f3
--- /dev/null
+++ b/node_modules/webpack/lib/webworker/WebWorkerTemplatePlugin.js
@@ -0,0 +1,25 @@
+/*
+	MIT License http://www.opensource.org/licenses/mit-license.php
+	Author Tobias Koppers @sokra
+*/
+"use strict";
+
+const WebWorkerMainTemplatePlugin = require("./WebWorkerMainTemplatePlugin");
+const WebWorkerChunkTemplatePlugin = require("./WebWorkerChunkTemplatePlugin");
+const WebWorkerHotUpdateChunkTemplatePlugin = require("./WebWorkerHotUpdateChunkTemplatePlugin");
+
+class WebWorkerTemplatePlugin {
+	apply(compiler) {
+		compiler.hooks.thisCompilation.tap(
+			"WebWorkerTemplatePlugin",
+			compilation => {
+				new WebWorkerMainTemplatePlugin().apply(compilation.mainTemplate);
+				new WebWorkerChunkTemplatePlugin().apply(compilation.chunkTemplate);
+				new WebWorkerHotUpdateChunkTemplatePlugin().apply(
+					compilation.hotUpdateChunkTemplate
+				);
+			}
+		);
+	}
+}
+module.exports = WebWorkerTemplatePlugin;